{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "880f0d99-6d5d-633a-fdee-5366d39d9620",
          "code": "DTXSID00894941",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID00894941",
          "code_system": "EPA CompTox",
          "references": [
            "2bb8558a-571a-3dc7-86f3-c1844f576f0d"
          ]
        },
        {
          "uuid": "00007f9d-cac3-4862-a389-aa67c9e624d5",
          "code": "38NVT24JZA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1ac662ab-fe0d-456f-dae4-7c590511c7fc",
          "code": "70495450",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/70495450",
          "code_system": "PUBCHEM",
          "references": [
            "059fad0e-351b-1239-3b19-d87e0221ca0f"
          ]
        },
        {
          "uuid": "6a6617cf-2a0b-4ccd-8262-abb512fe764e",
          "code": "1390661-72-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=1390661-72-9",
          "code_system": "CAS",
          "references": [
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1821f17e-977a-4fdf-b291-00dcaf264da5",
          "name": "2-Pyridinecarboxylic acid, 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-, phenylmethyl ester",
          "stdName": "2-PYRIDINECARBOXYLIC ACID, 4-AMINO-3-CHLORO-6-(4-CHLORO-2-FLUORO-3-METHOXYPHENYL)-5-FLUORO-, PHENYLMETHYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "e0c78711-b9af-40c3-8423-5dfb1d3490c9",
          "name": "4-Amino-3-chloro-5-fluoro-6-(4-chloro-2-fluoro-3-methoxyphenyl)pyridine-2-carboxylic acid benzyl ester",
          "stdName": "4-AMINO-3-CHLORO-5-FLUORO-6-(4-CHLORO-2-FLUORO-3-METHOXYPHENYL)PYRIDINE-2-CARBOXYLIC ACID BENZYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "e50fd8fa-4d71-4ba1-aca7-3b2c6db335f7",
          "name": "Benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridine-2-carboxylate",
          "stdName": "BENZYL 4-AMINO-3-CHLORO-6-(4-CHLORO-2-FLUORO-3-METHOXYPHENYL)-5-FLUOROPYRIDINE-2-CARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "b30e1e74-0c47-4948-9813-88a664d4f177",
          "name": "Florpyrauxifen-benzyl",
          "stdName": "FLORPYRAUXIFEN-BENZYL",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acc76562-406d-4346-97f4-908fd9fb177c"
          ],
          "display_name": true,
          "domains": [
            "Pesticide"
          ]
        },
        {
          "uuid": "fba37feb-d26e-4460-bc7a-060458660261",
          "name": "Phenylmethyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoro-2-pyridinecarboxylate",
          "stdName": "PHENYLMETHYL 4-AMINO-3-CHLORO-6-(4-CHLORO-2-FLUORO-3-METHOXYPHENYL)-5-FLUORO-2-PYRIDINECARBOXYLATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acc76562-406d-4346-97f4-908fd9fb177c",
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "d68a98ef-274f-4bae-b0e4-26d8620a3741",
          "name": "Rinskor",
          "stdName": "RINSKOR",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d2514efe-aba0-4f09-b746-f029cdbbf2f4"
          ],
          "display_name": false
        },
        {
          "uuid": "d932d833-e228-445d-8b5e-88304fe22d3b",
          "name": "florpyrauxifen-benzyl [ISO]",
          "stdName": "FLORPYRAUXIFEN-BENZYL [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "acc76562-406d-4346-97f4-908fd9fb177c"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "059fad0e-351b-1239-3b19-d87e0221ca0f",
          "citation": "PubChem",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "d2514efe-aba0-4f09-b746-f029cdbbf2f4",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "acc76562-406d-4346-97f4-908fd9fb177c",
          "citation": "ISO",
          "doc_type": "ISO",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2bb8558a-571a-3dc7-86f3-c1844f576f0d",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "acb6b82c-afbf-4e00-a761-56fa648a0efd",
          "id": "acb6b82c-afbf-4e00-a761-56fa648a0efd",
          "molfile": "\n  Marvin  10172215592D          \n\n 29 31  0  0  0  0            999 V2000\n    3.3000    0.0000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750    2.8579    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9500    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7750    2.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5375    3.5724    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1875    3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9500    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    2.8579    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7750    1.4290    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.4290    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    3.3000    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125    2.1434    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7125    0.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5375    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5375    0.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9500    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4750    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0625    0.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2375    2.1434    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2375    0.7144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.8250    1.4290    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0125    3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4250    4.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4250    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2500    4.2868    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2500    2.8579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6625    3.5724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 14  1  0  0  0  0\n  2 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3 15  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6 24  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 21  1  0  0  0  0\n 10 17  1  0  0  0  0\n 11 23  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 12 18  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 21 23  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 27 29  2  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
          "smiles": "COc1c(ccc(c1F)-c2c(c(c(c(C(=O)OCc3ccccc3)n2)Cl)N)F)Cl",
          "formula": "C20H14Cl2F2N2O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e192f6ea-f692-4c66-84bc-92f743d460cb"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "439.2402",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5c37f971-4f53-4d20-b008-7abe00283b50",
      "version": "5",
      "structure": {
        "id": "9ff2b8cc-c5f7-4973-831d-b8f78992458f",
        "molfile": "Benzyl 4-amino-3-chloro-6-(4-chloro-2-fluoro-3-methoxyphenyl)-5-fluoropyridin...\n   JSDraw210172215592D\n\n 29 31  0  0  0  0              0 V2000\n   23.2180  -11.7490    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -6.3450    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3380   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580   -4.9939    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   28.6780   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3380  -11.7490    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5381   -6.3450    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.9781   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   27.8980   -9.0470    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   16.9781   -9.0470    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n   23.2180   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980   -7.6959    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   23.9980  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   25.5580  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   26.3380   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   21.6580   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8781   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8781  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3181   -7.6959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.3181  -10.3981    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.5381   -9.0470    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   30.2379   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0179   -3.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   31.0179   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5779   -3.6430    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   32.5779   -6.3450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   33.3579   -4.9939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1 14  1  0  0  0  0\n  2 19  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3  5  2  0  0  0  0\n  3 15  1  0  0  0  0\n  4  6  1  0  0  0  0\n  6 24  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 21  1  0  0  0  0\n 10 17  1  0  0  0  0\n 11 23  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 12 18  1  0  0  0  0\n 13 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 15 17  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 19  2  0  0  0  0\n 18 20  1  0  0  0  0\n 19 21  1  0  0  0  0\n 20 22  2  0  0  0  0\n 21 23  2  0  0  0  0\n 22 23  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n 25 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 27 29  2  0  0  0  0\n 28 29  1  0  0  0  0\nM  END",
        "smiles": "COc1c(ccc(c1F)-c2c(c(c(c(C(=O)OCc3ccccc3)n2)Cl)N)F)Cl",
        "formula": "C20H14Cl2F2N2O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "439.2402",
        "optical_activity": "NONE",
        "references": [
          "d2514efe-aba0-4f09-b746-f029cdbbf2f4",
          "acc76562-406d-4346-97f4-908fd9fb177c"
        ],
        "stereo_centers": 0
      },
      "modifications": {
        "uuid": "1a1c154a-790b-46a3-b878-0bc2020ca3d0"
      },
      "unii": "38NVT24JZA"
    }
  ]
}