{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "187848f7-3ac2-4618-90a6-b278cfc8df6a",
          "code": "49557-75-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=49557-75-7",
          "code_system": "CAS",
          "references": [
            "5238b644-7bb1-4717-a3ad-6ede2e5d3f18",
            "47eab8c2-bae0-4583-a7ce-aec0cfc3e1dc"
          ]
        },
        {
          "uuid": "f76bf539-9709-4371-a002-83debe6f7f59",
          "code": "1368533",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1368533/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5238b644-7bb1-4717-a3ad-6ede2e5d3f18"
          ]
        },
        {
          "uuid": "196a5642-8987-4d48-b9f5-c7723e523e74",
          "code": "m5722",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5722?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5238b644-7bb1-4717-a3ad-6ede2e5d3f18"
          ]
        },
        {
          "uuid": "e3dc2c9a-3387-49f6-8ffb-3107ab8e4c2f",
          "code": "73587",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73587",
          "code_system": "PUBCHEM",
          "references": [
            "5238b644-7bb1-4717-a3ad-6ede2e5d3f18"
          ]
        },
        {
          "uuid": "a71b287b-6683-6ebb-e171-c223a7c6210a",
          "code": "DTXSID30197831",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID30197831",
          "code_system": "EPA CompTox",
          "references": [
            "b441d16d-0653-702c-aa7a-02368e6561e8"
          ]
        },
        {
          "uuid": "7e4c0502-5b66-7358-9e26-463e6aa8a462",
          "code": "DB11296",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB11296",
          "code_system": "DRUG BANK",
          "references": [
            "1309a110-860d-43f7-96ba-76c24c4706f9"
          ]
        },
        {
          "uuid": "adcb5253-be36-41ac-87c2-9e6b7452566c",
          "code": "39TG2H631E",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d2b77e8c-dad8-a082-03ed-26860697f122",
          "code": "75430",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75430",
          "code_system": "CHEBI",
          "references": [
            "1309a110-860d-43f7-96ba-76c24c4706f9"
          ]
        },
        {
          "uuid": "bef3981c-9eb7-1213-6656-5339387f0a3c",
          "code": "Copper peptide GHK-Cu",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Copper_peptide_GHK-Cu",
          "code_system": "WIKIPEDIA",
          "references": [
            "92cc043e-ceb3-53da-c8a9-2acffd71a349"
          ]
        },
        {
          "uuid": "83fb12ef-a8f9-1b96-e46a-8fca80a8b3bd",
          "code": "39TG2H631E",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=39TG2H631E",
          "code_system": "DAILYMED",
          "references": [
            "87023db1-76b4-f409-cc0a-bf3c6cd18c31"
          ]
        },
        {
          "uuid": "1e196d34-b67d-d683-4967-9da77aa0b8ad",
          "code": "379527",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=379527",
          "code_system": "NSC",
          "references": [
            "f449e5f0-b34e-de74-17cd-37c303a9e6f0"
          ]
        },
        {
          "uuid": "d00348aa-397b-bfad-a911-85cbda7f394f",
          "code": "300000053816",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "f087fbce-c812-a3fb-08c3-f653a293caa4"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "07d86013-04c2-427b-9bed-9a8344208a13",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "5abf56d6-b195-47df-9dc8-e3bb9f169285",
            "refuuid": "6cc2dc36-e77a-4034-9483-3e4387a9ac4d",
            "name": "PREZATIDE",
            "unii": "39TG2H631E",
            "linking_id": "39TG2H631E",
            "ref_pname": "PREZATIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "4e6d8359-9aed-4c8e-8395-33459c837da2",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "8e7d2f3a-cc91-49a5-a46e-1426b2990d75",
            "refuuid": "63d90537-8bc7-4f27-970a-60eab6009eb1",
            "name": "PREZATIDE COPPER",
            "unii": "6BJQ43T1I9",
            "linking_id": "6BJQ43T1I9",
            "ref_pname": "PREZATIDE COPPER",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "6facfaa0-c73d-46da-886f-e8300d6de2dd",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "a32610fb-3dac-4ee6-a004-57397b7e0d37",
            "refuuid": "00e8c670-95ba-41fa-82c7-fda008ff8128",
            "name": "PREZATIDE COPPER ACETATE",
            "unii": "A3LEI4P1NB",
            "linking_id": "A3LEI4P1NB",
            "ref_pname": "PREZATIDE COPPER ACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0221bc49-ed17-492b-911f-64b438478be8",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "ef2d425f-8c09-4d0d-909f-07f6aacec4c3",
            "refuuid": "9bf3cabd-24b6-474c-9d47-d05876f65929",
            "name": "PREZATIDE MONOACETATE",
            "unii": "8AA809EUS9",
            "linking_id": "8AA809EUS9",
            "ref_pname": "PREZATIDE MONOACETATE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "ef93f708-18c4-4b68-bbe4-9ec3e22956c9",
          "type": "SUBSTANCE->SUB_ALTERNATE",
          "related_substance": {
            "uuid": "5c46ec83-fb32-471c-a26d-8bd7ad53dbd3",
            "refuuid": "21602a9d-9edb-4666-a453-09b1b5677f9d",
            "name": "ALTERNATIVE DEFINITION for [PREZATIDE]",
            "linking_id": "21602a9d-9edb-4666-a453-09b1b5677f9d",
            "ref_pname": "NO NAME"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c48a57e8-b35b-4009-ba86-037c735ada39",
          "name": "C.P.P.",
          "stdName": "C.P.P.",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35680c38-1ae2-4025-a88d-4d59768799ff",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "6c3928c8-3098-49e9-8388-cb1d138acab6",
          "name": "GHK [MI]",
          "stdName": "GHK [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb8e44c7-b00c-41be-9c5e-e2d1ba404973",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "af834a7a-3ac2-4c07-bd67-c1e3d5a2d404",
          "name": "GLY-HIS-LYS-OH",
          "stdName": "GLY-HIS-LYS-OH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b74945d5-49b8-4093-9321-e6dcd78b0d4e",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "38353932-bb94-4b2a-a80e-2a67cb81bc44",
          "name": "GLYCYL-L-HISTIDYL-L-LYSINE",
          "stdName": "GLYCYL-L-HISTIDYL-L-LYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "03d92883-bd59-4887-af63-9593e3d1f92d",
          "name": "GLYCYLHISTIDYLLYSINE",
          "stdName": "GLYCYLHISTIDYLLYSINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "272ab103-44b8-4769-90ac-90bf96c6c479",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "7c556ecd-8559-43f3-948c-44ee25b2ad59",
          "name": "GROWTH-MODULATING PEPTIDE (HUMAN)",
          "stdName": "GROWTH-MODULATING PEPTIDE (HUMAN)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "4c662f30-c462-44cc-8fe5-13854616db8e",
          "name": "KOLLAREN",
          "stdName": "KOLLAREN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "f972608e-a734-499f-85e4-fefe77b411bb",
          "name": "L-LYSINE, GLYCYL-L-HISTIDYL-",
          "stdName": "L-LYSINE, GLYCYL-L-HISTIDYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "f8eb60bd-d7ab-4b2f-b186-f0f9bbbf2abb",
          "name": "LIVER CELL GROWTH FACTOR",
          "stdName": "LIVER CELL GROWTH FACTOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "2b637079-11f2-408a-81a5-527980c2ab31",
          "name": "NSC-379527",
          "stdName": "NSC-379527",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "a200b9a4-ce60-4dd3-96c1-9ab0a93abfcc",
          "name": "ORISTAR GHK",
          "stdName": "ORISTAR GHK",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "35680c38-1ae2-4025-a88d-4d59768799ff",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "4c644019-a2d6-4360-adc2-d33e8c287cde",
          "name": "PC-1020 FREE BASE",
          "stdName": "PC-1020 FREE BASE",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "06112c39-e96c-4e18-9c3e-a4e934b97b7c",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": false
        },
        {
          "uuid": "cf4ee7aa-15bf-4f21-9b2a-87914abc900f",
          "name": "PREZATIDE",
          "stdName": "PREZATIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
            "ee42948e-8605-441d-8e07-9d401b740b14"
          ],
          "display_name": true
        },
        {
          "uuid": "1070a4ad-6b00-4650-a18c-e90f32f1a573",
          "name": "TRIPEPTIDE-1",
          "stdName": "TRIPEPTIDE-1",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "35680c38-1ae2-4025-a88d-4d59768799ff",
            "fc360fa5-0833-49fd-92bf-c258b7935bfb",
            "ee42948e-8605-441d-8e07-9d401b740b14",
            "f22e13cd-49a5-4fce-aed7-048ad1b0a76a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ada487e8-52d7-49c5-9df9-05d5db671e64",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "f22e13cd-49a5-4fce-aed7-048ad1b0a76a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "ee42948e-8605-441d-8e07-9d401b740b14",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b74945d5-49b8-4093-9321-e6dcd78b0d4e",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a6e8dedb-11c1-47b1-a567-3329ae92e7ba",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "35680c38-1ae2-4025-a88d-4d59768799ff",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "272ab103-44b8-4769-90ac-90bf96c6c479",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb8e44c7-b00c-41be-9c5e-e2d1ba404973",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "06112c39-e96c-4e18-9c3e-a4e934b97b7c",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5238b644-7bb1-4717-a3ad-6ede2e5d3f18",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bf5ffb54-23bd-4009-be93-f6b3ecf64ec3",
          "citation": "SRS import [39TG2H631E]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=39TG2H631E",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390858000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fc360fa5-0833-49fd-92bf-c258b7935bfb",
          "citation": "TRIPEPTIDE-1 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b441d16d-0653-702c-aa7a-02368e6561e8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=49557-75-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "92cc043e-ceb3-53da-c8a9-2acffd71a349",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "47eab8c2-bae0-4583-a7ce-aec0cfc3e1dc",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "1309a110-860d-43f7-96ba-76c24c4706f9",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "f449e5f0-b34e-de74-17cd-37c303a9e6f0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "87023db1-76b4-f409-cc0a-bf3c6cd18c31",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "f087fbce-c812-a3fb-08c3-f653a293caa4",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "417d4e22-41a6-362c-29f3-8ec72a1c05fa",
          "id": "417d4e22-41a6-362c-29f3-8ec72a1c05fa",
          "molfile": "\n  Marvin  01132103272D          \n\n 24 24  0  0  1  0            999 V2000\n   14.8089   -2.4749    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.9523   -2.0624    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8089   -3.2999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -4.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9523   -3.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9523   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6667   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6667   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3812   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0957   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8101   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5246   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0944   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3799   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6261   -2.1394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0742   -2.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -3.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2937   -3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  1  0  0  0\n  1  8  1  0  0  0  0\n  1 19  1  0  0  0  0\n 10  2  1  0  0  0  0\n  2 11  1  6  0  0  0\n  2 14  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 20 24  2  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\nM  END",
          "smiles": "C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CN",
          "formula": "C14H24N6O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d1284f0e-f234-4cd0-987d-d6ca51bbc60d"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "340.3787",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6cc2dc36-e77a-4034-9483-3e4387a9ac4d",
      "version": "14",
      "structure": {
        "id": "05490f5f-280b-4acf-afdc-c6f5c758a85f",
        "molfile": "PREZATIDE MONOACETATE\n  Marvin  01132100342D          \n\n 24 24  0  0  1  0            999 V2000\n   14.8089   -2.4749    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   16.9523   -2.0624    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   14.8089   -3.2999    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -3.7124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -4.5374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -3.2999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9523   -3.7124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.5233   -1.2374    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9523   -1.2374    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.2378   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6667   -0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.6667   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.3812   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.0957   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.8101   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.5246   -2.4749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   14.0944   -2.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.3799   -2.4749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.6261   -2.1394    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.0742   -2.7525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.4868   -3.4670    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2937   -3.2954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  1  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  1  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n 10  2  1  0  0  0  0\n  8 10  1  0  0  0  0\n  2 11  1  6  0  0  0\n 11 12  2  0  0  0  0\n 11 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n  1 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  1  0  0  0  0\n 20 24  2  0  0  0  0\nM  END",
        "smiles": "C(CCN)C[C@@H](C(=O)O)NC(=O)[C@H](Cc1c[nH]cn1)NC(=O)CN",
        "formula": "C14H24N6O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "340.3787",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "bf5ffb54-23bd-4009-be93-f6b3ecf64ec3",
          "f22e13cd-49a5-4fce-aed7-048ad1b0a76a"
        ],
        "stereo_centers": 2
      },
      "unii": "39TG2H631E"
    }
  ]
}