{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "7b4f7ae2-0c8e-4c28-bced-ad7ee415e494",
          "code": "3691-35-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3691-35-8",
          "code_system": "CAS",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe",
            "4d84fc37-9c5f-4f47-9653-389d645dcec7"
          ]
        },
        {
          "uuid": "b92065b9-b446-4326-a346-64df6653583b",
          "code": "C004662",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67004662",
          "code_system": "MESH",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "71d03358-2962-41b7-8183-1a48114b4f76",
          "code": "CHLOROPHACINONE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Chlorophacinone",
          "code_system": "WIKIPEDIA",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "e5e36559-96f7-4ad1-bfab-0fdfb123cb16",
          "code": "67707",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1813",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "c32aab9f-e46b-45e5-97b3-076bd9ae3d29",
          "code": "m3425",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m3425?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "d5946702-da0c-476e-9394-e0ab73fe250d",
          "code": "223-003-0",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.020.912",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "14fc18cf-d401-4246-a1c8-5d178698ae8f",
          "code": "19402",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/19402",
          "code_system": "PUBCHEM",
          "references": [
            "790d59f3-88ab-4c49-b2d7-aa8a863669fe"
          ]
        },
        {
          "uuid": "3de2b872-8c4a-8386-062d-3f714d034fd1",
          "code": "6432",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6432",
          "code_system": "HSDB",
          "references": [
            "24a23b50-5bab-9390-9b37-a982b614eb9e"
          ]
        },
        {
          "uuid": "d80bc560-bd16-b338-0312-ab93a0972387",
          "code": "DTXSID2032348",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID2032348",
          "code_system": "EPA CompTox",
          "references": [
            "c3e99d1b-791a-c133-4dcd-8c8f5dd87677"
          ]
        },
        {
          "uuid": "1563fcf1-112e-4ceb-842a-fa2fcfd49103",
          "code": "34Y6E0063Y",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "235d14b6-f288-8c42-41c4-ab0d5e7b1985",
          "code": "chlorophacinone",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/chlorophacinone.html",
          "code_system": "ALANWOOD",
          "references": [
            "68dd635d-2d1a-b03f-9e5f-3a021d11f011"
          ]
        },
        {
          "uuid": "4155b971-b202-ce5d-cb12-e6a9d993b663",
          "code": "300000053213",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "d37a9101-7f87-61f0-455c-793d832bb0d7"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "ed354519-214a-4b5d-ad2f-9d6c3b504a62",
          "name": "2-(2-(4-CHLOROPHENYL)-2-PHENYLACETYL)INDAN-1, 3-DIONE",
          "stdName": "2-(2-(4-CHLOROPHENYL)-2-PHENYLACETYL)INDAN-1, 3-DIONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "6e423122-78e0-49d8-962e-479d7501715c"
          ],
          "display_name": false
        },
        {
          "uuid": "2535cc4b-7904-42a8-9ba8-924e6c4a3100",
          "name": "CHLORFACINON",
          "stdName": "CHLORFACINON",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "6e423122-78e0-49d8-962e-479d7501715c"
          ],
          "display_name": false
        },
        {
          "uuid": "ba45e759-35e8-4436-b069-f185a408aecc",
          "name": "CHLOROPHACINONE",
          "stdName": "CHLOROPHACINONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfd4123c-14c6-4412-b2f6-a90201b87c3f",
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "71bb7614-20a9-435c-a7f4-923bb15203b5",
            "79858ede-9f11-4413-abfc-1c821dbef228",
            "3e7990dd-e085-4d0f-89e1-e8918e8c2736",
            "7409e24f-b9fb-470b-b5ea-086806ab0b42",
            "7923c2bc-1a7c-4a2d-a6de-0aa069864dc0",
            "bb0ceddc-7a05-4c07-bd81-22a6b9c2029e",
            "efe0422c-e215-4a03-ad64-43c3a03b0aa9",
            "d6ab6d95-d298-44e6-8ebd-416895f6e835"
          ],
          "display_name": true
        },
        {
          "uuid": "d535c2ba-7835-448a-b00c-111901a4b469",
          "name": "CHLOROPHACINONE [HSDB]",
          "stdName": "CHLOROPHACINONE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfd4123c-14c6-4412-b2f6-a90201b87c3f",
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f"
          ],
          "display_name": false
        },
        {
          "uuid": "5c0f5695-bd4e-42cb-b39e-73ffa57aaaa3",
          "name": "CHLOROPHACINONE [ISO]",
          "stdName": "CHLOROPHACINONE [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "71bb7614-20a9-435c-a7f4-923bb15203b5"
          ],
          "display_name": false
        },
        {
          "uuid": "5d11bbcc-baa5-4d31-b491-6904bc3e6ad6",
          "name": "CHLOROPHACINONE [MART.]",
          "stdName": "CHLOROPHACINONE [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d6ab6d95-d298-44e6-8ebd-416895f6e835"
          ],
          "display_name": false
        },
        {
          "uuid": "2fc11ca6-b693-4ebb-ac09-916a458e5936",
          "name": "CHLOROPHACINONE [MI]",
          "stdName": "CHLOROPHACINONE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "3e7990dd-e085-4d0f-89e1-e8918e8c2736"
          ],
          "display_name": false
        },
        {
          "uuid": "79eebc62-ddf0-4fc0-8fd6-128034349e48",
          "name": "LIPHADIONE",
          "stdName": "LIPHADIONE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "473af1cc-c472-4fef-8edb-42ca265d06ef"
          ],
          "display_name": false
        },
        {
          "uuid": "4d080a11-7114-4853-8de7-3c3ca404c842",
          "name": "MURIOL",
          "stdName": "MURIOL",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "6e423122-78e0-49d8-962e-479d7501715c"
          ],
          "display_name": false
        },
        {
          "uuid": "944f68e4-ee73-46b6-9cd1-cd027f34bf6b",
          "name": "RAMUCIDE",
          "stdName": "RAMUCIDE",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
            "6e423122-78e0-49d8-962e-479d7501715c"
          ],
          "display_name": false
        },
        {
          "uuid": "6ce37be0-5bc2-4f2f-8fd5-e4ece15bc9bd",
          "name": "ROZOL",
          "stdName": "ROZOL",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "473af1cc-c472-4fef-8edb-42ca265d06ef"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "79858ede-9f11-4413-abfc-1c821dbef228",
          "citation": "MARTINDALE",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "c12b3e86-4cc6-407c-91e9-9105d9ce0b9f",
          "citation": "MARTINDALE",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e423122-78e0-49d8-962e-479d7501715c",
          "citation": "http://www.inchem.org/documents/pds/pds/pest62_e.htm",
          "url": "http://www.inchem.org/documents/pds/pds/pest62_e.htm",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d549b178-f81a-46da-9820-5821bcb5a936",
          "citation": "MICROMED 2010",
          "doc_type": "MARTINDALE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "473af1cc-c472-4fef-8edb-42ca265d06ef",
          "citation": "STN 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d6ab6d95-d298-44e6-8ebd-416895f6e835",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3e7990dd-e085-4d0f-89e1-e8918e8c2736",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dfd4123c-14c6-4412-b2f6-a90201b87c3f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71bb7614-20a9-435c-a7f4-923bb15203b5",
          "citation": "ISO",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "790d59f3-88ab-4c49-b2d7-aa8a863669fe",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390966000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4279ca51-ce4e-4845-84ee-72469725753c",
          "citation": "SRS import [34Y6E0063Y]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=34Y6E0063Y",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390966000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efe0422c-e215-4a03-ad64-43c3a03b0aa9",
          "citation": "CHLOROPHACINONE [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7923c2bc-1a7c-4a2d-a6de-0aa069864dc0",
          "citation": "CHLOROPHACINONE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb0ceddc-7a05-4c07-bd81-22a6b9c2029e",
          "citation": "CHLOROPHACINONE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "7409e24f-b9fb-470b-b5ea-086806ab0b42",
          "citation": "CHLOROPHACINONE [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "24a23b50-5bab-9390-9b37-a982b614eb9e",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+3691-35-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c3e99d1b-791a-c133-4dcd-8c8f5dd87677",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3691-35-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "68dd635d-2d1a-b03f-9e5f-3a021d11f011",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "4d84fc37-9c5f-4f47-9653-389d645dcec7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d37a9101-7f87-61f0-455c-793d832bb0d7",
          "citation": "SMS",
          "doc_type": "EMA LIST",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b894af6e-94a0-4d90-9aec-d374e1ac7cd9",
          "id": "b894af6e-94a0-4d90-9aec-d374e1ac7cd9",
          "molfile": "\n  Marvin  01132109332D          \n\n 27 30  0  0  0  0            999 V2000\n    6.6040   -0.9414    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7790   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3665   -1.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -1.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1290   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3665   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  3  0  0\n    2.7540   -1.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1665   -2.5455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9290   -1.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -2.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6998   -3.3247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6457   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0418   -2.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7752   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7752   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0418   -1.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6457   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -1.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6082   -0.5748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8915   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040    0.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8915    1.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665    1.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6540    0.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  7  2  2  0  0  0  0\n  3  4  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  2  0  0  0  0\n  8  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 22  1  0  0  0  0\n  9 10  2  0  0  0  0\n 11  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 20 11  1  0  0  0  0\n 12 13  2  0  0  0  0\n 12 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 19  2  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20 21  2  0  0  0  0\n 22 23  1  0  0  0  0\n 22 27  2  0  0  0  0\n 24 23  2  0  0  0  0\n 25 24  1  0  0  0  0\n 26 25  2  0  0  0  0\n 27 26  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)C(=O)C3C(=O)c4ccccc4C3=O",
          "formula": "C23H15ClO3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3285dcbd-faf0-40d9-b982-800081dee15b"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "374.8172",
          "optical_activity": "( + / - )",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "9d641f0e-f92f-4b8f-92ec-99689b530a97",
      "version": "6",
      "structure": {
        "id": "c3f9aa49-36ad-4e5a-88da-99ba34792f1b",
        "molfile": "\n  Marvin  01132110082D          \n\n 27 30  0  0  0  0            999 V2000\n    6.6040   -0.9414    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.7790   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3665   -1.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -1.6289    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.1290   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040   -0.9414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8915   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3040    0.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.8915    1.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665    1.2127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6540    0.5253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0665   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7540   -1.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9290   -1.8580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -2.4997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6998   -3.3247    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6457   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6457   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.4248   -1.1705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.6082   -0.5748    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0418   -1.0330    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7752   -1.4455    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7752   -2.2705    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0418   -2.6830    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.1665   -2.5455    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5415   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3665   -0.2080    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  2  0  0  0  0\n  7 12  1  0  0  0  0\n 13  6  1  0  0  0  0\n 14 13  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  2  0  0  0  0\n 15 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 14  1  0  0  0  0\n 21 18  1  0  0  0  0\n 22 21  2  0  0  0  0\n 23 22  1  0  0  0  0\n 24 23  2  0  0  0  0\n 17 24  1  0  0  0  0\n 13 25  2  0  0  0  0\n  5 26  1  0  0  0  0\n 26 27  2  0  0  0  0\n 27  2  1  0  0  0  0\nM  END",
        "smiles": "c1ccc(cc1)C(c2ccc(cc2)Cl)C(=O)C3C(=O)c4ccccc4C3=O",
        "formula": "C23H15ClO3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "RACEMIC",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "374.8172",
        "optical_activity": "( + / - )",
        "references": [
          "4279ca51-ce4e-4845-84ee-72469725753c",
          "79858ede-9f11-4413-abfc-1c821dbef228"
        ],
        "stereo_centers": 1
      },
      "unii": "34Y6E0063Y"
    }
  ]
}