{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b489dbca-2f11-451d-a162-200d08219028",
          "code": "2347-72-0",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2347-72-0",
          "code_system": "CAS",
          "references": [
            "c861a19a-761f-487b-a760-ae4fa281e9b1",
            "71254585-1809-476a-ac1e-ad169faefaad"
          ]
        },
        {
          "uuid": "10d3a6d8-a73c-4453-a7a9-043f48ce4277",
          "code": "219-073-7",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.017.340",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "c861a19a-761f-487b-a760-ae4fa281e9b1"
          ]
        },
        {
          "uuid": "9af5dfec-324b-41ec-a271-1bd19d0364f6",
          "code": "35HF83708U",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "5a85ad5b-e4e6-999d-16ab-d6ee091b39a6",
          "code": "Orange GGN",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Orange_GGN",
          "code_system": "WIKIPEDIA",
          "references": [
            "60b2656d-09e7-1eef-5c67-0eb1742cee86"
          ]
        },
        {
          "uuid": "5e76781d-b81f-a790-46e0-1898c4fcb6d7",
          "code": "DTXSID90893685",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID90893685",
          "code_system": "EPA CompTox"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "15015335-1c06-4b8f-9b4f-e6bf7eed6c3f",
          "name": "2-NAPHTHALENESULFONIC ACID, 6-HYDROXY-5-(2-(3-SULFOPHENYL)DIAZENYL)-, SODIUM SALT (1:2)",
          "stdName": "2-NAPHTHALENESULFONIC ACID, 6-HYDROXY-5-(2-(3-SULFOPHENYL)DIAZENYL)-, SODIUM SALT (1:2)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e5b578b-1da2-4fcf-ba52-d35c0b4c158f",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false
        },
        {
          "uuid": "11e350c9-991c-4fca-a934-a06bb68e8a96",
          "name": "C.I. 15980",
          "stdName": "C.I. 15980",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e5b578b-1da2-4fcf-ba52-d35c0b4c158f",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false
        },
        {
          "uuid": "0ce4558b-22f8-4daf-becb-b40323a6880b",
          "name": "C.I. FOOD ORANGE 2",
          "stdName": "C.I. FOOD ORANGE 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e5b578b-1da2-4fcf-ba52-d35c0b4c158f",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false
        },
        {
          "uuid": "f9cfcd34-57f3-4fc9-ae0a-df4d566fd611",
          "name": "CI 15980",
          "stdName": "CI 15980",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "1534af33-99ac-4680-9748-2cb50d0f8127",
            "c69c9d1b-edd0-4380-b737-a95e5e435f41",
            "9c864f6d-f173-4b61-9fb3-93dfdf5fc510",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "d2ec98ce-1d53-4c9c-ab5f-ba7a7f4b2963",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "47301f80-84cd-49a2-95ec-b2d18f45b6e4",
          "name": "DISODIUM 6-HYDROXY-5-((3-SULFOPHENYL)AZO)-2- NAPHTHALENESULFONATE",
          "stdName": "DISODIUM 6-HYDROXY-5-((3-SULFOPHENYL)AZO)-2- NAPHTHALENESULFONATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "de7f1506-2382-48bf-9e80-e58a0b29acef",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false
        },
        {
          "uuid": "7b992443-6379-4a7c-81cc-b9ba447d90e3",
          "name": "FOOD ORANGE 2",
          "stdName": "FOOD ORANGE 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c69c9d1b-edd0-4380-b737-a95e5e435f41",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": true
        },
        {
          "uuid": "f9a547bb-5d80-4f81-b054-135748655149",
          "name": "FOOD ORANGE 2 (E 111)",
          "stdName": "FOOD ORANGE 2 (E 111)",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54b40e94-c5c3-4c3c-bfda-6c10ae59ac0b",
            "e57891f3-e5bd-4b12-97e8-9c474e0209cb"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9c864f6d-f173-4b61-9fb3-93dfdf5fc510",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e57891f3-e5bd-4b12-97e8-9c474e0209cb",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c69c9d1b-edd0-4380-b737-a95e5e435f41",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e5b578b-1da2-4fcf-ba52-d35c0b4c158f",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "de7f1506-2382-48bf-9e80-e58a0b29acef",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54b40e94-c5c3-4c3c-bfda-6c10ae59ac0b",
          "citation": "SWISS MEDIC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c861a19a-761f-487b-a760-ae4fa281e9b1",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392564000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "67ad5a00-7853-4fdf-b028-d3a9d43905f0",
          "citation": "SRS import [35HF83708U]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=35HF83708U",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493392564000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1534af33-99ac-4680-9748-2cb50d0f8127",
          "citation": "CI 15980 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "60b2656d-09e7-1eef-5c67-0eb1742cee86",
          "citation": "WIKI",
          "doc_type": "WIKI",
          "public_domain": true
        },
        {
          "uuid": "71254585-1809-476a-ac1e-ad169faefaad",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "fd0c5a2f-5100-40d7-9ffe-6a8cf0a95e09",
          "id": "fd0c5a2f-5100-40d7-9ffe-6a8cf0a95e09",
          "molfile": "\n  Marvin  01132113062D          \n\n  1  0  0  0  0  0            999 V2000\n    2.4566    0.9345    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   1\nM  END",
          "smiles": "[Na+]",
          "formula": "Na",
          "atropisomerism": "No",
          "charge": 1,
          "count": 2,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 2,
            "units": "MOL RATIO",
            "uuid": "36b239b1-4586-4eca-b735-a40846cf3b8f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "22.9898",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "6b25d3b7-40d4-43c8-8b44-f60b1853685c",
          "id": "6b25d3b7-40d4-43c8-8b44-f60b1853685c",
          "molfile": "\n  Marvin  01132105342D          \n\n 27 29  0  0  0  0            999 V2000\n   -0.3243    3.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5179    2.8579    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2841    2.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3198    3.0515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7115    2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1137    1.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3073    0.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0987    0.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2922   -0.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0836   -0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2772   -1.3853    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.6813   -0.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4877    0.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6964    1.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.5028    1.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.6945   -0.9186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8881   -1.7206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2904   -2.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4840   -3.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1137   -3.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9051   -3.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0987   -2.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5009   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8900   -2.3912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6813   -2.1579    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    2.1233   -3.1825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6566   -1.5999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  4  2  0  0  0  0\n  5  2  1  0  0  0  0\n  5  6  1  0  0  0  0\n 15  5  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 14  2  0  0  0  0\n  9 10  2  0  0  0  0\n  9 16  1  0  0  0  0\n 10 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 18 23  2  0  0  0  0\n 20 19  2  0  0  0  0\n 21 20  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 22 24  1  0  0  0  0\n 24 25  1  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  2  0  0  0  0\nM  CHG  2  11  -1  25  -1\nM  END",
          "smiles": "c1cc(cc(c1)S(=O)(=O)[O-])/N=N/c2c3ccc(cc3ccc2[O-])S(=O)(=O)O",
          "formula": "C16H10N2O7S2",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "63399618-e416-4aa9-ae90-a13ce85c8340"
          },
          "defined_stereo": 0,
          "ez_centers": 1,
          "molecular_weight": "406.3926",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "f69a6ded-5405-412e-bfad-f8971dc2e6d0",
      "version": "5",
      "structure": {
        "id": "6197240b-e093-4580-b17f-ad88e72eeb27",
        "molfile": "\n  Marvin  01132105032D          \n\n 29 29  0  0  0  0            999 V2000\n    2.4566    0.9345    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n   -1.5028    1.8226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7115    2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.1137    1.4873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3073    0.6853    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.0987    0.4520    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.2922   -0.3500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.0836   -0.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.6813   -0.0147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.4877    0.7873    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6964    1.0206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.5179    2.8579    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2841    2.6643    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3198    3.0515    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.3243    3.6598    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -0.6945   -0.9186    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.8881   -1.7206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2904   -2.2892    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.5009   -2.0559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.0987   -2.6245    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9051   -3.4265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.1137   -3.6598    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4840   -3.0912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8900   -2.3912    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n    2.1233   -3.1825    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6566   -1.5999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6813   -2.1579    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n   -2.2772   -1.3853    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.4566    0.9345    0.0000 Na  0  3  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n  2 11  2  0  0  0  0\n  6 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  2  0  0  0  0\n 12 15  1  0  0  0  0\n  3 12  1  0  0  0  0\n 16 17  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 18 23  2  0  0  0  0\n 24 25  2  0  0  0  0\n 24 26  2  0  0  0  0\n 24 27  1  0  0  0  0\n 20 24  1  0  0  0  0\n 17 18  1  0  0  0  0\n  7 16  1  0  0  0  0\n  8 28  1  0  0  0  0\nM  CHG  4   1   1  15  -1  27  -1  29   1\nM  STY  1   1 MUL\nM  SCN  1   1 HT \nM  SAL   1  2   1  29\nM  SPA   1  1   1\nM  SDI   1  4    2.0366    0.5145    2.0366    1.3545\nM  SDI   1  4    2.8766    1.3545    2.8766    0.5145\nM  SMT   1 2\nM  END",
        "smiles": "c1cc(cc(c1)S(=O)(=O)[O-])/N=N/c2c3ccc(cc3ccc2O)S(=O)(=O)[O-].[Na+].[Na+]",
        "formula": "C16H10N2O7S2.2Na",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 1,
        "molecular_weight": "452.3721",
        "optical_activity": "NONE",
        "references": [
          "67ad5a00-7853-4fdf-b028-d3a9d43905f0",
          "6e5b578b-1da2-4fcf-ba52-d35c0b4c158f"
        ],
        "stereo_centers": 0
      },
      "unii": "35HF83708U"
    }
  ]
}