{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d4a339ed-8041-4db6-b771-66244d8bb80d",
          "code": "28947-50-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=28947-50-4",
          "code_system": "CAS",
          "references": [
            "36da8480-39d8-41f3-9b14-3fe471761e26",
            "464241af-50c5-4280-9332-61199209f8e9"
          ]
        },
        {
          "uuid": "a17de25a-5056-4905-8b03-13c8eb160ade",
          "code": "m5269",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5269?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "36da8480-39d8-41f3-9b14-3fe471761e26"
          ]
        },
        {
          "uuid": "a1006b4a-6e38-4ee5-99ed-e4a2df7b7020",
          "code": "115374",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115374",
          "code_system": "PUBCHEM",
          "references": [
            "36da8480-39d8-41f3-9b14-3fe471761e26"
          ]
        },
        {
          "uuid": "bd78bf4e-56e4-8238-3369-5e66ef6ad07e",
          "code": "Fencamine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Fencamine",
          "code_system": "WIKIPEDIA",
          "references": [
            "ae75a150-623b-6a59-44df-480217e37c0b"
          ]
        },
        {
          "uuid": "03e62f41-5c5e-44b6-8012-d2b51e717a9c",
          "code": "3AO7AC8C6K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "bf3a74af-6627-33a1-1cfd-35562d40f8d8",
          "code": "DTXSID10276158",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10276158",
          "code_system": "EPA CompTox",
          "references": [
            "8a7277d9-eba5-e327-127c-4e6894aadbf3"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f7009258-5764-4db0-8fd9-8432d14feb13",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "3bc4132e-f977-4484-9dc6-cac085fe0960",
            "refuuid": "ad893df1-4745-414b-ad60-89b0922833d2",
            "name": "FENCAMINE",
            "unii": "3AO7AC8C6K",
            "linking_id": "3AO7AC8C6K",
            "ref_pname": "FENCAMINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6c9d67dd-3792-489a-9540-414fa70a31b9",
          "name": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-8-((2-(METHYL(1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)AMINO)-",
          "stdName": "1H-PURINE-2,6-DIONE, 3,7-DIHYDRO-1,3,7-TRIMETHYL-8-((2-(METHYL(1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "e2ff3a79-79bb-4186-bc8d-cfd4f454c9d9"
          ],
          "display_name": false
        },
        {
          "uuid": "bf59f56f-c9cd-4aff-8b23-44b0a839019c",
          "name": "3,7-DIHYDRO-1,3,7-TRIMETHYL-8-((2-(METHYL(1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)AMINO)-1H-PURINE-2,6-DIONE",
          "stdName": "3,7-DIHYDRO-1,3,7-TRIMETHYL-8-((2-(METHYL(1-METHYL-2-PHENYLETHYL)AMINO)ETHYL)AMINO)-1H-PURINE-2,6-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "3dbff372-e797-4b5b-a545-47633849ea5e"
          ],
          "display_name": false
        },
        {
          "uuid": "4bc5459a-838a-4ef5-8f1d-e7b7f3103cde",
          "name": "FENCAMINE",
          "stdName": "FENCAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "077c3f76-60b7-4c02-89fc-913fe9b2d54e",
            "3dbff372-e797-4b5b-a545-47633849ea5e"
          ],
          "display_name": true
        },
        {
          "uuid": "ca52d02f-667e-45bb-9550-46ff25a1e5e5",
          "name": "FENCAMINE [MI]",
          "stdName": "FENCAMINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "3dbff372-e797-4b5b-a545-47633849ea5e"
          ],
          "display_name": false
        },
        {
          "uuid": "8a9965a7-1161-46b4-a671-897d01cf3461",
          "name": "FENCAMINE, (±)-",
          "stdName": "FENCAMINE, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "380b27bb-a05a-4daf-b073-7fb2c882a6a9",
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2"
          ],
          "display_name": false
        },
        {
          "uuid": "2ae79d52-dd05-46ce-adfe-2c444790d1f8",
          "name": "PHENCAMINE",
          "stdName": "PHENCAMINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "3dbff372-e797-4b5b-a545-47633849ea5e"
          ],
          "display_name": false
        },
        {
          "uuid": "32b6d144-69cf-4b91-9d76-33a7d45085be",
          "name": "ST-374",
          "stdName": "ST-374",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
            "3dbff372-e797-4b5b-a545-47633849ea5e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3dbff372-e797-4b5b-a545-47633849ea5e",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "22f27697-84e9-4fd8-b3b9-00777f19c1c2",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2ff3a79-79bb-4186-bc8d-cfd4f454c9d9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "380b27bb-a05a-4daf-b073-7fb2c882a6a9",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36da8480-39d8-41f3-9b14-3fe471761e26",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392050000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a5f88f0-5e3c-47be-8567-ef4fd4173b9c",
          "citation": "SRS import [3AO7AC8C6K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3AO7AC8C6K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392050000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "077c3f76-60b7-4c02-89fc-913fe9b2d54e",
          "citation": "FENCAMINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ae75a150-623b-6a59-44df-480217e37c0b",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/Fencamine",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1b0fd59e-43f3-9285-e67d-acb56400dd61",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28947-50-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "464241af-50c5-4280-9332-61199209f8e9",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8a7277d9-eba5-e327-127c-4e6894aadbf3",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3a09170-6a7a-4bf4-a6b8-3936755da63a",
          "id": "d3a09170-6a7a-4bf4-a6b8-3936755da63a",
          "molfile": "\n  Marvin  01132110562D          \n\n 28 30  0  0  0  0            999 V2000\n   11.0847   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6722   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n   11.0847   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9097   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3222   -7.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1472   -7.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5597   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1472   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3222   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -5.6011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6097   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1972   -4.1722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3722   -4.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8873   -4.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1027   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -4.9972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -5.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6737   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9592   -4.9972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6737   -3.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9592   -3.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -3.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -2.5222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1027   -3.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8873   -3.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1422   -2.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  2  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 27 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 26  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 18  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 20  1  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 26 24  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\nM  END",
          "smiles": "CC(Cc1ccccc1)N(C)CCNc2nc3c(c(=O)n(C)c(=O)n3C)n2C",
          "formula": "C20H28N6O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "da83ac12-e4eb-403a-8e10-0359022e1dd6"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "384.4761",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ad893df1-4745-414b-ad60-89b0922833d2",
      "version": "6",
      "structure": {
        "id": "555e393c-4e62-47b0-ac40-e49288d1bc97",
        "molfile": "\n  Marvin  01132104262D          \n\n 28 30  0  0  0  0            999 V2000\n    7.1422   -2.7201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8873   -3.5047    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3722   -4.1722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1972   -4.1722    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6097   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8472   -5.6011    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4347   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6722   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0847   -4.8866    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0847   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.9097   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3222   -7.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1472   -7.0301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.5597   -6.3156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.1472   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3222   -5.6011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8873   -4.8396    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1027   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -4.9972    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -5.8222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6737   -4.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9592   -4.9972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6737   -3.7597    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9592   -3.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -3.3472    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3882   -2.5222    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1027   -3.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 12 17  2  0  0  0  0\n  3 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  2  0  0  0  0\n 24 22  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 28 26  1  0  0  0  0\n 19 28  2  0  0  0  0\n 28  2  1  0  0  0  0\nM  END",
        "smiles": "CC(Cc1ccccc1)N(C)CCNc2nc3c(c(=O)n(C)c(=O)n3C)n2C",
        "formula": "C20H28N6O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "384.4761",
        "optical_activity": "( + / - )",
        "references": [
          "1a5f88f0-5e3c-47be-8567-ef4fd4173b9c",
          "e2ff3a79-79bb-4186-bc8d-cfd4f454c9d9"
        ],
        "stereo_centers": 1
      },
      "unii": "3AO7AC8C6K"
    }
  ]
}