{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "0f771ff9-3f15-4be6-a752-efd8fe5b0182",
          "code": "N06AF01",
          "comments": "ATC|NERVOUS SYSTEM|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Monoamine oxidase inhibitors, non-selective|isocarboxazid",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atc_ddd_index/?code=N06AF01&showdescription=yes",
          "code_system": "WHO-ATC",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "7de7ef82-3972-4300-80ce-8a839bc97042",
          "code": "N0000175744",
          "comments": "Established Pharmacologic Class [EPC]|Monoamine Oxidase Inhibitor [EPC]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000175744",
          "code_system": "NDF-RT",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "2bf06bbf-8a52-4d73-828d-3e70a4c8323d",
          "code": "N0000000184",
          "comments": "Cellular or Molecular Interactions [MoA]|Enzyme Interactions [MoA]|Enzyme Inhibitors [MoA]|Monoamine Oxidase Inhibitors [MoA]",
          "type": "PRIMARY",
          "url": "https://nciterms.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=VA_NDFRT&code=N0000000184",
          "code_system": "NDF-RT",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "cf474d6d-8b03-48e2-973a-c8d5f77dbfda",
          "code": "QN06AF01",
          "comments": "VATC|PSYCHOANALEPTICS|ANTIDEPRESSANTS|Monoamine oxidase inhibitors, non-selective|isocarboxazide",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QN06AF01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "7c53dca9-b115-4caf-aa96-dc73c20130be",
          "code": "59-63-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=59-63-2",
          "code_system": "CAS",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82",
            "3460347c-fb1d-47cc-9eca-c3022874036b"
          ]
        },
        {
          "uuid": "67f51682-59c2-4e26-842c-f9b54dbdb88c",
          "code": "C47573",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C47573",
          "code_system": "NCI_THESAURUS",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "004b5710-e731-457d-932c-3d93f1e3cbc8",
          "code": "D007520",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/68007520",
          "code_system": "MESH",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "b438d4a1-95da-473c-a167-ddf0194e5b81",
          "code": "NBK548518",
          "comments": "LiverTox|CNS|Antidepressant|MAO inhibitor",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/NBK548518/",
          "code_system": "LIVERTOX",
          "references": [
            "92399093-d281-e173-33d4-76978ed32dd3"
          ]
        },
        {
          "uuid": "8acd24f5-bb27-46b7-9799-ff6f247c6657",
          "code": "ISOCARBOXAZID",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Isocarboxazid",
          "code_system": "WIKIPEDIA",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "aab1d96d-6cc5-4906-95e5-7277f7cf1777",
          "code": "SUB08313MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "74ec5a2d-b168-4596-b0c1-82fc58a5b50b",
          "code": "1071",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1071",
          "code_system": "INN",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "e871d736-e1cf-4619-b7e1-bf2152ced887",
          "code": "200-438-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.000.399",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "3e3268cb-ccf3-4c75-bf41-f08a991f21b6",
          "code": "7204",
          "type": "PRIMARY",
          "url": "http://www.guidetopharmacology.org/GRAC/LigandDisplayForward?ligandId=7204",
          "code_system": "IUPHAR",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "10ab23cb-9ab8-4082-9e6a-63c9498afa89",
          "code": "6011",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/6011/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "1bb633ac-4457-44ee-8503-1a9fb40fc456",
          "code": "m6472",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m6472?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "04db9b70-6d0a-485d-966c-11f02e7fb213",
          "code": "DB01247",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB01247",
          "code_system": "DRUG BANK",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "69450326-911b-44f8-9da0-93c76b7d87b4",
          "code": "CHEMBL1201168",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1201168",
          "code_system": "ChEMBL",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "e6ffb4b8-2506-4744-a7eb-4fac616684c5",
          "code": "3759",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3759",
          "code_system": "PUBCHEM",
          "references": [
            "415cce24-e852-44c8-9f3c-1fc1e3355b82"
          ]
        },
        {
          "uuid": "b9b65454-9a68-e073-a061-fde7124388fe",
          "code": "DTXSID4023171",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4023171",
          "code_system": "EPA CompTox",
          "references": [
            "ff745cc9-8631-e7bf-58e3-074a83f6d8c4"
          ]
        },
        {
          "uuid": "d378e2db-94b3-a909-160c-66d7a2d8e052",
          "code": "Isocarboxazid",
          "type": "PRIMARY",
          "url": "https://www.ncbi.nlm.nih.gov/books/n/lactmed/LM830/",
          "code_system": "LACTMED",
          "references": [
            "92399093-d281-e173-33d4-76978ed32dd3"
          ]
        },
        {
          "uuid": "f251ca75-d2fc-e40c-92c0-1e1f89f75010",
          "code": "C265",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Antidepressant Agent",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C265",
          "code_system": "NCI_THESAURUS",
          "references": [
            "92399093-d281-e173-33d4-76978ed32dd3"
          ]
        },
        {
          "uuid": "d85d0326-00e9-d9b9-0363-b6c850af71db",
          "code": "C667",
          "comments": "Pharmacologic Substance[C1909]|Enzyme Inhibitor[C471]|Monoamine Oxidase Inhibitor",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C667",
          "code_system": "NCI_THESAURUS",
          "references": [
            "92399093-d281-e173-33d4-76978ed32dd3"
          ]
        },
        {
          "uuid": "7a203651-e20a-4f29-9da0-28d45669942e",
          "code": "34237V843T",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "b7938d5b-e2f3-80a2-9a69-fbbce74f981c",
          "code": "1490",
          "type": "PRIMARY",
          "url": "https://drugcentral.org/drugcard/1490",
          "code_system": "DRUG CENTRAL",
          "references": [
            "92399093-d281-e173-33d4-76978ed32dd3"
          ]
        },
        {
          "uuid": "c3d9dccf-a728-39f7-9f20-4c8c2d5ca11a",
          "code": "34237V843T",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=34237V843T",
          "code_system": "DAILYMED",
          "references": [
            "2fba5450-fc64-ddb4-0289-a6d08e9b81cb"
          ]
        },
        {
          "uuid": "626690cb-b5f5-ff92-0ff6-e6361ff659d5",
          "code": "100000082827",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "aab6dce6-83f9-5b62-1fe6-bde1efe3c887"
          ]
        },
        {
          "uuid": "26e6da78-52c6-c129-720f-129e53129f99",
          "code": "169893",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=169893",
          "code_system": "NSC",
          "references": [
            "ca71f89d-dca3-c41e-fb23-a36b74a146dc"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "64ebc8d5-24ac-4fe9-9e7c-62a248cb219c",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "233be055-1ba8-49e6-9cde-24bf6ad07035",
            "refuuid": "c3e042fc-215d-42f1-b0ba-964110836daa",
            "name": "ISOCARBOXAZID",
            "unii": "34237V843T",
            "linking_id": "34237V843T",
            "ref_pname": "ISOCARBOXAZID",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d31c97c3-6732-4d65-8597-a5603db1a4a0",
          "name": "3-ISOXAZOLECARBOXYLIC ACID, 5-METHYL-, 2-(PHENYLMETHYL)HYDRAZIDE",
          "stdName": "3-ISOXAZOLECARBOXYLIC ACID, 5-METHYL-, 2-(PHENYLMETHYL)HYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8221cede-4aab-401e-a20e-5dff97be0fbf"
          ],
          "display_name": false
        },
        {
          "uuid": "d701f098-4765-409f-b334-4e4781c70295",
          "name": "5-Methyl-3-isoxazolecarboxylic acid 2-benzylhydrazide",
          "stdName": "5-METHYL-3-ISOXAZOLECARBOXYLIC ACID 2-BENZYLHYDRAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8221cede-4aab-401e-a20e-5dff97be0fbf"
          ],
          "display_name": false
        },
        {
          "uuid": "ed61c923-35ae-43ef-b600-1762a0b68235",
          "name": "ENERZER",
          "stdName": "ENERZER",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6ebca5bc-6d62-47d9-87d2-778094ab49f8"
          ],
          "display_name": false
        },
        {
          "uuid": "a418c554-db39-4876-9dfa-c53cd1dc1a00",
          "name": "ISOCARBOXAZID",
          "stdName": "ISOCARBOXAZID",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c49e501-2823-48a9-9024-804f613e6c6b",
            "49853d42-8cbe-4c4c-93a4-aa1b93c6cfb5",
            "abc10737-1fcc-4001-ac57-fa0c793ccd37",
            "ba2cf529-4a47-4544-8ffc-ca6b58dee397",
            "2f576893-25a6-4f01-b3c3-55862e2f3ef3",
            "f928f733-4445-4f50-b3ae-427a0547f6b8",
            "7cc228e4-e9d9-47c1-8c23-ee522d57c80f",
            "cb09e810-0a41-4680-beb1-b18987d83e04",
            "662422a7-1e2d-444d-95c9-e59cf5145d05",
            "3eb702d8-1fb3-4450-90ad-55e17fbf9ae5",
            "63ce4ccd-3f04-4f4d-a821-2ff11320de4a",
            "487748f0-a118-481e-be53-c3eae8d7eb35",
            "537cddef-6e86-48c7-9f29-7f78c4ae7aa5",
            "d1443432-c382-4d13-9b97-e4bead6cb405",
            "10988a40-7211-40a2-87ee-e3793d94f131"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "052fb92b-1e74-49e5-bf0b-42dac18405b7",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "37d77061-2175-4ec8-99d6-f28d04daf35d",
          "name": "ISOCARBOXAZID [MART.]",
          "stdName": "ISOCARBOXAZID [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "537cddef-6e86-48c7-9f29-7f78c4ae7aa5"
          ],
          "display_name": false
        },
        {
          "uuid": "29ddc83c-d9d3-41e6-872b-f138608b81d1",
          "name": "ISOCARBOXAZID [MI]",
          "stdName": "ISOCARBOXAZID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7cc228e4-e9d9-47c1-8c23-ee522d57c80f"
          ],
          "display_name": false
        },
        {
          "uuid": "02b1d890-52e4-4f6b-97ea-4c1767b68e5b",
          "name": "ISOCARBOXAZID [ORANGE BOOK]",
          "stdName": "ISOCARBOXAZID [ORANGE BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "abc10737-1fcc-4001-ac57-fa0c793ccd37"
          ],
          "display_name": false
        },
        {
          "uuid": "de9b94f4-89cd-4e4b-b745-e5c704284dd4",
          "name": "ISOCARBOXAZID [USP-RS]",
          "stdName": "ISOCARBOXAZID [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2f576893-25a6-4f01-b3c3-55862e2f3ef3"
          ],
          "display_name": false
        },
        {
          "uuid": "bbbd18ba-e5e8-4c45-b7f2-ee1d676deb6c",
          "name": "ISOCARBOXAZIDE",
          "stdName": "ISOCARBOXAZIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a610f760-ea88-4d6d-bca1-52286efdf7ec"
          ],
          "display_name": false
        },
        {
          "uuid": "461aa150-96a3-7dce-c331-ca5b23fd0251",
          "name": "Isocarboxazid [WHO-DD]",
          "stdName": "ISOCARBOXAZID [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0097218c-cd34-0fd7-1880-49e2eafef3ed"
          ],
          "display_name": false
        },
        {
          "uuid": "17b9e49a-34f0-49cb-845b-b25f16e8ab8c",
          "name": "MARPLAN",
          "stdName": "MARPLAN",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "64040916-e93d-4521-b0fe-80f71c8738fa"
          ],
          "display_name": false
        },
        {
          "uuid": "6fb0b618-abaf-4553-ba6f-f211910d05d4",
          "name": "NSC-169893",
          "stdName": "NSC-169893",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "54140331-e34d-4ddf-b1b1-d3091f3d4d19"
          ],
          "display_name": false
        },
        {
          "uuid": "67f66208-8601-4c2c-9acc-2fa12db06f1c",
          "name": "RO 5-0831",
          "stdName": "RO 5-0831",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26db7171-e6cd-4086-9783-b1a7bcc11433"
          ],
          "display_name": false
        },
        {
          "uuid": "8d98c151-37b0-44f3-ad38-3766e663544d",
          "name": "RO-5-0831",
          "stdName": "RO-5-0831",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "26db7171-e6cd-4086-9783-b1a7bcc11433"
          ],
          "display_name": false
        },
        {
          "uuid": "e2dc7d93-77e5-4c78-b378-6c902001dea4",
          "name": "isocarboxazid [INN]",
          "stdName": "ISOCARBOXAZID [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "2c49e501-2823-48a9-9024-804f613e6c6b"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "3eb702d8-1fb3-4450-90ad-55e17fbf9ae5",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "8221cede-4aab-401e-a20e-5dff97be0fbf",
          "citation": "USP DICTIONARY 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "64040916-e93d-4521-b0fe-80f71c8738fa",
          "citation": "ORANGE BOOK",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2c49e501-2823-48a9-9024-804f613e6c6b",
          "citation": "INN Proposed List 11",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL11.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "abc10737-1fcc-4001-ac57-fa0c793ccd37",
          "citation": "ORANGE BOOK 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "537cddef-6e86-48c7-9f29-7f78c4ae7aa5",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7cc228e4-e9d9-47c1-8c23-ee522d57c80f",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2f576893-25a6-4f01-b3c3-55862e2f3ef3",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49853d42-8cbe-4c4c-93a4-aa1b93c6cfb5",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "10988a40-7211-40a2-87ee-e3793d94f131",
          "citation": "NDF-RT",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "26db7171-e6cd-4086-9783-b1a7bcc11433",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6ebca5bc-6d62-47d9-87d2-778094ab49f8",
          "citation": "http://www.flexyx.com/E/Enerzer.html",
          "url": "http://www.flexyx.com/E/Enerzer.html",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a610f760-ea88-4d6d-bca1-52286efdf7ec",
          "citation": "VATC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "54140331-e34d-4ddf-b1b1-d3091f3d4d19",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "415cce24-e852-44c8-9f3c-1fc1e3355b82",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389659000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86d258c1-1c75-457c-9ae3-5d0fa94f9a75",
          "citation": "SRS import [34237V843T]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=34237V843T",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389659000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f928f733-4445-4f50-b3ae-427a0547f6b8",
          "citation": "ISOCARBOXAZID [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "cb09e810-0a41-4680-beb1-b18987d83e04",
          "citation": "ISOCARBOXAZID [ORANGE BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ba2cf529-4a47-4544-8ffc-ca6b58dee397",
          "citation": "ISOCARBOXAZID [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "63ce4ccd-3f04-4f4d-a821-2ff11320de4a",
          "citation": "ISOCARBOXAZID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1443432-c382-4d13-9b97-e4bead6cb405",
          "citation": "ISOCARBOXAZID [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "487748f0-a118-481e-be53-c3eae8d7eb35",
          "citation": "ISOCARBOXAZID [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "662422a7-1e2d-444d-95c9-e59cf5145d05",
          "citation": "ISOCARBOXAZID [VANDF]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "ff745cc9-8631-e7bf-58e3-074a83f6d8c4",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=59-63-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f1233efc-233f-abba-5745-2647d126dad4",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+59-63-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "aab6dce6-83f9-5b62-1fe6-bde1efe3c887",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "92399093-d281-e173-33d4-76978ed32dd3",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "3460347c-fb1d-47cc-9eca-c3022874036b",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "ca71f89d-dca3-c41e-fb23-a36b74a146dc",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "2fba5450-fc64-ddb4-0289-a6d08e9b81cb",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "0097218c-cd34-0fd7-1880-49e2eafef3ed",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "10cc1668-a8d5-4e89-ac20-fab5f5907178",
          "id": "10cc1668-a8d5-4e89-ac20-fab5f5907178",
          "molfile": "\n  Marvin  01132101062D          \n\n 17 18  0  0  0  0            999 V2000\n    0.0000   -2.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4909   -2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3175   -2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.5759   -1.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9171   -0.9765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2351   -1.4570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3017   -1.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3121   -0.2712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0147   -1.5035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7458   -1.1574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4588   -1.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2028   -1.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1873   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9752    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6495   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6521   -1.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9081   -1.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  2  6  1  0  0  0  0\n  3  4  1  0  0  0  0\n  5  4  2  0  0  0  0\n  7  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  8  7  2  0  0  0  0\n  9  7  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 12  1  0  0  0  0\n 17 12  2  0  0  0  0\n 14 13  2  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "Cc1cc(C(=O)NNCc2ccccc2)no1",
          "formula": "C12H13N3O2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b320099a-35ac-41e0-96e5-5e0d987e26c7"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "231.251",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c3e042fc-215d-42f1-b0ba-964110836daa",
      "version": "19",
      "structure": {
        "id": "e0fd38dc-76d3-4d47-b8be-8ee4a0a438d1",
        "molfile": "\n  Marvin  01132111392D          \n\n 17 18  0  0  0  0            999 V2000\n    1.5759   -1.4751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.9171   -0.9765    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3175   -2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3017   -1.0954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.2351   -1.4570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4909   -2.2423    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3121   -0.2712    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    3.0147   -1.5035    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    3.7458   -1.1574    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    5.2028   -1.2090    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4588   -1.5681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.0000   -2.9088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9081   -1.6069    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.1873   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.9752    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6521   -1.2504    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6495   -0.3901    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  1  1  0  0  0  0\n  5  2  1  0  0  0  0\n  6  3  2  0  0  0  0\n  7  4  2  0  0  0  0\n  8  4  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  6  1  0  0  0  0\n 13 10  2  0  0  0  0\n 14 10  1  0  0  0  0\n 15 14  2  0  0  0  0\n 16 13  1  0  0  0  0\n 17 15  1  0  0  0  0\n  6  5  1  0  0  0  0\n 17 16  2  0  0  0  0\nM  END",
        "smiles": "Cc1cc(C(=O)NNCc2ccccc2)no1",
        "formula": "C12H13N3O2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "231.251",
        "optical_activity": "NONE",
        "references": [
          "3eb702d8-1fb3-4450-90ad-55e17fbf9ae5",
          "86d258c1-1c75-457c-9ae3-5d0fa94f9a75",
          "2c49e501-2823-48a9-9024-804f613e6c6b"
        ],
        "stereo_centers": 0
      },
      "unii": "34237V843T"
    }
  ]
}