{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "12fad027-b411-4661-9018-06d2027ca401",
          "code": "119291-09-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=119291-09-7",
          "code_system": "CAS",
          "references": [
            "500a1013-13fb-4cf9-94c8-d59d542daf57",
            "0e9573b5-ea88-4026-a884-a5829c14f22d"
          ]
        },
        {
          "uuid": "c44b6866-5470-41d5-a947-292ad784a4f7",
          "code": "701908-91-0",
          "type": "NON-SPECIFIC STOICHIOMETRY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=701908-91-0",
          "code_system": "CAS",
          "references": [
            "500a1013-13fb-4cf9-94c8-d59d542daf57",
            "e3e0cd51-ae9e-404b-9151-6c78d52e9b38"
          ]
        },
        {
          "uuid": "99a0a687-fd61-4436-8a40-b2752f5bfa72",
          "code": "71587442",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/71587442",
          "code_system": "PUBCHEM",
          "references": [
            "500a1013-13fb-4cf9-94c8-d59d542daf57"
          ]
        },
        {
          "uuid": "85c74d02-617e-072a-272c-373a00f877b2",
          "code": "DTXSID90152385",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90152385",
          "code_system": "EPA CompTox",
          "references": [
            "cf717dd5-55db-7588-4e37-341877c92e27"
          ]
        },
        {
          "uuid": "80e134b3-3a57-43b8-88c9-70b90b07315c",
          "code": "360MTI8GF9",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "48323790-d433-4dce-8971-36c71197f22f",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, MONOSODIUM SALT",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, MONOSODIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b28f4820-0132-4f05-b897-83d4bcc0d57e",
            "80a3b2ff-2629-443f-8080-0b4e6494df8d"
          ],
          "display_name": false
        },
        {
          "uuid": "e9ab242a-0e69-45fb-9946-5334958eb512",
          "name": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, SODIUM SALT (1:1)",
          "stdName": "L-GLUTAMIC ACID, N-(1-OXOOCTYL)-, SODIUM SALT (1:1)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b28f4820-0132-4f05-b897-83d4bcc0d57e",
            "80a3b2ff-2629-443f-8080-0b4e6494df8d"
          ],
          "display_name": false
        },
        {
          "uuid": "76dbcc19-009a-43a7-97ea-7b9713791b2a",
          "name": "SODIUM CAPRYLOYL GLUTAMATE",
          "stdName": "SODIUM CAPRYLOYL GLUTAMATE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2484a93-e09a-4457-8abc-ed328a39bdd3",
            "9dcd80c9-03ee-43c9-964e-dbdd2f91cca6",
            "cd0aadd9-e177-4195-987b-5c0f1075bb6d",
            "80a3b2ff-2629-443f-8080-0b4e6494df8d"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "42083680-687a-4bed-b3b3-9952b2235789",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "cd0aadd9-e177-4195-987b-5c0f1075bb6d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "80a3b2ff-2629-443f-8080-0b4e6494df8d",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9dcd80c9-03ee-43c9-964e-dbdd2f91cca6",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b28f4820-0132-4f05-b897-83d4bcc0d57e",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "500a1013-13fb-4cf9-94c8-d59d542daf57",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391113000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c0c81355-2d39-4e08-bb18-cc276c7d228a",
          "citation": "SRS import [360MTI8GF9]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=360MTI8GF9",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391113000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e2484a93-e09a-4457-8abc-ed328a39bdd3",
          "citation": "SODIUM CAPRYLOYL GLUTAMATE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cf717dd5-55db-7588-4e37-341877c92e27",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=119291-09-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e3e0cd51-ae9e-404b-9151-6c78d52e9b38",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "0e9573b5-ea88-4026-a884-a5829c14f22d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b01330fe-2f37-409e-a6c4-a12737c0e544",
          "id": "b01330fe-2f37-409e-a6c4-a12737c0e544",
          "molfile": "\n  Marvin  04202110322D          \n\n  1  0  0  0  1  0            999 V2000\n   12.5132   -6.5729    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "formula": "H",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "08c4bd47-1a78-40a7-9261-c34881013089"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "1.0079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "117709cc-9f2f-4f8e-ace9-b41d8c3c0a9f",
          "id": "117709cc-9f2f-4f8e-ace9-b41d8c3c0a9f",
          "molfile": "\n  Marvin  04202110322D          \n\n 19 18  0  0  1  0            999 V2000\n   11.2753   -5.7789    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.6994   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6994   -4.7398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1151   -5.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5308   -5.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9506   -5.7372    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9506   -6.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3966   -7.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6472   -7.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0932   -8.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3439   -9.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7898   -9.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0406  -10.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866  -11.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7414  -12.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5981   -6.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3788   -5.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3788   -4.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8197   -5.7372    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  6  0  0  0\n  6 17  1  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 16  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 18 17  2  0  0  0  0\n 19 17  1  0  0  0  0\nM  CHG  2   1  -1  19  -1\nM  END",
          "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-]",
          "formula": "C13H21NO5",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "1e28afa3-cd28-4db8-a0c7-32439cb3cb24"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "271.3101",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        },
        {
          "uuid": "37d6d13e-8f6e-4de5-8ea3-29a2650e7d97",
          "id": "37d6d13e-8f6e-4de5-8ea3-29a2650e7d97",
          "molfile": "\n  Marvin  04202110322D          \n\n  1  0  0  0  1  0            999 V2000\n   11.9932   -5.7789    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "be3a2af7-2b01-4a3e-b42a-344691b8c1e9"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "bbc4d560-3787-4ddd-91a9-c7b085c700ea",
      "version": "4",
      "structure": {
        "id": "6961ddd7-544f-4b88-9a9f-fc36f345f3a6",
        "molfile": "\n  Marvin  01132105292D          \n\n 21 18  0  0  1  0            999 V2000\n   12.5132   -6.5729    0.0000 H   0  3  0  0  0  0  0  0  0  0  0  0\n   11.2753   -5.7789    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   10.6994   -5.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6994   -4.7398    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1151   -5.7372    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5308   -5.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.9506   -5.7372    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    8.9506   -6.4134    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3966   -7.0217    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6472   -7.8077    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0932   -8.4202    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3439   -9.2063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7898   -9.8188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.0406  -10.6048    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4866  -11.2172    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7414  -12.0033    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5981   -6.8093    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3788   -5.3992    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3788   -4.7147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8197   -5.7372    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   11.9932   -5.7789    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  4  3  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  6  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n  9 17  2  0  0  0  0\n  7 18  1  0  0  0  0\n 19 18  2  0  0  0  0\n 20 18  1  0  0  0  0\nM  CHG  4   1   1   2  -1  20  -1  21   1\nM  END",
        "smiles": "CCCCCCCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-].[Na+].[H+]",
        "formula": "C13H21NO5.Na.H",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "295.3078",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "cd0aadd9-e177-4195-987b-5c0f1075bb6d",
          "c0c81355-2d39-4e08-bb18-cc276c7d228a"
        ],
        "stereo_centers": 1
      },
      "unii": "360MTI8GF9"
    }
  ]
}