{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5d8b167d-cf36-4368-9231-bef970b0b568",
          "code": "77-15-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=77-15-6",
          "code_system": "CAS",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4",
            "4595395f-007d-45b8-9add-0cf475e536ed"
          ]
        },
        {
          "uuid": "d4ec54d1-d67c-4e6f-b791-eaabec21d165",
          "code": "C76840",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C76840",
          "code_system": "NCI_THESAURUS",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "437f2b1a-381b-4cfa-8300-f5a3aad0c15c",
          "code": "C100067",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67100067",
          "code_system": "MESH",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "065a66a8-9f23-4800-842a-fecda73507ed",
          "code": "ETHOHEPTAZINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ethoheptazine",
          "code_system": "WIKIPEDIA",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "0c015873-19db-4bef-b0a2-a6dac6dd489e",
          "code": "SUB07280MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "18205725-ffed-42bd-93ae-e0611e5472fd",
          "code": "573",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=573",
          "code_system": "INN",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "2eebec27-2332-405a-b65b-c6b010fe5087",
          "code": "201-007-3",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.917",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "1e823adf-3bee-4814-80ef-dba0c3163c3e",
          "code": "24484",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/24484/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "1010ef1c-ea73-480f-9ca2-28afc16d61a6",
          "code": "m1138",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1138?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "6b8c732c-eec5-4b04-948b-ec929975dc18",
          "code": "CHEMBL170797",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL170797",
          "code_system": "ChEMBL",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "6d9f4a18-6e24-42c4-b1c3-3dfe4b5ec777",
          "code": "6469",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6469",
          "code_system": "PUBCHEM",
          "references": [
            "bf5778bb-6389-4d7f-aa05-b17ed54f93d4"
          ]
        },
        {
          "uuid": "940bbd29-0a07-22d7-7357-6cc15fa45de3",
          "code": "3326",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3326",
          "code_system": "HSDB",
          "references": [
            "6989f591-fb99-3a21-d2ce-4d63bce72208"
          ]
        },
        {
          "uuid": "f54ad63a-3f1a-99e8-8bce-e5dfac972f31",
          "code": "DTXSID7023017",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7023017",
          "code_system": "EPA CompTox",
          "references": [
            "06860eeb-6105-bed3-44f5-a778b9f3eec8"
          ]
        },
        {
          "uuid": "4d98e90e-dee9-b437-b868-d98bc53eecfe",
          "code": "C67413",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Opioid Receptor Agonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C67413",
          "code_system": "NCI_THESAURUS",
          "references": [
            "9eb57c0f-b19a-0a93-b328-09f5e1909030"
          ]
        },
        {
          "uuid": "f6ac63fb-0280-4147-a67a-9e945acb8c23",
          "code": "3A4G3A848U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "65b19b2e-b47e-b700-6e9f-b08b43dd5ab7",
          "code": "1085",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1085",
          "code_system": "DRUG CENTRAL",
          "references": [
            "9eb57c0f-b19a-0a93-b328-09f5e1909030"
          ]
        },
        {
          "uuid": "e380965d-c082-46a3-8bb2-e1f06df98b2e",
          "code": "DB08988",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB08988",
          "code_system": "DRUG BANK",
          "references": [
            "9eb57c0f-b19a-0a93-b328-09f5e1909030"
          ]
        },
        {
          "uuid": "ccf58a65-d41b-131b-b41a-2d5fa4d77bb0",
          "code": "100000082599",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "a7851b16-c287-5a70-1b50-59f7cb92c5f2"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "ccceea9c-f738-4f94-844e-acfa0fcdf924",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "864cd2c8-9b72-4a6d-a934-19aa6489a72c",
            "refuuid": "816dfd11-d80e-4b65-8069-6d910606a571",
            "name": "ETHOHEPTAZINE",
            "unii": "3A4G3A848U",
            "linking_id": "3A4G3A848U",
            "ref_pname": "ETHOHEPTAZINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "6ed3d8c7-fdce-44cd-8387-8d91a762b490",
          "name": "ETHOHEPTAZINE",
          "stdName": "ETHOHEPTAZINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b14d837-3116-4612-92f4-08e28f69f855",
            "e013389a-2ba7-4fcc-b515-eb409bb095f4",
            "2e07fbc9-f126-41ed-a54b-670f64fd1570",
            "5bf8fb1c-6b51-4c81-9cdb-eff77d4da2c1",
            "1f0faf71-91be-4fea-af14-219575852808",
            "d82d7bfd-fa26-4da5-8995-79714ee47e4f",
            "ebeef1b6-1e49-4931-a523-74a07cfd99d4",
            "007dcba5-6c00-4676-ac73-812b99741857",
            "9cedd9a1-8bbb-4e99-8747-6d1a01c057ac",
            "1eed1a1f-8eab-4122-a881-f4383c22d0d0",
            "334b379f-5140-4a62-a991-afe8987658d9",
            "f2dd180c-a1a1-4b96-bbc9-6516e9dfe879"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "a298cea9-2c2b-4929-9cca-3948f5c97103",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "cf55508d-0ec4-45af-8301-f726ca27f745",
          "name": "ETHOHEPTAZINE [HSDB]",
          "stdName": "ETHOHEPTAZINE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e013389a-2ba7-4fcc-b515-eb409bb095f4",
            "5bf8fb1c-6b51-4c81-9cdb-eff77d4da2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "c392c6f7-2345-4680-b6c3-1e9ce9b4c267",
          "name": "ETHOHEPTAZINE [MI]",
          "stdName": "ETHOHEPTAZINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "007dcba5-6c00-4676-ac73-812b99741857",
            "5bf8fb1c-6b51-4c81-9cdb-eff77d4da2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "6b6495bd-bd93-4bf4-b4d8-f4beacea9fc6",
          "name": "ETHOHEPTAZINE [VANDF]",
          "stdName": "ETHOHEPTAZINE [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d82d7bfd-fa26-4da5-8995-79714ee47e4f",
            "5bf8fb1c-6b51-4c81-9cdb-eff77d4da2c1"
          ],
          "display_name": false
        },
        {
          "uuid": "c9c7a6dd-ca82-303e-c350-f9079c0ad89d",
          "name": "Ethoheptazine [WHO-DD]",
          "stdName": "ETHOHEPTAZINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a0f4c777-9199-53b1-9ea5-96b78694455b"
          ],
          "display_name": false
        },
        {
          "uuid": "bd606968-d6e3-421b-afd8-e277b85338b4",
          "name": "ethoheptazine [INN]",
          "stdName": "ETHOHEPTAZINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5b14d837-3116-4612-92f4-08e28f69f855"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9a78fec5-a742-4929-bcc7-f9ac75455815",
          "citation": "STN 2007",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f2dd180c-a1a1-4b96-bbc9-6516e9dfe879",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "5b14d837-3116-4612-92f4-08e28f69f855",
          "citation": "INN Proposed List 5",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL05.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "007dcba5-6c00-4676-ac73-812b99741857",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5bf8fb1c-6b51-4c81-9cdb-eff77d4da2c1",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e013389a-2ba7-4fcc-b515-eb409bb095f4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f0faf71-91be-4fea-af14-219575852808",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d82d7bfd-fa26-4da5-8995-79714ee47e4f",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf5778bb-6389-4d7f-aa05-b17ed54f93d4",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9d5392ca-1aab-49e7-a2fe-34e00426ad72",
          "citation": "SRS import [3A4G3A848U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3A4G3A848U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390980000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ebeef1b6-1e49-4931-a523-74a07cfd99d4",
          "citation": "ETHOHEPTAZINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9cedd9a1-8bbb-4e99-8747-6d1a01c057ac",
          "citation": "ETHOHEPTAZINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "334b379f-5140-4a62-a991-afe8987658d9",
          "citation": "ETHOHEPTAZINE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1eed1a1f-8eab-4122-a881-f4383c22d0d0",
          "citation": "ETHOHEPTAZINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "2e07fbc9-f126-41ed-a54b-670f64fd1570",
          "citation": "ETHOHEPTAZINE [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6989f591-fb99-3a21-d2ce-4d63bce72208",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+77-15-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "06860eeb-6105-bed3-44f5-a778b9f3eec8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=77-15-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "a7851b16-c287-5a70-1b50-59f7cb92c5f2",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "9eb57c0f-b19a-0a93-b328-09f5e1909030",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "4595395f-007d-45b8-9add-0cf475e536ed",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "a0f4c777-9199-53b1-9ea5-96b78694455b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "0fbd74a5-4949-4485-83e1-89fb026d78a3",
          "id": "0fbd74a5-4949-4485-83e1-89fb026d78a3",
          "molfile": "\n  Marvin  01132101032D          \n\n 19 20  0  0  0  0            999 V2000\n    8.3368   -3.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5952   -4.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8218   -3.8869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0484   -4.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0484   -4.9854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2670   -3.4110    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.8506   -4.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1883   -4.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5774   -4.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4070   -3.3872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5899   -3.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9582   -2.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7832   -2.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9492   -2.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6988   -3.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4087   -2.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3929   -2.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6393   -1.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9571   -2.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  4  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  6 14  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 19 14  2  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\nM  END",
          "smiles": "CCOC(=O)C1(CCCN(C)CC1)c2ccccc2",
          "formula": "C16H23NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "4069f8f0-b455-41d7-9b6f-741d7cb34b1c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "261.3599",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "816dfd11-d80e-4b65-8069-6d910606a571",
      "version": "13",
      "structure": {
        "id": "36762709-6776-4379-8463-c74b1805220b",
        "molfile": "\n  Marvin  01132102542D          \n\n 19 20  0  0  0  0            999 V2000\n    5.2670   -3.4110    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0484   -4.2121    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7832   -2.7565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4070   -3.3872    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9492   -2.9905    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0484   -4.9854    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9582   -2.7604    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8218   -3.8869    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8506   -4.2279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5774   -4.1725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5899   -3.2087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1883   -4.4500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9571   -2.1457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6988   -3.3713    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5952   -4.2438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3368   -3.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4087   -2.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6393   -1.7214    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3929   -2.1140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  7  1  0  0  0  0\n  1  5  1  0  0  0  0\n  6  2  2  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  1  0  0  0  0\n  9  1  1  0  0  0  0\n 10 12  1  0  0  0  0\n 11  4  1  0  0  0  0\n 12  9  1  0  0  0  0\n 13  5  2  0  0  0  0\n 14  5  1  0  0  0  0\n 15  8  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 14  2  0  0  0  0\n 18 13  1  0  0  0  0\n 19 17  1  0  0  0  0\n 10  4  1  0  0  0  0\n 19 18  2  0  0  0  0\nM  END",
        "smiles": "CCOC(=O)C1(CCCN(C)CC1)c2ccccc2",
        "formula": "C16H23NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "261.3599",
        "optical_activity": "( + / - )",
        "references": [
          "9d5392ca-1aab-49e7-a2fe-34e00426ad72",
          "f2dd180c-a1a1-4b96-bbc9-6516e9dfe879",
          "5b14d837-3116-4612-92f4-08e28f69f855"
        ],
        "stereo_centers": 1
      },
      "unii": "3A4G3A848U"
    }
  ]
}