{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c6084333-f0fa-4f1a-90be-a10f44dc5982",
          "code": "96-69-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=96-69-5",
          "code_system": "CAS",
          "references": [
            "e95b6b2e-5b18-4ee1-9ca2-da92ef46d285",
            "4b2822ac-5719-4a93-b255-4bb10c9b4c05"
          ]
        },
        {
          "uuid": "25a81a93-1844-451a-af9c-8bfe98449384",
          "code": "SUB77729",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "e95b6b2e-5b18-4ee1-9ca2-da92ef46d285"
          ]
        },
        {
          "uuid": "cbe16f73-26ec-4bf3-b143-807d9663bdae",
          "code": "202-525-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.002.297",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e95b6b2e-5b18-4ee1-9ca2-da92ef46d285"
          ]
        },
        {
          "uuid": "ad3e0123-0ccd-4272-b3b8-2713b42055be",
          "code": "7308",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/7308",
          "code_system": "PUBCHEM",
          "references": [
            "e95b6b2e-5b18-4ee1-9ca2-da92ef46d285"
          ]
        },
        {
          "uuid": "515f2f3e-697c-b751-6e09-7eb8c1e86316",
          "code": "5304",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/5304",
          "code_system": "HSDB",
          "references": [
            "6d6ba651-f055-9d05-c479-d1209d2d6ffb"
          ]
        },
        {
          "uuid": "3b482888-bbfd-f2e4-a961-cea5dea604b7",
          "code": "DTXSID4021341",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4021341",
          "code_system": "EPA CompTox",
          "references": [
            "09e55879-be13-6c3f-2061-7bce97e42da7"
          ]
        },
        {
          "uuid": "4bf65018-04b5-4ad8-97fe-e5ceaf18cb0c",
          "code": "3CA5G9822V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "369307bc-5c1f-cbe3-92b9-2820049ee4ca",
          "code": "100000138279",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a9c28709-6d60-0ae7-e4cc-915637492f30"
          ]
        },
        {
          "uuid": "c37a5a12-93ac-7f8c-491d-f26da45b593d",
          "code": "35388",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=35388",
          "code_system": "NSC",
          "references": [
            "9a5f9413-91bd-f608-d2bf-6a453d8af443"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "73a7b65a-a11c-44be-8f5c-51e2597f71d6",
          "name": "4,4'-THIOBIS(2-TERT-BUTYL-5-METHYLPHENOL)",
          "stdName": "4,4'-THIOBIS(2-TERT-BUTYL-5-METHYLPHENOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54491e7a-9c36-4eed-8930-7bc38d5d3778",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": true
        },
        {
          "uuid": "30543a71-d34d-48a9-a83e-a77d82248219",
          "name": "4,4'-THIOBIS(6-TERT-BUTYL-M-CRESOL)",
          "stdName": "4,4'-THIOBIS(6-TERT-BUTYL-M-CRESOL)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1baeee8f-ed30-4eb1-8f76-faa7f699fc24",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "1e8604d2-7d2e-4929-8635-7b9803e79d03",
          "name": "4,4-THIO-BIS-2-TERTBUTYL-5-METHYLPHENOL",
          "stdName": "4,4-THIO-BIS-2-TERTBUTYL-5-METHYLPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aef8364c-1c6a-4ce7-8276-c94a214ce223",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "b4aa7954-42e3-4d0f-a3ea-b84af43fd015",
          "name": "LOWINOX 44S36",
          "stdName": "LOWINOX 44S36",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54491e7a-9c36-4eed-8930-7bc38d5d3778",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "9aabd6c6-7e39-480b-87f6-6524bcffce34",
          "name": "NSC-35388",
          "stdName": "NSC-35388",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b30f0b99-a5e4-4d26-818f-71c1d4d9cc9d",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "2590576b-7906-4fb8-87b7-8ce7d0c31709",
          "name": "SANTONOX",
          "stdName": "SANTONOX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f3ff15e8-4948-4cae-832b-7f5ab37b0406",
            "c601bdff-2ea6-4bf2-9912-7970edcee1be",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94",
            "615d8a0f-54d8-41dc-91ad-db903247670f"
          ],
          "display_name": false
        },
        {
          "uuid": "c554ba91-e320-4267-b732-37e87310b659",
          "name": "SANTONOX [HSDB]",
          "stdName": "SANTONOX [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c601bdff-2ea6-4bf2-9912-7970edcee1be",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "1343edd6-4193-4c0d-9431-e0c4f7aab18e",
          "name": "SUMILIZER WX",
          "stdName": "SUMILIZER WX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54491e7a-9c36-4eed-8930-7bc38d5d3778",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        },
        {
          "uuid": "47a652dd-99bf-41c7-9844-979c64b97707",
          "name": "THIO-BIS-2-TERTBUTYL-5-METHYLPHENOL",
          "stdName": "THIO-BIS-2-TERTBUTYL-5-METHYLPHENOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4bc26da3-9407-4413-8d67-4f77ed4ca8ae"
          ],
          "display_name": false
        },
        {
          "uuid": "bed7ff6a-cb20-4ccd-a1ca-6c10954ce84a",
          "name": "THIOBIS(6-TERT-BUTYL-M-CRESOL), 4,4'-",
          "stdName": "THIOBIS(6-TERT-BUTYL-M-CRESOL), 4,4'-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8b22da18-a341-4a96-a0b3-8516d242e11f"
          ],
          "display_name": false
        },
        {
          "uuid": "9757cc5b-42a0-4dd7-918b-1c2b7c83091d",
          "name": "ULTRANOX 236",
          "stdName": "ULTRANOX 236",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54491e7a-9c36-4eed-8930-7bc38d5d3778",
            "52926a37-9aca-4312-a0ca-c9e0367c7f94"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8b22da18-a341-4a96-a0b3-8516d242e11f",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c601bdff-2ea6-4bf2-9912-7970edcee1be",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "52926a37-9aca-4312-a0ca-c9e0367c7f94",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1baeee8f-ed30-4eb1-8f76-faa7f699fc24",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f3ff15e8-4948-4cae-832b-7f5ab37b0406",
          "citation": "NLM",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54491e7a-9c36-4eed-8930-7bc38d5d3778",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aef8364c-1c6a-4ce7-8276-c94a214ce223",
          "citation": "evmpd",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b30f0b99-a5e4-4d26-818f-71c1d4d9cc9d",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e95b6b2e-5b18-4ee1-9ca2-da92ef46d285",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390896000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0553ffa9-a57a-45b5-8adb-1cc49e7663cd",
          "citation": "SRS import [3CA5G9822V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3CA5G9822V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390896000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4e737452-7c47-45db-bf3d-e4d7aa4feae7",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "615d8a0f-54d8-41dc-91ad-db903247670f",
          "citation": "SANTONOX [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6d6ba651-f055-9d05-c479-d1209d2d6ffb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+96-69-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "09e55879-be13-6c3f-2061-7bce97e42da7",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=96-69-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a9c28709-6d60-0ae7-e4cc-915637492f30",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9a5f9413-91bd-f608-d2bf-6a453d8af443",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "4b2822ac-5719-4a93-b255-4bb10c9b4c05",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "4bc26da3-9407-4413-8d67-4f77ed4ca8ae",
          "citation": "mhra",
          "doc_type": "MHRSA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4b43c382-c988-49df-b5b6-bc56dfc7124f",
          "id": "4b43c382-c988-49df-b5b6-bc56dfc7124f",
          "molfile": "\n  Marvin  01132103562D          \n\n 25 26  0  0  0  0            999 V2000\n    5.2236   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -6.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5091   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5091   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7946   -4.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -4.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9380   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9380   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6526   -6.3026    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3670   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3670   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -4.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7960   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5104   -4.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7960   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -6.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -3.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2845   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9034   -3.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2247   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -3.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0205   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0804   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4017   -3.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  6 22  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 16 10  2  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 18  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(c(cc1Sc2cc(c(cc2C)O)C(C)(C)C)C(C)(C)C)O",
          "formula": "C22H30O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "875e5b7d-d6c1-4add-8d26-9f3eb7f8eb53"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "358.5393",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c4881eab-df09-422e-8534-a538d13bb466",
      "version": "9",
      "structure": {
        "id": "234129a9-b792-408c-96dd-85bed1001018",
        "molfile": "\n  Marvin  01132101582D          \n\n 25 26  0  0  0  0            999 V2000\n    8.0814   -4.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7960   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7960   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -6.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3670   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3670   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6526   -6.3026    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9380   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -6.3026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5091   -5.8902    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5091   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -4.6527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9380   -5.0652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -3.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0205   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0804   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4017   -3.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7946   -4.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2236   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -7.1277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5104   -4.6527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0814   -3.8277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2845   -3.6142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9034   -3.8996    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2247   -3.0152    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  1  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13  8  1  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n 11 18  1  0  0  0  0\n  9 19  1  0  0  0  0\n  4 20  1  0  0  0  0\n  2 21  1  0  0  0  0\n  1 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  1  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1cc(c(cc1Sc2cc(c(cc2C)O)C(C)(C)C)C(C)(C)C)O",
        "formula": "C22H30O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "358.5393",
        "optical_activity": "NONE",
        "references": [
          "0553ffa9-a57a-45b5-8adb-1cc49e7663cd",
          "4e737452-7c47-45db-bf3d-e4d7aa4feae7"
        ],
        "stereo_centers": 0
      },
      "unii": "3CA5G9822V"
    }
  ]
}