{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "cd20936c-25fb-47c4-960f-221f0ed0d61d",
          "code": "184830-08-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=184830-08-8",
          "code_system": "CAS",
          "references": [
            "8797ce8b-9e3f-47cd-8532-36202cde63de",
            "82deec8e-5550-4c7e-85d3-9fe2ae0dd0a2"
          ]
        },
        {
          "uuid": "0021adac-37bb-4679-a555-1b9c508b6a04",
          "code": "72941741",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72941741",
          "code_system": "PUBCHEM",
          "references": [
            "8797ce8b-9e3f-47cd-8532-36202cde63de"
          ]
        },
        {
          "uuid": "0277b294-50f3-46e5-b19c-a3dae46225de",
          "code": "36E3420K7N",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "57f3b91b-b7a0-b3ea-b685-12e4748c5fea",
          "code": "DTXSID601021724",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID601021724",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "34c94ad2-cd0b-4483-a5d7-f7d40ed1cc29",
          "name": "KERASTIM S",
          "stdName": "KERASTIM S",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e1c1603-87d4-464a-aaa1-2840b72fcd4a",
            "9c61c60c-3992-4d17-91a6-cbdb98f0b0b3"
          ],
          "display_name": false
        },
        {
          "uuid": "661bbf73-ee6f-4aff-810e-abb48356b824",
          "name": "L-CYSTINE, N,N'-BIS(3-CARBOXY-1-OXOPROPYL)-, TETRASODIUM SALT",
          "stdName": "L-CYSTINE, N,N'-BIS(3-CARBOXY-1-OXOPROPYL)-, TETRASODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e1c1603-87d4-464a-aaa1-2840b72fcd4a",
            "9c61c60c-3992-4d17-91a6-cbdb98f0b0b3"
          ],
          "display_name": false
        },
        {
          "uuid": "90b9ee4f-eb48-4934-a202-3c7f317ae70b",
          "name": "TETRASODIUM DISUCCINOYL CYSTINE",
          "stdName": "TETRASODIUM DISUCCINOYL CYSTINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1e1c1603-87d4-464a-aaa1-2840b72fcd4a",
            "9c61c60c-3992-4d17-91a6-cbdb98f0b0b3",
            "32f7e201-816f-4258-8ba2-7a44eb23efd9"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "1e284d02-766e-426c-b861-b2cd921a9828",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "1e1c1603-87d4-464a-aaa1-2840b72fcd4a",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "9c61c60c-3992-4d17-91a6-cbdb98f0b0b3",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8797ce8b-9e3f-47cd-8532-36202cde63de",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1ac7b3b6-5569-4657-9bae-5edd372d73f3",
          "citation": "SRS import [36E3420K7N]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=36E3420K7N",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391623000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c179455-9ef2-48e2-b94c-53125ab79e50",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "32f7e201-816f-4258-8ba2-7a44eb23efd9",
          "citation": "TETRASODIUM DISUCCINOYL CYSTINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82deec8e-5550-4c7e-85d3-9fe2ae0dd0a2",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b729b91c-6ac1-4ba5-816d-bbd06512085e",
          "id": "b729b91c-6ac1-4ba5-816d-bbd06512085e",
          "molfile": "\n  Marvin  01132109292D          \n\n  1  0  0  0  1  0            999 V2000\n    6.8194  -12.1845    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 4,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 4,
            "units": "MOL RATIO",
            "uuid": "6190f6ce-9412-4085-adb1-69e0685543d0"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "b1f4f605-d7dd-4102-ba1d-83c1f94c26ca",
          "id": "b1f4f605-d7dd-4102-ba1d-83c1f94c26ca",
          "molfile": "\n  Marvin  01132109132D          \n\n 28 27  0  0  1  0            999 V2000\n   17.3025  -12.7019    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   16.6153  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9007  -12.7019    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1861  -12.2896    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4713  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7566  -12.2896    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n   13.0420  -12.7019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3272  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3272  -11.4650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6125  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8980  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1832  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1832  -13.5266    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    9.4685  -12.2896    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7566  -11.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4713  -11.0527    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   13.0420  -11.0527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0172  -12.2896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7320  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7320  -13.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4466  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1613  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8761  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8761  -11.4650    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   21.5907  -12.7019    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3025  -13.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6153  -13.9389    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.0172  -13.9389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  1 18  1  6  0  0  0\n  1 26  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 15  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 23 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 26 28  2  0  0  0  0\nM  CHG  4  13  -1  16  -1  24  -1  27  -1\nM  END",
          "smiles": "C(CC(=O)[O-])C(=O)N[C@@H](CSSC[C@@H](C(=O)[O-])NC(=O)CCC(=O)[O-])C(=O)[O-]",
          "formula": "C14H16N2O10S2",
          "atropisomerism": "No",
          "charge": -4,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "a3deabef-1307-472c-96f8-4a1b1c35c623"
          },
          "defined_stereo": 2,
          "ez_centers": 0,
          "molecular_weight": "436.417",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 2
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "708e53bb-b591-475c-a582-6ffb13053ce1",
      "version": "5",
      "structure": {
        "id": "2aa8c15e-66d1-4686-a62a-519253636ebd",
        "molfile": "\n  Marvin  01132102192D          \n\n 32 27  0  0  1  0            999 V2000\n   17.3025  -13.5266    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   17.3025  -12.7019    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n   18.0172  -12.2896    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   18.7320  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   19.4466  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.1613  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8761  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   20.8761  -11.4650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   21.5907  -12.7019    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   18.7320  -13.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   16.6153  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   15.9007  -12.7019    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   15.1861  -12.2896    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4713  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7566  -12.2896    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n   13.0420  -12.7019    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.3272  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6125  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.8980  -12.2896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1832  -12.7019    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1832  -13.5266    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4685  -12.2896    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   12.3272  -11.4650    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.7566  -11.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   14.4713  -11.0527    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   13.0420  -11.0527    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   16.6153  -13.9389    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   18.0172  -13.9389    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    6.8194  -12.1845    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    6.8194  -12.1845    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    6.8194  -12.1845    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n    6.8194  -12.1845    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  1  0  0  0  0\n  4 10  2  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  6  0  0  0\n 16 17  1  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 20 22  1  0  0  0  0\n 17 23  2  0  0  0  0\n 15 24  1  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  1  0  0  0  0\n  1 27  2  0  0  0  0\n  1 28  1  0  0  0  0\n  2  1  1  6  0  0  0\n  3  2  1  0  0  0  0\n  3  4  1  0  0  0  0\nM  CHG  8   9  -1  22  -1  26  -1  28  -1  29   1  30   1  31   1  32   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  4  29  30  31  32\nM  SPA   1  1  29\nM  SDI   1  4    6.3994  -12.6045    6.3994  -11.7645\nM  SDI   1  4    7.2394  -11.7645    7.2394  -12.6045\nM  SMT   1 4\nM  END",
        "smiles": "C(CC(=O)[O-])C(=O)N[C@@H](CSSC[C@@H](C(=O)[O-])NC(=O)CCC(=O)[O-])C(=O)[O-].[Na+].[Na+].[Na+].[Na+]",
        "formula": "C14H16N2O10S2.4Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 2,
        "ez_centers": 0,
        "molecular_weight": "528.3761",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "4c179455-9ef2-48e2-b94c-53125ab79e50",
          "1ac7b3b6-5569-4657-9bae-5edd372d73f3"
        ],
        "stereo_centers": 2
      },
      "unii": "36E3420K7N"
    }
  ]
}