{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "04dd6d44-ea1a-42a2-b4b1-089a7d30c88e",
          "code": "R02AA18",
          "comments": "ATC|RESPIRATORY SYSTEM|THROAT PREPARATIONS|THROAT PREPARATIONS|Antiseptics|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R02AA18&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "f1dbf14a-b6ac-48fb-9965-816aa6ad1b12",
          "code": "S03AA05",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICAL AND OTOLOGICAL PREPARATIONS|ANTIINFECTIVES|Antiinfectives|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S03AA05&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "c74920cb-2934-4c8c-8b3d-32752f9d2e79",
          "code": "D08AC04",
          "comments": "ATC|DERMATOLOGICALS|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=D08AC04&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "f69b5b97-969d-440c-b56d-a3bf44ef64cd",
          "code": "R01AX07",
          "comments": "ATC|RESPIRATORY SYSTEM|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Other nasal preparations|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=R01AX07&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "de5774ad-2582-4480-b47a-60eff217823d",
          "code": "S01AX08",
          "comments": "ATC|SENSORY ORGANS|OPHTHALMOLOGICALS|ANTIINFECTIVES|Other antiinfectives|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=S01AX08&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "ca4696b2-9c3c-4514-8092-708a0c256ab5",
          "code": "QR02AA18",
          "comments": "VATC|THROAT PREPARATIONS|THROAT PREPARATIONS|Antiseptics|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR02AA18&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "d3d9b610-f8ef-4601-adaf-34325e7a9ed5",
          "code": "QS03AA05",
          "comments": "VATC|OPHTHALMOLOGICAL AND OTOLOGICAL PREPARATIONS|ANTIINFECTIVES|Antiinfectives|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS03AA05&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "a2c9d27d-1f76-42a7-8f7e-382a08d0a6da",
          "code": "QR01AX07",
          "comments": "VATC|NASAL PREPARATIONS|DECONGESTANTS AND OTHER NASAL PREPARATIONS FOR TOPICAL USE|Other nasal preparations|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QR01AX07&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "e1cf4def-146d-42eb-b532-503d71ad8a14",
          "code": "QD08AC54",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|hexamidine, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AC54&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "7b5bf0c6-1ce1-4b1b-8963-2aa291700042",
          "code": "QS01AX08",
          "comments": "VATC|OPHTHALMOLOGICALS|ANTIINFECTIVES|Other antiinfectives|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QS01AX08&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "360f1bbf-401b-454a-b078-883304d40503",
          "code": "QD08AC04",
          "comments": "VATC|ANTISEPTICS AND DISINFECTANTS|ANTISEPTICS AND DISINFECTANTS|Biguanides and amidines|hexamidine",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QD08AC04&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "360a8af6-f699-49f9-8304-206bf7bf64e1",
          "code": "3811-75-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=3811-75-4",
          "code_system": "CAS",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed",
            "967a9c92-a135-44f5-84cc-ae9d469b7d50"
          ]
        },
        {
          "uuid": "eb63d4d0-739b-47b2-a74e-4190f759a6cc",
          "code": "C65849",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C65849",
          "code_system": "NCI_THESAURUS",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "5fb47d4c-c497-4d1f-acb4-0bf99bc85a09",
          "code": "C018961",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67018961",
          "code_system": "MESH",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "72754305-fdf8-403d-9f42-d11358deab3a",
          "code": "HEXAMIDINE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Hexamidine",
          "code_system": "WIKIPEDIA",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "b440bbbc-68b0-4f6c-8b37-39b93d40746d",
          "code": "SUB08029MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "a8755a51-3b97-4734-b3e3-e6f44c96b822",
          "code": "1393",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1393",
          "code_system": "INN",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "de478d5d-c5ff-41a8-95d4-5d0ee39e963e",
          "code": "26849",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/26849/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "963effaf-a504-4889-b2f6-762d6793880f",
          "code": "m6000",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6000?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "b779b9bf-c501-483b-a704-150f0fddf39b",
          "code": "CHEMBL25105",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL25105",
          "code_system": "ChEMBL",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "def05898-243a-442b-8a41-904f11bce08e",
          "code": "65130",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/65130",
          "code_system": "PUBCHEM",
          "references": [
            "930d832c-dfab-4901-a586-9c18b787e6ed"
          ]
        },
        {
          "uuid": "cbac277f-2d91-4f7b-8795-4010f8509d6a",
          "code": "DTXSID60191524",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID60191524",
          "code_system": "EPA CompTox",
          "references": [
            "471e361f-888d-7f80-b8d8-44f3df37fbc8"
          ]
        },
        {
          "uuid": "3c46dd40-8b61-d46f-7780-cdef3034c933",
          "code": "C258",
          "comments": "Pharmacologic Substance[C1909]|Anti-Infective Agent[C254]|Antibiotic",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C258",
          "code_system": "NCI_THESAURUS",
          "references": [
            "98f22adf-188b-5f87-4f34-9c3dea0e9545"
          ]
        },
        {
          "uuid": "0b613420-02fe-4a9e-a401-55a2a97c8971",
          "code": "3483C2H13H",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "a99d9837-4f11-c010-af2c-073d6c8f3aa6",
          "code": "3275",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/3275",
          "code_system": "DRUG CENTRAL",
          "references": [
            "98f22adf-188b-5f87-4f34-9c3dea0e9545"
          ]
        },
        {
          "uuid": "a55d77e8-8888-d264-323f-122d84a88933",
          "code": "DB03808",
          "type": "PRIMARY",
          "url": "https://go.drugbank.com/drugs/DB03808",
          "code_system": "DRUG BANK",
          "references": [
            "98f22adf-188b-5f87-4f34-9c3dea0e9545"
          ]
        },
        {
          "uuid": "2ad5abc8-ba89-06aa-281d-127304e907fd",
          "code": "87184",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:87184",
          "code_system": "CHEBI",
          "references": [
            "98f22adf-188b-5f87-4f34-9c3dea0e9545"
          ]
        },
        {
          "uuid": "da4f7be6-287f-bea4-32d1-15dddb009c0e",
          "code": "100000083975",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "1f97ff92-3246-a8e8-2c72-e79cebb5a39a"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "eff0449d-4930-42f5-a5aa-69e0df960361",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "09a65060-5a9f-461e-8a29-dc4d241359c1",
            "refuuid": "486d1324-349f-4471-a04f-2e8c9f3f8e09",
            "name": "HEXAMIDINE",
            "unii": "3483C2H13H",
            "linking_id": "3483C2H13H",
            "ref_pname": "HEXAMIDINE",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "98c85226-8dce-4e95-b70e-8bf65e7a1eac",
          "type": "SALT/SOLVATE->PARENT",
          "related_substance": {
            "uuid": "2803bd0e-389e-4b35-bb7d-37a67552eb8d",
            "refuuid": "21afa077-7c1b-426d-b46b-e2e16b95b854",
            "name": "HEXAMIDINE DIISETHIONATE",
            "unii": "023XA5Z50L",
            "linking_id": "023XA5Z50L",
            "ref_pname": "HEXAMIDINE DIISETHIONATE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "df3c45df-fed6-4d35-9cb6-a0faff926ded",
          "name": "HEXAMIDINE",
          "stdName": "HEXAMIDINE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "e2ff2120-876c-4413-a52f-70fde8ef0e1b",
            "6142d0f3-efd7-436b-9bc4-6919de048f16",
            "8544e47b-6cfd-4ca5-8fba-b87191d262ec",
            "6dd3d63c-6dbc-4179-96ff-d98ed489b501",
            "60269a69-571f-4628-b189-657ec7020586",
            "216d96a4-63bc-47c7-bf80-7eb9833146ec",
            "82fd0930-318c-4b12-809f-19ce83933b04",
            "2ec26cfc-7f82-42bf-80e6-89bcaa25c593",
            "4182daf5-02e8-4599-a875-11927fb54cc8",
            "83acdcbe-6b02-4e7b-aa72-5f23f06d994e"
          ],
          "display_name": true,
          "domains": [
            "drug",
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "ade50da6-5144-4852-8669-cd35672da7a9",
              "name_org": "INN"
            },
            {
              "uuid": "07e951a9-1ccb-42f0-8235-aec725d7bf1c",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "63b378c0-130c-4b18-970b-be55308f7447",
          "name": "HEXAMIDINE [MI]",
          "stdName": "HEXAMIDINE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6142d0f3-efd7-436b-9bc4-6919de048f16",
            "216d96a4-63bc-47c7-bf80-7eb9833146ec"
          ],
          "display_name": false
        },
        {
          "uuid": "c6c4073e-1e82-3769-2342-6d25cc1b406d",
          "name": "Hexamidine [WHO-DD]",
          "stdName": "HEXAMIDINE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a029a5cd-88e9-ee11-4610-613dd3ba821b"
          ],
          "display_name": false
        },
        {
          "uuid": "fbb88026-bc5c-410e-a58c-8ca9665aba73",
          "name": "hexamidine [INN]",
          "stdName": "HEXAMIDINE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2ec26cfc-7f82-42bf-80e6-89bcaa25c593"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "60269a69-571f-4628-b189-657ec7020586",
          "citation": "USP Dictionary",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "2ec26cfc-7f82-42bf-80e6-89bcaa25c593",
          "citation": "INN Proposed List 13",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL13.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "6142d0f3-efd7-436b-9bc4-6919de048f16",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "216d96a4-63bc-47c7-bf80-7eb9833146ec",
          "citation": "MERCK INDEX",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4182daf5-02e8-4599-a875-11927fb54cc8",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6dd3d63c-6dbc-4179-96ff-d98ed489b501",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "930d832c-dfab-4901-a586-9c18b787e6ed",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "dbcddd06-f969-4879-9218-a6a66825aafa",
          "citation": "SRS import [3483C2H13H]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3483C2H13H",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390739000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "83acdcbe-6b02-4e7b-aa72-5f23f06d994e",
          "citation": "HEXAMIDINE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "8544e47b-6cfd-4ca5-8fba-b87191d262ec",
          "citation": "HEXAMIDINE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e2ff2120-876c-4413-a52f-70fde8ef0e1b",
          "citation": "HEXAMIDINE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "82fd0930-318c-4b12-809f-19ce83933b04",
          "citation": "HEXAMIDINE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "471e361f-888d-7f80-b8d8-44f3df37fbc8",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=3811-75-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "1f97ff92-3246-a8e8-2c72-e79cebb5a39a",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "98f22adf-188b-5f87-4f34-9c3dea0e9545",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "967a9c92-a135-44f5-84cc-ae9d469b7d50",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "b9aa98ec-f1a0-fa8a-6152-e1b99a4c41ea",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "a029a5cd-88e9-ee11-4610-613dd3ba821b",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "b07f6376-efdb-4551-9a7d-ba3156d5788b",
          "id": "b07f6376-efdb-4551-9a7d-ba3156d5788b",
          "molfile": "\n  Marvin  01132109092D          \n\n 26 27  0  0  0  0            999 V2000\n   -3.1106   -1.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3967   -1.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3981   -2.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6811   -1.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9648   -1.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2468   -1.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2497   -0.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4635   -0.1336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -0.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -0.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6054   -0.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3194   -0.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0333   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -0.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4613   -0.5303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1753   -0.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8897   -0.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6032   -0.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6027    0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8827    1.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1722    0.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3130    1.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0270    0.7140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3091    1.9498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9666   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6799   -0.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  2  0  0  0  0\n  4  2  1  0  0  0  0\n  4  5  1  0  0  0  0\n 26  4  2  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  7  8  1  0  0  0  0\n  7 25  2  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 21 16  2  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 19 20  2  0  0  0  0\n 19 22  1  0  0  0  0\n 20 21  1  0  0  0  0\n 22 23  1  0  0  0  0\n 22 24  2  0  0  0  0\n 25 26  1  0  0  0  0\nM  END",
          "smiles": "C(CCCOc1ccc(cc1)C(=N)N)CCOc2ccc(cc2)C(=N)N",
          "formula": "C20H26N4O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "8d383143-02a9-467a-8845-21c0ba9b4733"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "354.4468",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "486d1324-349f-4471-a04f-2e8c9f3f8e09",
      "version": "14",
      "structure": {
        "id": "8ebfc45c-eec9-40c0-a32a-9527d0c32094",
        "molfile": "\n  Marvin  01132107242D          \n\n 26 27  0  0  0  0            999 V2000\n   -1.6799   -0.5511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.6811   -1.3802    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9648   -1.7939    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2468   -1.3798    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2497   -0.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9666   -0.1375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4635   -0.1336    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1774   -0.5428    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8914   -0.1295    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.6054   -0.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3194   -0.1253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0333   -0.5344    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7473   -0.1211    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4613   -0.5303    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1753   -0.1169    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8897   -0.5315    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6032   -0.1188    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.6027    0.7071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8827    1.1185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1722    0.7035    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3967   -1.7912    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1106   -1.3778    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3130    1.1231    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0270    0.7140    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3091    1.9498    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.3981   -2.6179    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n 12 13  1  0  0  0  0\n  1  2  2  0  0  0  0\n 13 14  1  0  0  0  0\n  5  7  1  0  0  0  0\n 14 15  1  0  0  0  0\n  3  4  2  0  0  0  0\n 15 16  2  0  0  0  0\n  7  8  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n  8  9  1  0  0  0  0\n 18 19  1  0  0  0  0\n  4  5  1  0  0  0  0\n 19 20  2  0  0  0  0\n 20 15  1  0  0  0  0\n  9 10  1  0  0  0  0\n  2 21  1  0  0  0  0\n  2  3  1  0  0  0  0\n 21 22  1  0  0  0  0\n 10 11  1  0  0  0  0\n 18 23  1  0  0  0  0\n  5  6  2  0  0  0  0\n 23 24  1  0  0  0  0\n 11 12  1  0  0  0  0\n 23 25  2  0  0  0  0\n  6  1  1  0  0  0  0\n 21 26  2  0  0  0  0\nM  END",
        "smiles": "C(CCCOc1ccc(cc1)C(=N)N)CCOc2ccc(cc2)C(=N)N",
        "formula": "C20H26N4O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "354.4468",
        "optical_activity": "NONE",
        "references": [
          "60269a69-571f-4628-b189-657ec7020586",
          "dbcddd06-f969-4879-9218-a6a66825aafa",
          "2ec26cfc-7f82-42bf-80e6-89bcaa25c593"
        ],
        "stereo_centers": 0
      },
      "unii": "3483C2H13H"
    }
  ]
}