{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7f8fa133-3335-497d-8102-d0fa7b4f36b5",
          "code": "58479-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=58479-61-1",
          "code_system": "CAS",
          "references": [
            "e70e5fc3-21d0-4630-ab91-53e6bc6a470d",
            "e095498d-9333-4eb7-8db5-59e67d7ee120"
          ]
        },
        {
          "uuid": "6640b854-d8e8-49c0-8e60-56777811bcc7",
          "code": "261-282-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.055.692",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e70e5fc3-21d0-4630-ab91-53e6bc6a470d"
          ]
        },
        {
          "uuid": "8848ec47-2d82-417b-8c2d-fefd6cea84cd",
          "code": "m2838",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2838?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "e70e5fc3-21d0-4630-ab91-53e6bc6a470d"
          ]
        },
        {
          "uuid": "6a67ed7d-5eb9-4725-bf81-949a43f4ed44",
          "code": "94078",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/94078",
          "code_system": "PUBCHEM",
          "references": [
            "e70e5fc3-21d0-4630-ab91-53e6bc6a470d"
          ]
        },
        {
          "uuid": "5d97cb18-147b-aff2-2d93-fa4b936e51d3",
          "code": "DTXSID5069259",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5069259",
          "code_system": "EPA CompTox",
          "references": [
            "3d89c616-981d-3144-407a-76c57fb86538"
          ]
        },
        {
          "uuid": "acfee5c0-99dc-4fae-87d8-168f1e5d968f",
          "code": "3BEU48UI4E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "225bf965-a27b-c177-37b7-f8061b064056",
          "code": "617386",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=617386",
          "code_system": "NSC",
          "references": [
            "ec3f06ea-a61a-b874-485b-62adee0c37a7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6d829a54-7376-4d65-890b-1d9221b0cc6b",
          "name": "1,1'-(CHLORO(1,1-DIMETHYLETHYL)SILYLENE)BISBENZENE",
          "stdName": "1,1'-(CHLORO(1,1-DIMETHYLETHYL)SILYLENE)BISBENZENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "02ec3c78-39d6-4b88-976a-93730bfd2537",
          "name": "BENZENE, 1,1'-(CHLORO(1,1-DIMETHYLETHYL)SILYLENE)BIS-",
          "stdName": "BENZENE, 1,1'-(CHLORO(1,1-DIMETHYLETHYL)SILYLENE)BIS-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4f8eb0fe-77b4-43a5-b32d-2c84ccbb8357",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "1e838bde-222e-407f-bd36-8057cad5cba7",
          "name": "NSC-617386",
          "stdName": "NSC-617386",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "879570c1-955d-4ff1-bf37-4525e8160831",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "9dd1992d-1aa1-428f-82f9-f1db07347122",
          "name": "T-BUPH2SICL",
          "stdName": "T-BUPH2SICL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "2b855c0b-5a7b-42d1-b54d-3068906e5edd",
          "name": "TBDPS-CL",
          "stdName": "TBDPS-CL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "cdda9612-1897-4733-8f64-6b6319f46ea8",
          "name": "TERT-BUTYLCHLORODIPHENYLSILANE",
          "stdName": "TERT-BUTYLCHLORODIPHENYLSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        },
        {
          "uuid": "6036b1d9-8e33-4bac-8276-7c30fade6d2d",
          "name": "TERT-BUTYLDIPHENYLCHLOROSILANE",
          "stdName": "TERT-BUTYLDIPHENYLCHLOROSILANE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14",
            "50f912db-2ce5-4e5b-9ed4-7c239bd064cf"
          ],
          "display_name": true
        },
        {
          "uuid": "888329cf-16f0-4f2e-ba42-ba746f477547",
          "name": "TERT-BUTYLDIPHENYLCHLOROSILANE [MI]",
          "stdName": "TERT-BUTYLDIPHENYLCHLOROSILANE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9fdaa86-a549-42ec-9a98-6fc504782503",
            "4de27569-6633-409e-9a74-7c4136170b14"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4f8eb0fe-77b4-43a5-b32d-2c84ccbb8357",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "4de27569-6633-409e-9a74-7c4136170b14",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9fdaa86-a549-42ec-9a98-6fc504782503",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "879570c1-955d-4ff1-bf37-4525e8160831",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e70e5fc3-21d0-4630-ab91-53e6bc6a470d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce025303-0c8f-43e0-a951-bb5d219ef741",
          "citation": "SRS import [3BEU48UI4E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3BEU48UI4E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391665000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c3f083d-d7b5-480c-b3d7-9a0eafe27761",
          "citation": "CHEMID RECORD 58479-61-1",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "50f912db-2ce5-4e5b-9ed4-7c239bd064cf",
          "citation": "TERT-BUTYLDIPHENYLCHLOROSILANE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "3d89c616-981d-3144-407a-76c57fb86538",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=58479-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e095498d-9333-4eb7-8db5-59e67d7ee120",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ec3f06ea-a61a-b874-485b-62adee0c37a7",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "3d3b50bb-663d-4db5-9ee8-e19ca2c41124",
          "id": "3d3b50bb-663d-4db5-9ee8-e19ca2c41124",
          "molfile": "\n  Marvin  01132103152D          \n\n 18 19  0  0  0  0            999 V2000\n   11.3072  -10.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.7645  -10.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1539   -9.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6196  -10.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9441  -11.2937    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   10.1677  -10.6282    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   11.6822  -11.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772  -12.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3848  -12.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1052  -12.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1126  -11.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4026  -11.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2293  -11.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5141  -11.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8007  -11.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8007  -12.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5141  -12.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2293  -12.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  7  1  0  0  0  0\n  5 13  1  0  0  0  0\n  7  8  1  0  0  0  0\n 12  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 18 13  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)[Si](c1ccccc1)(c2ccccc2)Cl",
          "formula": "C16H19ClSi",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fc494423-7f4a-494a-a50b-ebb0421544cc"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "274.861",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "e0048d53-d544-454d-bb96-17b75fbb432f",
      "version": "4",
      "structure": {
        "id": "686c3710-4e64-430b-b0c4-2b2e9711c365",
        "molfile": "\n  Marvin  01132105262D          \n\n 18 19  0  0  0  0            999 V2000\n   11.6822  -11.7213    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6772  -12.5506    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3848  -12.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1052  -12.5593    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1126  -11.7355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4026  -11.3170    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1677  -10.6282    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.9441  -11.2937    0.0000 Si  0  0  0  0  0  0  0  0  0  0  0  0\n   11.7645  -10.7303    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3072  -10.0776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1539   -9.9786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2293  -11.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5141  -11.2947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8007  -11.7070    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8007  -12.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5141  -12.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2293  -12.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6196  -10.7275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n  6  1  2  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  8 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 12  2  0  0  0  0\n  8  1  1  0  0  0  0\n  4  5  2  0  0  0  0\n  9 18  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)[Si](c1ccccc1)(c2ccccc2)Cl",
        "formula": "C16H19ClSi",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "274.861",
        "optical_activity": "NONE",
        "references": [
          "ce025303-0c8f-43e0-a951-bb5d219ef741",
          "6c3f083d-d7b5-480c-b3d7-9a0eafe27761"
        ],
        "stereo_centers": 0
      },
      "unii": "3BEU48UI4E"
    }
  ]
}