{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "88af2a85-1ad0-4bdd-925e-70af28b4cb3b", "code": "24448-20-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=24448-20-2", "code_system": "CAS", "references": [ "b4c960fe-e75e-4dc0-a2ad-6d1b46a2657a", "61815449-34ca-47b2-9acb-2321dfd7f890" ] }, { "uuid": "538d38f0-1542-4e8e-9990-633496c7f78f", "code": "246-263-7", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.042.042", "code_system": "ECHA (EC/EINECS)", "references": [ "b4c960fe-e75e-4dc0-a2ad-6d1b46a2657a" ] }, { "uuid": "48072740-1e2b-4869-9060-1c014d8ac2d8", "code": "90508", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/90508", "code_system": "PUBCHEM", "references": [ "b4c960fe-e75e-4dc0-a2ad-6d1b46a2657a" ] }, { "uuid": "76f4d9ef-802a-f2f1-60a6-2a307ac37e2c", "code": "DTXSID1066992", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1066992", "code_system": "EPA CompTox", "references": [ "a3edff2c-4d96-1bb1-3fed-84efda19c1dd" ] }, { "uuid": "0dc8759d-a8d4-4253-afe8-615ae55c155c", "code": "37N3AE7XTL", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "158fec65-fe70-45ef-9456-f723ac51d1b8", "name": "2-Propenoic acid, 2-methyl-, 1,1′-[(1-methylethylidene)bis(4,1-phenyleneoxy-2,1-ethanediyl)] ester", "stdName": "2-PROPENOIC ACID, 2-METHYL-, 1,1'-((1-METHYLETHYLIDENE)BIS(4,1-PHENYLENEOXY-2,1-ETHANEDIYL)) ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "61815449-34ca-47b2-9acb-2321dfd7f890" ], "display_name": false }, { "uuid": "5b17f990-e2b1-4dbe-aa0f-9251aff94459", "name": "Bisphenol A bis(2-hydroxyethyl ether) dimethacrylate", "stdName": "BISPHENOL A BIS(2-HYDROXYETHYL ETHER) DIMETHACRYLATE", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "9a86815b-3a9f-4b74-8cfb-e38590abb262", "e33a1d3d-71d6-4074-a1ac-ce8124f3ab94" ], "display_name": true } ], "references": [ { "uuid": "9a86815b-3a9f-4b74-8cfb-e38590abb262", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e33a1d3d-71d6-4074-a1ac-ce8124f3ab94", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "b4c960fe-e75e-4dc0-a2ad-6d1b46a2657a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393975000, "tags": [ "NOMEN" ] }, { "uuid": "a3edff2c-4d96-1bb1-3fed-84efda19c1dd", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=24448-20-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "61815449-34ca-47b2-9acb-2321dfd7f890", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "2b138d1c-94d8-487f-b397-aa49681da14c", "id": "2b138d1c-94d8-487f-b397-aa49681da14c", "molfile": "\n Marvin 01132102202D \n\n 33 34 0 0 0 0 999 V2000\n -2.3721 -3.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6455 -3.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6379 -2.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9384 -3.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9470 -4.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2195 -3.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4881 -3.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2032 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9153 -3.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6345 -3.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6450 -2.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3614 -2.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0714 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0651 -3.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3446 -3.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7817 -2.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4933 -1.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0668 -1.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4990 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2090 -2.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9254 -2.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9359 -3.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6551 -3.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3672 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0823 -3.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7899 -3.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5088 -3.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5174 -4.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2159 -3.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9425 -3.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2083 -2.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2258 -3.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5053 -3.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 2 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 2 0 0 0 0\n 4 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 15 10 2 0 0 0 0\n 11 12 2 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 16 1 0 0 0 0\n 14 15 1 0 0 0 0\n 16 17 1 0 0 0 0\n 16 18 1 0 0 0 0\n 19 16 1 0 0 0 0\n 20 19 1 0 0 0 0\n 19 33 2 0 0 0 0\n 21 20 2 0 0 0 0\n 22 21 1 0 0 0 0\n 23 22 1 0 0 0 0\n 32 22 2 0 0 0 0\n 24 23 1 0 0 0 0\n 25 24 1 0 0 0 0\n 26 25 1 0 0 0 0\n 27 26 1 0 0 0 0\n 28 27 2 0 0 0 0\n 27 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 33 32 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCOc1ccc(cc1)C(C)(C)c2ccc(cc2)OCCOC(=O)C(=C)C", "formula": "C27H32O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "90c4a7c5-45f8-4d22-a560-ea970f244a69" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "452.5404", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e05b961e-7904-487d-ad48-0f8c4bb538fd", "version": "5", "structure": { "id": "262c3829-3443-44b1-9178-6f2310936f22", "molfile": "\n Marvin 01132102072D \n\n 33 34 0 0 0 0 999 V2000\n -0.9470 -4.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.9384 -3.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.2195 -3.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.4881 -3.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.2032 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.9153 -3.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6345 -3.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6450 -2.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3614 -2.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0714 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0651 -3.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3446 -3.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6455 -3.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.3721 -3.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.6379 -2.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7817 -2.3273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5174 -4.7396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 10.5088 -3.9142 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.7899 -3.5137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 9.0823 -3.9333 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.3672 -3.5304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.6551 -3.9527 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9359 -3.5486 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.9254 -2.7207 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2090 -2.3202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4990 -2.7403 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.5053 -3.5609 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2258 -3.9687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2159 -3.4948 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.9425 -3.8956 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.2083 -2.6677 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.4933 -1.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.0668 -1.9147 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 7 2 0 0 0 0\n 2 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 13 15 2 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 2 0 0 0 0\n 27 28 1 0 0 0 0\n 28 23 2 0 0 0 0\n 18 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 29 31 2 0 0 0 0\n 26 16 1 0 0 0 0\n 16 32 1 0 0 0 0\n 10 16 1 0 0 0 0\n 16 33 1 0 0 0 0\nM END", "smiles": "C=C(C)C(=O)OCCOc1ccc(cc1)C(C)(C)c2ccc(cc2)OCCOC(=O)C(=C)C", "formula": "C27H32O6", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "452.5404", "optical_activity": "NONE", "references": [ "9a86815b-3a9f-4b74-8cfb-e38590abb262" ], "stereo_centers": 0 }, "unii": "37N3AE7XTL" } ] }