{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "5b2edf3f-fbef-44e2-b6bf-219c14f3e3e9",
          "code": "69256-17-3",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=69256-17-3",
          "code_system": "CAS",
          "references": [
            "f7156af8-6396-44b2-a6af-f92bea9acc51",
            "8e5b7a05-976c-401b-a48c-f3ab81762973"
          ]
        },
        {
          "uuid": "b636e549-0a1a-4ebd-82ff-ef573680a23e",
          "code": "72327",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72327",
          "code_system": "PUBCHEM",
          "references": [
            "f7156af8-6396-44b2-a6af-f92bea9acc51"
          ]
        },
        {
          "uuid": "059523d5-d688-4355-bfdf-720e50f9778d",
          "code": "37F7D05ANB",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "2d0d6499-e6c3-67e1-cbb0-31870ed9a9e8",
          "code": "678516",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=678516",
          "code_system": "NSC",
          "references": [
            "f137439f-49e4-ac69-cba3-63c4dc098262"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "d7747be5-d5e8-4f3f-9498-7b183f3012bd",
          "type": "ACTIVE MOIETY",
          "references": [
            "4b3c0a67-8f53-4c3b-ba49-f720fb4764cc"
          ],
          "related_substance": {
            "uuid": "c9fe5816-2a8e-457b-804c-2768e05a67e2",
            "refuuid": "c6134d1d-f93e-4f90-ab25-3cc1dd480def",
            "name": "5-METHYL-2'-FLUOROARAURACIL",
            "unii": "37F7D05ANB",
            "linking_id": "37F7D05ANB",
            "ref_pname": "5-METHYL-2'-FLUOROARAURACIL",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2c22c63f-35a3-46f1-9946-4844961f6a30",
          "type": "LABELED->NON-LABELED",
          "references": [
            "cbf0ecb5-eb22-46f4-bfd8-6e7ce56352ee"
          ],
          "related_substance": {
            "uuid": "d2662b65-fe37-474c-b7c0-63872bb4d551",
            "refuuid": "7cbf7ce0-5662-e9fd-4f24-744d2b7ea0a8",
            "name": "5-METHYL-2'-FLUOROARAURACIL C-11",
            "unii": "2M23U3SV8L",
            "linking_id": "2M23U3SV8L",
            "ref_pname": "5-METHYL-2'-FLUOROARAURACIL C-11"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "19d7e604-9a82-47aa-a5cf-ec56a867dbef",
          "name": "1-(2'-DEOXY-2'-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYLURACIL",
          "stdName": "1-(2'-DEOXY-2'-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYLURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": false
        },
        {
          "uuid": "0b8041cf-d6d6-464e-b1b8-5512d458099d",
          "name": "1-(2-DEOXY-2-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYLURACIL",
          "stdName": "1-(2-DEOXY-2-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYLURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "62708861-3380-4c47-9d1d-c3ed90fb1322"
          ],
          "display_name": false
        },
        {
          "uuid": "01a21408-e9e8-4467-9800-b153de29791a",
          "name": "1-(2-FLUORO-2-DEOXY-.BETA.-D-ARABINOFURANOSYL)THYMINE",
          "stdName": "1-(2-FLUORO-2-DEOXY-.BETA.-D-ARABINOFURANOSYL)THYMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b3c0a67-8f53-4c3b-ba49-f720fb4764cc",
            "210242e4-2939-4561-8f84-55cca9641001"
          ],
          "display_name": false
        },
        {
          "uuid": "16301c05-f966-44d5-9fd2-330ad3dd20d0",
          "name": "2'-FLUORO-5-METHYL-1-.BETA.-D-ARABINOFURANOSYLURACIL",
          "stdName": "2'-FLUORO-5-METHYL-1-.BETA.-D-ARABINOFURANOSYLURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": false
        },
        {
          "uuid": "f4fa27c7-18e3-4181-bc84-39b425e71399",
          "name": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-DEOXY-2-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYL-",
          "stdName": "2,4(1H,3H)-PYRIMIDINEDIONE, 1-(2-DEOXY-2-FLUORO-.BETA.-D-ARABINOFURANOSYL)-5-METHYL-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": false
        },
        {
          "uuid": "0263431a-955c-4c65-9997-8fe8e311d5f0",
          "name": "5-METHYL-2'-FLUOROARAURACIL",
          "stdName": "5-METHYL-2'-FLUOROARAURACIL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": true
        },
        {
          "uuid": "28a741dc-7f70-498c-b3ca-b66186c3a814",
          "name": "D-FMAU",
          "stdName": "D-FMAU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": false
        },
        {
          "uuid": "b607538f-385f-4b16-817a-95dfbabd3576",
          "name": "FMAU",
          "stdName": "FMAU",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "210242e4-2939-4561-8f84-55cca9641001",
            "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
          ],
          "display_name": false
        },
        {
          "uuid": "f42a5943-0452-4917-aaa7-bee92c65ea6b",
          "name": "J61.760A",
          "stdName": "J61.760A",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4b3c0a67-8f53-4c3b-ba49-f720fb4764cc",
            "210242e4-2939-4561-8f84-55cca9641001"
          ],
          "display_name": false
        },
        {
          "uuid": "1f9abe34-0f44-4f87-3171-2f2f9f3e4cb6",
          "name": "NSC-678516",
          "stdName": "NSC-678516",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f137439f-49e4-ac69-cba3-63c4dc098262"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "4b3c0a67-8f53-4c3b-ba49-f720fb4764cc",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J61.760A",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J61.760A",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "210242e4-2939-4561-8f84-55cca9641001",
          "citation": "JAPAN CHEMICAL SUBSTANCE DICTIONARY",
          "doc_type": "JAPAN CHEMICAL SUBSTANCE DICTIONARY",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "62708861-3380-4c47-9d1d-c3ed90fb1322",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f7156af8-6396-44b2-a6af-f92bea9acc51",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4bd09909-c602-40c6-b2d1-c5aa8529d15f",
          "citation": "SRS import [37F7D05ANB]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=37F7D05ANB",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393331000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8e5b7a05-976c-401b-a48c-f3ab81762973",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "cbf0ecb5-eb22-46f4-bfd8-6e7ce56352ee",
          "citation": "Conti, Peter S., et al. \"Synthesis of 2′-fluoro-5-[11C]-methyl-1-β-d-arabinofuranosyluracil ([11C]-FMAU): a potential nucleoside analog for in vivo study of cellular proliferation with PET.\" Nuclear medicine and biology 22.6 (1995): 783-789.",
          "url": "https://www.sciencedirect.com/science/article/pii/096980519500017R",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f137439f-49e4-ac69-cba3-63c4dc098262",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ce4262d1-4ca3-4ccf-af9a-1bcfe04ad9cb",
          "id": "ce4262d1-4ca3-4ccf-af9a-1bcfe04ad9cb",
          "molfile": "\n  Marvin  01132110392D          \n\n 18 19  0  0  1  0            999 V2000\n   -1.0063   -2.2148    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n   -1.7922   -1.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4027   -2.5186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3413   -1.7266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.3285   -2.2083    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.1119   -1.9496    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7277   -2.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5111   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1268   -2.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6787   -1.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4621   -1.1734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0630   -0.8831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2795   -1.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6638   -0.5928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0773   -2.9942    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    0.5655   -3.6593    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7476   -2.9982    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   -1.2293   -3.6680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  1  0  0  0\n  1  4  1  0  0  0  0\n 17  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  5  4  1  1  0  0  0\n  5  6  1  0  0  0  0\n 15  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n 13  6  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  8  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  2  0  0  0  0\n 15 16  1  1  0  0  0\n 17 15  1  0  0  0  0\n 17 18  1  6  0  0  0\nM  END",
          "smiles": "Cc1cn([C@H]2[C@H]([C@@H]([C@@H](CO)O2)O)F)c(=O)[nH]c1=O",
          "formula": "C10H13FN2O5",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "50679415-008f-4980-85ee-72e1c90ba410"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "260.2194",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c6134d1d-f93e-4f90-ab25-3cc1dd480def",
      "version": "8",
      "structure": {
        "id": "9e4db0f4-34a0-4a3f-a7b0-bf0ba2eb83e8",
        "molfile": "\n  Marvin  01132108142D          \n\n 18 19  0  0  1  0            999 V2000\n    1.1119   -1.9496    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n    0.3285   -2.2083    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    0.0773   -2.9942    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.7476   -2.9982    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -1.2293   -3.6680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0063   -2.2148    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   -0.3413   -1.7266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7922   -1.9636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4027   -2.5186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5655   -3.6593    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0\n    1.2795   -1.1419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0630   -0.8831    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6787   -1.4322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5111   -2.2400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7277   -2.4987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1268   -2.7891    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4621   -1.1734    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6638   -0.5928    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  6  0  0  0\n  6  4  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  2  1  0  0  0  0\n  6  8  1  1  0  0  0\n  9  8  1  0  0  0  0\n  3 10  1  1  0  0  0\n 11  1  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15  1  1  0  0  0  0\n 16 14  1  0  0  0  0\n 17 13  2  0  0  0  0\n 18 11  2  0  0  0  0\nM  END",
        "smiles": "Cc1cn([C@H]2[C@H]([C@@H]([C@@H](CO)O2)O)F)c(=O)[nH]c1=O",
        "formula": "C10H13FN2O5",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "260.2194",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4bd09909-c602-40c6-b2d1-c5aa8529d15f",
          "091e5fe3-3c0c-46dd-bfb4-0b6ea629eb90"
        ],
        "stereo_centers": 4
      },
      "unii": "37F7D05ANB"
    }
  ]
}