{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2026-09-09",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "08ba562e-87ed-4d37-b1cc-d37a757e50ff",
          "code": "4727-40-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=4727-40-6",
          "code_system": "CAS",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7",
            "bbfb1950-de54-43f7-8f28-9625a346a389"
          ]
        },
        {
          "uuid": "fe1a6d1d-7fe8-4c89-9ba0-228ef8bc8911",
          "code": "D014814",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68014814",
          "code_system": "MESH",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "d8790688-6de4-4b45-9d88-f0c1c43ac1c4",
          "code": "S-METHYLMETHIONINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/S-Methylmethionine",
          "code_system": "WIKIPEDIA",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "18dec6e1-1074-4980-a21c-5313d5871593",
          "code": "m7440",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m7440?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "25149a3e-af2e-4aec-b11b-002271e0ac39",
          "code": "SUB15707MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "6161e8dc-ca1d-42c8-87b7-b959daa18459",
          "code": "CHEMBL45024",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL45024",
          "code_system": "ChEMBL",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "45519a2a-ae5d-4558-868a-00ff629a58ca",
          "code": "A02BX04",
          "comments": "ATC|ALIMENTARY TRACT AND METABOLISM|DRUGS FOR ACID RELATED DISORDERS|DRUGS FOR PEPTIC ULCER AND GASTRO-OESOPHAGEAL REFLUX DISEASE (GORD)|Other drugs for peptic ulcer and gastro-oesophageal reflux disease (GORD)|methiosulfonium chloride",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=A02BX04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "1b0639a7-5d4b-46dd-a55d-db79d4ba28fd",
          "code": "10197842",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/10197842",
          "code_system": "PUBCHEM",
          "references": [
            "512ce68f-7195-4984-8af4-6a95a43c8da7"
          ]
        },
        {
          "uuid": "d4a251ef-2ea0-ee91-9b81-ca268b9d489e",
          "code": "2308 (Number of products:2)",
          "comments": "Dietary Supplement Label Database|chemical|S-Methylmethionine",
          "type": "PRIMARY",
          "url": "https://dsld.od.nih.gov/dsld/rptIngredient.jsp?grpid=2308&item=S-Methylmethionine",
          "code_system": "DSLD",
          "references": [
            "afa9b24a-4285-ca4a-dc8c-af6a6c2dcfa6"
          ]
        },
        {
          "uuid": "0d608afc-1839-4a70-b46e-360aa12320ce",
          "code": "3485Y39925",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "299e40e7-f970-858d-7251-9bc9dc90eb3b",
          "code": "58252",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:58252",
          "code_system": "CHEBI",
          "references": [
            "afa9b24a-4285-ca4a-dc8c-af6a6c2dcfa6"
          ]
        },
        {
          "uuid": "c0a9726c-b8c8-b08f-5c1f-1f659fc3492a",
          "code": "17728",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:17728",
          "code_system": "CHEBI",
          "references": [
            "afa9b24a-4285-ca4a-dc8c-af6a6c2dcfa6"
          ]
        },
        {
          "uuid": "cdc9f184-38ba-792e-aaa3-449c067d24f7",
          "code": "100000076718",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "c406d7dd-1b5c-022d-0121-aad418979409"
          ]
        },
        {
          "uuid": "0a3d8692-644c-3182-b610-98674701f000",
          "code": "DTXSID401314761",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID401314761",
          "code_system": "EPA CompTox",
          "references": [
            "af73e42a-6389-1aea-b178-8dda14b75a8c"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "83c63e27-73ef-4a40-a370-4842dbf4e9e2",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2b6d6058-f04f-4acf-829b-f950d07a9627",
            "refuuid": "8c681932-1594-46bc-9b54-dffb79db36d9",
            "name": "METHYLMETHIONINE CHLORIDE",
            "unii": "G9CUR2204U",
            "linking_id": "G9CUR2204U",
            "ref_pname": "METHYLMETHIONINE CHLORIDE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9024a2dd-d4b9-41bf-8837-8254204561b7",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "734b3a4c-3881-4930-9bde-598e75e29066",
            "refuuid": "2e4609e5-8694-474b-ab0f-cbca71fae922",
            "name": "METHYLMETHIONINE",
            "unii": "3485Y39925",
            "linking_id": "3485Y39925",
            "ref_pname": "METHYLMETHIONINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8aef573d-b16c-45bd-894e-61437565a61f",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "23e209a5-aae4-4399-b27c-62353ae7673f",
            "refuuid": "2e4609e5-8694-474b-ab0f-cbca71fae922",
            "name": "METHYLMETHIONINE",
            "unii": "3485Y39925",
            "linking_id": "3485Y39925",
            "ref_pname": "METHYLMETHIONINE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5f62a757-bd54-44e1-a0d7-f843d250baac",
          "name": "METHIONINE, METHYL SULFONIUM",
          "stdName": "METHIONINE, METHYL SULFONIUM",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "d3db84bc-833b-4fa2-8c58-8dd00944260f",
          "name": "METHYL SULFONIUM METHIONINE",
          "stdName": "METHYL SULFONIUM METHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "b38af2f7-e44c-45e3-920c-25f4f7c8469a",
          "name": "METHYLMETHIONINE",
          "stdName": "METHYLMETHIONINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ec85c1-6808-4a02-bdae-527dfa334caf",
            "6394a999-32d1-4d46-876f-ba427063a5bd",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "a960eb73-e331-4c00-a770-13187dd57ad4",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7b3e604b-e6f6-42a8-8f93-2a82ba4ea804",
          "name": "S-METHYL-L-METHIONINE",
          "stdName": "S-METHYL-L-METHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ec85c1-6808-4a02-bdae-527dfa334caf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "f5830edb-a246-4df3-a1e3-b62dd61be99f",
          "name": "S-METHYLMETHIONINE",
          "stdName": "S-METHYLMETHIONINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
            "29ac3052-a37e-418e-a691-6eaf40993bbb",
            "56a44623-e66c-4a1c-8cea-80f6582301dd",
            "efd804de-e9cd-4df2-895a-a031e76156c2"
          ],
          "display_name": false
        },
        {
          "uuid": "8cc29b00-82fe-4542-9e9e-c2b3b7a91ccf",
          "name": "S-METHYLMETHIONINE ION",
          "stdName": "S-METHYLMETHIONINE ION",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "60f35570-452e-4624-b931-48ade3b26397",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "eeb7e2a6-bbac-4793-a3df-e8a2037cb328",
          "name": "S-METHYLMETHIONINE SULFONIUM SALT",
          "stdName": "S-METHYLMETHIONINE SULFONIUM SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "02180dcf-880e-458d-a83f-ce996e2afb82",
          "name": "S-METHYLMETHIONINE [MI]",
          "stdName": "S-METHYLMETHIONINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "56a44623-e66c-4a1c-8cea-80f6582301dd",
            "efd804de-e9cd-4df2-895a-a031e76156c2"
          ],
          "display_name": false
        },
        {
          "uuid": "21a87e2d-e95a-4e82-b955-2b96cce49d18",
          "name": "SULFONIUM, ((3S)-3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, INNER SALT",
          "stdName": "SULFONIUM, ((3S)-3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, INNER SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ec85c1-6808-4a02-bdae-527dfa334caf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "4225ffff-3e20-405c-929b-7eab241b6071",
          "name": "SULFONIUM, (3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, INNER SALT, (S)-",
          "stdName": "SULFONIUM, (3-AMINO-3-CARBOXYPROPYL)DIMETHYL-, INNER SALT, (S)-",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "d56e8b34-b1b1-4037-99d7-36fe1896bfe3",
          "name": "VITAMIN U",
          "stdName": "VITAMIN U",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a1ec85c1-6808-4a02-bdae-527dfa334caf",
            "4b6ab82c-f348-4b89-9153-001340b80669",
            "e58883b1-c4c7-47ad-b8e0-f62606417c12",
            "56a44623-e66c-4a1c-8cea-80f6582301dd"
          ],
          "display_name": false
        },
        {
          "uuid": "cbc7550f-d647-6201-1965-3823533b0afb",
          "name": "Vitamin u [WHO-DD]",
          "stdName": "VITAMIN U [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f9718b99-7b21-c4ea-b9bd-55a311c0e167"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a1ec85c1-6808-4a02-bdae-527dfa334caf",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "56a44623-e66c-4a1c-8cea-80f6582301dd",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e58883b1-c4c7-47ad-b8e0-f62606417c12",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "60f35570-452e-4624-b931-48ade3b26397",
          "citation": "CFSAN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "efd804de-e9cd-4df2-895a-a031e76156c2",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "512ce68f-7195-4984-8af4-6a95a43c8da7",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3928ffc1-d070-4e4b-8b1c-3ba124371362",
          "citation": "SRS import [3485Y39925]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3485Y39925",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391544000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6394a999-32d1-4d46-876f-ba427063a5bd",
          "citation": "METHYLMETHIONINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "4b6ab82c-f348-4b89-9153-001340b80669",
          "citation": "VITAMIN U [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "29ac3052-a37e-418e-a691-6eaf40993bbb",
          "citation": "S-METHYLMETHIONINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c406d7dd-1b5c-022d-0121-aad418979409",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "afa9b24a-4285-ca4a-dc8c-af6a6c2dcfa6",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "bbfb1950-de54-43f7-8f28-9625a346a389",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "f9718b99-7b21-c4ea-b9bd-55a311c0e167",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "af73e42a-6389-1aea-b178-8dda14b75a8c",
          "citation": "EPA CompTox",
          "doc_type": "EPA",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "8cf15d35-3367-462d-af9d-5275a1c9c65e",
          "id": "8cf15d35-3367-462d-af9d-5275a1c9c65e",
          "molfile": "\n  Marvin  01132107192D          \n\n 10  9  0  0  1  0            999 V2000\n    7.4773   -3.7777    0.0000 C   0  0  1  0  0  0  0  0  0  2  0  0\n    7.4773   -2.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7784   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0477   -3.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4090   -4.1821    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    4.6604   -3.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4090   -4.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1765   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8678   -3.7883    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1765   -5.0776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  3  1  0  0  0  0\n  1  8  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n  8 10  2  0  0  0  0\nM  CHG  2   5   1   9  -1\nM  END",
          "smiles": "C[S+](C)CC[C@@H](C(=O)[O-])N",
          "formula": "C6H13NO2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "45bab607-c663-413e-9c49-6dadc0882088"
          },
          "defined_stereo": 1,
          "ez_centers": 0,
          "molecular_weight": "163.2392",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 1
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "2e4609e5-8694-474b-ab0f-cbca71fae922",
      "version": "12",
      "structure": {
        "id": "08868e4d-ebdb-4b94-beef-45d6044bf75f",
        "molfile": "\n  Marvin  01132100432D          \n\n 10  9  0  0  1  0            999 V2000\n    7.4773   -3.7777    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.7784   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0477   -3.7777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4090   -4.1821    0.0000 S   0  3  0  0  0  0  0  0  0  0  0  0\n    4.6604   -3.7007    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4090   -4.9642    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1765   -4.2155    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8678   -3.7883    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.1765   -5.0776    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4773   -2.8432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  6  1  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7  9  2  0  0  0  0\n  1 10  1  6  0  0  0\nM  CHG  2   4   1   8  -1\nM  END",
        "smiles": "C[S+](C)CC[C@@H](C(=O)[O-])N",
        "formula": "C6H13NO2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 1,
        "ez_centers": 0,
        "molecular_weight": "163.2392",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "84ddeba0-49a3-434a-a6ef-4eec42c164cf",
          "3928ffc1-d070-4e4b-8b1c-3ba124371362"
        ],
        "stereo_centers": 1
      },
      "unii": "3485Y39925"
    }
  ]
}