{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "51ac8b4d-34fb-4ea6-8274-a0d3430aa6cb",
          "code": "365411-50-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=365411-50-3",
          "code_system": "CAS",
          "references": [
            "6efdf2fd-01bd-40f9-a6dd-c10e9acfd10c",
            "ca9784ce-9ff8-4925-8ea4-1aaeddcbf360"
          ]
        },
        {
          "uuid": "3e7b8a5e-9cb5-4d47-ad8b-b252ac40d907",
          "code": "15552386",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/15552386",
          "code_system": "PUBCHEM",
          "references": [
            "6efdf2fd-01bd-40f9-a6dd-c10e9acfd10c"
          ]
        },
        {
          "uuid": "83e29660-20d2-4ea9-a24c-93b31d383853",
          "code": "3A152H3F7R",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "f69648d3-b64c-506a-186b-e31180973e0a",
          "code": "DTXSID80889173",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80889173",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a6c9e894-1c93-4d35-b538-6f782d1ddf47",
          "name": "INDENO(4,5-D)-1,3-DIOXIN, 4,4A,5,6,7,8,9,9B-OCTAHYDRO-7,7,8,9,9-PENTAMETHYL-",
          "stdName": "INDENO(4,5-D)-1,3-DIOXIN, 4,4A,5,6,7,8,9,9B-OCTAHYDRO-7,7,8,9,9-PENTAMETHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73f61291-09b0-4fd9-8e0e-686071f064f9",
            "a86ec08f-bb81-4d35-b857-faa6fe81aa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "d55feb25-00a0-4d66-97db-9583550fdb25",
          "name": "NEBULONE",
          "stdName": "NEBULONE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9e31b08f-e8b2-4c72-b0b6-531c60463c7a",
            "a86ec08f-bb81-4d35-b857-faa6fe81aa1c"
          ],
          "display_name": false
        },
        {
          "uuid": "ef68cf47-4bc4-4d93-8d74-185d59c9f57c",
          "name": "PENTAMETHYL OCTAHYDROINDENODIOXANE",
          "stdName": "PENTAMETHYL OCTAHYDROINDENODIOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67574f11-2c4e-4c3c-a189-c32d618f0adf",
            "9e31b08f-e8b2-4c72-b0b6-531c60463c7a",
            "a86ec08f-bb81-4d35-b857-faa6fe81aa1c"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "cc57bf5c-3808-4391-9d94-85c2f6e9fa20",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "9e31b08f-e8b2-4c72-b0b6-531c60463c7a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a86ec08f-bb81-4d35-b857-faa6fe81aa1c",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73f61291-09b0-4fd9-8e0e-686071f064f9",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6efdf2fd-01bd-40f9-a6dd-c10e9acfd10c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b2edd2b8-a004-4a4f-8a9f-3d20d042afbe",
          "citation": "SRS import [3A152H3F7R]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3A152H3F7R",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390707000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f264bf83-001f-4e14-91b5-fc62b5571b9d",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67574f11-2c4e-4c3c-a189-c32d618f0adf",
          "citation": "PENTAMETHYL OCTAHYDROINDENODIOXANE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ca9784ce-9ff8-4925-8ea4-1aaeddcbf360",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9b3689df-3cc7-45c3-aed4-eb0b18e2e7c7",
          "id": "9b3689df-3cc7-45c3-aed4-eb0b18e2e7c7",
          "molfile": "\n  Marvin  01132108042D          \n\n 18 20  0  0  0  0            999 V2000\n    9.0997   -6.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2747   -6.2657    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.7898   -6.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0033   -7.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6009   -7.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0052   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0052   -5.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2908   -5.4406    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    6.2908   -4.6156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5763   -4.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8618   -4.6156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8618   -5.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5763   -5.8531    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    5.5763   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2908   -7.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7899   -5.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0034   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6011   -5.4479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n 16  2  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  1  0  0  0  0\n  6  3  1  0  0  0  0\n  6  7  2  0  0  0  0\n 15  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  1  0  0  0  0\nM  END",
          "smiles": "CC1C(C)(C)C2=C(C3C(CC2)COCO3)C1(C)C",
          "formula": "C16H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9dfe7287-032e-494a-80cf-821227fd67ef"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "250.377",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "3055a80b-fe05-4a6a-854b-3401f455cc25",
      "version": "4",
      "structure": {
        "id": "62284ef4-0896-4083-a817-27ed47fc4e6a",
        "molfile": "\n  Marvin  01132105052D          \n\n 18 20  0  0  0  0            999 V2000\n    5.5763   -5.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5763   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2908   -7.0907    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0052   -6.6781    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0052   -5.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2908   -5.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2908   -4.6156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5763   -4.2031    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8618   -4.6156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8618   -5.4406    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7898   -6.9331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7899   -5.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2747   -6.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0034   -4.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6011   -5.4479    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0997   -6.2657    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0033   -7.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6009   -7.0834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  5  6  1  0  0  0  0\n  4  5  2  0  0  0  0\n  3  4  1  0  0  0  0\n  2  3  1  0  0  0  0\n  1  2  1  0  0  0  0\n  1  6  1  0  0  0  0\n  9 10  1  0  0  0  0\n  8  9  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1 10  1  0  0  0  0\n 13 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n  4 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n 12 14  1  0  0  0  0\n 12 15  1  0  0  0  0\n 13 16  1  0  0  0  0\n 11 17  1  0  0  0  0\n 11 18  1  0  0  0  0\nM  END",
        "smiles": "CC1C(C)(C)C2=C(C3C(CC2)COCO3)C1(C)C",
        "formula": "C16H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "250.377",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "b2edd2b8-a004-4a4f-8a9f-3d20d042afbe",
          "f264bf83-001f-4e14-91b5-fc62b5571b9d"
        ],
        "stereo_centers": 3
      },
      "unii": "3A152H3F7R"
    }
  ]
}