{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "66e6a509-3a4a-466b-a6a0-d6891fb66405",
          "code": "480-40-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=480-40-0",
          "code_system": "CAS",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40",
            "9bd1f5c5-5544-440a-b505-1f2c149f6f2a"
          ]
        },
        {
          "uuid": "4aeb1225-b502-43ec-8d53-e8b5aef24b0f",
          "code": "C043561",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67043561",
          "code_system": "MESH",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "953b26d7-0bb2-415c-b47c-464b936fd94e",
          "code": "CHRYSIN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chrysin",
          "code_system": "WIKIPEDIA",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "076a3156-2f05-4223-bd39-b107f96d418d",
          "code": "207-549-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.006.864",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "da016565-e0c0-4b78-81b7-5f4466f14adf",
          "code": "1362888",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1362888/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "4173d987-79ce-4c99-a97e-157f96b210f5",
          "code": "m3530",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3530?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "552eb625-29fa-45b5-b796-c636e77759d3",
          "code": "SUB33945",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "fa4ef754-4266-466e-b5c1-9f3928804123",
          "code": "5281607",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/5281607",
          "code_system": "PUBCHEM",
          "references": [
            "bffb3592-26cb-438d-8749-914c3b653f40"
          ]
        },
        {
          "uuid": "fe615016-6f79-8abb-aa44-48fed25f86ad",
          "code": "DTXSID1022396",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1022396",
          "code_system": "EPA CompTox",
          "references": [
            "f402aee6-c03f-f137-9edf-7935dd01af59"
          ]
        },
        {
          "uuid": "041edf90-afc7-5671-0d22-3d25f02c11fc",
          "code": "1394 (Number of products:104)",
          "comments": "Dietary Supplement Label Database|Botanical|Flavonoid",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=1394&item=Flavonoid",
          "code_system": "DSLD",
          "references": [
            "060d085c-ef1e-597c-d6e0-cad8bd74806a"
          ]
        },
        {
          "uuid": "12dc4cdf-7403-03ef-026b-49ed822a54ed",
          "code": "386 (Number of products:107)",
          "comments": "Dietary Supplement Label Database|TBD|Chrysin",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=386&item=Chrysin",
          "code_system": "DSLD",
          "references": [
            "060d085c-ef1e-597c-d6e0-cad8bd74806a"
          ]
        },
        {
          "uuid": "93bfb210-63c3-95b4-83c3-9f1852aec39b",
          "code": "DB15581",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB15581",
          "code_system": "DRUG BANK",
          "references": [
            "060d085c-ef1e-597c-d6e0-cad8bd74806a"
          ]
        },
        {
          "uuid": "633b8002-7131-4699-8059-4530dc1b38c5",
          "code": "3CN01F5ZJ5",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c5b05dc6-9a06-8861-804a-5eec836a7889",
          "code": "75095",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75095",
          "code_system": "CHEBI",
          "references": [
            "060d085c-ef1e-597c-d6e0-cad8bd74806a"
          ]
        },
        {
          "uuid": "c52b01dc-b106-c4af-952c-7e055d5ba17c",
          "code": "100000127807",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "5dabc386-6054-e456-39da-886390eeb2d9"
          ]
        },
        {
          "uuid": "9e87ce19-d063-aba2-c8b5-64e0293c4b5d",
          "code": "3CN01F5ZJ5",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=3CN01F5ZJ5",
          "code_system": "DAILYMED",
          "references": [
            "24cb2b35-a018-cb3d-d5b3-6b21b4ef2011"
          ]
        },
        {
          "uuid": "51573087-8428-5a65-8133-abe074a8da71",
          "code": "407436",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=407436",
          "code_system": "NSC",
          "references": [
            "9202e0b5-e934-77d0-e3ce-e322c1030544"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "8c630a5e-e4f7-4abb-b524-268f208a63de",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "e4ed8266-85b4-4422-a724-b9b92eaa4963",
            "refuuid": "8a53002a-f8d9-4665-8d90-c752337224fc",
            "name": "CHRYSIN",
            "unii": "3CN01F5ZJ5",
            "linking_id": "3CN01F5ZJ5",
            "ref_pname": "CHRYSIN",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4c118c3c-fb00-489f-b0f5-91cc6f2c9e1a",
          "name": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-PHENYL-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 5,7-DIHYDROXY-2-PHENYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a8b52d-050f-4112-ada5-0ef985b5a74b",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        },
        {
          "uuid": "85864c1c-2a5b-40f2-8ff4-dde17e7187cd",
          "name": "5,7-DIHYDROXY-2-PHENYLCHROMEN-4-ONE",
          "stdName": "5,7-DIHYDROXY-2-PHENYLCHROMEN-4-ONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a8b52d-050f-4112-ada5-0ef985b5a74b",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        },
        {
          "uuid": "fc022497-1c93-48e6-b2e5-11675c6e33bc",
          "name": "5,7-DIHYDROXYFLAVONE",
          "stdName": "5,7-DIHYDROXYFLAVONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a8b52d-050f-4112-ada5-0ef985b5a74b",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        },
        {
          "uuid": "7daf136d-a8c6-4ded-8d38-2a5f820cd6e6",
          "name": "CHRYSIN",
          "stdName": "CHRYSIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "23711aff-17e7-4f96-aa6d-b95ef2eae74c",
            "ecdc8d9a-b9ad-4873-927f-70c502cdabe6",
            "9a0609a5-8f6d-488a-8fcf-7bb1037c5566",
            "0a7d4284-69e4-42f3-82fe-5bdb05a050a5",
            "ead7ade9-e6a6-4738-b522-25e9ec4089b3",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "8a53259b-6bbf-4482-927e-bf0b1945e875",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "ab7becf4-06de-4a48-bc8c-b70b7d8e19f2",
          "name": "CHRYSIN [MI]",
          "stdName": "CHRYSIN [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0a7d4284-69e4-42f3-82fe-5bdb05a050a5",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        },
        {
          "uuid": "48719a38-3f38-4340-b202-039eac2cdb53",
          "name": "FLAVONE, 5,7-DIHYDROXY-",
          "stdName": "FLAVONE, 5,7-DIHYDROXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a8b52d-050f-4112-ada5-0ef985b5a74b",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        },
        {
          "uuid": "a3723d1b-bfd9-42c1-9592-47e6a41ff816",
          "name": "NSC-407436",
          "stdName": "NSC-407436",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "49a8b52d-050f-4112-ada5-0ef985b5a74b",
            "3e698fad-f73f-47cc-943c-72422430e5aa"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ecdc8d9a-b9ad-4873-927f-70c502cdabe6",
          "citation": "CHRYSIN [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "23711aff-17e7-4f96-aa6d-b95ef2eae74c",
          "citation": "CHRYSIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ead7ade9-e6a6-4738-b522-25e9ec4089b3",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "49a8b52d-050f-4112-ada5-0ef985b5a74b",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e698fad-f73f-47cc-943c-72422430e5aa",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0a7d4284-69e4-42f3-82fe-5bdb05a050a5",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9a0609a5-8f6d-488a-8fcf-7bb1037c5566",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bffb3592-26cb-438d-8749-914c3b653f40",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390926000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "03122e85-c1de-4188-b8be-3f3b4ad45a8b",
          "citation": "SRS import [3CN01F5ZJ5]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3CN01F5ZJ5",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390926000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f4830ab7-0859-4a17-856c-9a6032dce2b0",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f402aee6-c03f-f137-9edf-7935dd01af59",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=480-40-0",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5dabc386-6054-e456-39da-886390eeb2d9",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "060d085c-ef1e-597c-d6e0-cad8bd74806a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9bd1f5c5-5544-440a-b505-1f2c149f6f2a",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "9202e0b5-e934-77d0-e3ce-e322c1030544",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "24cb2b35-a018-cb3d-d5b3-6b21b4ef2011",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f7f68d15-a9b8-4d68-b3ee-cebc7b94b5db",
          "id": "f7f68d15-a9b8-4d68-b3ee-cebc7b94b5db",
          "molfile": "\n  Marvin  01132112512D          \n\n 19 21  0  0  0  0            999 V2000\n    4.3558   -4.2749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -5.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -6.7718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5281   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5281   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -4.2749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9516   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9516   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -5.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -6.7718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7037   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4155   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1239   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1239   -3.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4155   -3.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7037   -3.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  8  2  2  0  0  0  0\n  4  3  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 12  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 14  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)-c2cc(=O)c3c(cc(cc3o2)O)O",
          "formula": "C15H10O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "cdc239af-b4c0-4cd6-9529-b2023f12473d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "254.2381",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8a53002a-f8d9-4665-8d90-c752337224fc",
      "version": "11",
      "structure": {
        "id": "4e2b4f27-47d4-419d-bf3b-5c9230ca95b8",
        "molfile": "\n  Marvin  01132104052D          \n\n 19 21  0  0  0  0            999 V2000\n    6.5281   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5281   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -4.2749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9516   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7037   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4155   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1239   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1239   -3.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4155   -3.0178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7037   -3.4348    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9516   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -5.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2398   -6.7718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -4.2749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -4.6920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3558   -4.2749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0642   -5.5146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -5.9364    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7759   -6.7718    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n  5 10  1  0  0  0  0\n 11  4  2  0  0  0  0\n 12 11  1  0  0  0  0\n  1 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n  2 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 15  2  0  0  0  0\n 18 17  1  0  0  0  0\n  1 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)-c2cc(=O)c3c(cc(cc3o2)O)O",
        "formula": "C15H10O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "254.2381",
        "optical_activity": "NONE",
        "references": [
          "03122e85-c1de-4188-b8be-3f3b4ad45a8b",
          "f4830ab7-0859-4a17-856c-9a6032dce2b0"
        ],
        "stereo_centers": 0
      },
      "unii": "3CN01F5ZJ5"
    }
  ]
}