{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "8ccfc38b-1c1f-44e7-8208-bcf2563063ff", "code": "52372-39-1", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=52372-39-1", "code_system": "CAS", "references": [ "aee65096-3914-4e21-b5b1-df1578cc76e3", "951d25e7-c502-4d98-9d87-a53bc9c7dac2" ] }, { "uuid": "834f49d1-a10d-4f28-a4cb-f48bfb52ebec", "code": "257-885-3", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.052.606", "code_system": "ECHA (EC/EINECS)", "references": [ "aee65096-3914-4e21-b5b1-df1578cc76e3" ] }, { "uuid": "736005ec-0948-4beb-bc85-18c22d165510", "code": "104185", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/104185", "code_system": "PUBCHEM", "references": [ "aee65096-3914-4e21-b5b1-df1578cc76e3" ] }, { "uuid": "b8b3a8f3-d217-f199-bd13-3c6cd8235032", "code": "DTXSID3068750", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID3068750", "code_system": "EPA CompTox", "references": [ "a9e180ce-991d-ff50-c164-b24e5472731c" ] }, { "uuid": "5d8a84e0-ed0a-45b8-abdb-a188d0b7962e", "code": "34HKH79XFH", "type": "PRIMARY", "code_system": "FDA UNII", "references": [ "951d25e7-c502-4d98-9d87-a53bc9c7dac2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "e954d99f-c9b3-45cc-8b08-0611e1d18547", "name": "3-(Diethylamino)-7-imino-7H-[1]benzopyrano[3′,2′:3,4]pyrido[1,2-a]benzimidazole-6-carbonitrile", "stdName": "3-(DIETHYLAMINO)-7-IMINO-7H-(1)BENZOPYRANO(3',2':3,4)PYRIDO(1,2-A)BENZIMIDAZOLE-6-CARBONITRILE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "951d25e7-c502-4d98-9d87-a53bc9c7dac2" ], "display_name": false }, { "uuid": "56864c64-77fa-4735-af69-7d45d4d70e49", "name": "3-(Diethylamino)-7-imino-7H-benzo[4,5]imidazo[1,2-a]chromeno[3,2-c]pyridine-6-carbonitrile", "stdName": "3-(DIETHYLAMINO)-7-IMINO-7H-BENZO(4,5)IMIDAZO(1,2-A)CHROMENO(3,2-C)PYRIDINE-6-CARBONITRILE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "951d25e7-c502-4d98-9d87-a53bc9c7dac2" ], "display_name": true }, { "uuid": "79d74c1a-c691-4e82-820b-5baa52e5049f", "name": "7H-[1]Benzopyrano[3′,2′:3,4]pyrido[1,2-a]benzimidazole-6-carbonitrile, 3-(diethylamino)-7-imino-", "stdName": "7H-(1)BENZOPYRANO(3',2':3,4)PYRIDO(1,2-A)BENZIMIDAZOLE-6-CARBONITRILE, 3-(DIETHYLAMINO)-7-IMINO-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "bbb59b22-2579-4523-9ff6-63cfaec92d20", "a6ba8367-a5e7-4572-bfa7-9eb9c9b451e5" ], "display_name": false }, { "uuid": "c0bef344-96e7-4cc7-a537-6cbe8f9ec2f9", "name": "Solvent Red 197", "stdName": "SOLVENT RED 197", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "951d25e7-c502-4d98-9d87-a53bc9c7dac2" ], "display_name": false } ], "references": [ { "uuid": "bbb59b22-2579-4523-9ff6-63cfaec92d20", "citation": "CHEMID", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "a6ba8367-a5e7-4572-bfa7-9eb9c9b451e5", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "aee65096-3914-4e21-b5b1-df1578cc76e3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493393957000, "tags": [ "NOMEN" ] }, { "uuid": "a9e180ce-991d-ff50-c164-b24e5472731c", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=52372-39-1", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "951d25e7-c502-4d98-9d87-a53bc9c7dac2", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "bb55be46-386c-44fb-b662-e31c940c641a", "id": "bb55be46-386c-44fb-b662-e31c940c641a", "molfile": "\n Marvin 01132109412D \n\n 29 33 0 0 0 0 999 V2000\n 9.3463 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6848 -9.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9789 -9.9912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9831 -10.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6495 -11.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2622 -9.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2577 -8.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5438 -8.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8303 -8.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1119 -8.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4022 -8.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6841 -8.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4717 -7.4520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6807 -7.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1829 -6.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4123 -6.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1030 -7.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5402 -8.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3513 -8.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9706 -8.7656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9752 -9.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2628 -10.0110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6890 -9.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6922 -10.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6955 -11.6509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4025 -9.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1126 -9.9991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8307 -9.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5487 -9.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 6 3 1 0 0 0 0\n 4 5 1 0 0 0 0\n 6 7 1 0 0 0 0\n 29 6 2 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 1 0 0 0 0\n 28 9 2 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 26 11 1 0 0 0 0\n 12 13 2 0 0 0 0\n 20 12 1 0 0 0 0\n 13 14 1 0 0 0 0\n 14 15 1 0 0 0 0\n 19 14 2 0 0 0 0\n 15 16 2 0 0 0 0\n 16 17 1 0 0 0 0\n 17 18 2 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\n 21 22 2 0 0 0 0\n 21 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 23 26 2 0 0 0 0\n 24 25 3 0 0 0 0\n 26 27 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 1 0 0 0 0\nM END", "smiles": "CCN(CC)c1ccc2cc3c(c(C#N)c(=N)n4c5ccccc5nc34)oc2c1", "formula": "C23H19N5O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "530aa5ae-d5b1-4506-886f-d6b71cd5a3fd" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "381.4307", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "976a1c29-b4af-477b-9fdb-6d0b4ad4e605", "version": "7", "structure": { "id": "35e8d6bb-4f05-4058-b4c1-7eb5cca4cb09", "molfile": "\n Marvin 01132102522D \n\n 29 33 0 0 0 0 999 V2000\n 5.8303 -8.7605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1119 -8.3480 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4022 -8.7612 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6841 -8.3503 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.4717 -7.4520 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.6807 -7.4602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1829 -6.8004 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4123 -6.8092 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.1030 -7.5537 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.5402 -8.2273 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.3513 -8.2251 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9706 -8.7656 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.9752 -9.5938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.2628 -10.0110 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6890 -9.9998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6922 -10.8253 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6955 -11.6509 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.4025 -9.5867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.1126 -9.9991 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 5.8307 -9.5860 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5487 -9.9969 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2622 -9.5816 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9789 -9.9912 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6848 -9.5777 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 9.3463 -9.9292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.9831 -10.8195 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 8.6495 -11.1917 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 7.2577 -8.7533 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.5438 -8.3473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 1 0 0 0 0\n 7 8 2 0 0 0 0\n 8 9 1 0 0 0 0\n 9 10 2 0 0 0 0\n 10 11 1 0 0 0 0\n 11 6 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 4 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 2 0 0 0 0\n 13 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 3 0 0 0 0\n 15 18 2 0 0 0 0\n 18 3 1 0 0 0 0\n 18 19 1 0 0 0 0\n 19 20 1 0 0 0 0\n 20 1 1 0 0 0 0\n 20 21 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 1 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 1 0 0 0 0\n 23 26 1 0 0 0 0\n 26 27 1 0 0 0 0\n 22 28 2 0 0 0 0\n 28 29 1 0 0 0 0\n 29 1 2 0 0 0 0\nM END", "smiles": "CCN(CC)c1ccc2cc3c(c(C#N)c(=N)n4c5ccccc5nc34)oc2c1", "formula": "C23H19N5O", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "381.4307", "optical_activity": "NONE", "references": [ "bbb59b22-2579-4523-9ff6-63cfaec92d20" ], "stereo_centers": 0 }, "unii": "34HKH79XFH" } ] }