{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2026-09-09", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "388bd213-7ca7-4c8e-94a0-cc526bb418a5", "code": "18125-49-0", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=18125-49-0", "code_system": "CAS", "references": [ "b7a1cabb-2f88-4ed7-b444-dd2de0c7c9d2" ] }, { "uuid": "1dfeaf06-da42-0648-bb4b-f80eb6a40aa6", "code": "123963", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/123963", "code_system": "PUBCHEM", "references": [ "b8f6a78a-092e-2181-07b1-4af2549d2511" ] }, { "uuid": "e70e2a9e-2c82-45b1-9ff0-701695ab906a", "code": "3F5YS569EB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "86c919be-1fe8-9c0c-aa8b-82af3081cdad", "code": "145210", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:145210", "code_system": "CHEBI", "references": [ "e781c571-be65-afdb-8c39-0e744f058048" ] }, { "uuid": "8bb2b936-ac12-4cbb-e6c3-1044a5bcc7a3", "code": "DTXSID00171087", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00171087", "code_system": "EPA CompTox", "references": [ "e781c571-be65-afdb-8c39-0e744f058048" ] } ], "relationships": [ { "uuid": "21113b56-8884-45d6-b460-3d57ffb2cd35", "qualification": "URINE", "type": "PARENT->METABOLITE", "interaction_type": "MAJOR", "references": [ "7aa175ed-353e-1455-aa77-f901cb57e99e" ], "related_substance": { "uuid": "4118b6e0-0584-41ea-9d87-2a0c4e37779a", "refuuid": "773a0ffb-9706-4f50-9973-628bdf152d66", "name": "ANTIPYRINE", "unii": "T3CHA1B51H", "linking_id": "T3CHA1B51H", "ref_pname": "ANTIPYRINE", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "7417f221-1edd-f1f0-9a6e-37f83e97444b", "name": "1,2-DIHYDRO-5-(HYDROXYMETHYL)-1-METHYL-2-PHENYL-3H-PYRAZOL-3-ONE", "stdName": "1,2-DIHYDRO-5-(HYDROXYMETHYL)-1-METHYL-2-PHENYL-3H-PYRAZOL-3-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "315d78b3-09e1-c172-ec1e-95fc2d773322" ], "display_name": false }, { "uuid": "61a77fe1-4e06-1dee-ac22-f17e504bfc83", "name": "3-(HYDROXYMETHYL)-2-METHYL-1-PHENYL-3-PYRAZOLIN-5-ONE", "stdName": "3-(HYDROXYMETHYL)-2-METHYL-1-PHENYL-3-PYRAZOLIN-5-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "315d78b3-09e1-c172-ec1e-95fc2d773322" ], "display_name": false }, { "uuid": "bcd43001-2237-5b46-c6c4-741e15e0dbb7", "name": "3-HYDROXYMETHYLANTIPYRINE", "stdName": "3-HYDROXYMETHYLANTIPYRINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "315d78b3-09e1-c172-ec1e-95fc2d773322" ], "display_name": true }, { "uuid": "dd48347e-29d7-9551-7a41-cb87a8b11a63", "name": "3H-PYRAZOL-3-ONE, 1,2-DIHYDRO-5-(HYDROXYMETHYL)-1-METHYL-2-PHENYL-", "stdName": "3H-PYRAZOL-3-ONE, 1,2-DIHYDRO-5-(HYDROXYMETHYL)-1-METHYL-2-PHENYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "315d78b3-09e1-c172-ec1e-95fc2d773322" ], "display_name": false }, { "uuid": "c1c2b70e-aea0-3ea2-2b9f-ce8ee9ba277e", "name": "HMA", "stdName": "HMA", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "7aa175ed-353e-1455-aa77-f901cb57e99e" ], "display_name": false }, { "uuid": "00a54464-4da0-4571-60a5-4e10a413f00e", "name": "HYDROXYMETHYLANTIPYRINE", "stdName": "HYDROXYMETHYLANTIPYRINE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "315d78b3-09e1-c172-ec1e-95fc2d773322" ], "display_name": false } ], "references": [ { "uuid": "b8f6a78a-092e-2181-07b1-4af2549d2511", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "315d78b3-09e1-c172-ec1e-95fc2d773322", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "7aa175ed-353e-1455-aa77-f901cb57e99e", "citation": "Akira, Kazuki, et al. \"Direct nuclear magnetic resonance spectroscopic analysis of 13C-labeled antipyrine metabolites in human urine.\" Drug metabolism and disposition 29.6 (2001): 903-907.", "url": "http://dmd.aspetjournals.org/content/dmd/29/6/903.full.pdf", "doc_type": "JA", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b7a1cabb-2f88-4ed7-b444-dd2de0c7c9d2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "e781c571-be65-afdb-8c39-0e744f058048", "doc_type": "SYSTEM", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "95885a57-fe70-2877-1d32-7e35b3e26825", "id": "95885a57-fe70-2877-1d32-7e35b3e26825", "molfile": "\n Marvin 01132107462D \n\n 15 16 0 0 0 0 999 V2000\n 15.6663 -4.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4044 -4.1650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0504 -3.6902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4912 -4.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7506 -4.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2022 -5.6434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6886 -3.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0400 -2.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4042 -3.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6730 -2.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9856 -4.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2723 -3.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9338 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2490 -2.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4154 -2.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 4 1 1 0 0 0 0\n 6 1 2 0 0 0 0\n 3 2 1 0 0 0 0\n 7 2 1 0 0 0 0\n 8 3 1 0 0 0 0\n 5 3 1 0 0 0 0\n 5 4 2 0 0 0 0\n 9 5 1 0 0 0 0\n 10 7 2 0 0 0 0\n 11 7 1 0 0 0 0\n 9 15 1 0 0 0 0\n 13 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 14 12 1 0 0 0 0\n 14 13 2 0 0 0 0\nM END", "smiles": "Cn1c(cc(=O)n1-c2ccccc2)CO", "formula": "C11H12N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "69ee0f4f-11a9-4f09-9fdb-f90ac88e52a7" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.2256", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "15bc1f0a-a75b-4bc9-89ab-a5722ef83dde", "version": "9", "structure": { "id": "6465b8da-f40e-d701-ed50-81555974a483", "molfile": "\n Marvin 01132105132D \n\n 15 16 0 0 0 0 999 V2000\n 15.6663 -4.9508 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.4044 -4.1650 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0504 -3.6902 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4912 -4.9353 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.7506 -4.1468 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.2022 -5.6434 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6886 -3.7576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.0400 -2.8421 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4042 -3.7810 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.6730 -2.9277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9856 -4.1960 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2723 -3.7992 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9338 -2.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.2490 -2.9822 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 17.4154 -2.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 1 1 0 0 0 0\n 5 4 2 0 0 0 0\n 6 1 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 3 1 0 0 0 0\n 9 5 1 0 0 0 0\n 10 7 2 0 0 0 0\n 11 7 1 0 0 0 0\n 12 11 2 0 0 0 0\n 13 10 1 0 0 0 0\n 14 12 1 0 0 0 0\n 5 3 1 0 0 0 0\n 14 13 2 0 0 0 0\n 9 15 1 0 0 0 0\nM END", "smiles": "Cn1c(cc(=O)n1-c2ccccc2)CO", "formula": "C11H12N2O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "204.2256", "optical_activity": "NONE", "references": [ "7aa175ed-353e-1455-aa77-f901cb57e99e" ], "stereo_centers": 0 }, "unii": "3F5YS569EB" } ] }