{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "331b8019-759c-4339-acb0-e905f592a9f8",
          "code": "3319-31-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3319-31-1",
          "code_system": "CAS",
          "references": [
            "ee1e9edb-dcbc-4719-875c-9e3c4378f7b5",
            "14f91efa-55d2-465c-800c-1844408dcb03"
          ]
        },
        {
          "uuid": "a6124c5c-76fb-428c-b57c-68b9153f6214",
          "code": "222-020-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.019",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ee1e9edb-dcbc-4719-875c-9e3c4378f7b5"
          ]
        },
        {
          "uuid": "2b477604-eba0-4626-8df8-b9430e292518",
          "code": "18725",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/18725",
          "code_system": "PUBCHEM",
          "references": [
            "ee1e9edb-dcbc-4719-875c-9e3c4378f7b5"
          ]
        },
        {
          "uuid": "23b1d765-3d0a-3fdc-104e-03f634684365",
          "code": "6145",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6145",
          "code_system": "HSDB",
          "references": [
            "d33f0f6f-bb78-98a7-0278-f250e2415ebb"
          ]
        },
        {
          "uuid": "3de5e02b-5790-a2b2-fc47-4ebaacb52194",
          "code": "DTXSID9026265",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID9026265",
          "code_system": "EPA CompTox",
          "references": [
            "d6ad7a80-2a86-867a-548d-5d74edfb3bc5"
          ]
        },
        {
          "uuid": "72af8ca0-7f49-4c92-b858-bfda15dabcd8",
          "code": "378539Q830",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c86b36ef-3aeb-4534-9d4f-3fc40ec1a6c1",
          "name": "1,2,4-BENZENETRICARBOXYLIC ACID TRI(2-ETHYLHEXYL)ESTER",
          "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID TRI(2-ETHYLHEXYL)ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b9ac3cb3-af4f-4b38-8843-7d9d6f5bdf33",
            "bd38552c-bbb3-4c20-b40c-ad7038100d9f"
          ],
          "display_name": false
        },
        {
          "uuid": "e8e692e4-efe1-47f6-842c-04d7938130c6",
          "name": "1,2,4-BENZENETRICARBOXYLIC ACID, TRIS(2-ETHYLHEXYL) ESTER",
          "stdName": "1,2,4-BENZENETRICARBOXYLIC ACID, TRIS(2-ETHYLHEXYL) ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "469678df-b649-459a-8582-b73df9de8aef"
          ],
          "display_name": false
        },
        {
          "uuid": "e08b41f0-cd6b-4e21-8e8c-53797d99f42a",
          "name": "BISOFLEX TOT (MED)",
          "stdName": "BISOFLEX TOT (MED)",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "6be81e4f-506c-41e0-a776-af8faff459e3"
          ],
          "display_name": false
        },
        {
          "uuid": "ca724f8c-869d-427b-af40-5ec1c71ad06e",
          "name": "DUB TMO",
          "stdName": "DUB TMO",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "6be81e4f-506c-41e0-a776-af8faff459e3"
          ],
          "display_name": false
        },
        {
          "uuid": "d9bbd508-22cf-4651-8323-513360aa4d4e",
          "name": "PELEMOL TOTM",
          "stdName": "PELEMOL TOTM",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "6be81e4f-506c-41e0-a776-af8faff459e3"
          ],
          "display_name": false
        },
        {
          "uuid": "e415b59e-c535-4c22-b2d7-7f4f19c880a7",
          "name": "TRI-2-ETHYLHEXYL TRIMELLITATE",
          "stdName": "TRI-2-ETHYLHEXYL TRIMELLITATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "469678df-b649-459a-8582-b73df9de8aef"
          ],
          "display_name": false
        },
        {
          "uuid": "939db6bd-4cb1-4b95-a3ca-6f0c83c8acfb",
          "name": "TRIETHYLHEXYL TRIMELLITATE",
          "stdName": "TRIETHYLHEXYL TRIMELLITATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "6be81e4f-506c-41e0-a776-af8faff459e3",
            "08783b0c-eb59-4f55-82a7-21aecbf16356"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ddc3ef2b-b78c-4438-b3f7-f615de104c3f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "e8b0d542-edc0-467b-b04c-195dd6903b76",
          "name": "TRIS(2-ETHYLHEXYL) TRIMELLITATE",
          "stdName": "TRIS(2-ETHYLHEXYL) TRIMELLITATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "02037a08-e55b-4710-a01b-9a80f9a7a3ef",
            "469678df-b649-459a-8582-b73df9de8aef",
            "408afab6-f357-4008-9fd6-3355b967f9e4"
          ],
          "display_name": false
        },
        {
          "uuid": "ad49f39a-b80b-4d0f-8066-0777281e50a0",
          "name": "TRIS(2-ETHYLHEXYL) TRIMELLITATE [HSDB]",
          "stdName": "TRIS(2-ETHYLHEXYL) TRIMELLITATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
            "408afab6-f357-4008-9fd6-3355b967f9e4"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b9ac3cb3-af4f-4b38-8843-7d9d6f5bdf33",
          "citation": "ST",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "bd38552c-bbb3-4c20-b40c-ad7038100d9f",
          "citation": "DMF 6407",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "469678df-b649-459a-8582-b73df9de8aef",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "59deb95b-2fe8-4827-8a7b-a388ee11d8e3",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "408afab6-f357-4008-9fd6-3355b967f9e4",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6be81e4f-506c-41e0-a776-af8faff459e3",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ee1e9edb-dcbc-4719-875c-9e3c4378f7b5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390308000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "69a2c925-195a-4efb-92f9-941f55ea4aa2",
          "citation": "SRS import [378539Q830]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=378539Q830",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390308000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02037a08-e55b-4710-a01b-9a80f9a7a3ef",
          "citation": "TRIS(2-ETHYLHEXYL) TRIMELLITATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08783b0c-eb59-4f55-82a7-21aecbf16356",
          "citation": "TRIETHYLHEXYL TRIMELLITATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d33f0f6f-bb78-98a7-0278-f250e2415ebb",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3319-31-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d6ad7a80-2a86-867a-548d-5d74edfb3bc5",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3319-31-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "14f91efa-55d2-465c-800c-1844408dcb03",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "72e41179-d50c-4a7a-bf95-8e4b349d7c3f",
          "id": "72e41179-d50c-4a7a-bf95-8e4b349d7c3f",
          "molfile": "\n  Marvin  01132105572D          \n\n 39 39  0  0  0  0            999 V2000\n   10.1119   -0.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3729   -0.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6158   -0.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8794   -0.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1404   -0.4275    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.0992   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8562   -1.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4451    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5387   -0.0412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9594   -0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2873   -0.3116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -1.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -1.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -2.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -3.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6546   -4.4032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -4.4032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5483   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8428   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.9767   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2325   -5.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1166   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4214   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7133   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6546   -2.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6546   -1.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4039   -3.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0863   -2.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3833   -4.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2331   -3.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7275   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    7.4648   -5.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7816   -5.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5386   -4.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1411   -4.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9419   -4.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5316   -5.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5  8  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 10 12  1  0  0  0  0\n 13 12  1  0  0  0  0\n 12 28  2  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 27  2  0  0  0  0\n 17 16  2  0  0  0  0\n 18 16  1  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 23 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 27  1  0  0  0  0\n 30 29  2  0  0  0  0\n 31 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 33 32  1  0  0  0  0\n 34 33  1  0  0  0  0\n 36 33  1  0  0  0  0\n 35 34  1  0  0  0  0\n 37 36  1  0  0  0  0\n 38 37  1  0  0  0  0\n 39 38  1  0  0  0  0\nM  END",
          "smiles": "CCCCC(CC)COC(=O)c1ccc(c(c1)C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC",
          "formula": "C33H54O6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "MIXED",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6089a571-4914-4840-aaa4-b7e2bc23bbd5"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "546.7795",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 3
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "8374b205-1f1a-4521-9406-84c07cbfe83d",
      "version": "5",
      "structure": {
        "id": "10998e91-32c8-42b4-baa9-efb2512f0e08",
        "molfile": "\n  Marvin  01132101052D          \n\n 39 39  0  0  0  0            999 V2000\n    5.6546   -2.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -3.1775    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6546   -1.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4039   -3.2007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9594   -0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9465   -1.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -2.7810    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3833   -4.0195    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -4.4032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.5387   -0.0412    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2332   -1.9338    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0863   -2.8119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6546   -4.4032    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2873   -0.3116    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2331   -3.8341    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5483   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4451    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8428   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7275   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1404   -0.4275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0992   -1.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4648   -5.0006    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.9767   -5.0624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5386   -4.1818    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1166   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8794   -0.0489    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7133   -3.9886    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9419   -4.6118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.3729   -0.0798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4214   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6158   -0.4944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1411   -4.8126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7816   -5.7576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8562   -1.5476    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.2325   -5.5928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -4.4032    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5316   -5.2143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1119   -0.4635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  1  2  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  3  1  0  0  0  0\n  8  2  2  0  0  0  0\n  9  4  1  0  0  0  0\n 10  5  1  0  0  0  0\n 11  6  1  0  0  0  0\n 12  7  2  0  0  0  0\n 13  4  2  0  0  0  0\n 14  5  2  0  0  0  0\n 15  6  2  0  0  0  0\n 16  9  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 11  1  0  0  0  0\n 19 17  1  0  0  0  0\n 20 16  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 20  1  0  0  0  0\n 24 19  1  0  0  0  0\n 25 20  1  0  0  0  0\n 26 19  1  0  0  0  0\n 27 21  1  0  0  0  0\n 28 31  1  0  0  0  0\n 29 33  1  0  0  0  0\n 30 32  1  0  0  0  0\n 31 26  1  0  0  0  0\n 32 27  1  0  0  0  0\n 33 25  1  0  0  0  0\n 34 23  1  0  0  0  0\n 35 22  1  0  0  0  0\n 36 24  1  0  0  0  0\n 37 28  1  0  0  0  0\n 38 29  1  0  0  0  0\n 39 30  1  0  0  0  0\n 12  8  1  0  0  0  0\nM  END",
        "smiles": "CCCCC(CC)COC(=O)c1ccc(c(c1)C(=O)OCC(CC)CCCC)C(=O)OCC(CC)CCCC",
        "formula": "C33H54O6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "MIXED",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "546.7795",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "69a2c925-195a-4efb-92f9-941f55ea4aa2",
          "469678df-b649-459a-8582-b73df9de8aef"
        ],
        "stereo_centers": 3
      },
      "unii": "378539Q830"
    }
  ]
}