{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "d24cc1e3-075f-4f75-8b83-f0f7ed247a90",
          "code": "139528-85-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=139528-85-1",
          "code_system": "CAS",
          "references": [
            "100c0b71-b569-4d7e-a322-f9ec8dc52a5c",
            "ddafcb31-d2d5-41fd-b969-0ef4efce9feb"
          ]
        },
        {
          "uuid": "db532648-d687-4959-8b00-6ac7c2a3289c",
          "code": "86422",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/86422",
          "code_system": "PUBCHEM",
          "references": [
            "100c0b71-b569-4d7e-a322-f9ec8dc52a5c"
          ]
        },
        {
          "uuid": "336d7d29-658e-49b6-a9a3-46b4efe83355",
          "code": "DTXSID9047544",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9047544",
          "code_system": "EPA CompTox",
          "references": [
            "635eae65-6b6d-1557-c6e1-47ca40cfd6ec"
          ]
        },
        {
          "uuid": "114c8cde-7458-471c-a366-8b23ddecc5ee",
          "code": "38SY84A64X",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "28deb5f1-c42d-62cf-ffef-b3e9a06b7c6b",
          "code": "metosulam",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/metosulam.html",
          "code_system": "ALANWOOD",
          "references": [
            "d9f0d9fc-5853-0cfa-6609-538ddd05bce5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "bc59c794-8e39-4c19-9eda-d8db15da3c09",
          "name": "(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE, N-(2,6-DICHLORO-3-METHYLPHENYL)-5,7-DIMETHOXY-",
          "stdName": "(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE, N-(2,6-DICHLORO-3-METHYLPHENYL)-5,7-DIMETHOXY-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6f00ebb-564e-4156-90f2-e1122f936779",
            "6c5ae33e-82b4-4831-be3e-7ec53f58deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "f2b05754-da96-45d7-a471-03d65d1d3102",
          "name": "2',6'-DICHLORO-5,7-DIMETHOXY-3'-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONANILIDE",
          "stdName": "2',6'-DICHLORO-5,7-DIMETHOXY-3'-METHYL(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONANILIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "73b379d2-9f34-4110-8df4-07cd11a65fd0",
            "eac8bb07-a398-441c-9d3d-c3bad8bfa5f1"
          ],
          "display_name": false
        },
        {
          "uuid": "8c91fd5a-c5e2-47a9-8094-eab658d6a7e9",
          "name": "DE-511",
          "stdName": "DE-511",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6f00ebb-564e-4156-90f2-e1122f936779",
            "6c5ae33e-82b4-4831-be3e-7ec53f58deeb"
          ],
          "display_name": false
        },
        {
          "uuid": "a2b110bf-3390-49c0-9d60-8de5c6f2322d",
          "name": "METOSULAM",
          "stdName": "METOSULAM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f99b73ff-8eeb-4a18-9fdf-b674ff09d961",
            "b464d189-6eab-447c-95c4-8a679e81aa60",
            "c6f00ebb-564e-4156-90f2-e1122f936779",
            "42a999f0-c93f-4eb1-a208-bde6bff88b22"
          ],
          "display_name": true
        },
        {
          "uuid": "999e1181-4419-4c7e-813d-53ad999c846b",
          "name": "METOSULAM [ISO]",
          "stdName": "METOSULAM [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b464d189-6eab-447c-95c4-8a679e81aa60",
            "c6f00ebb-564e-4156-90f2-e1122f936779"
          ],
          "display_name": false
        },
        {
          "uuid": "3ba219b2-9125-4d59-a0f9-2a7f6c4c66a2",
          "name": "N-(2,6-DICHLORO-3-METHYLPHENYL)-5,7-DIMETHOXY(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE",
          "stdName": "N-(2,6-DICHLORO-3-METHYLPHENYL)-5,7-DIMETHOXY(1,2,4)TRIAZOLO(1,5-A)PYRIMIDINE-2-SULFONAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "eac8bb07-a398-441c-9d3d-c3bad8bfa5f1",
            "dcfb465f-d879-4d92-b2ef-6b26a8322158"
          ],
          "display_name": false
        },
        {
          "uuid": "2de37480-a40e-4e46-a910-e76f04f308cf",
          "name": "TACCO",
          "stdName": "TACCO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c6f00ebb-564e-4156-90f2-e1122f936779",
            "6c5ae33e-82b4-4831-be3e-7ec53f58deeb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "f99b73ff-8eeb-4a18-9fdf-b674ff09d961",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "eac8bb07-a398-441c-9d3d-c3bad8bfa5f1",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "73b379d2-9f34-4110-8df4-07cd11a65fd0",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dcfb465f-d879-4d92-b2ef-6b26a8322158",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b464d189-6eab-447c-95c4-8a679e81aa60",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c6f00ebb-564e-4156-90f2-e1122f936779",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c5ae33e-82b4-4831-be3e-7ec53f58deeb",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "100c0b71-b569-4d7e-a322-f9ec8dc52a5c",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390920000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea9f4014-604d-4a1f-ac09-03404be2cf92",
          "citation": "SRS import [38SY84A64X]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=38SY84A64X",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390920000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "96fc43b1-b3cc-44be-a898-b45b2d129e9b",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "42a999f0-c93f-4eb1-a208-bde6bff88b22",
          "citation": "METOSULAM [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "635eae65-6b6d-1557-c6e1-47ca40cfd6ec",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=139528-85-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d9f0d9fc-5853-0cfa-6609-538ddd05bce5",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "ddafcb31-d2d5-41fd-b969-0ef4efce9feb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4d38cbd2-ed1f-4f0c-a209-bc4f6a4f33e1",
          "id": "4d38cbd2-ed1f-4f0c-a209-bc4f6a4f33e1",
          "molfile": "\n  Marvin  01132104022D          \n\n 26 28  0  0  0  0            999 V2000\n    3.5882   -2.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5882   -3.5963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -3.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -4.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0336   -5.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0336   -6.0439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3379   -6.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7327   -4.8029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5360   -5.0451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0100   -4.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5106   -3.7108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7327   -3.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0150   -3.5733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -4.3574    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -3.5335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -5.1819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6538   -4.3574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2492   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0731   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4693   -4.6013    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   10.4978   -6.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0985   -6.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2700   -6.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8762   -7.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8494   -6.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3552   -6.0571    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n 13  3  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  5  8  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 12  8  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 10 14  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  2  0  0  0  0\n 14 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 19 18  1  0  0  0  0\n 18 25  2  0  0  0  0\n 19 20  1  0  0  0  0\n 21 19  2  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 23  1  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(c(c1Cl)NS(=O)(=O)c2nc3nc(cc(n3n2)OC)OC)Cl",
          "formula": "C14H13Cl2N5O4S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "fdd547cb-04b9-4d0b-a3b0-c0ae396077ca"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "418.2566",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "4d85a73e-ee47-4a88-be7c-1868ea1cfcdc",
      "version": "4",
      "structure": {
        "id": "ec5e8b63-b72e-483e-9345-f228f0f5aed8",
        "molfile": "\n  Marvin  01132112142D          \n\n 26 28  0  0  0  0            999 V2000\n    3.5882   -2.7725    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5882   -3.5963    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -3.9944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3067   -4.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0336   -5.2239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0336   -6.0439    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.3379   -6.4664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7327   -4.8029    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5360   -5.0451    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0100   -4.3574    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -4.3574    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -3.5335    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8338   -5.1819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6538   -4.3574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2492   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8494   -6.0571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3552   -6.0571    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    9.2700   -6.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8762   -7.4795    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0985   -6.7586    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4978   -6.0266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.0731   -5.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4693   -4.6013    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5106   -3.7108    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7327   -3.9801    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0150   -3.5733    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 16 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 15  2  0  0  0  0\n 22 23  1  0  0  0  0\n 10 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 25  8  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26  3  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(c(c1Cl)NS(=O)(=O)c2nc3nc(cc(n3n2)OC)OC)Cl",
        "formula": "C14H13Cl2N5O4S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "418.2566",
        "optical_activity": "NONE",
        "references": [
          "ea9f4014-604d-4a1f-ac09-03404be2cf92",
          "96fc43b1-b3cc-44be-a898-b45b2d129e9b"
        ],
        "stereo_centers": 0
      },
      "unii": "38SY84A64X"
    }
  ]
}