{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "ecdef7c8-8765-4fa1-b665-3fcfbd50fbae",
          "code": "SCLAREOLIDE",
          "comments": "JECFA|FUNCTIONAL CLASSIFICATION|Flavouring Agent",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemID=4563",
          "code_system": "JECFA EVALUATION",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "d770efbf-02d9-489e-8fcb-949b1cd0b372",
          "code": "564-20-5",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=564-20-5",
          "code_system": "CAS",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e",
            "3bb03fac-ad88-4906-ab80-36b08ac7c474"
          ]
        },
        {
          "uuid": "238f92c2-0963-4711-b9b5-d77f3ad67d47",
          "code": "C109395",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67109395",
          "code_system": "MESH",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "39d10f96-14b0-4e6f-b12f-d49f961a1535",
          "code": "SCLAREOLIDE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Sclareolide",
          "code_system": "WIKIPEDIA",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "5167cc05-159a-42f8-80d2-7df6bf4f0212",
          "code": "1426934",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426934/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "e1f1c35d-c520-4a19-8f40-a0205068f888",
          "code": "929262",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/929262",
          "code_system": "PUBCHEM",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "5dce7f30-e983-4ac4-9084-66990fd45815",
          "code": "209-269-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.008.427",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "1571940b-ad28-4f79-966a-743274f5693e"
          ]
        },
        {
          "uuid": "6e29df98-aef0-f89d-5cc6-bb9c83bcbce6",
          "code": "DTXSID8047686",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8047686",
          "code_system": "EPA CompTox",
          "references": [
            "6cb69f95-7172-121e-8827-ca23b176c24c"
          ]
        },
        {
          "uuid": "b026ff4b-e261-92a4-b6a9-c49a7061210e",
          "code": "3501 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|chemical|Sclareolide",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=3501&item=Sclareolide",
          "code_system": "DSLD",
          "references": [
            "79de8232-44fa-a740-740b-75f6b2376613"
          ]
        },
        {
          "uuid": "c9b259fe-edf0-40fe-ae23-0468e9437a92",
          "code": "37W4O0O6E6",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0f7633c5-ecb0-1860-c3e5-a053eb55ceb8",
          "code": "37W4O0O6E6",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=37W4O0O6E6",
          "code_system": "DAILYMED",
          "references": [
            "88c81217-d55d-83bd-b4fc-52c8acdeea82"
          ]
        },
        {
          "uuid": "04903ed5-199d-0413-dd34-51786842e30c",
          "code": "1156",
          "type": "PRIMARY",
          "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/1156/",
          "code_system": "JECFA MONOGRAPH",
          "references": [
            "b937392c-d541-a800-3e53-bca96a14f562"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "405bc88a-5792-4a7a-8c42-6ae4e05ff2df",
          "name": "(3AR)-(+)-SCLAREOLIDE",
          "stdName": "(3AR)-(+)-SCLAREOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "4b129501-e4a0-46c3-b754-2bd71714fe73"
          ],
          "display_name": false
        },
        {
          "uuid": "8e1ce722-4b80-4f83-9e5f-67c7a285bdce",
          "name": "12-NORAMBREINOLIDE",
          "stdName": "12-NORAMBREINOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "91081596-6d5e-4e40-927e-2b674a61ee0a"
          ],
          "display_name": false
        },
        {
          "uuid": "d05c4f45-7a21-41b3-841c-846de6376082",
          "name": "FEMA NO. 3794",
          "stdName": "FEMA NO. 3794",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "07f3af8f-9c22-4764-ba28-2e997ed8c9b4"
          ],
          "display_name": false
        },
        {
          "uuid": "3f864811-6c97-4ea9-89b1-62906ba08ded",
          "name": "NAPHTHO(2,1-B)FURAN-2(1H)-ONE, DECAHYDRO-3A,6,6,9A-TETRAMETHYL-, (3AR,5AS,9AS,9BR)-",
          "stdName": "NAPHTHO(2,1-B)FURAN-2(1H)-ONE, DECAHYDRO-3A,6,6,9A-TETRAMETHYL-, (3AR,5AS,9AS,9BR)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "91081596-6d5e-4e40-927e-2b674a61ee0a"
          ],
          "display_name": false
        },
        {
          "uuid": "290ca5a4-5666-47fd-aa56-bdb099552793",
          "name": "NORAMBREINOLIDE",
          "stdName": "NORAMBREINOLIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3de0449a-9665-4042-9ded-657134031033",
            "c0505fd6-4d5c-4132-bee5-8784cb32444f"
          ],
          "display_name": false
        },
        {
          "uuid": "8efdb7bd-ad9c-48e2-a602-3617e55dee33",
          "name": "SCLAREOLIDE",
          "stdName": "SCLAREOLIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "71afcef4-b41e-4562-afec-cb1667b4a49e",
            "db828626-a7d9-4ea6-89ec-81ddcba42286",
            "91081596-6d5e-4e40-927e-2b674a61ee0a",
            "07f3af8f-9c22-4764-ba28-2e997ed8c9b4",
            "4c61a94b-a9e1-4a09-ac95-816c26be3f64"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3c8f72b0-2caa-4089-866c-e6f48868c385",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "752c0d77-f354-4c68-a712-9838548b7882",
          "name": "SCLAREOLIDE [FHFI]",
          "stdName": "SCLAREOLIDE [FHFI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c0505fd6-4d5c-4132-bee5-8784cb32444f",
            "07f3af8f-9c22-4764-ba28-2e997ed8c9b4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "91081596-6d5e-4e40-927e-2b674a61ee0a",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c0505fd6-4d5c-4132-bee5-8784cb32444f",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b129501-e4a0-46c3-b754-2bd71714fe73",
          "citation": "http://www.thegoodscentscompany.com/data/rw1038441.html",
          "url": "http://www.thegoodscentscompany.com/data/rw1038441.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c61a94b-a9e1-4a09-ac95-816c26be3f64",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07f3af8f-9c22-4764-ba28-2e997ed8c9b4",
          "citation": "FHFI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3de0449a-9665-4042-9ded-657134031033",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1571940b-ad28-4f79-966a-743274f5693e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390838000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ad7a3f83-58b5-4871-8661-59f3e934c296",
          "citation": "SRS import [37W4O0O6E6]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=37W4O0O6E6",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390838000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71afcef4-b41e-4562-afec-cb1667b4a49e",
          "citation": "SCLAREOLIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "db828626-a7d9-4ea6-89ec-81ddcba42286",
          "citation": "SCLAREOLIDE [FHFI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6cb69f95-7172-121e-8827-ca23b176c24c",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=564-20-5",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "79de8232-44fa-a740-740b-75f6b2376613",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3bb03fac-ad88-4906-ab80-36b08ac7c474",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "88c81217-d55d-83bd-b4fc-52c8acdeea82",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "b937392c-d541-a800-3e53-bca96a14f562",
          "citation": "JECFA",
          "doc_type": "JECFA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f2812829-f592-4599-aa22-fec981403c6c",
          "id": "f2812829-f592-4599-aa22-fec981403c6c",
          "molfile": "\n  Marvin  01132112352D          \n\n 18 20  0  0  1  0            999 V2000\n    7.7787   -4.8194    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    7.9486   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7659   -3.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3464   -3.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1034   -4.6811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4886   -5.2319    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.2627   -5.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4886   -6.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7787   -6.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0641   -6.0568    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    6.3451   -6.4692    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    5.9054   -7.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -7.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6308   -6.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6308   -5.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3451   -4.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0641   -5.2318    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    6.9948   -4.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  6  1  1  0  0  0  0\n 17  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  1  0  0  0\n  8  6  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  1  0  0  0\n 10 17  1  0  0  0  0\n 11 12  1  0  0  0  0\n 11 13  1  0  0  0  0\n 14 11  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 17 16  1  0  0  0  0\n 17 18  1  1  0  0  0\nM  END",
          "smiles": "CC1(C)CCC[C@@]2(C)[C@H]1CC[C@]3(C)[C@@H]2CC(=O)O3",
          "formula": "C16H26O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3bc9f9b9-7a62-4f06-acbf-737fa0d44b72"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "250.377",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d571960-02c0-4e2c-9c4e-7705540531c5",
      "version": "7",
      "structure": {
        "id": "e8c27ac4-acfa-4396-a085-923e94ea40f3",
        "molfile": "\n  Marvin  01132112032D          \n\n 20 22  0  0  1  0            999 V2000\n    5.6308   -5.2318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6308   -6.0568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3451   -6.4692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0641   -6.0568    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.0641   -5.2318    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.3451   -4.8194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7787   -4.8194    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.4886   -5.2319    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    8.4886   -6.0569    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7787   -6.4693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1034   -4.6811    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7659   -3.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9486   -4.0111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3464   -3.3446    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2627   -5.4301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7787   -5.7250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9948   -4.2037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3665   -6.8125    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9054   -7.4490    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5087   -7.4558    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n  4 10  1  0  0  0  0\n  8 11  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n  7 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n  8 15  1  1  0  0  0\n  7 16  1  6  0  0  0\n  5 17  1  1  0  0  0\n  4 18  1  6  0  0  0\n  3 19  1  0  0  0  0\n  3 20  1  0  0  0  0\nM  END",
        "smiles": "CC1(C)CCC[C@@]2(C)[C@@]1([H])CC[C@]3(C)[C@]2([H])CC(=O)O3",
        "formula": "C16H26O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "250.377",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "91081596-6d5e-4e40-927e-2b674a61ee0a",
          "ad7a3f83-58b5-4871-8661-59f3e934c296"
        ],
        "stereo_centers": 4
      },
      "unii": "37W4O0O6E6"
    }
  ]
}