{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b38eab54-fec4-4c40-a023-5bf11a695d7c",
          "code": "M01AG01",
          "comments": "ATC|MUSCULO-SKELETAL SYSTEM|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Fenamates|mefenamic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=M01AG01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "de047266-761d-4797-96ff-1d0b90904abe",
          "code": "N0000175721",
          "comments": "Chemical Ingredients [Chemical/Ingredient]|Chemical Classes for Pharmacologic Classification [Chemical/Ingredient]|Nonsteroidal Anti-inflammatory Compounds [Chemical/Ingredient]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175721",
          "code_system": "NDF-RT",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "90e9e244-4125-44f3-85cc-71a750a7330c",
          "code": "N0000175722",
          "comments": "Established Pharmacologic Class [EPC]|Nonsteroidal Anti-inflammatory Drug [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175722",
          "code_system": "NDF-RT",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "22f8255b-bcb1-48aa-938f-24098ed753dc",
          "code": "N0000000160",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Cyclooxygenase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000160",
          "code_system": "NDF-RT",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "ea94affd-93bf-442c-8671-dac9ef17bd0a",
          "code": "QM01AG01",
          "comments": "VATC|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS|ANTIINFLAMMATORY AND ANTIRHEUMATIC PRODUCTS, NON-STEROIDS|Fenamates|mefenamic acid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QM01AG01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "0738f707-a1c2-4a53-b9d0-60e67cfe8055",
          "code": "61-68-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=61-68-7",
          "code_system": "CAS",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7",
            "7167831a-72ca-42cb-93f9-201281166e24"
          ]
        },
        {
          "uuid": "9a263ec7-cbf6-4e37-aa19-06185ea48445",
          "code": "C47599",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47599",
          "code_system": "NCI_THESAURUS",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "00923d5d-3f88-4f5f-abd3-b2f96a77eac4",
          "code": "D008528",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68008528",
          "code_system": "MESH",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "ed89ffef-444b-4ed4-9a87-dbde00ae04fb",
          "code": "NBK548029",
          "comments": "LiverTox|Analgesic|Mild-Moderate Pain|NSAID",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548029/",
          "code_system": "LIVERTOX",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "37553f47-fc70-4673-9c8f-bc290acb2438",
          "code": "MEFENAMIC ACID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Mefenamic_acid",
          "code_system": "WIKIPEDIA",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "752c4748-12ce-45ac-885b-9ca9e133b89a",
          "code": "SUB08703MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "83ce8f62-a25b-4e0f-b33c-a64433dc4a59",
          "code": "1494",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1494",
          "code_system": "INN",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "abaa45fa-9a50-48e0-ba88-b5bbe2f7e01b",
          "code": "2593",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=2593",
          "code_system": "IUPHAR",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "99bbdd72-4a97-4852-b624-cbdaa3a02fe0",
          "code": "6693",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6693/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "be64aeb3-88c3-4161-a0dd-9cc87efd2022",
          "code": "m7139",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7139?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "676a6cb7-85bd-452b-91cb-fef8dd325b2e",
          "code": "DB00784",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB00784",
          "code_system": "DRUG BANK",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "12e3b19b-5590-48f6-8c04-61de3c2f1a83",
          "code": "CHEMBL686",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL686",
          "code_system": "ChEMBL",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "2743bc81-fce6-4549-969b-b0ee6522c05e",
          "code": "200-513-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.467",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "cb2ac00e-1438-4234-a2f1-a58e53490f22",
          "code": "4044",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4044",
          "code_system": "PUBCHEM",
          "references": [
            "a80a046c-d342-4988-81b9-22170b0546b7"
          ]
        },
        {
          "uuid": "bfa24fae-2011-757d-3b44-5271d5737d72",
          "code": "3115",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/3115",
          "code_system": "HSDB",
          "references": [
            "da320bbe-1190-7fd3-6722-d0ce5deac9c2"
          ]
        },
        {
          "uuid": "be8d176b-f222-0c00-56a3-2e28ff072776",
          "code": "DTXSID5023243",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023243",
          "code_system": "EPA CompTox",
          "references": [
            "15d55286-5739-db3e-2802-2fa5666a8c7e"
          ]
        },
        {
          "uuid": "cd9c1af4-bba6-c635-30ef-df7cb9250e37",
          "code": "Mefenamic Acid",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM166/",
          "code_system": "LACTMED",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "d89e2715-60d0-fa86-a2ee-cf4b3f83c7a4",
          "code": "C257",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Analgesic Agent[C241]|Nonnarcotic Analgesic[C2198]|Analgesic and Antipyretic[C2356]|Nonsteroidal Antiinflammatory Drug",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C257",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "56fe1081-976e-40b5-bf68-777ea6e9eae4",
          "code": "257844",
          "type": "ALTERNATIVE",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/257844/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "a9b6d80d-d43a-672b-2b89-4b47cd314eb0"
          ]
        },
        {
          "uuid": "ec365ff7-2f20-4bc1-a6c9-814c706155b6",
          "code": "367589PJ2C",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "db548c59-b785-d68b-b456-4287aae789d8",
          "code": "1663",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1663",
          "code_system": "DRUG CENTRAL",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "bb7dbddb-f331-7015-b72e-78986c870f25",
          "code": "6717",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:6717",
          "code_system": "CHEBI",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "97427428-125b-f51b-e700-d3ee7d2638c3",
          "code": "1379605",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1379605",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ec0d984b-6d1b-1577-725e-23d10a13685a"
          ]
        },
        {
          "uuid": "f6b5f88c-b9b4-6b20-a26b-28c510d3ec53",
          "code": "94437",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=94437",
          "code_system": "NSC",
          "references": [
            "7c6d6a15-c8b7-fc01-8b74-83fd2400a96d"
          ]
        },
        {
          "uuid": "84c264b2-5202-7ec0-627a-aed48fbbff6b",
          "code": "100000091703",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c896b63a-6068-8172-9ed4-56e3f676b8b8"
          ]
        },
        {
          "uuid": "15768bff-39b1-d91a-e068-470f52211b23",
          "code": "367589PJ2C",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=367589PJ2C",
          "code_system": "DAILYMED",
          "references": [
            "c8979090-5ec2-737c-a021-649e2e21413c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "f849f1da-eb03-45a1-bc79-2d4c31e5b71a",
          "amount": {
            "uuid": "68fbe09f-20e8-4536-aafd-89dedbfc3102"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "d61ff4dc-2318-4162-b138-ff6127972d5d",
            "refuuid": "5d977fa9-129f-447d-ba7a-214abb8f8757",
            "name": "MEFENAMIC ACID",
            "unii": "367589PJ2C",
            "linking_id": "367589PJ2C",
            "ref_pname": "MEFENAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "2dc68bab-c94a-4024-9863-b93acac5b109",
          "amount": {
            "uuid": "99882115-acf7-431d-a737-80c12a5a0a58",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "Correction factors: for the calculation of contents, multiply the peak areas by 5.9",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "0babaa73-8436-4f5e-a96a-3e4edb147807",
            "4fcc27b2-3f0e-4388-943d-ae870c836867"
          ],
          "related_substance": {
            "uuid": "da041dae-2eb3-4e20-bb4c-06840e4ee751",
            "refuuid": "0c558fc3-f708-4710-8ca6-b30450eed449",
            "name": "O-Chlorobenzoic acid",
            "unii": "8P0867193V",
            "linking_id": "8P0867193V",
            "ref_pname": "O-Chlorobenzoic acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "cc97f824-683c-46b2-9724-77fe815f54a8",
          "amount": {
            "uuid": "7b44d2a9-2e4c-4f2f-ab93-03836dea3d24",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7034db3f-3b90-4d61-93e8-04e57edf4f18",
            "5364c391-71b8-4e0d-a165-d4a5d716211d"
          ],
          "related_substance": {
            "uuid": "e4619055-0a7a-4965-ab24-78c3ec7033d6",
            "refuuid": "4392c981-a795-4bfc-97ff-b68f3a4e94fb",
            "name": "2,3-DIMETHYL-N-PHENYLANILINE",
            "unii": "U88XP2706B",
            "linking_id": "U88XP2706B",
            "ref_pname": "2,3-DIMETHYL-N-PHENYLANILINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "f5e74127-ee9c-4c9c-963d-c20c103f1623",
          "amount": {
            "uuid": "d749dff0-d45d-4e52-8fba-a46c285a8135",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "7b0afa71-0fe8-4811-8075-5b33a3c93d4d"
          ],
          "related_substance": {
            "uuid": "065b755a-bf83-4ebf-a21d-2d75149389d8",
            "refuuid": "4b4d8005-fff5-4b2a-ad07-79f6ed4ed84b",
            "name": "N-(2,3-DIMETHYLPHENYL)-2-((2,3-DIMETHYLPHENYL)AMINO)BENZAMIDE",
            "unii": "3A84PG9047",
            "linking_id": "3A84PG9047",
            "ref_pname": "N-(2,3-DIMETHYLPHENYL)-2-((2,3-DIMETHYLPHENYL)AMINO)BENZAMIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9311b1f0-befb-4517-807b-69932e0614aa",
          "type": "METABOLITE->PARENT",
          "references": [
            "cb5589fa-f6cc-4880-8726-5086ee8b20d4"
          ],
          "related_substance": {
            "uuid": "a6591a80-5d6a-411a-a3ff-2ef04c9ea188",
            "refuuid": "82566d10-62f1-4860-96a8-4f67982b74ef",
            "name": "3-CARBOXYMEFENAMIC ACID",
            "unii": "LLA90H5KPK",
            "linking_id": "LLA90H5KPK",
            "ref_pname": "3-CARBOXYMEFENAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "d2fb423e-79ce-482c-b083-db84263c5a5a",
          "type": "METABOLITE->PARENT",
          "mediator_substance": {
            "uuid": "c0fc999a-ac91-42ec-92dc-05eb67f2ba8a",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          },
          "references": [
            "cb5589fa-f6cc-4880-8726-5086ee8b20d4"
          ],
          "related_substance": {
            "uuid": "8f9271a3-a18b-4ccc-8e56-d76e3a550cee",
            "refuuid": "a1c6bc39-0eb0-420a-83b9-e6b855b247a6",
            "name": "3-HYDROXYMETHYL MEFENAMIC ACID",
            "unii": "8L4T2779IX",
            "linking_id": "8L4T2779IX",
            "ref_pname": "3-HYDROXYMETHYL MEFENAMIC ACID",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "443329df-93bd-48a1-9db4-83d70368ea30",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "c6ddee27-d764-4fa3-a5b7-2479726fdc43"
          ],
          "related_substance": {
            "uuid": "3abece46-8bfc-48ce-8ade-1dc12a2186f0",
            "refuuid": "0ca86877-c2cd-47c4-ac3a-935faef1b807",
            "name": "3-CARBOXY MEFENAMIC ACID ACYL-.BETA.-D-GLUCURONIDE",
            "unii": "M3G76I0347",
            "linking_id": "M3G76I0347",
            "ref_pname": "3-CARBOXY MEFENAMIC ACID ACYL-.BETA.-D-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "836c34a7-b3e3-448e-9586-e03ff0a4daa4",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "8349102e-eaa7-4524-9612-9f8fde9200eb"
          ],
          "related_substance": {
            "uuid": "7ec93129-3b1f-44ab-9579-778060358e54",
            "refuuid": "fc7d5ed9-9e05-4f6a-9efa-60453b01b0ac",
            "name": "3-HYDROXYMETHYL MEFENAMIC ACID ACYL-.BETA.-D-GLUCURONIDE",
            "unii": "53XT40J50Q",
            "linking_id": "53XT40J50Q",
            "ref_pname": "3-HYDROXYMETHYL MEFENAMIC ACID ACYL-.BETA.-D-GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "584cec9b-e867-409b-ad15-baf36f4f8416",
          "type": "METABOLITE->PARENT",
          "interaction_type": "MAJOR",
          "references": [
            "d9d84830-cb17-4610-8aa8-7062e2d133d8"
          ],
          "related_substance": {
            "uuid": "d7e747de-bccb-42bd-93c3-d8202d71e7f1",
            "refuuid": "c476c324-162d-46a2-b9b4-a45973ada11d",
            "name": "MEFENAMIC ACID GLUCURONIDE",
            "unii": "OX5H10G1RG",
            "linking_id": "OX5H10G1RG",
            "ref_pname": "MEFENAMIC ACID GLUCURONIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b9ae8a16-a01b-41d2-bb70-54e8c04e1249",
          "amount": {
            "uuid": "9db63d07-f075-4f5c-9d0c-d2751e41a808",
            "type": "RELATIONSHIP_AMOUNT",
            "average": 1.2,
            "units": "MICROMOLAR"
          },
          "comments": "inhibits pradigastat glucuronidation",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "22ad229a-45d4-4db7-8443-322ac4bed7be"
          ],
          "related_substance": {
            "uuid": "112a23bd-a783-4790-aafc-1cb723bc4987",
            "refuuid": "e720bbda-7ff3-4519-9e1c-8a4880de5e0f",
            "name": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 2B7",
            "unii": "0M77ZW789J",
            "linking_id": "0M77ZW789J",
            "ref_pname": "URIDINE DIPHOSPHATE GLUCURONOSYLTRANSFERASE 2B7",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "b8bbf84b-77c7-49d6-8640-cac5e81c6823",
          "amount": {
            "uuid": "73b70b4c-304b-4e5e-8329-d17a8abcfdf0",
            "units": "PPM",
            "high_limit": 100
          },
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "2c50fdf3-f064-438e-811a-09e3e6e7910e"
          ],
          "related_substance": {
            "uuid": "d190c282-64e7-499a-8a89-1177303b0d09",
            "refuuid": "4676efc8-a754-4336-a4f4-72b54ec19615",
            "name": "2,3-XYLIDINE",
            "unii": "ZD450ABI9X",
            "linking_id": "ZD450ABI9X",
            "ref_pname": "2,3-XYLIDINE"
          }
        },
        {
          "uuid": "26382e5f-e7eb-4ed3-a146-dccc2570aaa6",
          "amount": {
            "uuid": "3878d6cd-dc16-42fe-8e46-466ee2efdf5f",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "comments": "Correction factors: for the calculation of contents, multiply the peak areas by 4.0",
          "qualification": "EP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "b7c58196-8ac2-4134-ba46-3c2b5e4331c5"
          ],
          "related_substance": {
            "uuid": "b46db8ce-ed8f-4039-82b2-ae3db4be489c",
            "refuuid": "76d7e2f1-16f8-4289-8ee1-a8e17c4804bb",
            "name": "Benzoic Acid",
            "unii": "8SKN0B0MIM",
            "linking_id": "8SKN0B0MIM",
            "ref_pname": "Benzoic Acid"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4b8ab617-2afc-4fc6-a74f-1fc21c83cf48",
          "name": "2-(2,3-DIMETHYLPHENYL)AMINOBENZOIC ACID",
          "stdName": "2-(2,3-DIMETHYLPHENYL)AMINOBENZOIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e0c122dd-0a5c-4b3e-ae5c-f1ff2102191d"
          ],
          "display_name": false
        },
        {
          "uuid": "4eb55f05-ad83-47a9-b71b-9de92ed6f8eb",
          "name": "BENZOIC ACID, 2-(2,3-DIMETHYLPHENYL)AMINO-",
          "stdName": "BENZOIC ACID, 2-(2,3-DIMETHYLPHENYL)AMINO-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "82567e51-b75e-45d3-80bf-e6a990c7192b"
          ],
          "display_name": false
        },
        {
          "uuid": "3599ec31-690e-416e-8891-c362a71bcb70",
          "name": "CI-473",
          "stdName": "CI-473",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48ac5131-e606-4546-821f-601afca5dbce"
          ],
          "display_name": false
        },
        {
          "uuid": "3bbce81b-a8e4-40c2-942e-564394510313",
          "name": "CN-35355",
          "stdName": "CN-35355",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48ac5131-e606-4546-821f-601afca5dbce"
          ],
          "display_name": false
        },
        {
          "uuid": "02573778-b88d-4e57-b90f-becac9a1e06e",
          "name": "GARDAN",
          "stdName": "GARDAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60d22cc3-7b7e-45ad-9816-a2f0f24375cd"
          ],
          "display_name": false
        },
        {
          "uuid": "f1e90d7f-2007-49be-a0e4-f11c6b3106db",
          "name": "INF-3355",
          "stdName": "INF-3355",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48ac5131-e606-4546-821f-601afca5dbce"
          ],
          "display_name": false
        },
        {
          "uuid": "77591902-1f3e-444a-970f-41f4a5467468",
          "name": "J2.344B",
          "stdName": "J2.344B",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1a4cf5fa-5ffc-4ac0-96ed-ada9e304e408"
          ],
          "display_name": false
        },
        {
          "uuid": "1425a668-fe95-42a3-9516-b5cee8d4ae76",
          "name": "M01AG01",
          "stdName": "M01AG01",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "feec9c92-ea28-45b7-a7a8-73ea493c6d39"
          ],
          "display_name": false
        },
        {
          "uuid": "3d38559e-50d6-ba51-b769-453e2fb4409d",
          "name": "MEFENAMATE",
          "stdName": "MEFENAMATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a9b6d80d-d43a-672b-2b89-4b47cd314eb0"
          ],
          "display_name": false
        },
        {
          "uuid": "ad879328-f492-4ab9-bb79-32cbe55e46c2",
          "name": "MEFENAMIC ACID",
          "stdName": "MEFENAMIC ACID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "cc5fe6f7-74ed-4b50-ab91-5826a8e1424b",
            "c2067088-560e-44db-93db-c41a64e5f6d8",
            "bf3a8b08-1161-4640-9a7d-d38597a14615",
            "08b3e01e-de22-4a5d-9f41-1de311de24ad",
            "1b3f5767-57a0-4146-9c27-372deaa1e62a",
            "fe8b45f6-2021-4778-b4f0-ad431e5306ec",
            "eaab53bf-fbaf-4ad5-950c-27c19138b324",
            "36313a00-107b-42b2-a8ea-0c7739f227e5",
            "8bda8d2b-023c-471f-82e9-02fec70b0448",
            "2332d198-4335-4b2b-878d-933f477b4d20",
            "62d0d1fd-3c3b-4fe5-90df-f96d86f267c7",
            "3b5c0872-b9fb-4d86-b536-bb44f4fbc541",
            "6fa60ef8-b34c-492b-ad3d-d708f599021d",
            "b9a3bd87-c038-4ee0-9141-9271b8569686",
            "b6382a2f-5d6b-43fc-a12e-dea25d105db7",
            "d7b4502a-edb7-4bee-9bf9-89ce0e89d1cc",
            "2876f88c-49d6-4102-9b90-54cbb0d603cf",
            "d7d4e1ac-a3cf-4ac4-beb3-ce6c37a112f8",
            "7448b0dd-c3c8-4584-b1d5-ec944c537ca1",
            "00725807-c9ef-4e73-be43-ad5c3fb9ab2c",
            "092e227e-3963-4787-861b-044166e041d4",
            "1a4a90cc-eda8-4fb7-8d09-15b9d06d064e",
            "ffcd9689-0c0a-4b2c-bdab-d7791374ab45"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "ed3c6467-57e5-4ffc-9618-edb47296e5eb",
              "name_org": "INN"
            },
            {
              "uuid": "64808129-4721-4400-83e9-cb1b9b5c4db0",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "4004d16b-9bec-595d-fb0c-5057ac4d7a72",
          "name": "MEFENAMIC ACID [EP MONOGRAPH]",
          "stdName": "MEFENAMIC ACID [EP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "3523ee87-f749-d9db-3a1a-1c61ce9bf724"
          ],
          "display_name": false
        },
        {
          "uuid": "8d612e37-0db2-4da1-b805-987305000ce1",
          "name": "MEFENAMIC ACID [HSDB]",
          "stdName": "MEFENAMIC ACID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fe8b45f6-2021-4778-b4f0-ad431e5306ec"
          ],
          "display_name": false
        },
        {
          "uuid": "a863c2a4-41f8-459a-9e51-b91d5ad560c0",
          "name": "MEFENAMIC ACID [JAN]",
          "stdName": "MEFENAMIC ACID [JAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dc8341a8-02b9-a0d0-cf6c-5b23b4a89824"
          ],
          "display_name": false
        },
        {
          "uuid": "421d6357-8c25-4d12-b536-04fd791ba480",
          "name": "MEFENAMIC ACID [MART.]",
          "stdName": "MEFENAMIC ACID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ffcd9689-0c0a-4b2c-bdab-d7791374ab45"
          ],
          "display_name": false
        },
        {
          "uuid": "873a0010-011b-44c3-a085-d80718233935",
          "name": "MEFENAMIC ACID [MI]",
          "stdName": "MEFENAMIC ACID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "00725807-c9ef-4e73-be43-ad5c3fb9ab2c"
          ],
          "display_name": false
        },
        {
          "uuid": "e1690549-9b34-40ec-b4b4-71dd884a0244",
          "name": "MEFENAMIC ACID [ORANGE BOOK]",
          "stdName": "MEFENAMIC ACID [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2332d198-4335-4b2b-878d-933f477b4d20"
          ],
          "display_name": false
        },
        {
          "uuid": "a37bade2-32a6-48c3-b73b-8c99f865a14f",
          "name": "MEFENAMIC ACID [USAN]",
          "stdName": "MEFENAMIC ACID [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "092e227e-3963-4787-861b-044166e041d4"
          ],
          "display_name": false
        },
        {
          "uuid": "8dcac3fd-544f-cd02-0eea-9d00c4df823d",
          "name": "MEFENAMIC ACID [USP MONOGRAPH]",
          "stdName": "MEFENAMIC ACID [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6be3b0fa-5f68-c63a-f114-8f2fa9242633"
          ],
          "display_name": false
        },
        {
          "uuid": "ba02f9db-2db4-4c97-a66b-24d99e161dab",
          "name": "MEFENAMIC ACID [USP-RS]",
          "stdName": "MEFENAMIC ACID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d7b4502a-edb7-4bee-9bf9-89ce0e89d1cc"
          ],
          "display_name": false
        },
        {
          "uuid": "69e1c4de-a620-49cd-b69b-45ee9f40ad43",
          "name": "MEFENAMIC ACID [VANDF]",
          "stdName": "MEFENAMIC ACID [VANDF]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b6382a2f-5d6b-43fc-a12e-dea25d105db7"
          ],
          "display_name": false
        },
        {
          "uuid": "46f2b904-afa1-4aba-83b3-6a25ae974c5c",
          "name": "MEFENAMINIC ACID",
          "stdName": "MEFENAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "41ff08a2-1d6b-42db-bddf-1911b42afb61"
          ],
          "display_name": false
        },
        {
          "uuid": "877883d1-b8b0-4923-8591-3f389a850e9f",
          "name": "MEPHENAMIC ACID",
          "stdName": "MEPHENAMIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9b1f5750-ffc7-42b6-9e57-5d208d664fd3"
          ],
          "display_name": false
        },
        {
          "uuid": "fa531dec-0416-47d4-b057-37b17b7a2dad",
          "name": "MEPHENAMINIC ACID",
          "stdName": "MEPHENAMINIC ACID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b67028fa-c7f1-4d91-a366-44066e9478bb"
          ],
          "display_name": false
        },
        {
          "uuid": "e6999fb4-d152-32ef-08af-d891440b104e",
          "name": "Mefenamic acid [WHO-DD]",
          "stdName": "MEFENAMIC ACID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7aed5033-e561-54f5-b2aa-8c5295d21a82"
          ],
          "display_name": false
        },
        {
          "uuid": "20847876-5484-43b1-a49c-05dd602b6f20",
          "name": "N-2,3-Xylylanthranilic acid",
          "stdName": "N-2,3-XYLYLANTHRANILIC ACID",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "48ac5131-e606-4546-821f-601afca5dbce"
          ],
          "display_name": false
        },
        {
          "uuid": "4b499c33-9602-4ba1-92a8-bbc1d9d3beda",
          "name": "NSC-94437",
          "stdName": "NSC-94437",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e62e16ae-55ac-4dc7-b93a-72b79bd3abd4"
          ],
          "display_name": false
        },
        {
          "uuid": "151a8a55-1596-4c5f-838c-e907d7605040",
          "name": "PONSTEL",
          "stdName": "PONSTEL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c9ebd59e-31a0-4e34-8b13-a19219efcf31"
          ],
          "display_name": false
        },
        {
          "uuid": "e3760db8-df1f-43af-aab5-3f979abb0eba",
          "name": "mefenamic acid [INN]",
          "stdName": "MEFENAMIC ACID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "36313a00-107b-42b2-a8ea-0c7739f227e5"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "b7c58196-8ac2-4134-ba46-3c2b5e4331c5",
          "citation": "European Pharmacopoeia Online 9.8, Mefenamic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0babaa73-8436-4f5e-a96a-3e4edb147807",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/mefenamic-acid-1-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4fcc27b2-3f0e-4388-943d-ae870c836867",
          "citation": "European Pharmacopoeia Online 9.8, Mefenamic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7034db3f-3b90-4d61-93e8-04e57edf4f18",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/mefenamic-acid-1-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5f68a13-7893-f534-c8e0-0f621927a42a",
          "citation": "USP42-NF37 - 2710, Mefenamic Acid Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5a3e6f16-7878-dd7a-485a-f490c92ff2d4",
          "citation": "European Pharmacopoeia Online 9.8, Mefenamic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "5364c391-71b8-4e0d-a165-d4a5d716211d",
          "citation": "European Pharmacopoeia Online 9.8, Mefenamic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "2c50fdf3-f064-438e-811a-09e3e6e7910e",
          "citation": "European Pharmacopoeia Online 9.8, Mefenamic Acid Monograph",
          "doc_type": "EP",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "7b0afa71-0fe8-4811-8075-5b33a3c93d4d",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/mefenamic-acid-1-0",
          "doc_type": "USP-MC",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2876f88c-49d6-4102-9b90-54cbb0d603cf",
          "citation": "USP Dictionary 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "82567e51-b75e-45d3-80bf-e6a990c7192b",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e0c122dd-0a5c-4b3e-ae5c-f1ff2102191d",
          "citation": "WIKEPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "feec9c92-ea28-45b7-a7a8-73ea493c6d39",
          "citation": "ATC CODE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "48ac5131-e606-4546-821f-601afca5dbce",
          "citation": "USP DICTIONARY 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c9ebd59e-31a0-4e34-8b13-a19219efcf31",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "36313a00-107b-42b2-a8ea-0c7739f227e5",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "092e227e-3963-4787-861b-044166e041d4",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a4a90cc-eda8-4fb7-8d09-15b9d06d064e",
          "citation": "EP 7.2",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7d4e1ac-a3cf-4ac4-beb3-ce6c37a112f8",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2332d198-4335-4b2b-878d-933f477b4d20",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ffcd9689-0c0a-4b2c-bdab-d7791374ab45",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "00725807-c9ef-4e73-be43-ad5c3fb9ab2c",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60d22cc3-7b7e-45ad-9816-a2f0f24375cd",
          "citation": "MIMS PHILIPPINES",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fe8b45f6-2021-4778-b4f0-ad431e5306ec",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1b3f5767-57a0-4146-9c27-372deaa1e62a",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b6382a2f-5d6b-43fc-a12e-dea25d105db7",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d7b4502a-edb7-4bee-9bf9-89ce0e89d1cc",
          "citation": "http://store.usp.org/OA_HTML/ibeCCtpItmDspRte.jsp?item=19103&section=10560&beginIndex=40&sitex=10020",
          "url": "http://store.usp.org/OA_HTML/ibeCCtpItmDspRte.jsp?item=19103&section=10560&beginIndex=40&sitex=10020",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b67028fa-c7f1-4d91-a366-44066e9478bb",
          "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/61-68-7",
          "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/61-68-7",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9b1f5750-ffc7-42b6-9e57-5d208d664fd3",
          "citation": "SciFinder",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1a4cf5fa-5ffc-4ac0-96ed-ada9e304e408",
          "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.344B",
          "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J2.344B",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "41ff08a2-1d6b-42db-bddf-1911b42afb61",
          "citation": "http://www.ncbi.nlm.nih.gov/mesh/?term=Mefenaminic%20Acid",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/?term=Mefenaminic%20Acid",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e62e16ae-55ac-4dc7-b93a-72b79bd3abd4",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a80a046c-d342-4988-81b9-22170b0546b7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6b8ffb5-fecc-4247-bdc0-4611dc11d108",
          "citation": "USP-MC",
          "url": "https://mc.usp.org/monographs/mefenamic-acid-1-0",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cb5589fa-f6cc-4880-8726-5086ee8b20d4",
          "citation": "http://www.accessdata.fda.gov/spl/data/cb0460b9-a3f2-4228-8120-caa3447ab196/cb0460b9-a3f2-4228-8120-caa3447ab196.xml",
          "url": "http://www.accessdata.fda.gov/spl/data/cb0460b9-a3f2-4228-8120-caa3447ab196/cb0460b9-a3f2-4228-8120-caa3447ab196.xml",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8349102e-eaa7-4524-9612-9f8fde9200eb",
          "citation": "BIOLOGICAL & PHARMACEUTICAL, BULLETIN, VOLUME 16, ISSUE 8, PAGES 811-12",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "22ad229a-45d4-4db7-8443-322ac4bed7be",
          "citation": "THEJOURNALOFCLINICALPHARMACOLOGY 2016, 56(3) 355?364",
          "url": "http://onlinelibrary.wiley.com/doi/10.1002/jcph.595/pdf",
          "doc_type": "JOURNAL ARTICLE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61399cc3-85f4-4d73-9346-8877f2667f8a",
          "citation": "SRS import [367589PJ2C]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=367589PJ2C",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389661000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "181a3ff8-a683-4ea8-a013-646144fb5f09",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3b5c0872-b9fb-4d86-b536-bb44f4fbc541",
          "citation": "MEFENAMIC ACID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bf3a8b08-1161-4640-9a7d-d38597a14615",
          "citation": "MEFENAMIC ACID [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "6fa60ef8-b34c-492b-ad3d-d708f599021d",
          "citation": "MEFENAMIC ACID [EP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8bda8d2b-023c-471f-82e9-02fec70b0448",
          "citation": "MEFENAMIC ACID [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "62d0d1fd-3c3b-4fe5-90df-f96d86f267c7",
          "citation": "MEFENAMIC ACID [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08b3e01e-de22-4a5d-9f41-1de311de24ad",
          "citation": "MEFENAMIC ACID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b9a3bd87-c038-4ee0-9141-9271b8569686",
          "citation": "MEFENAMIC ACID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7448b0dd-c3c8-4584-b1d5-ec944c537ca1",
          "citation": "MEFENAMIC ACID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cc5fe6f7-74ed-4b50-ab91-5826a8e1424b",
          "citation": "MEFENAMIC ACID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c2067088-560e-44db-93db-c41a64e5f6d8",
          "citation": "MEFENAMIC ACID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eaab53bf-fbaf-4ad5-950c-27c19138b324",
          "citation": "MEFENAMIC ACID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc8341a8-02b9-a0d0-cf6c-5b23b4a89824",
          "citation": "jan",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "da320bbe-1190-7fd3-6722-d0ce5deac9c2",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+61-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "15d55286-5739-db3e-2802-2fa5666a8c7e",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=61-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ce32a630-1c83-5f7c-b020-6dafb253fc97",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+61-68-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c896b63a-6068-8172-9ed4-56e3f676b8b8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ec0d984b-6d1b-1577-725e-23d10a13685a",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "a9b6d80d-d43a-672b-2b89-4b47cd314eb0",
          "citation": "RXNORM",
          "doc_type": "NLM",
          "public_domain": true
        },
        {
          "uuid": "7167831a-72ca-42cb-93f9-201281166e24",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5118e20e-681a-3b92-63de-56da4df9a80c",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "6be3b0fa-5f68-c63a-f114-8f2fa9242633",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "d9d84830-cb17-4610-8aa8-7062e2d133d8",
          "citation": "Biol Pharm Bull 1993 Aug;16(8):811-2",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c6ddee27-d764-4fa3-a5b7-2479726fdc43",
          "citation": "Biol Pharm Bull 1993 Aug;16(8):811-2",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "3523ee87-f749-d9db-3a1a-1c61ce9bf724",
          "citation": "EP 10.5",
          "doc_type": "EP",
          "public_domain": true
        },
        {
          "uuid": "7c6d6a15-c8b7-fc01-8b74-83fd2400a96d",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "7aed5033-e561-54f5-b2aa-8c5295d21a82",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "c8979090-5ec2-737c-a021-649e2e21413c",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "9770edb7-305b-438c-8182-079c7836a284",
          "id": "9770edb7-305b-438c-8182-079c7836a284",
          "molfile": "\n  Marvin  01132107522D          \n\n 18 19  0  0  0  0            999 V2000\n    6.3167   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0375   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0375   -7.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7500   -7.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -7.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1792   -6.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8917   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8875   -7.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -7.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3125   -7.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -6.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6000   -6.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8792   -4.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -4.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7500   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7417   -5.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 17  2  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n 17  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 13  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 14  2  0  0  0  0\n 18 17  1  0  0  0  0\nM  END",
          "smiles": "Cc1cccc(c1C)Nc2ccccc2C(=O)O",
          "formula": "C15H15NO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "ada55f3e-86f5-4a51-bbcf-007d7cde234c"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "241.2857",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "5d977fa9-129f-447d-ba7a-214abb8f8757",
      "version": "44",
      "structure": {
        "id": "e983a29d-97a8-420c-a703-43b360a8aec2",
        "molfile": "\n  Marvin  01132112052D          \n\n 18 19  0  0  0  0            999 V2000\n   10.6000   -6.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1792   -6.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8917   -6.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -5.1750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7500   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8792   -4.7625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0375   -6.4167    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -4.7542    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3042   -6.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4667   -7.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.8875   -7.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7500   -7.6542    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7417   -5.1792    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0375   -7.2417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3167   -6.0042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.3125   -7.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.5917   -7.6417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  6  1  0  0  0  0\n  9  4  1  0  0  0  0\n 10  1  2  0  0  0  0\n 11  5  1  0  0  0  0\n 12  3  2  0  0  0  0\n 13 11  2  0  0  0  0\n 14  6  1  0  0  0  0\n 15 13  1  0  0  0  0\n 16  8  1  0  0  0  0\n 17 10  1  0  0  0  0\n 18 17  2  0  0  0  0\n 12 18  1  0  0  0  0\n  8 15  2  0  0  0  0\nM  END",
        "smiles": "Cc1cccc(c1C)Nc2ccccc2C(=O)O",
        "formula": "C15H15NO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "241.2857",
        "optical_activity": "NONE",
        "references": [
          "61399cc3-85f4-4d73-9346-8877f2667f8a",
          "181a3ff8-a683-4ea8-a013-646144fb5f09",
          "36313a00-107b-42b2-a8ea-0c7739f227e5"
        ],
        "stereo_centers": 0
      },
      "unii": "367589PJ2C"
    }
  ]
}