{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "81efc54b-b510-4b37-9f93-6a969b2ef63e", "code": "28472-97-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=28472-97-1", "code_system": "CAS", "references": [ "4dce55eb-4cb0-49e4-b58b-cc2ad974f935", "cda30b90-5ae8-4760-9881-d60ef6a3eb06" ] }, { "uuid": "15afe4e5-8e54-42c7-8257-782187dc452e", "code": "249-044-4", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.044.571", "code_system": "ECHA (EC/EINECS)", "references": [ "4dce55eb-4cb0-49e4-b58b-cc2ad974f935" ] }, { "uuid": "85706498-95d0-4f15-b536-47d1cc039fb4", "code": "119967", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/119967", "code_system": "PUBCHEM", "references": [ "4dce55eb-4cb0-49e4-b58b-cc2ad974f935" ] }, { "uuid": "655e8f76-1430-482f-ab33-58b3ef73a5a2", "code": "362AT1XP12", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "02047426-fe2a-4987-ae01-61867badb725", "name": "AZELAIC ACID, DIISODECYL ESTER", "stdName": "AZELAIC ACID, DIISODECYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "72005122-0e89-43ee-8e83-13122c7a259d" ], "display_name": false }, { "uuid": "9145b0f1-778c-49b9-9c92-59c6a59ad478", "name": "DIISODECYL AZELAATE", "stdName": "DIISODECYL AZELAATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "72005122-0e89-43ee-8e83-13122c7a259d" ], "display_name": false }, { "uuid": "3a9edef5-b6d2-44f2-8741-3b3a17d3617e", "name": "DIISODECYL AZELATE", "stdName": "DIISODECYL AZELATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "79c09dd8-a290-4618-be41-2b1b39df7b97" ], "display_name": false }, { "uuid": "a46c1a5d-1124-4d4b-b44e-d6d382225e9b", "name": "ISODECYL ALCOHOL, AZELAATE (2:1)", "stdName": "ISODECYL ALCOHOL, AZELAATE (2:1)", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "72005122-0e89-43ee-8e83-13122c7a259d" ], "display_name": false }, { "uuid": "238bf4ba-319a-4606-a754-456d706eb3c3", "name": "J263.519D", "stdName": "J263.519D", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "c6a505c1-8657-4f84-a925-aa0d74361eba" ], "display_name": false }, { "uuid": "127fd134-90e1-4857-aeb9-8af1727c6993", "name": "NONANEDIOIC ACID, 1,9-DIISODECYL ESTER", "stdName": "NONANEDIOIC ACID, 1,9-DIISODECYL ESTER", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "72005122-0e89-43ee-8e83-13122c7a259d" ], "display_name": false }, { "uuid": "1299b834-660b-4a80-9cc3-767e4ab97aad", "name": "NONANEDIOIC ACID, DIISODECYL ESTER", "stdName": "NONANEDIOIC ACID, DIISODECYL ESTER", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "c6c20fbc-8046-4ef5-b57b-0df02a3df1e3" ], "display_name": true }, { "uuid": "dd91011f-762e-4b2b-bd64-f753be86cd4c", "name": "PRIOLUBE 1858", "stdName": "PRIOLUBE 1858", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "c8f3089e-59b4-4463-8d55-d15579defecb" ], "display_name": false } ], "references": [ { "uuid": "c6c20fbc-8046-4ef5-b57b-0df02a3df1e3", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "c8f3089e-59b4-4463-8d55-d15579defecb", "citation": "SciFinder", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "c6a505c1-8657-4f84-a925-aa0d74361eba", "citation": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J263.519D", "url": "http://nikkajiweb.jst.go.jp/nikkaji_web/pages/top_e.jsp?CONTENT=syosai&SN=J263.519D", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "79c09dd8-a290-4618-be41-2b1b39df7b97", "citation": "http://chem.sis.nlm.nih.gov/chemidplus/rn/28472-97-1", "url": "http://chem.sis.nlm.nih.gov/chemidplus/rn/28472-97-1", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "72005122-0e89-43ee-8e83-13122c7a259d", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "4dce55eb-4cb0-49e4-b58b-cc2ad974f935", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393063000, "tags": [ "NOMEN" ] }, { "uuid": "ee8c17c3-8df0-4e2d-9077-7365c8447f4a", "citation": "SRS import [362AT1XP12]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=362AT1XP12", "doc_type": "SRS", "public_domain": true, "document_date": 1493393063000, "tags": [ "NOMEN" ] }, { "uuid": "69b58266-951a-a096-b88b-1b45c80006d3", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=28472-97-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "cda30b90-5ae8-4760-9881-d60ef6a3eb06", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "17549ff5-0cd4-4b10-bb9e-c8e8bab2b211", "id": "17549ff5-0cd4-4b10-bb9e-c8e8bab2b211", "molfile": "\n Marvin 01132101242D \n\n 33 32 0 0 0 0 999 V2000\n 0.0000 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -7.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4354 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8708 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5803 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3062 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0157 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7417 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4511 -6.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1606 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1606 -5.3952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8865 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5960 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3220 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0479 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7574 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4833 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1928 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9023 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -6.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9023 -5.3952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -4.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -4.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3377 -3.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3377 -2.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 -2.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 -1.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7731 -1.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7731 -0.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4991 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 2 3 1 0 0 0 0\n 4 2 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 12 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 31 32 1 0 0 0 0\n 31 33 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCCCOC(=O)CCCCCCCC(=O)OCCCCCCCC(C)C", "formula": "C29H56O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "eba8ff4e-b62b-4a76-a983-e5f9b6f4a557" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "468.7536", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "REPRESENTATIVE", "uuid": "676e2bcc-9285-4446-b2b4-739c8efb0829", "version": "4", "structure": { "id": "9f863c23-8ec3-4a58-98e8-c80a1168bb84", "molfile": "\n Marvin 01132108172D \n\n 33 32 0 0 0 0 999 V2000\n 7.1606 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.8865 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.5960 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3220 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.0479 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 10.7574 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 11.4833 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.1928 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9023 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.1606 -5.3952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 6.4511 -6.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -6.6326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 12.9023 -5.3952 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.7417 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.0157 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.3062 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5803 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8708 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1449 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4354 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -6.6326 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -6.2202 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -4.9662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 13.6282 -4.1412 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3377 -3.7288 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14.3377 -2.9039 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 -2.4914 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 -1.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7731 -1.2539 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.7731 -0.4290 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 16.4991 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7095 -7.4576 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 15.0637 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 1 11 1 0 0 0 0\n 1 10 2 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 1 0 0 0 0\n 9 13 1 0 0 0 0\n 9 12 2 0 0 0 0\n 11 14 1 0 0 0 0\n 13 23 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 32 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 25 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 1 0 0 0 0\n 30 33 1 0 0 0 0\nM END", "smiles": "CC(C)CCCCCCCOC(=O)CCCCCCCC(=O)OCCCCCCCC(C)C", "formula": "C29H56O4", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "468.7536", "optical_activity": "NONE", "references": [ "c6c20fbc-8046-4ef5-b57b-0df02a3df1e3", "ee8c17c3-8df0-4e2d-9077-7365c8447f4a" ], "stereo_centers": 0 }, "unii": "362AT1XP12" } ] }