{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "1b469b40-abc0-4c28-8bd5-641fae55337a",
          "code": "N06AF04",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Monoamine oxidase inhibitors, non-selective|tranylcypromine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AF04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "dad679d4-0c2f-487d-afc4-887740c5fd70",
          "code": "N0000175744",
          "comments": "Established Pharmacologic Class [EPC]|Monoamine Oxidase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175744",
          "code_system": "NDF-RT",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "117859cd-cb16-430e-959c-c57aa292372f",
          "code": "N0000000184",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Monoamine Oxidase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000184",
          "code_system": "NDF-RT",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "469fb8b6-c712-457b-84b2-d412f9c76d68",
          "code": "QN06AF04",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Monoamine oxidase inhibitors, non-selective|tranylcypromine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AF04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "191f9921-a5a5-47b7-87b0-0be68ee6271e",
          "code": "155-09-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=155-09-9",
          "code_system": "CAS",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc",
            "4c03f4ae-5191-47a1-9bed-842138f00fdb"
          ]
        },
        {
          "uuid": "06b70094-c31a-4214-b2f5-4e2545b7e4b6",
          "code": "C61979",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C61979",
          "code_system": "NCI_THESAURUS",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "a17f4537-1ab2-4c5d-911e-7d8331bd98bc",
          "code": "NBK548572",
          "comments": "LiverTox|CNS|Antidepressant|MAO inhibitor",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548572/",
          "code_system": "LIVERTOX",
          "references": [
            "3bbfb668-56a6-9d01-df89-c1f30e14a668"
          ]
        },
        {
          "uuid": "3adcddb0-22e6-40ac-9aff-c87ce5d71c3a",
          "code": "D014191",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014191",
          "code_system": "MESH",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "a4de02e3-10e1-49bc-a18e-29ae3ab917d3",
          "code": "TRANYLCYPROMINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tranylcypromine",
          "code_system": "WIKIPEDIA",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "819ad948-cbd3-43ba-affd-4798282476d1",
          "code": "SUB11218MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "5f9358c7-f631-4229-99a3-31d950e924c6",
          "code": "986",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=986",
          "code_system": "INN",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "9fc1605e-0264-482e-bbcd-b7748b58367a",
          "code": "5281",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=5281",
          "code_system": "IUPHAR",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "02b1966a-d34f-4967-88a2-697ac0993ecb",
          "code": "10734",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/10734/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "e98e0d69-4e3e-49d7-969c-ab33cf48e5ba",
          "code": "m11004",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11004?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "7338f1e4-7900-458e-ba92-bb62ddca4409",
          "code": "3721-28-6",
          "type": "GENERIC (FAMILY)",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3721-28-6",
          "code_system": "CAS",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc",
            "12c271b2-e19d-4bdb-8750-2a32059aa314"
          ]
        },
        {
          "uuid": "c4145b3d-e55a-495f-a2e2-43e44f87dcb5",
          "code": "DB00752",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00752",
          "code_system": "DRUG BANK",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "bc39d1ab-2f40-4bdc-98f4-e98689ca13ff",
          "code": "CHEMBL313833",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL313833",
          "code_system": "ChEMBL",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "75b3d871-b0be-4621-b3b6-13cc0b1ccbd1",
          "code": "19493",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19493",
          "code_system": "PUBCHEM",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "e2505ec7-3c4c-488e-9983-8c9bf2f1120f",
          "code": "205-841-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.005.312",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc"
          ]
        },
        {
          "uuid": "c79d3c91-22e7-382d-0427-e04980451a2d",
          "code": "3404",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3404",
          "code_system": "HSDB",
          "references": [
            "c156d886-b892-8044-89b3-929b52c9c5be"
          ]
        },
        {
          "uuid": "2e47524e-720f-5c6b-09dd-df1ff2fd11a2",
          "code": "DTXSID2023694",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2023694",
          "code_system": "EPA CompTox",
          "references": [
            "3a6b16b3-2a5c-6506-ad9a-61233e3dbdb0"
          ]
        },
        {
          "uuid": "1a2ba2c4-b8f4-0626-d092-15e401cfc141",
          "code": "C667",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Monoamine Oxidase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C667",
          "code_system": "NCI_THESAURUS",
          "references": [
            "3bbfb668-56a6-9d01-df89-c1f30e14a668"
          ]
        },
        {
          "uuid": "374f7b0c-3cbb-4114-a19f-318119e81088",
          "code": "3E3V44J4Z9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "39296e72-26f2-c928-97b1-1e9a07ec4aaa",
          "code": "Tranylcypromine",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM311/",
          "code_system": "LACTMED",
          "references": [
            "3bbfb668-56a6-9d01-df89-c1f30e14a668"
          ]
        },
        {
          "uuid": "356680d8-a8be-c4ca-e5ed-18c0ec6fd2ce",
          "code": "2715",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/2715",
          "code_system": "DRUG CENTRAL",
          "references": [
            "3bbfb668-56a6-9d01-df89-c1f30e14a668"
          ]
        },
        {
          "uuid": "d53e7b23-43f9-7193-185b-8d2aaed777c3",
          "code": "9652",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:9652",
          "code_system": "CHEBI",
          "references": [
            "3bbfb668-56a6-9d01-df89-c1f30e14a668"
          ]
        },
        {
          "uuid": "815bb1ea-205e-ce7e-c624-c1e0f88230c7",
          "code": "80664",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=80664",
          "code_system": "NSC",
          "references": [
            "b55abd58-fe30-7f74-bdca-546beeab0c4f"
          ]
        },
        {
          "uuid": "1b06ddfa-38d3-31f9-23a5-44cc1c8e7ccf",
          "code": "3E3V44J4Z9",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3E3V44J4Z9",
          "code_system": "DAILYMED",
          "references": [
            "07eb7fd9-109c-1406-1d8b-c73be9444bde"
          ]
        },
        {
          "uuid": "0f109139-d22e-5c03-8f11-1693437ccc64",
          "code": "100000077494",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f8289069-c3aa-71d9-2759-365dfe16fae3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "28b83fe9-f765-48a8-ae50-4fb2743094f0",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "16ec8054-6ebc-4385-8927-f0a89d899b92",
            "refuuid": "ae15c3df-2c99-4842-b93d-23455cc5363f",
            "name": "TRANYLCYPROMINE",
            "unii": "3E3V44J4Z9",
            "linking_id": "3E3V44J4Z9",
            "ref_pname": "TRANYLCYPROMINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "35a3aa9e-27bb-40c9-95a7-94d775d4235c",
          "type": "IMPURITY->PARENT",
          "references": [
            "d0f42079-279e-48c1-9d9a-fca5a054bfe8"
          ],
          "related_substance": {
            "uuid": "ea462b06-383d-4344-9d9d-9e0d860cabdd",
            "refuuid": "16091760-51e0-4a79-9754-cfd3cd07eab8",
            "name": "TRANYLCYPROMINE, CIS-",
            "unii": "HXA9ID52RQ",
            "linking_id": "HXA9ID52RQ",
            "ref_pname": "TRANYLCYPROMINE, CIS-",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "101d0266-5c78-4ac5-ad39-be7684b2ba47",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "526ee007-6f20-4ade-bcd0-bc84d67e06a7",
            "refuuid": "def12d32-efd3-4ccb-ae42-813058c9fefe",
            "name": "TRANYLCYPROMINE HYDROCHLORIDE",
            "unii": "7H4CZX4FYH",
            "linking_id": "7H4CZX4FYH",
            "ref_pname": "TRANYLCYPROMINE HYDROCHLORIDE"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "632f3e4c-6206-43b4-965c-3480ef322f42",
          "name": "CYCLOPROPANAMINE, 2-PHENYL-, (1S,2R)-",
          "stdName": "CYCLOPROPANAMINE, 2-PHENYL-, (1S,2R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "634bceec-0493-4f67-9089-327ac2e83a0d"
          ],
          "display_name": false
        },
        {
          "uuid": "8d42557a-80cf-4deb-ba15-8e2d90555bb7",
          "name": "NSC-80664",
          "stdName": "NSC-80664",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ada74b59-a027-47a5-9b4f-1a3569df2e08"
          ],
          "display_name": false
        },
        {
          "uuid": "775a21b8-001c-4b93-ba5c-c3fd27f3c98d",
          "name": "TRANYLCYPROMINE",
          "stdName": "TRANYLCYPROMINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c2a03005-413b-470e-9da4-d95276e03b02",
            "686d613f-e422-4e6c-b77c-552dfc6e0084",
            "9c6cb90f-bf7c-4588-b599-99848d5f0a78",
            "a3429145-ca76-4bed-b247-9971111ae591",
            "01ab4271-3ba7-4598-98f0-74f7e82648ae",
            "53dd7ee5-b8b7-46db-9cfd-cecad9a3f8f7",
            "b11097ae-6c65-4d93-880a-0ce5f78f3f2b",
            "d55f635a-81e2-4f03-ae1f-9d1682720267",
            "63e0108f-1131-4d69-ba46-79f02f92ef0a",
            "eb86b4f3-57d4-47b6-ab22-4f357394122f",
            "d0f42079-279e-48c1-9d9a-fca5a054bfe8"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "32d50be8-642d-4c60-b62e-246db57dd939",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "83514bcc-33fb-4485-b2fe-1623c7bbc698",
          "name": "TRANYLCYPROMINE [HSDB]",
          "stdName": "TRANYLCYPROMINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c6cb90f-bf7c-4588-b599-99848d5f0a78"
          ],
          "display_name": false
        },
        {
          "uuid": "4854df66-bd38-4b48-b16c-e76207288c08",
          "name": "TRANYLCYPROMINE [MI]",
          "stdName": "TRANYLCYPROMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0f42079-279e-48c1-9d9a-fca5a054bfe8"
          ],
          "display_name": false
        },
        {
          "uuid": "48cc7deb-79cb-4322-82ca-c79256062302",
          "name": "TRANYLCYPROMINE [VANDF]",
          "stdName": "TRANYLCYPROMINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d55f635a-81e2-4f03-ae1f-9d1682720267"
          ],
          "display_name": false
        },
        {
          "uuid": "8745db2c-921e-ce60-fc8a-e5e941913a4f",
          "name": "Tranylcypromine [WHO-DD]",
          "stdName": "TRANYLCYPROMINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89dc6147-c95b-5edc-afc1-3dbca802dd62"
          ],
          "display_name": false
        },
        {
          "uuid": "1264cbaf-8c3b-4945-888f-5c681bf3ac4b",
          "name": "tranylcypromine [INN]",
          "stdName": "TRANYLCYPROMINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "686d613f-e422-4e6c-b77c-552dfc6e0084"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "63e0108f-1131-4d69-ba46-79f02f92ef0a",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "686d613f-e422-4e6c-b77c-552dfc6e0084",
          "citation": "INN Proposed List 11",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL11.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9c6cb90f-bf7c-4588-b599-99848d5f0a78",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53dd7ee5-b8b7-46db-9cfd-cecad9a3f8f7",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d55f635a-81e2-4f03-ae1f-9d1682720267",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0f42079-279e-48c1-9d9a-fca5a054bfe8",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "634bceec-0493-4f67-9089-327ac2e83a0d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ada74b59-a027-47a5-9b4f-1a3569df2e08",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59bc20aa-ce93-4dbf-87b1-80f64d8b86bc",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390988000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06f0cd18-ec88-4c25-9a86-84f49a2f4018",
          "citation": "SRS import [3E3V44J4Z9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3E3V44J4Z9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390988000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b11097ae-6c65-4d93-880a-0ce5f78f3f2b",
          "citation": "TRANYLCYPROMINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "01ab4271-3ba7-4598-98f0-74f7e82648ae",
          "citation": "TRANYLCYPROMINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb86b4f3-57d4-47b6-ab22-4f357394122f",
          "citation": "TRANYLCYPROMINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2a03005-413b-470e-9da4-d95276e03b02",
          "citation": "TRANYLCYPROMINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a3429145-ca76-4bed-b247-9971111ae591",
          "citation": "TRANYLCYPROMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c156d886-b892-8044-89b3-929b52c9c5be",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+155-09-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3a6b16b3-2a5c-6506-ad9a-61233e3dbdb0",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=155-09-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e98e1332-bbf9-9710-de41-4431f94b69af",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+155-09-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f8289069-c3aa-71d9-2759-365dfe16fae3",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "3bbfb668-56a6-9d01-df89-c1f30e14a668",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "12c271b2-e19d-4bdb-8750-2a32059aa314",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4c03f4ae-5191-47a1-9bed-842138f00fdb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "89dc6147-c95b-5edc-afc1-3dbca802dd62",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "b55abd58-fe30-7f74-bdca-546beeab0c4f",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "07eb7fd9-109c-1406-1d8b-c73be9444bde",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "36172662-35bf-4e65-9e3a-e43bbf093a37",
          "id": "36172662-35bf-4e65-9e3a-e43bbf093a37",
          "molfile": "\n  Marvin  01132102532D          \n\n 10 11  0  0  0  0            999 V2000\n    6.9675   -5.8263    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.6796   -6.2386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5510   -5.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1429   -5.8346    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    5.4348   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4348   -7.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -7.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -7.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -5.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  3  1  0  0  0  0\n  4  1  1  0  0  0  0\n  4  3  1  6  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)[C@@H]2C[C@H]2N",
          "formula": "C9H11N",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3244a7a9-0e61-4d80-b92a-51ef10ed2b23"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "133.1907",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ae15c3df-2c99-4842-b93d-23455cc5363f",
      "version": "23",
      "structure": {
        "id": "ebb356f2-024d-4d4c-87be-6628fffc36a7",
        "molfile": "\n  Marvin  01132112122D          \n\n 10 11  0  0  0  0            999 V2000\n    6.1429   -5.8346    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.5510   -5.1142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9675   -5.8263    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.4348   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6796   -6.2386    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4348   -7.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -5.8388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7186   -7.4921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -6.2511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0064   -7.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  1  4  1  6  0  0  0\n  3  5  1  1  0  0  0\n  6  4  1  0  0  0  0\n  7  4  2  0  0  0  0\n  8  6  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  8  1  0  0  0  0\n  3  2  1  0  0  0  0\n 10  9  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)[C@@H]2C[C@H]2N",
        "formula": "C9H11N",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "133.1907",
        "optical_activity": "( + / - )",
        "references": [
          "63e0108f-1131-4d69-ba46-79f02f92ef0a",
          "06f0cd18-ec88-4c25-9a86-84f49a2f4018",
          "686d613f-e422-4e6c-b77c-552dfc6e0084"
        ],
        "stereo_centers": 2
      },
      "unii": "3E3V44J4Z9"
    }
  ]
}