{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "798c2229-d9c0-4286-90c0-7208e1f13b66",
          "code": "20020-02-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=20020-02-4",
          "code_system": "CAS",
          "references": [
            "f407cc93-47c4-43f1-9527-6461ea0ced10",
            "3cc6f0b4-bfb4-49cf-9e9d-c63ebe948a3d"
          ]
        },
        {
          "uuid": "1c4ee1f9-5734-4b05-96d8-1bfe84566acf",
          "code": "29910",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/29910",
          "code_system": "PUBCHEM",
          "references": [
            "f407cc93-47c4-43f1-9527-6461ea0ced10"
          ]
        },
        {
          "uuid": "820ab2b6-0c33-2434-be9c-99da453824fa",
          "code": "4283",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/4283",
          "code_system": "HSDB",
          "references": [
            "eb9f183c-e977-624b-859b-af14fdada218"
          ]
        },
        {
          "uuid": "5408f436-b358-a612-61b0-0f7ece53fea7",
          "code": "DTXSID5026095",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5026095",
          "code_system": "EPA CompTox",
          "references": [
            "6e9746d4-6509-b77f-c290-8ed01b6bf3f1"
          ]
        },
        {
          "uuid": "697e7251-260f-4a9d-a1d4-288e6ada6853",
          "code": "365DE4737Q",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "12f27944-9469-d5f9-6d6d-fe031ce8aa93",
          "code": "524443",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=524443",
          "code_system": "NSC",
          "references": [
            "61b51f50-8242-ff5b-5a49-8dabfcd3748a"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "4e3fd571-37ff-4c3f-8442-f55209b099c2",
          "name": "1,2,3,4-TETRACHLORONAPHTHALENE",
          "stdName": "1,2,3,4-TETRACHLORONAPHTHALENE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ac5951e7-3719-4206-b79f-c19b76f9973c",
            "8f9c2366-835c-4a2c-8047-227bd807f519",
            "aff4ed5e-1852-4da1-8fd9-cc79073684e3"
          ],
          "display_name": true
        },
        {
          "uuid": "c46d6e13-84b1-414f-a41c-3ac33086eb8d",
          "name": "1,2,3,4-TETRACHLORONAPHTHALENE [HSDB]",
          "stdName": "1,2,3,4-TETRACHLORONAPHTHALENE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f9c2366-835c-4a2c-8047-227bd807f519",
            "aff4ed5e-1852-4da1-8fd9-cc79073684e3"
          ],
          "display_name": false
        },
        {
          "uuid": "fdb6dca1-a4c8-4770-8a77-b0f6c1d1764a",
          "name": "NIBREN WAX",
          "stdName": "NIBREN WAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d10569-a67f-4a7d-9528-b224cdd750ef",
            "8f9c2366-835c-4a2c-8047-227bd807f519"
          ],
          "display_name": false
        },
        {
          "uuid": "241770e9-8e18-4211-afe7-e6d23ffa4c3f",
          "name": "NSC-524443",
          "stdName": "NSC-524443",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d10569-a67f-4a7d-9528-b224cdd750ef",
            "8f9c2366-835c-4a2c-8047-227bd807f519"
          ],
          "display_name": false
        },
        {
          "uuid": "0e72ab80-f6d6-425e-a1db-c2f4b94a2189",
          "name": "SEEKAY WAX",
          "stdName": "SEEKAY WAX",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "61d10569-a67f-4a7d-9528-b224cdd750ef",
            "8f9c2366-835c-4a2c-8047-227bd807f519"
          ],
          "display_name": false
        },
        {
          "uuid": "2156d72b-dd08-4417-ab01-2a6970609d36",
          "name": "TETRACHLORONAPHTHALENE, 1,2,3,4-",
          "stdName": "TETRACHLORONAPHTHALENE, 1,2,3,4-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2d07e5a6-0349-4c6a-8d35-53978492679a"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "2d07e5a6-0349-4c6a-8d35-53978492679a",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "aff4ed5e-1852-4da1-8fd9-cc79073684e3",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8f9c2366-835c-4a2c-8047-227bd807f519",
          "citation": "NLM",
          "doc_type": "NLM",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "61d10569-a67f-4a7d-9528-b224cdd750ef",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f407cc93-47c4-43f1-9527-6461ea0ced10",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390955000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "fa20e064-b952-4648-978a-fc2cb1cffca8",
          "citation": "SRS import [365DE4737Q]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=365DE4737Q",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390955000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "88e57e0f-bea9-4269-babf-4aac80d35349",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ac5951e7-3719-4206-b79f-c19b76f9973c",
          "citation": "1,2,3,4-TETRACHLORONAPHTHALENE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "eb9f183c-e977-624b-859b-af14fdada218",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+20020-02-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6e9746d4-6509-b77f-c290-8ed01b6bf3f1",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=20020-02-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "61b51f50-8242-ff5b-5a49-8dabfcd3748a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "3cc6f0b4-bfb4-49cf-9e9d-c63ebe948a3d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "1b447528-ca60-4691-bce4-1a6e05c9426c",
          "id": "1b447528-ca60-4691-bce4-1a6e05c9426c",
          "molfile": "\n  Marvin  01132101362D          \n\n 14 15  0  0  0  0            999 V2000\n    8.6912   -6.0597    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9757   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9757   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6912   -4.4184    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -3.5932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.5548   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8395   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1242   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1242   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8395   -6.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5548   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -6.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -6.8849    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n 13  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  2  0  0  0  0\n  5  6  1  0  0  0  0\n  7  5  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 12  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 11 10  2  0  0  0  0\n 12 11  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\nM  END",
          "smiles": "c1ccc2c(c1)c(c(c(c2Cl)Cl)Cl)Cl",
          "formula": "C10H4Cl4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "992bbfb0-72ef-43dc-b067-cabd5eea8391"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "265.9509",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "443e2915-a683-400a-aa28-eafa5e919109",
      "version": "5",
      "structure": {
        "id": "4624b9a0-7b21-4a7a-8b63-ee092d9496ab",
        "molfile": "\n  Marvin  01132103412D          \n\n 14 15  0  0  0  0            999 V2000\n    6.5548   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5548   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -6.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.9757   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6912   -6.0597    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.9757   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -3.5932    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    8.6912   -4.4184    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.2595   -6.8849    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.8395   -6.0597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1242   -5.6485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1242   -4.8294    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.8395   -4.4184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  7  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  6  9  1  0  0  0  0\n  3 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 13 12  1  0  0  0  0\n 14 13  2  0  0  0  0\n  1 14  1  0  0  0  0\nM  END",
        "smiles": "c1ccc2c(c1)c(c(c(c2Cl)Cl)Cl)Cl",
        "formula": "C10H4Cl4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "265.9509",
        "optical_activity": "NONE",
        "references": [
          "88e57e0f-bea9-4269-babf-4aac80d35349",
          "fa20e064-b952-4648-978a-fc2cb1cffca8"
        ],
        "stereo_centers": 0
      },
      "unii": "365DE4737Q"
    }
  ]
}