{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "39bdd4ce-54fb-4be2-83fe-0fe6b013108a",
          "code": "731-27-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=731-27-1",
          "code_system": "CAS",
          "references": [
            "ea2e4eda-8d90-43cf-b69a-4ab47dfd3914",
            "add943b5-2e9a-4032-a606-68ef5aaea8b7"
          ]
        },
        {
          "uuid": "5c7ea747-1073-4e7e-ad44-3f5abb7aa0b5",
          "code": "309200",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4074",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "ea2e4eda-8d90-43cf-b69a-4ab47dfd3914"
          ]
        },
        {
          "uuid": "ba9af446-f6c5-4edf-85cc-a1e245209f3c",
          "code": "12898",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/12898",
          "code_system": "PUBCHEM",
          "references": [
            "ea2e4eda-8d90-43cf-b69a-4ab47dfd3914"
          ]
        },
        {
          "uuid": "4e19051c-4ad2-4382-b265-5ea7a1b8e48f",
          "code": "211-986-9",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.010.898",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ea2e4eda-8d90-43cf-b69a-4ab47dfd3914"
          ]
        },
        {
          "uuid": "318f4df5-f7f4-068f-2250-0c347ab865b5",
          "code": "6739",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6739",
          "code_system": "HSDB",
          "references": [
            "b70ad3a0-22b4-121c-23d3-26853c63faba"
          ]
        },
        {
          "uuid": "04c8569f-e98d-cff5-100a-2a1063587bc8",
          "code": "DTXSID8042478",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8042478",
          "code_system": "EPA CompTox",
          "references": [
            "187db65a-4b22-413b-09d5-228e18be2300"
          ]
        },
        {
          "uuid": "a25893e3-43ce-46a8-8177-16ef19a9cbfe",
          "code": "382277YXSG",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "08f27a13-d1ad-87ba-c16a-40296b9cccda",
          "code": "75182",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:75182",
          "code_system": "CHEBI",
          "references": [
            "df9e34a9-b0b8-63d9-d5f0-d6646b49b5b7"
          ]
        },
        {
          "uuid": "897451a9-c96b-a76a-fea4-cb002d479fce",
          "code": "Tolylfluanid",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Tolylfluanid",
          "code_system": "WIKIPEDIA",
          "references": [
            "e8ee7431-233c-ed20-0c0f-ac8bfaab9eac"
          ]
        },
        {
          "uuid": "30435df0-48aa-d713-9fc8-8b74676ce692",
          "code": "tolylfluanid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/tolylfluanid.html",
          "code_system": "ALANWOOD",
          "references": [
            "1d44c975-46b6-2e88-8259-14ceecdfcc16"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "493adfef-6562-49ab-a8a5-3b09eafc4ac2",
          "name": "1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-(4-METHYLPHENYL)METHANESULFENAMIDE",
          "stdName": "1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-(4-METHYLPHENYL)METHANESULFENAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc444105-3dd0-4a76-bb1f-53fe48003864",
            "ff47502c-60d7-4dc7-aeb7-7933b8d46b38"
          ],
          "display_name": false
        },
        {
          "uuid": "255363f1-a1d2-491d-9fed-6fe067c084fb",
          "name": "BAY-5712A",
          "stdName": "BAY-5712A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c980c01-eea7-44d3-83c7-8ecfbcbb3651",
            "7c0be9d3-e9a9-4001-8c92-208849779c02"
          ],
          "display_name": false
        },
        {
          "uuid": "3a55133c-9f76-42d3-ad7a-c432dca95bb9",
          "name": "DICHLOFLUANID-METHYL",
          "stdName": "DICHLOFLUANID-METHYL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "6c382dd7-8b28-4c79-ab63-e0eb171019ac",
          "name": "EUPAREN MULTI",
          "stdName": "EUPAREN MULTI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "c5b941dd-92a7-4156-b8dc-f8f16c50245e",
          "name": "FOLICUR MULTI",
          "stdName": "FOLICUR MULTI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "3a428273-3261-4478-8b9d-4135b1751b8a",
          "name": "GORI-28",
          "stdName": "GORI-28",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6c980c01-eea7-44d3-83c7-8ecfbcbb3651",
            "7c0be9d3-e9a9-4001-8c92-208849779c02"
          ],
          "display_name": false
        },
        {
          "uuid": "192f4e93-762c-47be-97ac-3866062f7377",
          "name": "MELODY MULTI",
          "stdName": "MELODY MULTI",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "9d27474c-f005-4b6d-ac00-ce6fd035d4e3",
          "name": "METHANESULFENAMIDE, 1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-(4-METHYLPHENYL)-",
          "stdName": "METHANESULFENAMIDE, 1,1-DICHLORO-N-((DIMETHYLAMINO)SULFONYL)-1-FLUORO-N-(4-METHYLPHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "f5207240-6214-4db7-aadc-edc65bb11011",
          "name": "N'-DICHLOROFLUOROMETHYLTHIO-N,N-DIMETHYL-N'(P-TOLYL)SULFAMIDE",
          "stdName": "N'-DICHLOROFLUOROMETHYLTHIO-N,N-DIMETHYL-N'(P-TOLYL)SULFAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "b873ce75-0e14-43f8-829d-8f0d39f9b556",
          "name": "N-DICHLOROFLUOROMETHYLTHIO-N',N'-DIMETHYL-N-P-TOLYLSULFAMIDE",
          "stdName": "N-DICHLOROFLUOROMETHYLTHIO-N',N'-DIMETHYL-N-P-TOLYLSULFAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fc444105-3dd0-4a76-bb1f-53fe48003864",
            "d14e8ed4-1401-402f-8b59-1ce2ae633af7"
          ],
          "display_name": false
        },
        {
          "uuid": "20a0e4e0-8b99-4a1e-ac3a-166ad8ef7d2e",
          "name": "SULFAMIDE, N-((DICHLOROFLUOROMETHYL)THIO)-N',N'-DIMETHYL-N-P-TOLYL-",
          "stdName": "SULFAMIDE, N-((DICHLOROFLUOROMETHYL)THIO)-N',N'-DIMETHYL-N-P-TOLYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "433bff40-c55a-40d3-8e5b-1288fea770b9",
          "name": "TOLILFLUANIDE",
          "stdName": "TOLILFLUANIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        },
        {
          "uuid": "d2cfc47c-b7d5-4458-a646-b476c6494d70",
          "name": "TOLYLFLUANID",
          "stdName": "TOLYLFLUANID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1b41a4a5-e1fb-4d2b-b22e-acfac37c8523",
            "a1def6fb-3b93-4f9c-ad83-21edc109a71e",
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "cf9b21ef-7a36-4cdb-9eb0-6c10ec258b42",
            "8ff96c41-cbc0-4ec1-a6e9-026c1e33c54d",
            "ad7092da-1d38-4f0b-a57d-d834d5c98f31"
          ],
          "display_name": true
        },
        {
          "uuid": "12603827-ccaf-4308-9eaa-c79badb69f37",
          "name": "TOLYLFLUANID [HSDB]",
          "stdName": "TOLYLFLUANID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "8ff96c41-cbc0-4ec1-a6e9-026c1e33c54d"
          ],
          "display_name": false
        },
        {
          "uuid": "ccb06d7f-3a4b-43c0-a9c3-b023232f5123",
          "name": "TOLYLFLUANID [ISO]",
          "stdName": "TOLYLFLUANID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "cf9b21ef-7a36-4cdb-9eb0-6c10ec258b42"
          ],
          "display_name": false
        },
        {
          "uuid": "32013555-e4df-4f28-8d6e-5191bbf257ef",
          "name": "TOLYLFLUANIDE",
          "stdName": "TOLYLFLUANIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7c0be9d3-e9a9-4001-8c92-208849779c02",
            "9f034bb8-ff0f-4635-b59d-91caea9c7c5a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1def6fb-3b93-4f9c-ad83-21edc109a71e",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fc444105-3dd0-4a76-bb1f-53fe48003864",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d14e8ed4-1401-402f-8b59-1ce2ae633af7",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff47502c-60d7-4dc7-aeb7-7933b8d46b38",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8ff96c41-cbc0-4ec1-a6e9-026c1e33c54d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7c0be9d3-e9a9-4001-8c92-208849779c02",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf9b21ef-7a36-4cdb-9eb0-6c10ec258b42",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9f034bb8-ff0f-4635-b59d-91caea9c7c5a",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c980c01-eea7-44d3-83c7-8ecfbcbb3651",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea2e4eda-8d90-43cf-b69a-4ab47dfd3914",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cd3fb52f-83e0-4f14-bfc8-4c7bf4f3a098",
          "citation": "SRS import [382277YXSG]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=382277YXSG",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390956000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4baaf786-4e1b-4726-a849-87625e6a95aa",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad7092da-1d38-4f0b-a57d-d834d5c98f31",
          "citation": "TOLYLFLUANID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "1b41a4a5-e1fb-4d2b-b22e-acfac37c8523",
          "citation": "TOLYLFLUANID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b70ad3a0-22b4-121c-23d3-26853c63faba",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+731-27-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "187db65a-4b22-413b-09d5-228e18be2300",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=731-27-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e8ee7431-233c-ed20-0c0f-ac8bfaab9eac",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "1d44c975-46b6-2e88-8259-14ceecdfcc16",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "df9e34a9-b0b8-63d9-d5f0-d6646b49b5b7",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "add943b5-2e9a-4032-a606-68ef5aaea8b7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9a84b22c-4c5f-43fb-8adf-9a3d64459edf",
          "id": "9a84b22c-4c5f-43fb-8adf-9a3d64459edf",
          "molfile": "\n  Marvin  01132108022D          \n\n 19 19  0  0  0  0            999 V2000\n    5.8407   -2.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8407   -3.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1344   -3.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -3.6003    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1445   -4.3170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9769   -2.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -4.0139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -3.6020    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7023   -4.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4188   -4.4259    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1188   -3.2934    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2876   -4.7307    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -4.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -6.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -6.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -6.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  4  6  2  0  0  0  0\n  7  4  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 13  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n  9 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 19  2  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 19 18  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)N(SC(Cl)(Cl)F)S(=O)(=O)N(C)C",
          "formula": "C10H13Cl2FN2O2S2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0af287b3-6ce8-4ff1-8ca7-d40a9d9cb2e1"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "347.2593",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "7e2ea2bd-030f-4a2d-af9c-fa10ea38daee",
      "version": "8",
      "structure": {
        "id": "2f641b15-1b49-4b68-9e5e-913708af019a",
        "molfile": "\n  Marvin  01132102332D          \n\n 19 19  0  0  0  0            999 V2000\n    5.8407   -3.1849    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8407   -2.3615    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1344   -3.5966    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -3.6003    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -4.0139    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -4.8363    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5596   -6.0734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -6.4832    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2779   -7.3061    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -6.0696    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -5.2457    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9861   -3.6020    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7023   -4.0139    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4188   -4.4259    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1188   -3.2934    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.2876   -4.7307    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.1445   -4.3170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9769   -2.8799    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  2  0  0  0  0\n  6 12  1  0  0  0  0\n  5 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  1  0  0  0  0\n 14 17  1  0  0  0  0\n  4 18  2  0  0  0  0\n  4 19  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)N(SC(Cl)(Cl)F)S(=O)(=O)N(C)C",
        "formula": "C10H13Cl2FN2O2S2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "347.2593",
        "optical_activity": "NONE",
        "references": [
          "cd3fb52f-83e0-4f14-bfc8-4c7bf4f3a098",
          "4baaf786-4e1b-4726-a849-87625e6a95aa"
        ],
        "stereo_centers": 0
      },
      "unii": "382277YXSG"
    }
  ]
}