{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0b0f08db-5543-4820-b44f-000472a5f921",
          "code": "10193-99-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=10193-99-4",
          "code_system": "CAS",
          "references": [
            "e587c61a-b46f-4e91-a99e-c38081652fb6",
            "9d0737e6-5804-42cd-b752-92c6c9df0919"
          ]
        },
        {
          "uuid": "869ea807-1484-4a5a-838a-2686a5fc6181",
          "code": "233-482-8",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.030.426",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "e587c61a-b46f-4e91-a99e-c38081652fb6"
          ]
        },
        {
          "uuid": "f1dd6655-e060-4399-b591-f5ba8e16b5bd",
          "code": "82441",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/82441",
          "code_system": "PUBCHEM",
          "references": [
            "e587c61a-b46f-4e91-a99e-c38081652fb6"
          ]
        },
        {
          "uuid": "30c6f65d-77fe-7522-3061-e926bda30b0a",
          "code": "DTXSID8064989",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8064989",
          "code_system": "EPA CompTox",
          "references": [
            "36697bf9-f811-ca54-a947-1b4a2a1b4b22"
          ]
        },
        {
          "uuid": "834000f5-d87f-407a-898a-82914207021f",
          "code": "36R0OK7GPK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a80f8d6a-b049-c467-748e-0b60447207c1",
          "code": "65476",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=65476",
          "code_system": "NSC",
          "references": [
            "dab7d48c-2972-268d-054c-cefcc4825401"
          ]
        },
        {
          "uuid": "4a294d62-309e-cdc3-b746-e96bed670545",
          "code": "528294",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=528294",
          "code_system": "NSC",
          "references": [
            "dab7d48c-2972-268d-054c-cefcc4825401"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "eb05b168-fe96-bef4-6b56-d5766def5d98",
          "name": "2,2-BIS(((MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL BIS(MERCAPTOACETATE)",
          "stdName": "2,2-BIS(((MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL BIS(MERCAPTOACETATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "1f8ce8ea-af5e-d0ca-4bdf-bb28b0c2945a",
          "name": "ACETIC ACID, 2-MERCAPTO-, 1,1'-(2,2-BIS(((2-MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "stdName": "ACETIC ACID, 2-MERCAPTO-, 1,1'-(2,2-BIS(((2-MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "32333601-bf3d-4a14-834f-8cb19ccee116",
          "name": "ACETIC ACID, MERCAPTO-, 2,2-BIS(((MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "stdName": "ACETIC ACID, MERCAPTO-, 2,2-BIS(((MERCAPTOACETYL)OXY)METHYL)-1,3-PROPANEDIYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88b5fcbf-d8e0-43da-b475-899be0c36507",
            "9cfba86c-fb2d-4350-a715-5816a9317d3b"
          ],
          "display_name": false
        },
        {
          "uuid": "6fb876ca-95d1-dfd7-5384-b9dfc346485e",
          "name": "ACETIC ACID, MERCAPTO-, NEOPENTANETETRAYL ESTER",
          "stdName": "ACETIC ACID, MERCAPTO-, NEOPENTANETETRAYL ESTER",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "e3bf7720-2b06-372b-da4e-10fe027872fe",
          "name": "ACETIC ACID, MERCAPTO-, TETRAESTER WITH PENTAERYTHRITOL",
          "stdName": "ACETIC ACID, MERCAPTO-, TETRAESTER WITH PENTAERYTHRITOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "d15d96d3-f8c8-4e44-03c1-15d7bc4f488b",
          "name": "NSC-528294",
          "stdName": "NSC-528294",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "f3378bd0-3ed6-4682-8010-2900a566e924",
          "name": "NSC-65476",
          "stdName": "NSC-65476",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "88b5fcbf-d8e0-43da-b475-899be0c36507",
            "9cfba86c-fb2d-4350-a715-5816a9317d3b"
          ],
          "display_name": false
        },
        {
          "uuid": "e150bd54-9b41-3039-9696-2fbc878023da",
          "name": "PE-TSA",
          "stdName": "PE-TSA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "18324511-38fb-2ad5-4177-18741b4bc7fe",
          "name": "PENTAERYTHRITOL TETRA(MERCAPTOACETATE)",
          "stdName": "PENTAERYTHRITOL TETRA(MERCAPTOACETATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "a7410a9b-e2bc-e8c8-07be-a7d1bd738d6f",
          "name": "PENTAERYTHRITOL TETRA(THIOGLYCOLATE)",
          "stdName": "PENTAERYTHRITOL TETRA(THIOGLYCOLATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "207e9803-54ac-61a2-0dce-21d219e2e1a0",
          "name": "PENTAERYTHRITOL TETRAKIS(2-MERCAPTOACETATE)",
          "stdName": "PENTAERYTHRITOL TETRAKIS(2-MERCAPTOACETATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "76bced30-47d5-6407-66f3-b09b0c366d0a",
          "name": "PENTAERYTHRITOL TETRAKIS(3-MERCAPTOACETATE)",
          "stdName": "PENTAERYTHRITOL TETRAKIS(3-MERCAPTOACETATE)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "9c79fe89-2754-c4ac-7bfa-1ea8dad3b2ef",
          "name": "PENTAERYTHRITOL TETRAKIS(THIOGLYCOLATE)",
          "stdName": "PENTAERYTHRITOL TETRAKIS(THIOGLYCOLATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "2729d994-3395-6679-54e6-5300a1b67a7b",
          "name": "PENTAERYTHRITOL, TETRAKIS(MERCAPTOACETATE)",
          "stdName": "PENTAERYTHRITOL, TETRAKIS(MERCAPTOACETATE)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "edba61a9-90cf-7ef7-d431-a0ea23361b58",
          "name": "PETG",
          "stdName": "PETG",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": false
        },
        {
          "uuid": "e7943d6b-a685-aaa1-eba4-84b8c8503b74",
          "name": "THIOCURE PETMA",
          "stdName": "THIOCURE PETMA",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "718151cf-ee84-ccb0-7f3e-7b7932fa3639"
          ],
          "display_name": true
        }
      ],
      "references": [
        {
          "uuid": "9cfba86c-fb2d-4350-a715-5816a9317d3b",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88b5fcbf-d8e0-43da-b475-899be0c36507",
          "citation": "EPA",
          "doc_type": "EPA",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e587c61a-b46f-4e91-a99e-c38081652fb6",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493393839000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36697bf9-f811-ca54-a947-1b4a2a1b4b22",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=10193-99-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "718151cf-ee84-ccb0-7f3e-7b7932fa3639",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "9d0737e6-5804-42cd-b752-92c6c9df0919",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "dab7d48c-2972-268d-054c-cefcc4825401",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1c9b3151-eaec-4cba-b929-25df6e5f2da7",
          "id": "1c9b3151-eaec-4cba-b929-25df6e5f2da7",
          "molfile": "\n  Marvin  01132101392D          \n\n 25 24  0  0  0  0            999 V2000\n    1.0582   -3.1607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7759   -2.7482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7767   -1.9280    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0629   -1.5146    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4940   -1.5155    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4947   -0.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2124   -0.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7418    0.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4581    1.1266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9859    1.7550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7983    1.6119    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7023    2.5322    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2300    3.1607    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6825    0.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8677    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3412    0.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6244    1.6102    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5264    0.6921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.3216    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9296   -0.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6391   -0.2830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3563   -0.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3584   -1.5198    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0658   -0.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7830   -0.6950    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  3  4  2  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 14  1  0  0  0  0\n 20  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
          "smiles": "C(C(=O)OCC(COC(=O)CS)(COC(=O)CS)COC(=O)CS)S",
          "formula": "C13H20O8S4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a336f088-663e-4425-8ef2-f02198042d5d"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "432.558",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "58d2a392-d8ec-4eb1-b168-504cd6309bb8",
      "version": "8",
      "structure": {
        "id": "87523852-d484-4af3-95b8-4ce98071df3f",
        "molfile": "\n  Marvin  01132107012D          \n\n 25 24  0  0  0  0            999 V2000\n    5.3588   -1.5199    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3567   -0.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6394   -0.2830    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9299   -0.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2126   -0.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4949   -0.6951    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4942   -1.5156    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7768   -1.9281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0630   -1.5147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.7760   -2.7484    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0583   -3.1609    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7421    0.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.4584    1.1267    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.9862    1.7551    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7986    1.6120    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7026    2.5324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2303    3.1609    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6827    0.3494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8678    0.2062    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3413    0.8354    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6245    1.6103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5264    0.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000    1.3217    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0662   -0.2830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7835   -0.6951    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n  5 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 14 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n  5 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n  2 24  1  0  0  0  0\n 24 25  1  0  0  0  0\nM  END",
        "smiles": "C(C(=O)OCC(COC(=O)CS)(COC(=O)CS)COC(=O)CS)S",
        "formula": "C13H20O8S4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "432.558",
        "optical_activity": "NONE",
        "references": [
          "718151cf-ee84-ccb0-7f3e-7b7932fa3639",
          "9cfba86c-fb2d-4350-a715-5816a9317d3b"
        ],
        "stereo_centers": 0
      },
      "unii": "36R0OK7GPK"
    }
  ]
}