{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "790c4e51-4204-4f13-b6d3-abff0d7473fe",
          "code": "72584-75-9",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=72584-75-9",
          "code_system": "CAS",
          "references": [
            "fb00863e-d990-4713-b457-e435f94cc113",
            "daad8123-f2b8-447d-80af-3f4b5fcd74a7"
          ]
        },
        {
          "uuid": "4417b625-d96c-4646-ba7e-a7370a254f34",
          "code": "1312548",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1312548/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "fb00863e-d990-4713-b457-e435f94cc113"
          ]
        },
        {
          "uuid": "ce611618-56e2-445e-a922-232323e78f79",
          "code": "11732365",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11732365",
          "code_system": "PUBCHEM",
          "references": [
            "fb00863e-d990-4713-b457-e435f94cc113"
          ]
        },
        {
          "uuid": "74663501-c783-a568-17d9-a784390e5e70",
          "code": "DTXSID60222908",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60222908",
          "code_system": "EPA CompTox",
          "references": [
            "0451140d-1a12-e73a-ee24-f75dd229a6fa"
          ]
        },
        {
          "uuid": "12fc00c7-3748-4198-abd0-db12ca586441",
          "code": "37727Z7M0I",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "1944b1cd-db4d-e2ab-ad43-40dd3aad3b4b",
          "code": "37727Z7M0I",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=37727Z7M0I",
          "code_system": "DAILYMED",
          "references": [
            "c2574fb7-32b2-cc2a-c168-d819a092bd11"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "b12c64eb-9591-4423-8b36-17a8bdc9def0",
          "name": "(+)-BOLDINE DIACETATE",
          "stdName": "(+)-BOLDINE DIACETATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
          ],
          "display_name": false
        },
        {
          "uuid": "88fc7379-d97d-4b91-ba3b-ce8e3e315616",
          "name": "4H-DIBENZO(DE,G)QUINOLINE-2,9-DIOL, 5,6,6A,7-TETRAHYDRO-1,10-DIMETHOXY-6-METHYL-, 2,9-DIACETATE, (6AS)-",
          "stdName": "4H-DIBENZO(DE,G)QUINOLINE-2,9-DIOL, 5,6,6A,7-TETRAHYDRO-1,10-DIMETHOXY-6-METHYL-, 2,9-DIACETATE, (6AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
          ],
          "display_name": false
        },
        {
          "uuid": "9c5b3d2b-4fc3-44e8-b1f7-17d806c420fb",
          "name": "4H-DIBENZO(DE,G)QUINOLINE-2,9-DIOL, 5,6,6A,7-TETRAHYDRO-1,10-DIMETHOXY-6-METHYL-, DIACETATE (ESTER), (6AS)-",
          "stdName": "4H-DIBENZO(DE,G)QUINOLINE-2,9-DIOL, 5,6,6A,7-TETRAHYDRO-1,10-DIMETHOXY-6-METHYL-, DIACETATE (ESTER), (6AS)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
          ],
          "display_name": false
        },
        {
          "uuid": "639dcfef-2df4-447d-a439-42da1726342a",
          "name": "DIACETYL BOLDINE",
          "stdName": "DIACETYL BOLDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "268f51cc-29f9-4479-97bd-7a5dd4cac165",
            "8970c475-caee-40a4-ab58-475b83c1afe1"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "75e28051-ca2f-4c4f-994d-1b290f1f8cdd",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "f36c8f3b-87f6-4548-b640-ebc0ddbd2cca",
          "name": "DIACETYLBOLDINE",
          "stdName": "DIACETYLBOLDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
          ],
          "display_name": false
        },
        {
          "uuid": "133c68cc-410a-43f1-a6d2-585b9dd56e3f",
          "name": "LUMISKIN",
          "stdName": "LUMISKIN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "8970c475-caee-40a4-ab58-475b83c1afe1"
          ],
          "display_name": false
        },
        {
          "uuid": "85ee40c2-5876-4f4d-9be6-2442f8ced76a",
          "name": "LUMISPHERE",
          "stdName": "LUMISPHERE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "8970c475-caee-40a4-ab58-475b83c1afe1"
          ],
          "display_name": false
        },
        {
          "uuid": "d7f16d6f-8c26-4f16-8489-2559603a1c91",
          "name": "O,O-DIACETYLBOLDINE",
          "stdName": "O,O-DIACETYLBOLDINE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c8cbe1e2-e18e-439c-b575-7695820036dd",
            "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8970c475-caee-40a4-ab58-475b83c1afe1",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c8cbe1e2-e18e-439c-b575-7695820036dd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fb00863e-d990-4713-b457-e435f94cc113",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "13ada8d7-da90-4e4f-ad0b-8b489016affa",
          "citation": "SRS import [37727Z7M0I]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=37727Z7M0I",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391493000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "268f51cc-29f9-4479-97bd-7a5dd4cac165",
          "citation": "DIACETYL BOLDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62aeb2bc-ba4c-b5a5-7976-516c5e202928",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=72584-75-9",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "daad8123-f2b8-447d-80af-3f4b5fcd74a7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "c2574fb7-32b2-cc2a-c168-d819a092bd11",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0451140d-1a12-e73a-ee24-f75dd229a6fa",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "e84c86a9-031e-40ec-ac4e-9d68430e829d",
          "id": "e84c86a9-031e-40ec-ac4e-9d68430e829d",
          "molfile": "\n  Marvin  01132112012D          \n\n 30 33  0  0  1  0            999 V2000\n   12.5425  -10.2744    0.0000 C   0  0  2  0  0  0  0  0  0  2  0  0\n   11.8270  -10.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4101  -10.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6945  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745  -10.6852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9703  -11.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2502  -11.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6883  -11.9288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6945   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745   -9.0329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4101   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8270   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8270   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -7.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -6.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425   -7.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425   -6.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2540   -6.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2540   -5.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9653   -6.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9779   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9779  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532  -10.6852    0.0000 N   0  0  2  0  0  0  0  0  0  0  0  0\n   13.2532  -11.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  1 28  1  1  0  0  0\n  1 30  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n 14  3  2  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n 10  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 10 13  2  0  0  0  0\n 12 11  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 16 15  1  0  0  0  0\n 15 30  2  0  0  0  0\n 17 16  1  0  0  0  0\n 16 19  2  0  0  0  0\n 18 17  1  0  0  0  0\n 20 19  1  0  0  0  0\n 19 24  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 21 23  2  0  0  0  0\n 24 25  2  0  0  0  0\n 26 25  1  0  0  0  0\n 25 30  1  0  0  0  0\n 27 26  1  0  0  0  0\n 28 27  1  0  0  0  0\n 29 28  1  0  0  0  0\nM  END",
          "smiles": "CC(=O)Oc1cc2C[C@H]3c4c(CCN3C)cc(c(c4-c2cc1OC)OC)OC(=O)C",
          "formula": "C23H25NO6",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "bf0c3431-4303-453f-a1b7-8f3fa443e1b4"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "411.4486",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ee3b8f61-e599-4a28-8a11-9ff83cc66f05",
      "version": "7",
      "structure": {
        "id": "1f2018a2-0f57-4418-9f26-7fe0c52b7f79",
        "molfile": "\n  Marvin  01132101472D          \n\n 31 34  0  0  1  0            999 V2000\n   11.8270  -10.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532  -11.5114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9779   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9779  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532  -10.6852    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425  -11.0960    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425  -10.2744    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   12.5425   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2532   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425   -6.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   12.5425   -7.7959    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -6.9744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -7.7959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8270   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.8270   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745   -8.2113    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745   -9.0329    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6945   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4101   -9.0329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208   -9.4436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1208  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.4101  -10.6852    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6945  -10.2744    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9745  -10.6852    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9703  -11.5143    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2502  -11.9251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2540   -6.5636    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.2540   -5.7421    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.9653   -6.9744    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6883  -11.9288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n 16  8  2  0  0  0  0\n 22  1  1  0  0  0  0\n  1  7  1  0  0  0  0\n  2  5  1  0  0  0  0\n  3  9  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  5  7  1  0  0  0  0\n  7  6  1  6  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 12 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 15 12  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 21 16  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 24  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 25 26  1  0  0  0  0\n 26 27  1  0  0  0  0\n 11 28  1  0  0  0  0\n 28 29  1  0  0  0  0\n 28 30  2  0  0  0  0\n 26 31  2  0  0  0  0\nM  END",
        "smiles": "CC(=O)Oc1cc2C[C@@]3([H])c4c(CCN3C)cc(c(c4-c2cc1OC)OC)OC(=O)C",
        "formula": "C23H25NO6",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "411.4486",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "13ada8d7-da90-4e4f-ad0b-8b489016affa",
          "f5c8a590-d15b-4a1c-b1f2-c38233a43f4e"
        ],
        "stereo_centers": 1
      },
      "unii": "37727Z7M0I"
    }
  ]
}