{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d076501d-25c5-4263-ac18-9ac71aeab5a4",
          "code": "1119-33-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1119-33-1",
          "code_system": "CAS",
          "references": [
            "9f061798-41cd-4157-af19-9c0843d0762d",
            "e422f205-36cf-4aea-84c2-26a0b3f3b10a"
          ]
        },
        {
          "uuid": "3f7fa3aa-ebd3-431b-95ce-972a4ba063d0",
          "code": "214-274-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.012.977",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "9f061798-41cd-4157-af19-9c0843d0762d"
          ]
        },
        {
          "uuid": "4399d30b-4397-4c7a-9b39-6c419fd0d4ac",
          "code": "1544275",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1544275/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "9f061798-41cd-4157-af19-9c0843d0762d"
          ]
        },
        {
          "uuid": "0b3200d4-fc30-4a5e-a000-160843720c0f",
          "code": "m5776",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5776?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "9f061798-41cd-4157-af19-9c0843d0762d"
          ]
        },
        {
          "uuid": "3f7d8c6c-f4f2-41c4-bac3-3162d5147bea",
          "code": "3082305",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3082305",
          "code_system": "PUBCHEM",
          "references": [
            "9f061798-41cd-4157-af19-9c0843d0762d"
          ]
        },
        {
          "uuid": "2d7ea32f-c200-43d0-86f2-0ee29c6c27d0",
          "code": "3EC85NWR4K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f78914e2-d4b0-ea26-ed6e-f62a9992b9b5",
          "code": "DTXSID901018766",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID901018766",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "165a4a22-e481-22f8-3754-a019575dec08",
          "code": "156977",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=156977",
          "code_system": "NSC",
          "references": [
            "d02401db-45ee-ce17-8b60-a6e56a5dc8bb"
          ]
        },
        {
          "uuid": "c5e0e188-4aea-6d67-23ef-2fe6094437f6",
          "code": "100000178012",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1bbb5664-e61e-f52a-545c-1c799f62cefe"
          ]
        },
        {
          "uuid": "5e792b02-ceff-a904-d88f-6b57497430e1",
          "code": "16885",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=16885",
          "code_system": "NSC",
          "references": [
            "d02401db-45ee-ce17-8b60-a6e56a5dc8bb"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1219e778-8ca5-405f-b7c2-5f84ba59fe9c",
          "name": ".GAMMA.-ETHYL GLUTAMATE",
          "stdName": ".GAMMA.-ETHYL GLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "075fbc88-85a6-4710-85ae-00de5cef0ce2",
          "name": ".GAMMA.-ETHYL L-GLUTAMATE",
          "stdName": ".GAMMA.-ETHYL L-GLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "75971fa4-dcba-48b7-ad58-3350b6f5249d",
          "name": ".GAMMA.-MONOETHYL GLUTAMATE",
          "stdName": ".GAMMA.-MONOETHYL GLUTAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "144d9b6e-a281-43ad-bd11-fa4fa4bc64e7",
          "name": "5-ETHYL GLUTAMATE, L-",
          "stdName": "5-ETHYL GLUTAMATE, L-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "264547a6-5627-4935-b583-95cdad738b11",
            "79fe814c-07ed-419a-a1d1-736d50595f82"
          ],
          "display_name": false
        },
        {
          "uuid": "f527bda5-0b24-4672-9c00-88c3df21072c",
          "name": "5-ETHYL L-GLUTAMATE",
          "stdName": "5-ETHYL L-GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "0e3acbdf-1bf9-4709-b6ab-fadd8713d471",
          "name": "ETHYL GLUTAMATE",
          "stdName": "ETHYL GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31e1a7e0-d319-454c-9bda-a2252771a19c",
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "790920a0-6f55-462a-a07b-3e9f348ec94e"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "4c801240-41d9-4a03-b1b0-a2f8131db349",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "75f63c81-45ca-4b4e-8aad-9813702b8f20",
          "name": "ETHYL L-GLUTAMATE",
          "stdName": "ETHYL L-GLUTAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "3734e9de-163f-4f5f-aeb6-8b62e9fec728",
          "name": "L-GLUTAMIC ACID .GAMMA.-ETHYL ESTER",
          "stdName": "L-GLUTAMIC ACID .GAMMA.-ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "6f090825-5945-47b1-ba95-a62f0850ad0e",
          "name": "L-GLUTAMIC ACID 5-ETHYL ESTER",
          "stdName": "L-GLUTAMIC ACID 5-ETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0687e63d-57f4-4482-aeac-c520c0b37abe",
            "688e6aaa-b3e8-44f5-a566-f68cbe182c2c",
            "003673e0-7bab-428a-ab70-37c1e78066dd",
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "30b66774-301f-405f-9e62-23021032f98a"
          ],
          "display_name": false
        },
        {
          "uuid": "98e6af0f-3067-4d65-b080-84fcc576fd81",
          "name": "L-GLUTAMIC ACID 5-ETHYL ESTER [MI]",
          "stdName": "L-GLUTAMIC ACID 5-ETHYL ESTER [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "30b66774-301f-405f-9e62-23021032f98a"
          ],
          "display_name": false
        },
        {
          "uuid": "cbc87b8c-b694-44aa-8d97-03190c4bff8a",
          "name": "L-GLUTAMIC ACID, 5-ETHYL ESTER",
          "stdName": "L-GLUTAMIC ACID, 5-ETHYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "e9a7de98-7099-3adf-3422-40109be5d3e0",
          "name": "L-Glutamic acid 5-ethyl ester [WHO-DD]",
          "stdName": "L-GLUTAMIC ACID 5-ETHYL ESTER [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65245c81-a2ac-fe3a-17ed-f846fc51a4b9"
          ],
          "display_name": false
        },
        {
          "uuid": "aaa2f809-5daa-46d4-9571-7220e270e4a2",
          "name": "NSC-156977",
          "stdName": "NSC-156977",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "17865d6b-7803-438b-b57b-3dc955fefe96",
          "name": "NSC-16885",
          "stdName": "NSC-16885",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "79fe814c-07ed-419a-a1d1-736d50595f82",
            "60859334-f3f9-4460-9ad3-e2df1ec94eec"
          ],
          "display_name": false
        },
        {
          "uuid": "01aa511e-7ac6-4e42-a177-5d01bd677354",
          "name": "POLYAMINON-3",
          "stdName": "POLYAMINON-3",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "31e1a7e0-d319-454c-9bda-a2252771a19c",
            "79fe814c-07ed-419a-a1d1-736d50595f82"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "688e6aaa-b3e8-44f5-a566-f68cbe182c2c",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "30b66774-301f-405f-9e62-23021032f98a",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "79fe814c-07ed-419a-a1d1-736d50595f82",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "31e1a7e0-d319-454c-9bda-a2252771a19c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60859334-f3f9-4460-9ad3-e2df1ec94eec",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "264547a6-5627-4935-b583-95cdad738b11",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f061798-41cd-4157-af19-9c0843d0762d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a475b25-dcf1-45ba-a8fc-8f15d3165c19",
          "citation": "SRS import [3EC85NWR4K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3EC85NWR4K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389732000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "27e80e5e-882b-4fd9-b5e4-15db74895693",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0687e63d-57f4-4482-aeac-c520c0b37abe",
          "citation": "L-GLUTAMIC ACID 5-ETHYL ESTER [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "790920a0-6f55-462a-a07b-3e9f348ec94e",
          "citation": "ETHYL GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "003673e0-7bab-428a-ab70-37c1e78066dd",
          "citation": "L-GLUTAMIC ACID 5-ETHYL ESTER [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1bbb5664-e61e-f52a-545c-1c799f62cefe",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "e422f205-36cf-4aea-84c2-26a0b3f3b10a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "65245c81-a2ac-fe3a-17ed-f846fc51a4b9",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "d02401db-45ee-ce17-8b60-a6e56a5dc8bb",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "75acbbef-e64c-55c2-4119-656944d0680e",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "afb26c8e-27fc-4711-b5cf-7803d57a2185",
          "id": "afb26c8e-27fc-4711-b5cf-7803d57a2185",
          "molfile": "\n  Marvin  01132109072D          \n\n 12 11  0  0  1  0            999 V2000\n   -1.9264   -8.7569    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n   -1.9264   -9.6110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1943   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4725   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2232   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2232   -7.5392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9398   -8.7932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6719   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3937   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6429   -8.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6429   -7.5392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3620   -8.7569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)CC[C@@H](C(=O)O)N",
          "formula": "C7H13NO4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "21ba9200-b054-44f6-a852-866903c198e7"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "175.1827",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c542ab3c-1dd9-4d94-a8cd-60e4ad3601e2",
      "version": "11",
      "structure": {
        "id": "df2791f3-68f4-4fbb-9ddf-b9c04320e347",
        "molfile": "\n  Marvin  01132111342D          \n\n 12 11  0  0  1  0            999 V2000\n   -2.6429   -8.3492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2232   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6429   -7.5392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9264   -8.7569    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    0.2232   -7.5392    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.1943   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4725   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.3620   -8.7569    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9264   -9.6110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9398   -8.7932    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6719   -8.3830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3937   -8.7932    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  7  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  2  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  1  1  0  0  0  0\n  4  9  1  6  0  0  0\n 10  2  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)CC[C@@H](C(=O)O)N",
        "formula": "C7H13NO4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "175.1827",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4a475b25-dcf1-45ba-a8fc-8f15d3165c19",
          "27e80e5e-882b-4fd9-b5e4-15db74895693"
        ],
        "stereo_centers": 1
      },
      "unii": "3EC85NWR4K"
    }
  ]
}