{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "07752265-38ee-4021-b274-0a437b96122f",
          "code": "81-48-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=81-48-1",
          "code_system": "CAS",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d",
            "47d480d5-4663-4d2b-bca2-3a367fd55d3d"
          ]
        },
        {
          "uuid": "7a5555f7-cba1-49b7-acd7-6b1fd38e656d",
          "code": "C71669",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C71669",
          "code_system": "NCI_THESAURUS",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "1a3db20f-a360-41ef-852a-de6106efbca3",
          "code": "FCN NO. 90",
          "comments": "FCN|COATING|BEER",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/fcn/fcnDetailNavigation.cfm?rpt=fcslisting&id=90",
          "code_system": "Food Contact Sustance Notif, (FCN No.)",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "0ea2f597-185b-404d-af79-cb027423f8c7",
          "code": "SOLVENT VIOLET 13",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Solvent_Violet_13",
          "code_system": "WIKIPEDIA",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "75edd300-4622-4368-81d6-2ad313f20fa9",
          "code": "1426924",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1426924/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "0c70fa7c-84a6-4e2a-9064-46ab4accd44b",
          "code": "201-353-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.001.231",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "a8e95b98-3270-4679-aeeb-b91653ceb9fe",
          "code": "6680",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/6680",
          "code_system": "PUBCHEM",
          "references": [
            "2975160a-60e5-4431-80a7-d02545b4ca0d"
          ]
        },
        {
          "uuid": "321f9cb9-7edc-d41f-9444-aef835870aa1",
          "code": "1958",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/1958",
          "code_system": "HSDB",
          "references": [
            "9bfabf9c-b10c-97bc-37b5-581a8162ad90"
          ]
        },
        {
          "uuid": "b4e72148-8fb7-8d2e-ef47-14764473ca6a",
          "code": "DTXSID1026293",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID1026293",
          "code_system": "EPA CompTox",
          "references": [
            "ea8623cd-41f4-97f0-db8e-a307d80346e2"
          ]
        },
        {
          "uuid": "016d659b-9b4b-c9ad-e1bd-d520ff7d4979",
          "code": "C461",
          "comments": "Industrial Aid[C45678]|Dye",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C461",
          "code_system": "NCI_THESAURUS",
          "references": [
            "e7b0e263-1d38-8de2-1353-85a25594f4ca"
          ]
        },
        {
          "uuid": "ca2024fb-965e-4a74-b305-11b65d0b1333",
          "code": "350KA7O6HK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "777257ea-c364-46ce-6a29-01c0716150e1",
          "code": "2856",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=2856",
          "code_system": "NSC",
          "references": [
            "d5767f68-9bf6-e68e-a28f-d8c5c4b5025a"
          ]
        },
        {
          "uuid": "ab034441-4592-47fd-2006-cffdd0304bb2",
          "code": "350KA7O6HK",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=350KA7O6HK",
          "code_system": "DAILYMED",
          "references": [
            "9b42b451-d77b-ed94-176f-5c91cd68dfa5"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "c0623a59-762a-4a0f-aecd-be25c0824ddb",
          "name": "1-HYDROXY-4-((4-METHYLPHENYL)AMINO)-9,10-ANTHRACENEDIONE",
          "stdName": "1-HYDROXY-4-((4-METHYLPHENYL)AMINO)-9,10-ANTHRACENEDIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54902f6e-9393-40c6-9a2a-8c5e0675bcad",
            "8c66050f-e9f4-433d-a643-4690ad6f68cd"
          ],
          "display_name": false
        },
        {
          "uuid": "fab7574f-0b71-4cca-af29-a334bc08594e",
          "name": "9,10-ANTHRACENEDIONE, 1-HYDROXY-4-((4-METHYLPHENYL)AMINO)-",
          "stdName": "9,10-ANTHRACENEDIONE, 1-HYDROXY-4-((4-METHYLPHENYL)AMINO)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "18b353bb-1125-42d6-b7fe-1be61228a005",
            "1a2a00da-c315-42a2-9aad-cd97944aaf43"
          ],
          "display_name": false
        },
        {
          "uuid": "bef5b032-5d89-4196-abd3-9498cc1362f5",
          "name": "ALIZUROL PURPLE [HSDB]",
          "stdName": "ALIZUROL PURPLE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f462f22d-2fca-454a-8555-48f9995289bf",
            "04776565-56f9-41d1-b448-e3e6d3f6360a"
          ],
          "display_name": false
        },
        {
          "uuid": "b4b934c5-d781-4e17-9317-c7047c2a56d3",
          "name": "CI 60725",
          "stdName": "CI 60725",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "c30720a4-9441-4d81-b416-393f6cae9db1",
            "09f71c4c-3f41-4927-9048-d5e4b2dbb341",
            "94a18c4d-6e95-43bb-b1e4-4ab2188f1ffb",
            "04776565-56f9-41d1-b448-e3e6d3f6360a"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "218fb612-f59e-4139-93dd-7543c002d67f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "57502aa6-bc9c-4c8c-92f6-95700938bcd0",
          "name": "D & C VIOLET NO.2",
          "stdName": "D & C VIOLET NO.2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "c7c94c93-9887-4f35-8fa8-704baf21818f"
          ],
          "display_name": false
        },
        {
          "uuid": "4ba33c45-1abc-43c5-bf28-4cc02bfc46eb",
          "name": "D&C VIOLET 2",
          "stdName": "D&C VIOLET 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "53052dca-8e9a-4b1d-83e8-dd392c3afcf2"
          ],
          "display_name": false
        },
        {
          "uuid": "64bca463-60a1-4c5d-8e9d-bf44f6924ed9",
          "name": "D&C VIOLET NO. 2",
          "stdName": "D&C VIOLET NO. 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54902f6e-9393-40c6-9a2a-8c5e0675bcad"
          ],
          "display_name": true
        },
        {
          "uuid": "1d404f93-2fdc-4fd0-8d97-753c20406647",
          "name": "DC VIOLET NO. 2",
          "stdName": "DC VIOLET NO. 2",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "c7c94c93-9887-4f35-8fa8-704baf21818f"
          ],
          "display_name": false
        },
        {
          "uuid": "28d26781-6b36-4de3-a812-a3e0eebaeae3",
          "name": "DISPERSE BLUE 72",
          "stdName": "DISPERSE BLUE 72",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "9e489ecb-53f1-49ce-9c7f-919ae9406a5b"
          ],
          "display_name": false
        },
        {
          "uuid": "b0c4a9db-b662-4b9a-b454-935695a976a1",
          "name": "MURASAKI201",
          "stdName": "MURASAKI201",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "09f71c4c-3f41-4927-9048-d5e4b2dbb341",
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "b5683f2e-d3bf-477a-bd77-0e6d3db092a0",
            "29e13de5-a4f7-4860-af34-7962f1201011"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "3e241373-615c-46b0-b839-28cd16b3a5d1",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "6bad8966-f00a-4009-91cc-c4220b45e8a0",
          "name": "NSC-2856",
          "stdName": "NSC-2856",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "14bd29e6-f7e9-4aba-bb9e-4f7f90bef045"
          ],
          "display_name": false
        },
        {
          "uuid": "9ab63bcf-9dcf-48ad-9e61-d54bc71db7dc",
          "name": "SANDOPLAST VIOLET RSB",
          "stdName": "SANDOPLAST VIOLET RSB",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f10b6426-907b-4c61-97cf-cd757f2da110",
            "04776565-56f9-41d1-b448-e3e6d3f6360a"
          ],
          "display_name": false
        },
        {
          "uuid": "19fb05cc-2992-4d49-ae3e-94564de0f1f0",
          "name": "SOLVENT VIOLET 13",
          "stdName": "SOLVENT VIOLET 13",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "78e3d3ac-6c7e-4d0a-af26-7a0022eedcd7",
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "b5683f2e-d3bf-477a-bd77-0e6d3db092a0"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "e188d788-f381-44fc-a424-df4882d14e7c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "49801bc2-cc71-406c-bc77-6fc203cee3d2",
          "name": "VIOLET 2",
          "stdName": "VIOLET 2",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "99e78ff4-b818-4021-be3d-a0ce9daea8a2",
            "09f71c4c-3f41-4927-9048-d5e4b2dbb341",
            "04776565-56f9-41d1-b448-e3e6d3f6360a",
            "ea97b054-935d-4543-ba0a-94b5a9b280eb"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "813aa1e5-6771-42c0-a933-c7123bbb2128",
              "name_org": "INCI"
            }
          ]
        }
      ],
      "references": [
        {
          "uuid": "1a2a00da-c315-42a2-9aad-cd97944aaf43",
          "citation": "ACD8.0(21CFR74.1602)",
          "doc_type": "ACD",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "18b353bb-1125-42d6-b7fe-1be61228a005",
          "citation": "CEDI",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c30720a4-9441-4d81-b416-393f6cae9db1",
          "citation": "CTFA 2006",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54902f6e-9393-40c6-9a2a-8c5e0675bcad",
          "citation": "21CFR74.1602",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ea97b054-935d-4543-ba0a-94b5a9b280eb",
          "citation": "CTFA 2009",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "04776565-56f9-41d1-b448-e3e6d3f6360a",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "09f71c4c-3f41-4927-9048-d5e4b2dbb341",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b5683f2e-d3bf-477a-bd77-0e6d3db092a0",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f462f22d-2fca-454a-8555-48f9995289bf",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7c94c93-9887-4f35-8fa8-704baf21818f",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c66050f-e9f4-433d-a643-4690ad6f68cd",
          "citation": "CFR",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "14bd29e6-f7e9-4aba-bb9e-4f7f90bef045",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9e489ecb-53f1-49ce-9c7f-919ae9406a5b",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f10b6426-907b-4c61-97cf-cd757f2da110",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "53052dca-8e9a-4b1d-83e8-dd392c3afcf2",
          "citation": "TOX 21",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2975160a-60e5-4431-80a7-d02545b4ca0d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "87e1d5d3-8241-4309-9a38-ace1342ca708",
          "citation": "SRS import [350KA7O6HK]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=350KA7O6HK",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390703000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a383fc2-d95d-4aad-a018-dc353e057dcd",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "99e78ff4-b818-4021-be3d-a0ce9daea8a2",
          "citation": "VIOLET 2 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "94a18c4d-6e95-43bb-b1e4-4ab2188f1ffb",
          "citation": "CI 60725 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29e13de5-a4f7-4860-af34-7962f1201011",
          "citation": "MURASAKI201 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "78e3d3ac-6c7e-4d0a-af26-7a0022eedcd7",
          "citation": "SOLVENT VIOLET 13 [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "9bfabf9c-b10c-97bc-37b5-581a8162ad90",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+81-48-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ea8623cd-41f4-97f0-db8e-a307d80346e2",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=81-48-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "e7b0e263-1d38-8de2-1353-85a25594f4ca",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9b42b451-d77b-ed94-176f-5c91cd68dfa5",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "d5767f68-9bf6-e68e-a28f-d8c5c4b5025a",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "47d480d5-4663-4d2b-bca2-3a367fd55d3d",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "a16e8dc8-2495-4b6e-817a-cb51720ec8ad",
          "id": "a16e8dc8-2495-4b6e-817a-cb51720ec8ad",
          "molfile": "\n  Marvin  01132108232D          \n\n 25 28  0  0  0  0            999 V2000\n    7.8165   -5.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9934   -5.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5763   -6.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7536   -6.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -5.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5154   -5.6922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5223   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2386   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2424   -3.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5299   -3.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5238   -2.3913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8181   -3.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1037   -3.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0966   -2.3870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -3.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6771   -3.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9640   -3.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9640   -4.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6771   -4.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3867   -4.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0967   -4.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0924   -5.6922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8143   -4.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7525   -4.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5814   -4.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 25  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 24  2  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n 23  7  2  0  0  0  0\n  8  9  2  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 10  2  0  0  0  0\n 12 13  1  0  0  0  0\n 12 23  1  0  0  0  0\n 13 14  2  0  0  0  0\n 15 13  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 17 16  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 21 23  1  0  0  0  0\n 25 24  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(cc1)Nc2ccc(c3c2C(=O)c4ccccc4C3=O)O",
          "formula": "C21H15NO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "2125eae1-8341-4bc7-95d2-c7fe90061f75"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "329.3495",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "663ab8b9-e405-42be-a197-c8f1a6f2bbd2",
      "version": "12",
      "structure": {
        "id": "6004ccf3-0316-4cd8-9609-29fff8d6cd50",
        "molfile": "\n  Marvin  01132104582D          \n\n 25 28  0  0  0  0            999 V2000\n    0.9640   -3.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9640   -4.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6771   -4.8618    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6771   -3.2092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3903   -3.6265    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3867   -4.4528    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0967   -4.8667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1037   -3.2141    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8181   -3.6326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8143   -4.4568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5223   -4.8699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2386   -4.4634    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2424   -3.6392    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5299   -3.2215    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0966   -2.3870    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0924   -5.6922    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5238   -2.3913    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5154   -5.6922    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3417   -5.6922    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7536   -6.4097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5763   -6.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.9934   -5.6979    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.5814   -4.9805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7525   -4.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8165   -5.6964    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  4  1  0  0  0  0\n  9 14  2  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n  2  3  1  0  0  0  0\n  8 15  2  0  0  0  0\n  5  8  1  0  0  0  0\n  7 16  2  0  0  0  0\n  6  7  1  0  0  0  0\n 14 17  1  0  0  0  0\n  7 10  1  0  0  0  0\n 11 18  1  0  0  0  0\n  9  8  1  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n  9 10  1  0  0  0  0\n  3  6  2  0  0  0  0\n  5  4  2  0  0  0  0\n  5  6  1  0  0  0  0\n 19 24  1  0  0  0  0\n 20 21  1  0  0  0  0\n 21 22  2  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  2  0  0  0  0\n  1  2  2  0  0  0  0\n 22 25  1  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(cc1)Nc2ccc(c3c2C(=O)c4ccccc4C3=O)O",
        "formula": "C21H15NO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "329.3495",
        "optical_activity": "NONE",
        "references": [
          "4a383fc2-d95d-4aad-a018-dc353e057dcd",
          "87e1d5d3-8241-4309-9a38-ace1342ca708"
        ],
        "stereo_centers": 0
      },
      "unii": "350KA7O6HK"
    }
  ]
}