{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0cd285bb-e03c-44bd-baf1-ffac4afad8a6",
          "code": "56425-91-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=56425-91-3",
          "code_system": "CAS",
          "references": [
            "2943a1ba-2a2f-4908-86ed-31d8a5a19623",
            "47fa0fb7-7a09-4431-acef-3fd3bf07f8f7"
          ]
        },
        {
          "uuid": "b83fa8dc-7dfe-435e-832c-447101f4983d",
          "code": "m5504",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5504?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "2943a1ba-2a2f-4908-86ed-31d8a5a19623"
          ]
        },
        {
          "uuid": "0f8e5d39-bc25-47fa-ab12-5e34a57f57b7",
          "code": "73668",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/73668",
          "code_system": "PUBCHEM",
          "references": [
            "2943a1ba-2a2f-4908-86ed-31d8a5a19623"
          ]
        },
        {
          "uuid": "38372cc9-8bdb-fb98-2867-f469437f593c",
          "code": "DTXSID3024108",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3024108",
          "code_system": "EPA CompTox",
          "references": [
            "409aab50-67c7-42fd-397b-791627820d00"
          ]
        },
        {
          "uuid": "8e8eaec9-bbd8-4cc0-8b86-e609c65d7dfe",
          "code": "39B8QWM1Y2",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "e5aa1b71-8c34-8849-8d86-c955cf6dcb50",
          "code": "flurprimidol",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/flurprimidol.html",
          "code_system": "ALANWOOD",
          "references": [
            "bd0514d8-9352-3a23-4f89-456bd47c025e"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "97997e25-05f7-4bb6-a091-9770ced31c82",
          "name": "(RS)-2-METHYL-1-PYRIMIDIN-5-YL-1-(4-TRIFLUOROMETHOXYPHENYL)PROPAN-1-OL",
          "stdName": "(RS)-2-METHYL-1-PYRIMIDIN-5-YL-1-(4-TRIFLUOROMETHOXYPHENYL)PROPAN-1-OL",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "511c0451-3e88-44b1-ac95-e856ffadec6f",
            "5af248b8-0c03-429e-af56-cb0ec18acdce"
          ],
          "display_name": false
        },
        {
          "uuid": "1bbb31c8-f416-4ae2-a614-14b44d407b96",
          "name": "CUTLESS",
          "stdName": "CUTLESS",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "824ef507-c549-4869-b8a0-3ee70706c6e1",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        },
        {
          "uuid": "ee5eb95f-6305-4fbe-a8c6-f38900983063",
          "name": "EL-500",
          "stdName": "EL-500",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "824ef507-c549-4869-b8a0-3ee70706c6e1",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        },
        {
          "uuid": "ed7bc3ac-9709-4a00-a29b-6a9779767c92",
          "name": "FLURPRIMIDOL",
          "stdName": "FLURPRIMIDOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae76803e-f0d8-4098-bc3b-d128d2322e97",
            "a9ef329b-dc09-4e93-b6a3-d8e0c0aac4a4",
            "eb40cafc-f6b3-41b5-8d6f-c4fa31dafb34",
            "511c0451-3e88-44b1-ac95-e856ffadec6f",
            "ca9f3f95-f3cb-4063-be82-34fd78af0d63",
            "5068f14e-8e46-4a4b-a0a4-9bd9f09a4f86"
          ],
          "display_name": true
        },
        {
          "uuid": "910c265b-10a1-47d5-b753-4961279db202",
          "name": "FLURPRIMIDOL [ISO]",
          "stdName": "FLURPRIMIDOL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9ef329b-dc09-4e93-b6a3-d8e0c0aac4a4",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        },
        {
          "uuid": "a5b30fd2-5bf4-4062-83c8-ae84ee2af0ad",
          "name": "FLURPRIMIDOL [MI]",
          "stdName": "FLURPRIMIDOL [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eb40cafc-f6b3-41b5-8d6f-c4fa31dafb34",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        },
        {
          "uuid": "e1acd82e-31f8-4d27-9ec1-61e3302e43db",
          "name": "FLURPRIMIDOL, (±)-",
          "stdName": "FLURPRIMIDOL, (+/-)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2335f601-7fd5-4484-95a5-79695c7969b5",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        },
        {
          "uuid": "9d478ebc-c3fb-4df0-9269-c600e9e5e650",
          "name": "TOPFLOR",
          "stdName": "TOPFLOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "824ef507-c549-4869-b8a0-3ee70706c6e1",
            "511c0451-3e88-44b1-ac95-e856ffadec6f"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "5af248b8-0c03-429e-af56-cb0ec18acdce",
          "citation": "http://www.alanwood.net/pesticides/flurprimidol.html",
          "url": "http://www.alanwood.net/pesticides/flurprimidol.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "511c0451-3e88-44b1-ac95-e856ffadec6f",
          "citation": "ALANWOOD",
          "doc_type": "ALANWOOD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae76803e-f0d8-4098-bc3b-d128d2322e97",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a9ef329b-dc09-4e93-b6a3-d8e0c0aac4a4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "824ef507-c549-4869-b8a0-3ee70706c6e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2335f601-7fd5-4484-95a5-79695c7969b5",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "eb40cafc-f6b3-41b5-8d6f-c4fa31dafb34",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2943a1ba-2a2f-4908-86ed-31d8a5a19623",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fcea900-b044-473d-89ae-804d803b9b1a",
          "citation": "SRS import [39B8QWM1Y2]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=39B8QWM1Y2",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392095000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ca9f3f95-f3cb-4063-be82-34fd78af0d63",
          "citation": "FLURPRIMIDOL [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "5068f14e-8e46-4a4b-a0a4-9bd9f09a4f86",
          "citation": "FLURPRIMIDOL [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "409aab50-67c7-42fd-397b-791627820d00",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=56425-91-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "bd0514d8-9352-3a23-4f89-456bd47c025e",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "47fa0fb7-7a09-4431-acef-3fd3bf07f8f7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "47052846-10d9-4309-9e2c-e94897edcdb5",
          "id": "47052846-10d9-4309-9e2c-e94897edcdb5",
          "molfile": "\n  Marvin  01132103442D          \n\n 22 23  0  0  0  0            999 V2000\n    5.1482   -2.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4365   -1.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7178   -2.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4365   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    4.4365    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6073   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2064   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3702   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9487   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1333   -0.8362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7187   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3041   -2.2666    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4374   -1.9626    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.1333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3702   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2064   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2589   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6734   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5027   -1.5410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9104   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5027   -0.1174    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6734   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  4 17  1  0  0  0  0\n  6  7  1  0  0  0  0\n  6 16  2  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  9 15  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 11 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 18  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 20  2  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "CC(C)C(c1ccc(cc1)OC(F)(F)F)(c2cncnc2)O",
          "formula": "C15H15F3N2O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "540e6217-005e-469a-85db-7eccd65b9719"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "312.2876",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8c225a08-eae6-4b5f-a02f-a0833572fcfe",
      "version": "4",
      "structure": {
        "id": "4706f403-6fb7-4b86-b1e3-fa913caf13b3",
        "molfile": "\n  Marvin  01132103442D          \n\n 22 23  0  0  0  0            999 V2000\n    4.4365   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7187   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2589   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6073   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1333   -0.8362    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5027   -0.1174    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5027   -1.5410    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9104   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2064   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2064   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3041   -2.2666    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4374   -1.9626    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -1.1333    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4365   -1.6585    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9487   -0.8362    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4365    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6734   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6734   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3702   -0.1174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3702   -1.5410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1482   -2.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7178   -2.0731    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  1 14  1  0  0  0  0\n  1 16  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2 11  1  0  0  0  0\n  2 12  1  0  0  0  0\n  2 13  1  0  0  0  0\n  3 17  2  0  0  0  0\n  3 18  1  0  0  0  0\n  4  9  1  0  0  0  0\n  4 10  2  0  0  0  0\n  5 15  1  0  0  0  0\n  6 18  2  0  0  0  0\n  6  8  1  0  0  0  0\n  7 17  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9 20  2  0  0  0  0\n 10 19  1  0  0  0  0\n 14 21  1  0  0  0  0\n 14 22  1  0  0  0  0\n 15 19  2  0  0  0  0\n 15 20  1  0  0  0  0\nM  END",
        "smiles": "CC(C)C(c1ccc(cc1)OC(F)(F)F)(c2cncnc2)O",
        "formula": "C15H15F3N2O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "312.2876",
        "optical_activity": "( + / - )",
        "references": [
          "ae76803e-f0d8-4098-bc3b-d128d2322e97",
          "6fcea900-b044-473d-89ae-804d803b9b1a"
        ],
        "stereo_centers": 1
      },
      "unii": "39B8QWM1Y2"
    }
  ]
}