{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "68e55059-587c-44c0-8914-2da899e968d7",
          "code": "915-67-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=915-67-3",
          "code_system": "CAS",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb",
            "7e669393-26ac-4a8c-9db2-3868f54ac400"
          ]
        },
        {
          "uuid": "463ebc21-f115-4745-8481-afb27a6c5827",
          "code": "C71677",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71677",
          "code_system": "NCI_THESAURUS",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "fcbfe1ac-5245-412e-8cc9-904b033e7890",
          "code": "INS-123",
          "comments": "Codex Alimentarius|Functional Classification|Colour",
          "type": "PRIMARY",
          "url": "http://www.fao.org/gsfaonline/additives/details.html?id=105",
          "code_system": "CODEX ALIMENTARIUS (GSFA)",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "ea10bf75-9892-4495-9ceb-6f5dcba6310a",
          "code": "INS-123",
          "comments": "JECFA|Functional Classification|Colour",
          "type": "PRIMARY",
          "url": "http://apps.who.int/food-additives-contaminants-jecfa-database/chemical.aspx?chemINS=123",
          "code_system": "JECFA EVALUATION",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "07fa5a57-2e8a-482f-aefd-156f6bca0797",
          "code": "m1639",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1639?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "60412629-7f65-4c87-94d7-9784744558ef",
          "code": "SUB12840MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "54caf4b1-1b8c-42da-9e07-075c3a4768f4",
          "code": "CHEMBL1408927",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1408927",
          "code_system": "ChEMBL",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "6d1863b9-e261-4693-b0be-e1f4aefa13e8",
          "code": "213-022-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.839",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "45b5f642-2c0d-4f73-8456-499341f648cb"
          ]
        },
        {
          "uuid": "e2447cd4-a1ab-dcfe-3af0-da49bd7e7e3c",
          "code": "FD&C Red No. 2",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/FD&C_Red%20No.%202",
          "code_system": "WIKIPEDIA",
          "references": [
            "cb2d648d-88e2-623f-fb4a-c116565ab274"
          ]
        },
        {
          "uuid": "7cce4ec8-df3f-b046-00e2-7e1cf7329552",
          "code": "569",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/569",
          "code_system": "HSDB",
          "references": [
            "31b5cf39-d625-a973-04d6-35ace2c631cb"
          ]
        },
        {
          "uuid": "a1619251-8206-847a-15fe-649df6f97452",
          "code": "DTXSID2021232",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2021232",
          "code_system": "EPA CompTox",
          "references": [
            "90d96d1f-f752-a7bc-d004-29026ee04943"
          ]
        },
        {
          "uuid": "a7d31c69-3988-48d0-37c2-8e6ce9ab5081",
          "code": "1433189",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1433189/allProperties.xml?prop=all",
          "code_system": "RXCUI"
        },
        {
          "uuid": "9c0421ad-a34a-2d9b-4752-be84f455fcf9",
          "code": "265 (Number of products:165)",
          "comments": "Dietary Supplement Label Database|Botanical|Amaranth",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=265&item=Amaranth",
          "code_system": "DSLD",
          "references": [
            "ec49006c-104a-5319-8ac8-52fdb43d7319"
          ]
        },
        {
          "uuid": "c5846765-a117-4a74-add7-c15f7168638e",
          "code": "37RBV3X49K",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a8865869-26c8-acf6-53e4-0b81e95bb78e",
          "code": "1018607",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1018607",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ec49006c-104a-5319-8ac8-52fdb43d7319"
          ]
        },
        {
          "uuid": "33c25d14-fd88-1a83-db95-afef38b0ffb1",
          "code": "100000077702",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "6d5d176c-aa69-6254-0d42-5a1aa8b84ad5"
          ]
        },
        {
          "uuid": "432c35b8-a65c-e208-0eff-decb0f74f588",
          "code": "4300",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=4300",
          "code_system": "NSC",
          "references": [
            "c33844d5-007e-3c8c-dc30-9f709d1b89c0"
          ]
        },
        {
          "uuid": "fcc5af28-50f7-9ce2-2b33-7e2f5cf9b6ae",
          "code": "37RBV3X49K",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=37RBV3X49K",
          "code_system": "DAILYMED",
          "references": [
            "3a49997b-2e7d-c417-2a29-10d6f5735fe4"
          ]
        },
        {
          "uuid": "c1594d72-42d5-0d13-41db-08c9eb4ab4ce",
          "code": "215207",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=215207",
          "code_system": "NSC",
          "references": [
            "c33844d5-007e-3c8c-dc30-9f709d1b89c0"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "98db6cc1-0de1-420e-abed-66d6b3d418cc",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c25acfa4-1a22-4521-bfb3-15d3216626ac",
            "refuuid": "905f8e61-bc8f-4a88-908e-42e05ee0a59e",
            "name": "AMARANTH ACID",
            "unii": "02J7X17ZUQ",
            "linking_id": "02J7X17ZUQ",
            "ref_pname": "AMARANTH ACID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "028eae4d-0c09-4a23-8a88-2cd6b578db85",
          "name": "1-(4-SULFO-1-NAPHTHYLAZO)-2-NAPHTHOL-3,6-DISULFONIC ACID TRISODIUM SALT",
          "stdName": "1-(4-SULFO-1-NAPHTHYLAZO)-2-NAPHTHOL-3,6-DISULFONIC ACID TRISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "148deb43-7802-4111-80eb-ded595f9f502"
          ],
          "display_name": false
        },
        {
          "uuid": "eae81dac-b0ef-4047-9d47-9a1f6022c1a8",
          "name": "2,7-NAPHTHALENEDISULFONIC ACID, 3-HYDROXY-4-((E)-(4-SULFO-1-NAPHTHALENYL)AZO)-, TRISODIUM SALT",
          "stdName": "2,7-NAPHTHALENEDISULFONIC ACID, 3-HYDROXY-4-((E)-(4-SULFO-1-NAPHTHALENYL)AZO)-, TRISODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb7cef92-182a-47ef-8a11-367895ee979c",
            "f708c48d-681c-4309-8e32-08b9294e6825"
          ],
          "display_name": false
        },
        {
          "uuid": "a0ecb31b-1b06-4e4d-983b-b14b6f321640",
          "name": "3-HYDROXY-4-(2-(4-SULFO-1-NAPHTHALENYL)DIAZENYL)-2,7-NAPHTHALENEDISULFONIC ACID SODIUM SALT (1:3)",
          "stdName": "3-HYDROXY-4-(2-(4-SULFO-1-NAPHTHALENYL)DIAZENYL)-2,7-NAPHTHALENEDISULFONIC ACID SODIUM SALT (1:3)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "ff0c3fa3-02a7-43dc-9ad8-bfca1c361d60"
          ],
          "display_name": false
        },
        {
          "uuid": "da8608f5-dce3-4deb-bdaf-fe743d86697a",
          "name": "ACID RED 27",
          "stdName": "ACID RED 27",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "4d3c1fe5-84d0-42d8-9e28-32a01a30f45b",
            "a476836e-9851-44a7-af3b-cbc482cf43e7",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "14747b73-17fe-451a-8e77-fa0fefa33367",
            "f708c48d-681c-4309-8e32-08b9294e6825"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e4f2c167-15d1-468d-ac6a-f14d46e394dd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "604d8f5e-9248-468c-a589-5afbfaab6e0b",
          "name": "AKA2",
          "stdName": "AKA2",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "ce746ead-753d-4554-922d-7a3bf621cbeb",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "59148000-25ff-473a-8a7c-40fcf164faee"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "95c0bac4-d1e9-4820-befa-263891cf1a7c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4c531324-adb6-4085-842a-115228251e99",
          "name": "AMARANTH",
          "stdName": "AMARANTH",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "b839e1c4-7593-4280-bd08-7e700b17b3cc",
            "616056ed-133a-4834-90f7-64e75d9249bf",
            "20a2f415-12ad-4bde-bf94-eb34f0ff0e6a"
          ],
          "display_name": true
        },
        {
          "uuid": "c50bd83d-4a32-431c-a999-f4736f8778cf",
          "name": "AMARANTH (DYE)",
          "stdName": "AMARANTH (DYE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "80d191d8-8952-4bd2-bf2f-0d2c98a947d0",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "6c5ac930-ddff-4d3c-a6f8-37292cf75a0f",
            "c69faa26-ea50-4c15-86e9-7a760f3f1642"
          ],
          "display_name": false
        },
        {
          "uuid": "ee6c69c4-e36b-4760-b87c-78871bc5b740",
          "name": "AMARANTH (DYE) [MI]",
          "stdName": "AMARANTH (DYE) [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "6c5ac930-ddff-4d3c-a6f8-37292cf75a0f"
          ],
          "display_name": false
        },
        {
          "uuid": "7c40459d-3e49-4c1c-9bb5-3feed61e2607",
          "name": "AMARANTH (E 123)",
          "stdName": "AMARANTH (E 123)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "2a743a36-6f6b-4704-bec0-f553748156d1"
          ],
          "display_name": false
        },
        {
          "uuid": "a4f4eefe-8627-430a-9dc7-ef59af290756",
          "name": "AMARANTH DYE [HSDB]",
          "stdName": "AMARANTH DYE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "a7f61c32-3205-4a4e-abcc-7922320df50d"
          ],
          "display_name": false
        },
        {
          "uuid": "59ac5b70-2e3d-9ec9-a275-a88f826b6af7",
          "name": "AMARANTH [IARC]",
          "stdName": "AMARANTH [IARC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "064710af-e646-9996-5052-700236d3db0c"
          ],
          "display_name": false
        },
        {
          "uuid": "e61c476d-9c2c-4b31-a843-c40665da97df",
          "name": "AMARANTH [MART.]",
          "stdName": "AMARANTH [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b839e1c4-7593-4280-bd08-7e700b17b3cc"
          ],
          "display_name": false
        },
        {
          "uuid": "34241157-5031-51ed-aa53-539cf4439f1a",
          "name": "AMARANTH [USP-RS]",
          "stdName": "AMARANTH [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f671b45-82bb-9fe0-729d-84fd816d8810"
          ],
          "display_name": false
        },
        {
          "uuid": "f3212803-1fb6-4d08-a366-d61f8ec4ae9e",
          "name": "B1717 [LANGUAL]",
          "stdName": "B1717 [LANGUAL]",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "67984032-30a4-4d3a-a4de-5ff58ab10e2d",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34"
          ],
          "display_name": false
        },
        {
          "uuid": "b94a7cbe-0f81-44a0-9f7b-f4603c178360",
          "name": "C.I. 16185",
          "stdName": "C.I. 16185",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "f708c48d-681c-4309-8e32-08b9294e6825"
          ],
          "display_name": false
        },
        {
          "uuid": "c6bf51d1-c151-423a-bc0e-1e421de00a9c",
          "name": "C.I. ACID RED 27",
          "stdName": "C.I. ACID RED 27",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "148deb43-7802-4111-80eb-ded595f9f502"
          ],
          "display_name": false
        },
        {
          "uuid": "31406318-fc6c-4c1c-ac1b-3dfe18b4fb97",
          "name": "C.I. FOOD RED 9",
          "stdName": "C.I. FOOD RED 9",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "07f544c1-3007-4ea5-9758-c53f9818cf89"
          ],
          "display_name": false
        },
        {
          "uuid": "cdc1125c-d06b-4f73-aa94-fa3ffd08a83e",
          "name": "CI 16185",
          "stdName": "CI 16185",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "a476836e-9851-44a7-af3b-cbc482cf43e7",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "14747b73-17fe-451a-8e77-fa0fefa33367",
            "f708c48d-681c-4309-8e32-08b9294e6825",
            "737bf18b-6e27-485c-8f7d-3c35d2090db1"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "7b5642b2-86c9-43e4-8874-8c670c762203",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "92bbf980-f0e2-402d-b92b-9c6926301064",
          "name": "CI-(1975)NO.16185",
          "stdName": "CI-(1975)NO.16185",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "8720af87-9ee1-492f-bad1-4157d4f20eb8",
          "name": "CI-FOOD RED 9",
          "stdName": "CI-FOOD RED 9",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "9a2d3517-894f-4530-a6db-3197473ddb6f",
          "name": "E-123",
          "stdName": "E-123",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "9da59d65-5c9c-4d94-80a1-4703909f8ae1",
          "name": "FD&C RED NO. 2 (DELISTED)",
          "stdName": "FD&C RED NO. 2 (DELISTED)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4b445b76-fd44-4e76-81e3-41ada927f16b",
            "321f20bc-93c1-4180-84ff-293c990acc4a"
          ],
          "display_name": false
        },
        {
          "uuid": "75970f20-100a-49a2-b987-fa2e3e65bee5",
          "name": "FD&C RED NO. 2 (DELISTED) [II]",
          "stdName": "FD&C RED NO. 2 (DELISTED) [II]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4b445b76-fd44-4e76-81e3-41ada927f16b"
          ],
          "display_name": false
        },
        {
          "uuid": "f06e2070-d54d-4ea7-9242-d4d1a752a454",
          "name": "INS NO.123",
          "stdName": "INS NO.123",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "067e89d5-c2b4-432d-9c81-1565e009b5f3",
          "name": "INS-123",
          "stdName": "INS-123",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "2c3af6b7-2854-4511-9711-745086705c88",
          "name": "NAPHTOL ROT S.",
          "stdName": "NAPHTOL ROT S.",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "4694672f-a8dc-4a10-9c5e-ceea87362447"
          ],
          "display_name": false
        },
        {
          "uuid": "083ffda1-03af-4c3e-a486-6dff3bbf2d60",
          "name": "NSC-215207",
          "stdName": "NSC-215207",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "139eef90-e6ae-4e82-b50e-60a07b822407",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34"
          ],
          "display_name": false
        },
        {
          "uuid": "d805ac0f-43ab-4784-b0ae-a98686cff937",
          "name": "NSC-4300",
          "stdName": "NSC-4300",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "139eef90-e6ae-4e82-b50e-60a07b822407",
            "ef3e952f-fea4-4860-be62-b0fc0154ca34"
          ],
          "display_name": false
        },
        {
          "uuid": "b726ef0f-b131-4160-8847-53ed3472704d",
          "name": "RED NO. 2",
          "stdName": "RED NO. 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ef3e952f-fea4-4860-be62-b0fc0154ca34",
            "148deb43-7802-4111-80eb-ded595f9f502"
          ],
          "display_name": false
        },
        {
          "uuid": "02ae6fcc-772b-488a-8848-e16eb0291b87",
          "name": "TRISODIUM 3-HYDROXY-4-((E)-(4-SULFONATO-1-NAPHTHYL)DIAZENYL)NAPHTHALENE-2,7-DISULFONATE",
          "stdName": "TRISODIUM 3-HYDROXY-4-((E)-(4-SULFONATO-1-NAPHTHYL)DIAZENYL)NAPHTHALENE-2,7-DISULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb7cef92-182a-47ef-8a11-367895ee979c",
            "f708c48d-681c-4309-8e32-08b9294e6825"
          ],
          "display_name": false
        },
        {
          "uuid": "6758ae47-c5af-4e06-a486-1c9880041fa3",
          "name": "TRISODIUM 3-HYDROXY-4-((E)-(4-SULPHONATO-1-NAPHTHYL)DIAZENYL)NAPHTHALENE-2,7-DISULPHONATE",
          "stdName": "TRISODIUM 3-HYDROXY-4-((E)-(4-SULPHONATO-1-NAPHTHYL)DIAZENYL)NAPHTHALENE-2,7-DISULPHONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "413a384c-174c-4d09-a611-55fc5ed4c758"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "802ed5c4-2670-42fd-8896-fdce58641451",
          "citation": "JOURNAL ARTICLE",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f708c48d-681c-4309-8e32-08b9294e6825",
          "citation": "CTFA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "14747b73-17fe-451a-8e77-fa0fefa33367",
          "citation": "CTFA 2006",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb7cef92-182a-47ef-8a11-367895ee979c",
          "citation": "ACD 9.0(CTFA 2006)",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "07f544c1-3007-4ea5-9758-c53f9818cf89",
          "citation": "http://en.wikipedia.org/wiki/Amaranth_(dye)",
          "url": "http://en.wikipedia.org/wiki/Amaranth_(dye)",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ef3e952f-fea4-4860-be62-b0fc0154ca34",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "148deb43-7802-4111-80eb-ded595f9f502",
          "citation": "Merck",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b445b76-fd44-4e76-81e3-41ada927f16b",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ff0c3fa3-02a7-43dc-9ad8-bfca1c361d60",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "413a384c-174c-4d09-a611-55fc5ed4c758",
          "citation": "FDA-SRS 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b839e1c4-7593-4280-bd08-7e700b17b3cc",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6c5ac930-ddff-4d3c-a6f8-37292cf75a0f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a476836e-9851-44a7-af3b-cbc482cf43e7",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a7f61c32-3205-4a4e-abcc-7922320df50d",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67984032-30a4-4d3a-a4de-5ff58ab10e2d",
          "citation": "LANGUAL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c69faa26-ea50-4c15-86e9-7a760f3f1642",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "616056ed-133a-4834-90f7-64e75d9249bf",
          "citation": "usp",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ce746ead-753d-4554-922d-7a3bf621cbeb",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2a743a36-6f6b-4704-bec0-f553748156d1",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4694672f-a8dc-4a10-9c5e-ceea87362447",
          "citation": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=105",
          "url": "http://www.codexalimentarius.net/gsfaonline/additives/details.html?id=105",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "139eef90-e6ae-4e82-b50e-60a07b822407",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45b5f642-2c0d-4f73-8456-499341f648cb",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390518000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1fc136dc-0054-4702-99b4-efc4dd7c684d",
          "citation": "SRS import [37RBV3X49K]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=37RBV3X49K",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390518000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "20a2f415-12ad-4bde-bf94-eb34f0ff0e6a",
          "citation": "AMARANTH [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "80d191d8-8952-4bd2-bf2f-0d2c98a947d0",
          "citation": "AMARANTH (DYE) [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4d3c1fe5-84d0-42d8-9e28-32a01a30f45b",
          "citation": "ACID RED 27 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "737bf18b-6e27-485c-8f7d-3c35d2090db1",
          "citation": "CI 16185 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "321f20bc-93c1-4180-84ff-293c990acc4a",
          "citation": "FD&C RED NO. 2 (DELISTED) [II]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "59148000-25ff-473a-8a7c-40fcf164faee",
          "citation": "AKA2 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb2d648d-88e2-623f-fb4a-c116565ab274",
          "citation": "WIKI",
          "url": "https://en.wikipedia.org/wiki/FD&C_Red%20No.%202",
          "doc_type": "WIKI",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "31b5cf39-d625-a973-04d6-35ace2c631cb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+915-67-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "90d96d1f-f752-a7bc-d004-29026ee04943",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=915-67-3",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6d5d176c-aa69-6254-0d42-5a1aa8b84ad5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "064710af-e646-9996-5052-700236d3db0c",
          "citation": "IARC",
          "doc_type": "IARC",
          "public_domain": true
        },
        {
          "uuid": "ec49006c-104a-5319-8ac8-52fdb43d7319",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7e669393-26ac-4a8c-9db2-3868f54ac400",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "8f671b45-82bb-9fe0-729d-84fd816d8810",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "3a49997b-2e7d-c417-2a29-10d6f5735fe4",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "c33844d5-007e-3c8c-dc30-9f709d1b89c0",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d6f08098-1e03-427b-be7f-1dcc8d86b0d3",
          "id": "d6f08098-1e03-427b-be7f-1dcc8d86b0d3",
          "molfile": "\n  Marvin  01132111082D          \n\n  1  0  0  0  0  0            999 V2000\n    3.6404    1.3424    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 3,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 3,
            "units": "MOL RATIO",
            "uuid": "522c42bc-43bf-402e-8c2a-46d23f608b72"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "85be684b-845c-45af-a861-9c66d8187eac",
          "id": "85be684b-845c-45af-a861-9c66d8187eac",
          "molfile": "\n  Marvin  01132106562D          \n\n 35 38  0  0  0  0            999 V2000\n    5.5398   -1.4157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8245   -1.8320    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4084   -2.5471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2378   -2.5500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1067   -1.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1004   -0.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3825   -0.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6732   -0.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9551   -0.1905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2398   -0.6067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5218   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5208    0.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2353    1.0463    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.1964    1.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9119    0.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9014   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6090   -0.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6042   -1.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8857   -1.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1810   -1.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1877   -0.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3244   -1.8495    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0395   -1.4333    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.7377   -2.5676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9111   -2.5676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2022    1.8700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9203    2.2804    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.6273    1.8700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2081    2.5882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6796   -1.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9693   -1.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9697   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6862   -3.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3935   -2.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3913   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 35  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 30  2  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 21 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 14 26  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 22  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 22 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\n 26 29  2  0  0  0  0\n 30 31  1  0  0  0  0\n 35 30  1  0  0  0  0\n 31 32  2  0  0  0  0\n 32 33  1  0  0  0  0\n 33 34  2  0  0  0  0\n 34 35  1  0  0  0  0\nM  CHG  3  13  -1  23  -1  27  -1\nM  END",
          "smiles": "c1ccc2c(c1)c(ccc2S(=O)(=O)O)/N=N/c3c4ccc(cc4cc(c3[O-])S(=O)(=O)[O-])S(=O)(=O)[O-]",
          "formula": "C20H11N2O10S3",
          "atropisomerism": "No",
          "charge": -3,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "e6630b09-4fa2-4a8d-8203-0409093db619"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "535.5078",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ddaf50a3-d8c2-4c5e-bb17-75be6a7c6e9e",
      "version": "21",
      "structure": {
        "id": "4e397d50-f453-4ed0-825d-944db3e07d4b",
        "molfile": "\n  Marvin  01132104052D          \n\n 38 38  0  0  0  0            999 V2000\n    0.5218   -0.1964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2398   -0.6067    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9551   -0.1905    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6732   -0.6009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1067   -1.4225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1004   -0.5912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3825   -0.1847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3913   -1.8393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6796   -1.4277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9693   -1.8384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9697   -2.6603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6862   -3.0700    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3935   -2.6570    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8245   -1.8320    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5398   -1.4157    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    4.4084   -2.5471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2378   -2.5500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5208    0.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1964    1.0420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9119    0.6253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1877   -0.6126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9014   -0.2051    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6090   -0.6194    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6042   -1.4410    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8857   -1.8466    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1810   -1.4300    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2353    1.0463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2022    1.8700    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9203    2.2804    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    0.6273    1.8700    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2081    2.5882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3244   -1.8495    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.0395   -1.4333    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.7377   -2.5676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.9111   -2.5676    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6404    1.3424    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.6404    1.3424    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    3.6404    1.3424    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  1 18  2  0  0  0  0\n  3  4  1  0  0  0  0\n 18 19  1  0  0  0  0\n  8  9  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 22  1  0  0  0  0\n 21  1  1  0  0  0  0\n  4  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 21 22  1  0  0  0  0\n  1  2  1  0  0  0  0\n 22 23  2  0  0  0  0\n 10 11  2  0  0  0  0\n 23 24  1  0  0  0  0\n  8  5  2  0  0  0  0\n 24 25  2  0  0  0  0\n 11 12  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 21  2  0  0  0  0\n 18 27  1  0  0  0  0\n 12 13  2  0  0  0  0\n 19 28  1  0  0  0  0\n 13  8  1  0  0  0  0\n 28 29  1  0  0  0  0\n  5  6  1  0  0  0  0\n 28 30  2  0  0  0  0\n  5 14  1  0  0  0  0\n 28 31  2  0  0  0  0\n  2  3  2  0  0  0  0\n 24 32  1  0  0  0  0\n 14 15  1  0  0  0  0\n 32 33  1  0  0  0  0\n  6  7  2  0  0  0  0\n 32 34  2  0  0  0  0\n 14 16  2  0  0  0  0\n 32 35  2  0  0  0  0\n  7  4  1  0  0  0  0\n 14 17  2  0  0  0  0\nM  CHG  6  15  -1  29  -1  33  -1  36   1  37   1  38   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  3  36  37  38\nM  SPA   1  1  36\nM  SDI   1  4    3.2204    0.9224    3.2204    1.7624\nM  SDI   1  4    4.0604    1.7624    4.0604    0.9224\nM  SMT   1 3\nM  END",
        "smiles": "c1ccc2c(c1)c(ccc2S(=O)(=O)[O-])/N=N/c3c4ccc(cc4cc(c3O)S(=O)(=O)[O-])S(=O)(=O)[O-].[Na+].[Na+].[Na+]",
        "formula": "C20H11N2O10S3.3Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "604.4771",
        "optical_activity": "NONE",
        "references": [
          "1fc136dc-0054-4702-99b4-efc4dd7c684d",
          "14747b73-17fe-451a-8e77-fa0fefa33367"
        ],
        "stereo_centers": 0
      },
      "unii": "37RBV3X49K"
    }
  ]
}