{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "bf38624b-db14-46c8-ae6a-be23cb12c04c",
          "code": "71617-10-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=71617-10-2",
          "code_system": "CAS",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900",
            "ad928afc-2822-4d96-b349-5dd6693e3de8"
          ]
        },
        {
          "uuid": "ec733c42-e9ee-48cf-bf3f-f321b05fa2fe",
          "code": "C83532",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C83532",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "113bf64e-23ba-419c-b40e-21b8db5902d8",
          "code": "C077647",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67077647",
          "code_system": "MESH",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "7bedbd5d-c370-4496-bae4-db3623adfee9",
          "code": "SUB87953",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "c8bad8d0-dab6-456d-a4e8-f011ac6ee9da",
          "code": "7938",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=7938",
          "code_system": "INN",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "facb54ac-1c76-4684-adab-e39a3562c0a7",
          "code": "275-702-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.068.798",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "41eca170-68ed-4434-9aee-b1da72bc51d4",
          "code": "1426854",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426854/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "51d30538-3f48-4830-ac05-d116259f12a6",
          "code": "CHEMBL1476782",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1476782",
          "code_system": "ChEMBL",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "93dbce43-0505-44ed-bc3a-cb30290911d5",
          "code": "1549789",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/1549789",
          "code_system": "PUBCHEM",
          "references": [
            "ec019a73-dc45-491f-b663-ae0619e54900"
          ]
        },
        {
          "uuid": "2c382a0c-3086-e0f9-edc5-3727db57f946",
          "code": "DTXSID1046055",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1046055",
          "code_system": "EPA CompTox",
          "references": [
            "037dce19-21d9-bcf8-0047-a88b746e3807"
          ]
        },
        {
          "uuid": "6b66d0cd-81f4-9c73-4e41-77b4138c78e3",
          "code": "C851",
          "comments": "Pharmacologic Substance[C1909]|Chemopreventive Agent[C1892]|Sunscreen",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C851",
          "code_system": "NCI_THESAURUS",
          "references": [
            "15bb15e1-7501-d394-ca85-0ced65e5f1df"
          ]
        },
        {
          "uuid": "b4eebfa9-4487-4b30-8f9b-fb195bc0ac14",
          "code": "376KTP06K8",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "0434ea2b-6e64-20dc-fc99-a00e2dcd3918",
          "code": "m11779",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m11779",
          "code_system": "MERCK INDEX",
          "references": [
            "15bb15e1-7501-d394-ca85-0ced65e5f1df"
          ]
        },
        {
          "uuid": "35e0594d-edeb-8c68-1c1a-3179654b0461",
          "code": "4500",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/4500",
          "code_system": "DRUG CENTRAL",
          "references": [
            "15bb15e1-7501-d394-ca85-0ced65e5f1df"
          ]
        },
        {
          "uuid": "b8766748-661b-ee25-cf26-eb7a7cbb75a4",
          "code": "DB11207",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11207",
          "code_system": "DRUG BANK",
          "references": [
            "15bb15e1-7501-d394-ca85-0ced65e5f1df"
          ]
        },
        {
          "uuid": "943eff59-2d6b-64a4-c203-942d5a93fc9f",
          "code": "1347755",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1347755",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "15bb15e1-7501-d394-ca85-0ced65e5f1df"
          ]
        },
        {
          "uuid": "07234b3c-94ae-9b19-c659-e7b663cc2474",
          "code": "LL-21",
          "type": "PRIMARY",
          "url": "https://searchusan.ama-assn.org/finder/usan/search/LL-21/relevant/1/",
          "code_system": "USAN",
          "references": [
            "19021785-7df9-c20b-269a-55a21eafd434"
          ]
        },
        {
          "uuid": "920e184d-ce21-c1e5-fce8-510e067bdeac",
          "code": "Amiloxate",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Amiloxate",
          "code_system": "WIKIPEDIA",
          "references": [
            "26f2a8d2-282c-9b71-3cfc-30a96df81d0c"
          ]
        },
        {
          "uuid": "aa011775-7b9b-fdc2-0417-1416bdf35ec5",
          "code": "100000139402",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "93a7bff8-7e4b-9add-78a9-5a96cf548e40"
          ]
        },
        {
          "uuid": "ffabe160-3bc6-d4d5-d0ef-ec3da9fb031a",
          "code": "376KTP06K8",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=376KTP06K8",
          "code_system": "DAILYMED",
          "references": [
            "8c6523d3-c3e0-f4ac-0966-14f9583423c3"
          ]
        },
        {
          "uuid": "cfd31c31-5086-774c-9e1a-c73a0b4c94ef",
          "code": "408332",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=408332",
          "code_system": "NSC",
          "references": [
            "860eae4d-2fda-37a2-ea68-72806697dd29"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "7f9c4d0f-f2c0-49f0-8767-a07b3c7920e3",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "243c0512-08bd-4c42-924c-a25a5c19fb95",
            "refuuid": "cf23b20b-3a17-4e7c-b30b-54077f7594b2",
            "name": "AMILOXATE",
            "unii": "376KTP06K8",
            "linking_id": "376KTP06K8",
            "ref_pname": "AMILOXATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "f11269ba-f655-4200-84f2-ac76b0a29fce",
          "name": "4-METHOXYCINNAMIC ACID, ISOAMYL ESTER",
          "stdName": "4-METHOXYCINNAMIC ACID, ISOAMYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceba637b-2e02-40a5-8dd6-1777a600e303"
          ],
          "display_name": false
        },
        {
          "uuid": "0a904c70-8207-4675-9af2-3c147f35fece",
          "name": "AMILOXATE",
          "stdName": "AMILOXATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43966e8c-b12a-49d2-a51f-ff6b5f9724b1",
            "1dc610f4-e90d-4695-ac50-a24846b467f0",
            "79b22d5a-9a37-4010-88fd-f414704863fd",
            "71586547-9646-4147-860b-ef00e56be2e8",
            "ceba637b-2e02-40a5-8dd6-1777a600e303",
            "89c72c5d-56b3-419c-8b73-61e7441432ef",
            "8eb404b8-6d14-4904-87ff-e6b403aa0d68",
            "664cd8a5-96e9-467e-bd14-cdbcd29ac7e5",
            "c3916334-5c91-4b91-8205-b2687b4de720",
            "3ab58418-09a3-4a72-b9ee-328772b31f38",
            "a22299a3-fdd4-47f7-87ee-772172749f16"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "78ab4003-e8de-455d-8bc5-21b14071dfdd",
              "name_org": "USAN"
            },
            {
              "uuid": "3c4170b8-47e5-471f-b0a6-1dddc65165b5",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "5286e759-2816-4f2b-bde4-5d4a138fea47",
          "name": "AMILOXATE [MART.]",
          "stdName": "AMILOXATE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3ab58418-09a3-4a72-b9ee-328772b31f38"
          ],
          "display_name": false
        },
        {
          "uuid": "641e77c8-8688-7a39-d7c2-c498d70e14e2",
          "name": "AMILOXATE [MI]",
          "stdName": "AMILOXATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97734168-cd10-2ee5-f514-fb922b57e9f9"
          ],
          "display_name": false
        },
        {
          "uuid": "bba797c1-8459-4ab8-8883-a86c74c15863",
          "name": "AMILOXATE [USAN]",
          "stdName": "AMILOXATE [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "89c72c5d-56b3-419c-8b73-61e7441432ef"
          ],
          "display_name": false
        },
        {
          "uuid": "ccb65609-63dd-79e2-4cb9-524673970635",
          "name": "AMILOXATE [USP IMPURITY]",
          "stdName": "AMILOXATE [USP IMPURITY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "43966e8c-b12a-49d2-a51f-ff6b5f9724b1"
          ],
          "display_name": false
        },
        {
          "uuid": "05209d9e-d185-9d5d-8c95-01c8afa628ea",
          "name": "AMILOXATE [USP MONOGRAPH]",
          "stdName": "AMILOXATE [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "390be818-d82f-5fee-8142-52d236086443"
          ],
          "display_name": false
        },
        {
          "uuid": "9599da03-631d-47e0-9c75-ff9ce774229e",
          "name": "AMILOXATE [USP-RS]",
          "stdName": "AMILOXATE [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "664cd8a5-96e9-467e-bd14-cdbcd29ac7e5"
          ],
          "display_name": false
        },
        {
          "uuid": "40c73604-2c77-b92e-1cd7-d32e8a1df7a6",
          "name": "Amiloxate [WHO-DD]",
          "stdName": "AMILOXATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "df71d71f-3b96-f203-5ab5-680c6e9dd6c7"
          ],
          "display_name": false
        },
        {
          "uuid": "d8320abe-4139-41e9-b336-11bdba7b6332",
          "name": "E-1000",
          "stdName": "E-1000",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceba637b-2e02-40a5-8dd6-1777a600e303"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e932d5-fb96-403b-9d8f-dd4499dd1b5f",
          "name": "ISOAMYL 4-METHOXYCINNAMATE",
          "stdName": "ISOAMYL 4-METHOXYCINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "68cfce53-f790-42e8-9d71-20daf46cbeae"
          ],
          "display_name": false
        },
        {
          "uuid": "5f4d74a0-a643-4aa0-a734-6401ba1fd300",
          "name": "ISOAMYL METHOXYCINNAMATE",
          "stdName": "ISOAMYL METHOXYCINNAMATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ceba637b-2e02-40a5-8dd6-1777a600e303"
          ],
          "display_name": false
        },
        {
          "uuid": "e6c6e57f-fee7-4f39-947e-39ab59f01b9f",
          "name": "ISOAMYL P-METHOXYCINNAMATE",
          "stdName": "ISOAMYL P-METHOXYCINNAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "b0eb5435-2630-42e4-9106-ecd0ac4dd341",
            "69eff868-5d8b-43aa-9124-894e12d86d8c"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ab68a357-eff9-45ad-8cb7-9eea2243b2d1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "bb0e394b-6bf1-40ea-b102-4a02e4d3d008",
          "name": "NSC-408332",
          "stdName": "NSC-408332",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7220bfe1-c26c-4095-a4e9-bbdfc26aa1ae"
          ],
          "display_name": false
        },
        {
          "uuid": "3cabdab8-b348-4986-aefb-f357fd2e89bb",
          "name": "amiloxate [INN]",
          "stdName": "AMILOXATE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1dc610f4-e90d-4695-ac50-a24846b467f0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "ceba637b-2e02-40a5-8dd6-1777a600e303",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "69eff868-5d8b-43aa-9124-894e12d86d8c",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7220bfe1-c26c-4095-a4e9-bbdfc26aa1ae",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89c72c5d-56b3-419c-8b73-61e7441432ef",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1dc610f4-e90d-4695-ac50-a24846b467f0",
          "citation": "INN Proposed List 83",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL83.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "43966e8c-b12a-49d2-a51f-ff6b5f9724b1",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ab58418-09a3-4a72-b9ee-328772b31f38",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "664cd8a5-96e9-467e-bd14-cdbcd29ac7e5",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "68cfce53-f790-42e8-9d71-20daf46cbeae",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ec019a73-dc45-491f-b663-ae0619e54900",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4b067e33-711f-4a72-ad21-077c7d93c711",
          "citation": "SRS import [376KTP06K8]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=376KTP06K8",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390470000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8eb404b8-6d14-4904-87ff-e6b403aa0d68",
          "citation": "AMILOXATE [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c3916334-5c91-4b91-8205-b2687b4de720",
          "citation": "AMILOXATE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "79b22d5a-9a37-4010-88fd-f414704863fd",
          "citation": "AMILOXATE [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "71586547-9646-4147-860b-ef00e56be2e8",
          "citation": "AMILOXATE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b0eb5435-2630-42e4-9106-ecd0ac4dd341",
          "citation": "ISOAMYL P-METHOXYCINNAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "a22299a3-fdd4-47f7-87ee-772172749f16",
          "citation": "AMILOXATE [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "037dce19-21d9-bcf8-0047-a88b746e3807",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=71617-10-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "93a7bff8-7e4b-9add-78a9-5a96cf548e40",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "15bb15e1-7501-d394-ca85-0ced65e5f1df",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "be6d1773-9e2b-867f-b25e-3cc30c91796e",
          "citation": "USP42-NF37 - 220, Amiloxate Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ad928afc-2822-4d96-b349-5dd6693e3de8",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "97734168-cd10-2ee5-f514-fb922b57e9f9",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true
        },
        {
          "uuid": "26f2a8d2-282c-9b71-3cfc-30a96df81d0c",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "19021785-7df9-c20b-269a-55a21eafd434",
          "citation": "USAD COUN",
          "doc_type": "USANCOUN",
          "public_domain": true
        },
        {
          "uuid": "df71d71f-3b96-f203-5ab5-680c6e9dd6c7",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7d6a70e5-8df0-809c-3be6-9b97e0c525a4",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "390be818-d82f-5fee-8142-52d236086443",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "860eae4d-2fda-37a2-ea68-72806697dd29",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "8c6523d3-c3e0-f4ac-0966-14f9583423c3",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8f0f495f-2250-46a8-a377-f6845e21d0bc",
          "id": "8f0f495f-2250-46a8-a377-f6845e21d0bc",
          "molfile": "\n  Marvin  01132107252D          \n\n 18 18  0  0  0  0            999 V2000\n   11.0563   -5.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -4.2346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3419   -3.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3419   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1984   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -1.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0550   -2.9972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3404   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1969   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -3.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -4.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  3 18  2  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  2  0  0  0  0\n  8  7  2  0  0  0  0\n  8  9  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11  9  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  1  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCOC(=O)/C=C/c1ccc(cc1)OC",
          "formula": "C15H20O3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63f158b7-75d5-43b0-b3b2-eb2fa12f6508"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "248.3181",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "cf23b20b-3a17-4e7c-b30b-54077f7594b2",
      "version": "31",
      "structure": {
        "id": "00cc8c7d-f334-48f0-a570-5e0302566b79",
        "molfile": "\n  Marvin  01132100212D          \n\n 18 18  0  0  0  0            999 V2000\n    6.7695   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4839   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1984   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3419   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.3419   -3.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6273   -4.2346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9129   -3.8221    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -4.2346    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0563   -5.0598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7695   -1.7597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0550   -2.9972    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3404   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6260   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -2.5847    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1969   -2.9972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9115   -1.7597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  9  4  1  0  0  0  0\n 10  7  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12  1  2  0  0  0  0\n 13  1  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCOC(=O)/C=C/c1ccc(cc1)OC",
        "formula": "C15H20O3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "248.3181",
        "optical_activity": "NONE",
        "references": [
          "4b067e33-711f-4a72-ad21-077c7d93c711",
          "ceba637b-2e02-40a5-8dd6-1777a600e303",
          "1dc610f4-e90d-4695-ac50-a24846b467f0"
        ],
        "stereo_centers": 0
      },
      "unii": "376KTP06K8"
    }
  ]
}