{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "2b2176c4-3b67-4891-ac2b-2f0463ce588f",
          "code": "15662-33-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=15662-33-6",
          "code_system": "CAS",
          "references": [
            "65057244-6a07-44c5-8ca2-959b5bbb48ce",
            "2bc240ce-7163-4f0b-b63b-e8e84d32aa4f"
          ]
        },
        {
          "uuid": "4fe5d098-c7fe-4eb5-af55-9d3b6950bb62",
          "code": "71502",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:3723",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "65057244-6a07-44c5-8ca2-959b5bbb48ce"
          ]
        },
        {
          "uuid": "46b8f505-21da-441e-a87b-2fc9cebf3793",
          "code": "m9712",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9712?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "65057244-6a07-44c5-8ca2-959b5bbb48ce"
          ]
        },
        {
          "uuid": "abce97ca-dd94-4205-ad36-e6da3832f692",
          "code": "441753",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/441753",
          "code_system": "PUBCHEM",
          "references": [
            "65057244-6a07-44c5-8ca2-959b5bbb48ce"
          ]
        },
        {
          "uuid": "dffd3f49-26a8-4a6a-b256-cfc331332bd0",
          "code": "239-732-2",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.036.105",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "65057244-6a07-44c5-8ca2-959b5bbb48ce"
          ]
        },
        {
          "uuid": "e4e950a9-b153-63c9-c146-04011ea2d7c9",
          "code": "DTXSID0032574",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID0032574",
          "code_system": "EPA CompTox",
          "references": [
            "7319f0e3-62e1-0115-b6cf-b870c1e4d2f3"
          ]
        },
        {
          "uuid": "0116351a-2dff-0894-c9b9-2eef3396b3ca",
          "code": "8047-13-0",
          "type": "SUPERSEDED",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=8047-13-0",
          "code_system": "CAS",
          "references": [
            "2bc240ce-7163-4f0b-b63b-e8e84d32aa4f"
          ]
        },
        {
          "uuid": "d8b81d7f-4e73-4fdb-97d6-1c9e6cd9d0f6",
          "code": "37H6ATE4SA",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ee34fcb6-4141-c59f-3c50-ea3eb1f3caca",
          "code": "8925",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:8925",
          "code_system": "CHEBI",
          "references": [
            "be255c84-769a-d52d-d78b-45865df309d8"
          ]
        },
        {
          "uuid": "580cb717-4da1-2de8-5155-03143da1c331",
          "code": "Ryanodine",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Ryanodine",
          "code_system": "WIKIPEDIA",
          "references": [
            "f36f7d4b-aeda-057e-9130-515f51307ec1"
          ]
        },
        {
          "uuid": "aa429b49-892c-8dd0-8739-25bb60e025d1",
          "code": "114572",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=114572",
          "code_system": "NSC",
          "references": [
            "7b5d36e0-1c81-0297-46af-8d15e8a9bbb6"
          ]
        },
        {
          "uuid": "b75e1f98-8561-5877-0a17-5ab19267918d",
          "code": "ryania",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/ryania.html",
          "code_system": "ALANWOOD",
          "references": [
            "24a1c39e-b5fc-c636-e268-dc0f00698280"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "071df9be-2637-484e-87fc-9629b3945c32",
          "name": "(+)-RYANODINE",
          "stdName": "(+)-RYANODINE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7283f4da-9224-4e0e-8076-6da77b4670e1"
          ],
          "display_name": false
        },
        {
          "uuid": "3f9b2306-d201-41ee-8d31-f588a859383f",
          "name": "1H-PYRROLE-2-CARBOXYLIC ACID, (3S,4R,4AR,6S,6AS,7S,8R,8AS,8BR,9S,9AS)-DODECAHYDRO-4,6,7,8A,8B,9A-HEXAHYDROXY-3,6A,9-TRIMETHYL-7-(1-METHYLETHYL)-6,9-METHANOBENZO(1,2)PENTALENO(1,6-BC)FURAN-8-YL ESTER",
          "stdName": "1H-PYRROLE-2-CARBOXYLIC ACID, (3S,4R,4AR,6S,6AS,7S,8R,8AS,8BR,9S,9AS)-DODECAHYDRO-4,6,7,8A,8B,9A-HEXAHYDROXY-3,6A,9-TRIMETHYL-7-(1-METHYLETHYL)-6,9-METHANOBENZO(1,2)PENTALENO(1,6-BC)FURAN-8-YL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7283f4da-9224-4e0e-8076-6da77b4670e1"
          ],
          "display_name": false
        },
        {
          "uuid": "494e6c73-00ea-4fd0-93b5-10eb1da6a7a0",
          "name": "NSC-114572",
          "stdName": "NSC-114572",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bea233b-0d64-4528-b22e-3e507ace801c"
          ],
          "display_name": false
        },
        {
          "uuid": "6014bac6-189c-4bbe-899f-29e91397ba3a",
          "name": "RYANEX",
          "stdName": "RYANEX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7283f4da-9224-4e0e-8076-6da77b4670e1"
          ],
          "display_name": false
        },
        {
          "uuid": "38cbd420-3669-4097-8e37-6ea1c9640930",
          "name": "RYANIA",
          "stdName": "RYANIA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bea233b-0d64-4528-b22e-3e507ace801c",
            "933eef9c-7609-4601-b70e-228bb5123de9",
            "45a5f2ce-3012-44d2-aef1-4a5f9d26b7a1"
          ],
          "display_name": true
        },
        {
          "uuid": "389b9f1c-af9b-4403-9bfb-34cd600c29f3",
          "name": "RYANIA [ISO]",
          "stdName": "RYANIA [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9bea233b-0d64-4528-b22e-3e507ace801c"
          ],
          "display_name": false
        },
        {
          "uuid": "7598cb39-6691-4fe6-9b9a-426faa394202",
          "name": "RYANICIDE",
          "stdName": "RYANICIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7283f4da-9224-4e0e-8076-6da77b4670e1"
          ],
          "display_name": false
        },
        {
          "uuid": "e6711e1d-fdde-452c-aa73-8d10ee778dc0",
          "name": "RYANODIN",
          "stdName": "RYANODIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7283f4da-9224-4e0e-8076-6da77b4670e1"
          ],
          "display_name": false
        },
        {
          "uuid": "36868c8e-d2c2-4aa3-95cd-b635c2240e20",
          "name": "RYANODINE [MI]",
          "stdName": "RYANODINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d0047224-52b1-41d2-b104-6d3f6c32a50b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d0047224-52b1-41d2-b104-6d3f6c32a50b",
          "citation": "MERCK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "65057244-6a07-44c5-8ca2-959b5bbb48ce",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0c80b788-9797-4caf-ab6e-bbabc10934f4",
          "citation": "SRS import [37H6ATE4SA]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=37H6ATE4SA",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392018000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "45a5f2ce-3012-44d2-aef1-4a5f9d26b7a1",
          "citation": "RYANIA [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "933eef9c-7609-4601-b70e-228bb5123de9",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "7283f4da-9224-4e0e-8076-6da77b4670e1",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9bea233b-0d64-4528-b22e-3e507ace801c",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7319f0e3-62e1-0115-b6cf-b870c1e4d2f3",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=15662-33-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f36f7d4b-aeda-057e-9130-515f51307ec1",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "2bc240ce-7163-4f0b-b63b-e8e84d32aa4f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "24a1c39e-b5fc-c636-e268-dc0f00698280",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "be255c84-769a-d52d-d78b-45865df309d8",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "7b5d36e0-1c81-0297-46af-8d15e8a9bbb6",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "f42ffab0-c119-4d8f-8910-4d4fed0469e2",
          "id": "f42ffab0-c119-4d8f-8910-4d4fed0469e2",
          "molfile": "\n  Marvin  01132112402D          \n\n 35 40  0  0  1  0            999 V2000\n    7.8440   -6.0106    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    7.1160   -5.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0879   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7879   -4.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3598   -4.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2458   -3.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4334   -3.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0455   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6180   -4.7712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9002   -6.8337    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    7.8125   -7.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0754   -6.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6492   -7.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6767   -6.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.7097   -6.9925    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    8.6602   -7.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4782   -7.4362    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n    9.9210   -8.2607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5934   -3.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1549   -4.9453    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.8877   -4.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8958   -5.3082    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    9.8677   -4.4837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6642   -4.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4327   -5.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4327   -6.1956    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   12.1472   -6.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6642   -6.6393    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.6642   -7.4643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8958   -6.1956    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   10.1629   -6.9761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0727   -6.2517    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    9.4356   -5.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6126   -5.5669    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    8.4263   -6.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1 10  1  0  0  0  0\n 34  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  5  9  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  6  0  0  0\n 10 12  1  0  0  0  0\n 15 10  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  1  0  0  0  0\n 15 16  1  6  0  0  0\n 15 17  1  0  0  0  0\n 32 15  1  0  0  0  0\n 17 18  1  1  0  0  0\n 17 19  1  0  0  0  0\n 17 31  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  1  6  0  0  0\n 20 22  1  0  0  0  0\n 20 34  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22 24  1  0  0  0  0\n 22 30  1  0  0  0  0\n 24 25  1  0  0  0  0\n 26 25  1  0  0  0  0\n 26 27  1  6  0  0  0\n 28 26  1  0  0  0  0\n 28 29  1  1  0  0  0\n 30 28  1  0  0  0  0\n 30 31  1  1  0  0  0\n 32 30  1  0  0  0  0\n 32 33  1  6  0  0  0\n 34 32  1  0  0  0  0\n 34 35  1  6  0  0  0\nM  END",
          "smiles": "CC(C)[C@]1([C@H]([C@]2([C@@]3(C)C[C@]4([C@]1(C)[C@@]2([C@]5([C@@H]([C@@H](C)CC[C@]35O)O)O4)O)O)O)OC(=O)c6ccc[nH]6)O",
          "formula": "C25H35NO9",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1ab30045-f0cd-4d12-a28a-644ce7133629"
          },
          "defined_stereo": 11,
          "ez_centers": 0,
          "molecular_weight": "493.5477",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 11
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "158976b1-42dd-4129-b324-a46222304fb9",
      "version": "12",
      "structure": {
        "id": "b9bec23d-6edc-4125-8e1c-24efee542f16",
        "molfile": "\n  Marvin  01132109372D          \n\n 35 40  0  0  1  0            999 V2000\n    9.4356   -5.5108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0727   -6.2517    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.7097   -6.9925    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    9.4782   -7.4362    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    9.9210   -8.2607    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5934   -3.3579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1549   -4.9453    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.8877   -4.1648    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6126   -5.5669    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.8440   -6.0106    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    7.1160   -5.6227    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0879   -4.7982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3598   -4.4102    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6180   -4.7712    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.0455   -4.1773    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4334   -3.4492    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2458   -3.5931    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7879   -4.3616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9002   -6.8337    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    7.8125   -7.6540    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0754   -6.8178    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6492   -7.5242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6767   -6.0956    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4263   -6.3706    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8958   -5.3082    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6642   -4.8645    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4327   -5.3082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.4327   -6.1956    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.1472   -6.6081    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6642   -6.6393    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   10.6642   -7.4643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8958   -6.1956    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   10.1629   -6.9761    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8677   -4.4837    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6602   -7.9179    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  6  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  1  0  0  0\n  7  6  1  1  0  0  0\n  7  8  1  0  0  0  0\n  2  9  1  0  0  0  0\n  9  7  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  1  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  2  0  0  0  0\n 17 16  1  0  0  0  0\n 13 17  2  0  0  0  0\n 12 18  2  0  0  0  0\n  3 19  1  0  0  0  0\n 10 19  1  0  0  0  0\n 19 20  1  6  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  1  0  0  0  0\n  9 24  1  6  0  0  0\n 25  7  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 28 27  1  0  0  0  0\n 28 29  1  6  0  0  0\n 30 28  1  0  0  0  0\n 30 31  1  1  0  0  0\n 32 30  1  0  0  0  0\n 32 25  1  0  0  0  0\n  2 32  1  0  0  0  0\n 32 33  1  1  0  0  0\n 33  4  1  0  0  0  0\n 25 34  1  6  0  0  0\n  3 35  1  6  0  0  0\nM  END",
        "smiles": "CC(C)[C@]1([C@H]([C@]2([C@@]3(C)C[C@]4([C@]1(C)[C@@]2([C@]5([C@@H]([C@@H](C)CC[C@]35O)O)O4)O)O)O)OC(=O)c6ccc[nH]6)O",
        "formula": "C25H35NO9",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 11,
        "ez_centers": 0,
        "molecular_weight": "493.5477",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "933eef9c-7609-4601-b70e-228bb5123de9",
          "0c80b788-9797-4caf-ab6e-bbabc10934f4"
        ],
        "stereo_centers": 11
      },
      "unii": "37H6ATE4SA"
    }
  ]
}