{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ec39f933-04c4-4149-a6cc-a2c24818c5e7", "code": "2140-76-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=2140-76-3", "code_system": "CAS", "references": [ "bad60f28-0054-4ec8-9804-0858775344af", "99727d2a-0c18-407d-b812-5989f76cc2a7" ] }, { "uuid": "276ee211-9ffb-47a3-a733-81ba3e1bdb45", "code": "102212", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/102212", "code_system": "PUBCHEM", "references": [ "bad60f28-0054-4ec8-9804-0858775344af" ] }, { "uuid": "4cb65ac4-8a6b-417b-900a-b0feec4e2e83", "code": "399VZB6TMB", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "f4f8abc5-aeb4-2534-81b7-a439366e1b96", "code": "19227", "type": "PRIMARY", "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:19227", "code_system": "CHEBI", "references": [ "51ecbf95-88b4-7c81-a89f-c01f2a088ed0" ] }, { "uuid": "2bef3d7b-2f93-b904-baee-10d16b25551a", "code": "DTXSID10943959", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID10943959", "code_system": "EPA CompTox", "references": [ "6d18bed2-4f4f-addf-e2da-458eecd3e9ac" ] } ], "substance_class": "chemical", "names": [ { "uuid": "792dbe0e-57ee-4292-8c35-4804cd34a55c", "name": "2'-O-METHYLURIDINE", "stdName": "2'-O-METHYLURIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7944604c-bc32-48d1-99b5-5c924800806b", "15b7a3af-754b-453f-a6e9-9f69a509317f" ], "display_name": true }, { "uuid": "2826eefa-063b-40f1-af0c-ac8abfad0860", "name": "O2'-METHYLURIDINE", "stdName": "O2'-METHYLURIDINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7944604c-bc32-48d1-99b5-5c924800806b", "15b7a3af-754b-453f-a6e9-9f69a509317f" ], "display_name": false }, { "uuid": "3f3b1df4-8d29-4fa2-9260-6801e0060943", "name": "URIDINE, 2'-O-METHYL-", "stdName": "URIDINE, 2'-O-METHYL-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "7944604c-bc32-48d1-99b5-5c924800806b", "15b7a3af-754b-453f-a6e9-9f69a509317f" ], "display_name": false } ], "references": [ { "uuid": "7944604c-bc32-48d1-99b5-5c924800806b", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "15b7a3af-754b-453f-a6e9-9f69a509317f", "citation": "STN (SCIFINDER)", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "bad60f28-0054-4ec8-9804-0858775344af", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393163000, "tags": [ "NOMEN" ] }, { "uuid": "49b3fa6a-072d-4979-a561-81d329cb72c1", "citation": "SRS import [399VZB6TMB]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=399VZB6TMB", "doc_type": "SRS", "public_domain": true, "document_date": 1493393163000, "tags": [ "NOMEN" ] }, { "uuid": "51ecbf95-88b4-7c81-a89f-c01f2a088ed0", "doc_type": "SYSTEM", "public_domain": true }, { "uuid": "99727d2a-0c18-407d-b812-5989f76cc2a7", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true }, { "uuid": "6d18bed2-4f4f-addf-e2da-458eecd3e9ac", "citation": "EPA CompTox", "doc_type": "EPA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "d60f8dd3-d1bc-4c27-a87a-37c1d81a4b8d", "id": "d60f8dd3-d1bc-4c27-a87a-37c1d81a4b8d", "molfile": "\n Marvin 01132111052D \n\n 18 19 0 0 1 0 999 V2000\n 13.4904 -7.3152 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.9903 -7.9715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6719 -8.7326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7276 -6.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0494 -6.0553 0.0000 C 0 0 1 0 0 0 0 0 0 1 0 0\n 13.0308 -5.2305 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7357 -4.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7171 -3.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9935 -3.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9749 -2.7561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2885 -4.0094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3072 -4.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6022 -5.2628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3931 -6.5551 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 11.6029 -6.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0024 -6.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6656 -7.3338 0.0000 C 0 0 2 0 0 0 0 0 0 1 0 0\n 12.1960 -8.0120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 6 0 0 0\n 1 4 1 0 0 0 0\n 1 17 1 0 0 0 0\n 3 2 1 0 0 0 0\n 5 4 1 6 0 0 0\n 5 6 1 0 0 0 0\n 14 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 6 12 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 14 15 1 1 0 0 0\n 17 14 1 0 0 0 0\n 15 16 1 0 0 0 0\n 17 18 1 1 0 0 0\nM END", "smiles": "CO[C@@H]1[C@@H]([C@@H](CO)O[C@H]1n2ccc(=O)[nH]c2=O)O", "formula": "C10H14N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "b42e66c2-a00d-49ec-956a-0193f86cd807" }, "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "258.2284", "optical_activity": "UNSPECIFIED", "stereo_centers": 4 } ], "definition_level": "COMPLETE", "uuid": "f6c1e121-9a1e-4ed9-8842-e2cbf2565887", "version": "6", "structure": { "id": "1700b191-c7e2-4c3a-bf2a-968cd578c5e0", "molfile": "\n Marvin 01132101232D \n\n 18 19 0 0 1 0 999 V2000\n 13.6719 -8.7326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.9903 -7.9715 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.4904 -7.3152 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.7276 -6.5250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.0494 -6.0553 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0\n 13.0308 -5.2305 0.0000 N 0 0 2 0 0 0 0 0 0 0 0 0\n 13.7357 -4.8020 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.7171 -3.9772 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9935 -3.5809 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9749 -2.7561 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.2885 -4.0094 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3072 -4.8342 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.6022 -5.2628 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.3931 -6.5551 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 11.6029 -6.3180 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.6656 -7.3338 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0\n 12.1960 -8.0120 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.0024 -6.8837 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 3 2 1 6 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 6 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 9 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 6 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 5 14 1 0 0 0 0\n 14 15 1 1 0 0 0\n 14 16 1 0 0 0 0\n 3 16 1 0 0 0 0\n 16 17 1 1 0 0 0\n 15 18 1 0 0 0 0\nM END", "smiles": "CO[C@@H]1[C@@H]([C@@H](CO)O[C@H]1n2ccc(=O)[nH]c2=O)O", "formula": "C10H14N2O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ABSOLUTE", "defined_stereo": 4, "ez_centers": 0, "molecular_weight": "258.2284", "optical_activity": "UNSPECIFIED", "references": [ "7944604c-bc32-48d1-99b5-5c924800806b", "49b3fa6a-072d-4979-a561-81d329cb72c1" ], "stereo_centers": 4 }, "unii": "399VZB6TMB" } ] }