{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "244629f2-0b23-4ce7-99d6-333d08ed1892",
          "code": "23522-05-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23522-05-6",
          "code_system": "CAS",
          "references": [
            "c919aa1a-7b70-4874-99ad-d1743d9c8cd4",
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ]
        },
        {
          "uuid": "a4c1c23b-1279-4d05-bfbb-93b524e831b3",
          "code": "211707",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/211707",
          "code_system": "PUBCHEM",
          "references": [
            "c919aa1a-7b70-4874-99ad-d1743d9c8cd4"
          ]
        },
        {
          "uuid": "b7743755-9c96-4853-4511-52b7b7be185e",
          "code": "DTXSID60946258",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60946258",
          "code_system": "EPA CompTox",
          "references": [
            "e3da61ad-5b4d-ca05-470b-7755051aee62"
          ]
        },
        {
          "uuid": "c7d67043-692e-45dd-82b5-3480862a79ce",
          "code": "3E93Z2RU2H",
          "type": "PRIMARY",
          "code_system": "FDA UNII",
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3a47b091-59a4-401b-a444-0ab58211a357",
          "name": "(3S,3aS,5aR,9bS)-3a,5,5a,7,8,9b-Hexahydro-3,5a,9-trimethylnaphtho[1,2-b]furan-2,6(3H,4H)-dione",
          "stdName": "(3S,3AS,5AR,9BS)-3A,5,5A,7,8,9B-HEXAHYDRO-3,5A,9-TRIMETHYLNAPHTHO(1,2-B)FURAN-2,6(3H,4H)-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": false
        },
        {
          "uuid": "5782c106-1c0a-4471-8637-ee0c6e593c5d",
          "name": "Barrelierin",
          "stdName": "BARRELIERIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": false
        },
        {
          "uuid": "25b439aa-d49e-4160-8849-1487f1e686c8",
          "name": "Dibicor",
          "stdName": "DIBICOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": false
        },
        {
          "uuid": "73a1d1da-249f-45b5-938e-0b0635bc4fd0",
          "name": "Eudesm-4-en-12-oic acid, 6-hydroxy-1-oxo-, γ-lactone",
          "stdName": "EUDESM-4-EN-12-OIC ACID, 6-HYDROXY-1-OXO-, .GAMMA.-LACTONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9f67844d-8075-4d38-af54-62c83b325164"
          ],
          "display_name": false
        },
        {
          "uuid": "a0f8e9cb-ac78-40fc-9a2f-930f882eddfa",
          "name": "Gracilin",
          "stdName": "GRACILIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": false
        },
        {
          "uuid": "255e0642-2eec-4047-ab9d-fa32e69f48e9",
          "name": "Naphtho[1,2-b]furan-2,6(3H,4H)-dione, 3a,5,5a,7,8,9b-hexahydro-3,5a,9-trimethyl-, (3S,3aS,5aR,9bS)-",
          "stdName": "NAPHTHO(1,2-B)FURAN-2,6(3H,4H)-DIONE, 3A,5,5A,7,8,9B-HEXAHYDRO-3,5A,9-TRIMETHYL-, (3S,3AS,5AR,9BS)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": false
        },
        {
          "uuid": "e4eba7f3-dfb1-4142-bbcc-401ad573de46",
          "name": "Taurin",
          "stdName": "TAURIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c8ec899-8b46-4dc9-9658-3cac14fded74"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "9f67844d-8075-4d38-af54-62c83b325164",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c919aa1a-7b70-4874-99ad-d1743d9c8cd4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392054000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c8ec899-8b46-4dc9-9658-3cac14fded74",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e3da61ad-5b4d-ca05-470b-7755051aee62",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9212f8c1-48cc-4a4c-b66b-6c6f0e42fa52",
          "id": "9212f8c1-48cc-4a4c-b66b-6c6f0e42fa52",
          "molfile": "\n  Marvin  01132107342D          \n\n 18 20  0  0  1  0            999 V2000\n    3.5629   -1.4173    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    4.3609   -1.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5585   -0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1428    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1325   -0.5931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1369   -1.4216    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    1.4260   -1.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7152   -1.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7065   -0.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7152   -3.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7065   -3.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4260   -2.6645    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.4216   -3.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1412   -3.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -2.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8520   -1.8359    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n 18  1  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n 18  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7 14  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  6  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  1  6  0  0  0\nM  END",
          "smiles": "CC1=C2[C@@H]3[C@@H](CC[C@@]2(C)C(=O)CC1)[C@H](C)C(=O)O3",
          "formula": "C15H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9501456d-1461-4a92-b247-adb6bcfc791e"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "248.3181",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4eee38dd-e874-486d-9819-59abce3c5fee",
      "version": "7",
      "structure": {
        "id": "c2156e30-7be7-46a1-95fb-6de930ed4cd2",
        "molfile": "\n  Marvin  01132110022D          \n\n 20 22  0  0  1  0            999 V2000\n    0.0000   -1.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.6645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7152   -3.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7152   -1.4216    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4260   -1.8359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4260   -2.6645    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    2.1412   -3.0744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8564   -2.6601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8520   -1.8359    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1369   -1.4216    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    2.1325   -0.5931    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5629   -1.4173    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    3.5585   -0.5887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1428    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7065   -3.8986    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7065   -0.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3609   -1.6266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8477   -1.0074    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1325   -2.2459    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4216   -3.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3 15  2  0  0  0  0\n  3  6  1  0  0  0  0\n  4 16  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 20  1  6  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 12  1  0  0  0  0\n  9 18  1  1  0  0  0\n 10 11  1  0  0  0  0\n 10 19  1  6  0  0  0\n 11 13  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 17  1  1  0  0  0\n 13 14  2  0  0  0  0\nM  END",
        "smiles": "CC1=C2[C@]3([H])[C@@]([H])(CC[C@@]2(C)C(=O)CC1)[C@H](C)C(=O)O3",
        "formula": "C15H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "248.3181",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "9f67844d-8075-4d38-af54-62c83b325164",
          "6c8ec899-8b46-4dc9-9658-3cac14fded74"
        ],
        "stereo_centers": 4
      },
      "unii": "3E93Z2RU2H"
    }
  ]
}