{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c192498f-34f0-43cc-a414-3a40c5c73a45",
          "code": "22888-70-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=22888-70-6",
          "code_system": "CAS",
          "references": [
            "05df7f53-13bd-465e-be5c-c2aaeada3e5d",
            "570bbe15-3ce2-468d-b0e0-539eba46a1aa"
          ]
        },
        {
          "uuid": "ae4882e6-3928-4259-95bf-80aee8fb4f95",
          "code": "245-302-5",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.168",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "05df7f53-13bd-465e-be5c-c2aaeada3e5d"
          ]
        },
        {
          "uuid": "0ce36852-62f9-45ef-902c-901bb27de207",
          "code": "31553",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/31553",
          "code_system": "PUBCHEM",
          "references": [
            "05df7f53-13bd-465e-be5c-c2aaeada3e5d"
          ]
        },
        {
          "uuid": "6e39568a-7288-a222-9987-70fdea030136",
          "code": "DTXSID8026018",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID8026018",
          "code_system": "EPA CompTox",
          "references": [
            "2ef2a2b8-7cec-da9d-38bc-581aa00557ba"
          ]
        },
        {
          "uuid": "e57fd89c-69ac-4b38-9e83-79eb6d1586ab",
          "code": "m9941",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m9941",
          "code_system": "MERCK INDEX",
          "references": [
            "f0e1d110-9bb8-3575-41f3-d6492c873972"
          ]
        },
        {
          "uuid": "0157a6c8-fb76-4728-ae4e-f60f2fc3e5b7",
          "code": "33X338MNE4",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "ef48c589-212a-17c7-a925-e6df99994c4a",
          "code": "300000005280",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "257e2b2c-9acc-ff83-a2ec-bae6915c38d5"
          ]
        },
        {
          "uuid": "71a1935b-e24d-abb9-7e45-1b8a0d028714",
          "code": "651520",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=651520",
          "code_system": "NSC",
          "references": [
            "e038c6b2-73c5-cbcc-2e01-b18018bdb9bf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "b36566ba-3dda-4497-98f7-30c86f2ade3b",
          "type": "METABOLIC ENZYME->SUBSTRATE",
          "references": [
            "67dab5a2-cc24-a3ae-855e-0b8c06785ada"
          ],
          "related_substance": {
            "uuid": "a692adc2-0d8d-48a1-8a0b-4a04e8afe857",
            "refuuid": "dfc5c3ca-bf96-45b7-acc6-3034e22bc3ee",
            "name": "CYTOCHROME P450 2C8",
            "unii": "L0423Z5LDW",
            "linking_id": "L0423Z5LDW",
            "ref_pname": "CYTOCHROME P450 2C8",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c93c3ffc-2421-4cd6-9fba-5aa859296be6",
          "amount": {
            "uuid": "e1c864cf-9163-4807-b2f4-f111fc1232d8",
            "average": 49.8,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "67dab5a2-cc24-a3ae-855e-0b8c06785ada"
          ],
          "related_substance": {
            "uuid": "becde011-0416-48bc-b55c-00cd9ac00fe6",
            "refuuid": "4275827d-e329-4907-95b5-7d690692872a",
            "name": "CYTOCHROME P450 3A4",
            "unii": "PUO0521HZV",
            "linking_id": "PUO0521HZV",
            "ref_pname": "CYTOCHROME P450 3A4",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "0993ea22-537c-4655-84d7-920cc0c100ad",
          "amount": {
            "uuid": "c71f8258-0b87-4f41-ab33-e3fd621214b6",
            "average": 34.1,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "67dab5a2-cc24-a3ae-855e-0b8c06785ada"
          ],
          "related_substance": {
            "uuid": "8dc7deb9-dd2a-45b7-9060-9bb9c130a80a",
            "refuuid": "50fbc0e6-a35d-4d72-849b-84bfc9d44cd5",
            "name": "CYTOCHROME P450 2C9",
            "unii": "L9DP834D1P",
            "linking_id": "L9DP834D1P",
            "ref_pname": "CYTOCHROME P450 2C9",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "c5534da9-b14c-47ab-884d-67a57622cd82",
          "amount": {
            "uuid": "90b502e6-8177-4b55-8cbe-e2685192b83c",
            "average": 220,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "67dab5a2-cc24-a3ae-855e-0b8c06785ada"
          ],
          "related_substance": {
            "uuid": "1f00130c-5c15-4eb3-bccb-645ee9aa2bdf",
            "refuuid": "2964cc53-40a9-4b2b-b19c-d61342fadb5a",
            "name": "CYTOCHROME P450 1A2",
            "unii": "VK4SQL11C0",
            "linking_id": "VK4SQL11C0",
            "ref_pname": "CYTOCHROME P450 1A2",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9953f810-c450-4e37-b207-522f48d66acd",
          "amount": {
            "uuid": "a95e6de7-99a1-4bfb-97be-90e78e9f4ea5",
            "average": 250,
            "low": 250,
            "units": "MICROMOLAR"
          },
          "qualification": "IC50",
          "type": "METABOLIC ENZYME->INHIBITOR",
          "references": [
            "67dab5a2-cc24-a3ae-855e-0b8c06785ada"
          ],
          "related_substance": {
            "uuid": "cdbe94e0-9d87-4a23-ab1c-f286c6ddb2f1",
            "refuuid": "dfc5c3ca-bf96-45b7-acc6-3034e22bc3ee",
            "name": "CYTOCHROME P450 2C8",
            "unii": "L0423Z5LDW",
            "linking_id": "L0423Z5LDW",
            "ref_pname": "CYTOCHROME P450 2C8",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "731fb8df-4a4d-457f-883c-a52daaf3f716",
          "name": "4H-1-BENZOPYRAN-4-ONE, 2-((2R,3R)-2,3-DIHYDRO-3-(4-HYDROXY-3-METHOXYPHENYL)-2-(HYDROXYMETHYL)-1,4-BENZODIOXIN-6-YL)-2,3-DIHYDRO-3,5,7-TRIHYDROXY-, (2R,3R)-",
          "stdName": "4H-1-BENZOPYRAN-4-ONE, 2-((2R,3R)-2,3-DIHYDRO-3-(4-HYDROXY-3-METHOXYPHENYL)-2-(HYDROXYMETHYL)-1,4-BENZODIOXIN-6-YL)-2,3-DIHYDRO-3,5,7-TRIHYDROXY-, (2R,3R)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93654b29-5280-4993-8781-66b1bb0307cc",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": false
        },
        {
          "uuid": "56fe3733-e755-4128-b7ff-843d84d2a289",
          "name": "NSC-651520",
          "stdName": "NSC-651520",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "16b093ff-f960-4d43-8b0d-e172d9d47192",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": false
        },
        {
          "uuid": "44556fe4-886f-4c33-90e3-8d2646102b32",
          "name": "SILIBININ A",
          "stdName": "SILIBININ A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "987d77e2-bd5c-4f88-8c52-efb92c456171",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": true
        },
        {
          "uuid": "9158ed97-6605-4fa4-92cd-179ad76d53b2",
          "name": "SILYBIN A",
          "stdName": "SILYBIN A",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93654b29-5280-4993-8781-66b1bb0307cc",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": false
        },
        {
          "uuid": "14f85931-1da8-4077-9202-fc66adeaab4e",
          "name": "SILYBIN A (CONSTITUENT OF MILK THISTLE) [DSC]",
          "stdName": "SILYBIN A (CONSTITUENT OF MILK THISTLE) [DSC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f6f77d14-95da-4bc5-907e-9d4355ba9855",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": false
        },
        {
          "uuid": "5e5ba3e4-4018-84b9-d34f-348dbe0a4eba",
          "name": "SILYBIN A [MI]",
          "stdName": "SILYBIN A [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "f0e1d110-9bb8-3575-41f3-d6492c873972"
          ],
          "display_name": false
        },
        {
          "uuid": "957724dc-f168-4826-8c72-4c923c1846fa",
          "name": "SILYMARIN I",
          "stdName": "SILYMARIN I",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "93654b29-5280-4993-8781-66b1bb0307cc",
            "b550dbfa-ee5f-4e52-8582-ae2c4f54af40"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "93654b29-5280-4993-8781-66b1bb0307cc",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b550dbfa-ee5f-4e52-8582-ae2c4f54af40",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "987d77e2-bd5c-4f88-8c52-efb92c456171",
          "citation": "stn",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f6f77d14-95da-4bc5-907e-9d4355ba9855",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "16b093ff-f960-4d43-8b0d-e172d9d47192",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "05df7f53-13bd-465e-be5c-c2aaeada3e5d",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "310d9f8f-b06c-4862-9af3-02c13061166c",
          "citation": "USP-DSC",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "28ac1927-8d3d-4fac-8600-4088995568ca",
          "citation": "SRS import [33X338MNE4]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=33X338MNE4",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390982000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "12bd3f10-68de-483a-8add-5f31c9a8267f",
          "citation": "WIKIPEDIA",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2ef2a2b8-7cec-da9d-38bc-581aa00557ba",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=22888-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "22b5ab13-901b-e9ce-2ee6-dca5bb1e6177",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search/r?dbs+lactmed:@term+@rel+@rn+22888-70-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "f0e1d110-9bb8-3575-41f3-d6492c873972",
          "citation": "MI",
          "doc_type": "MERCK INDEX",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "257e2b2c-9acc-ff83-a2ec-bae6915c38d5",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "67dab5a2-cc24-a3ae-855e-0b8c06785ada",
          "citation": "Jančová, Petra, et al. \"Silybin is metabolized by cytochrome P450 2C8 in vitro.\" Drug metabolism and disposition 35.11 (2007): 2035-2039.",
          "url": "http://dmd.aspetjournals.org/content/dmd/35/11/2035.full.pdf",
          "doc_type": "JA",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "570bbe15-3ce2-468d-b0e0-539eba46a1aa",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "e038c6b2-73c5-cbcc-2e01-b18018bdb9bf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "ebae6e3b-30fe-4f89-b764-3f02b8d6c7c6",
          "id": "ebae6e3b-30fe-4f89-b764-3f02b8d6c7c6",
          "molfile": "\n  Marvin  01132112122D          \n\n 35 39  0  0  1  0            999 V2000\n    6.1718   -1.7451    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    6.8848   -1.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -1.7451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -1.3349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7408   -1.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0230   -1.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3098   -1.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3098   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0230   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7408   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -2.9849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1718   -2.5701    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    6.8848   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8848   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3158   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -4.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3158   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7466   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5920   -2.9849    0.0000 C   0  0  1  0  0  0  0  0  0  1  0  0\n    1.8790   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1657   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2651   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9830   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2651   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -5.0451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1657   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8790   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8790   -5.0451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5920   -3.8099    0.0000 C   0  0  2  0  0  0  0  0  0  1  0  0\n    3.3098   -4.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  6  0  0  0\n  1  4  1  0  0  0  0\n  1 12  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  2  0  0  0  0\n 22  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  1  1  0  0  0\n 12 13  1  0  0  0  0\n 13 14  1  0  0  0  0\n 13 21  2  0  0  0  0\n 15 14  2  0  0  0  0\n 16 15  1  0  0  0  0\n 16 17  1  0  0  0  0\n 18 16  2  0  0  0  0\n 18 19  1  0  0  0  0\n 21 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 23  1  6  0  0  0\n 22 34  1  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  1  0  0  0  0\n 31 24  2  0  0  0  0\n 26 25  2  0  0  0  0\n 26 27  1  0  0  0  0\n 28 26  1  0  0  0  0\n 29 28  2  0  0  0  0\n 29 30  1  0  0  0  0\n 31 29  1  0  0  0  0\n 32 31  1  0  0  0  0\n 32 33  2  0  0  0  0\n 34 32  1  0  0  0  0\n 34 35  1  1  0  0  0\nM  END",
          "smiles": "COc1cc(ccc1O)[C@@H]2[C@@H](CO)Oc3ccc(cc3O2)[C@@H]4[C@H](C(=O)c5c(cc(cc5O4)O)O)O",
          "formula": "C25H22O10",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ABSOLUTE",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b59b0ca6-bc5b-4b17-a28f-7f74650c6b50"
          },
          "defined_stereo": 4,
          "ez_centers": 0,
          "molecular_weight": "482.4371",
          "optical_activity": "UNSPECIFIED",
          "stereo_centers": 4
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "01b7246d-ddd2-4328-a414-e38512f1bac1",
      "version": "10",
      "structure": {
        "id": "921645e7-25f3-4820-bb09-88b972af6ea9",
        "molfile": "\n  Marvin  01132107342D          \n\n 35 39  0  0  1  0            999 V2000\n    3.3098   -4.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5920   -3.8099    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    1.8790   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8790   -5.0451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1657   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1657   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.8790   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    2.5920   -2.9849    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    3.3098   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.3098   -1.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0230   -1.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7408   -1.7451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.7408   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.0230   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -2.9849    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1718   -2.5701    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0\n    6.8848   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.8848   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3158   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -4.2201    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.3158   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.0289   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.7466   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1718   -1.7451    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0\n    6.8848   -1.3349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.5979   -1.7451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.4538   -1.3349    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -2.5701    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2651   -2.9849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.9830   -2.5701    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.2651   -3.8099    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -4.2201    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.4480   -5.0451    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  1  0  0  0\n  2  3  1  0  0  0  0\n  3  4  2  0  0  0  0\n  3  5  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  6  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 12 13  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14  9  1  0  0  0  0\n 13 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  1  0  0  0\n 17 18  2  0  0  0  0\n 19 18  1  0  0  0  0\n 20 19  2  0  0  0  0\n 20 21  1  0  0  0  0\n 22 20  1  0  0  0  0\n 22 23  1  0  0  0  0\n 23 24  1  0  0  0  0\n 25 22  2  0  0  0  0\n 17 25  1  0  0  0  0\n 16 26  1  0  0  0  0\n 26 27  1  6  0  0  0\n 27 28  1  0  0  0  0\n 29 26  1  0  0  0  0\n 29 12  1  0  0  0  0\n  8  2  1  0  0  0  0\n 30  6  1  0  0  0  0\n 31 30  2  0  0  0  0\n 31 32  1  0  0  0  0\n 33 31  1  0  0  0  0\n 34 33  2  0  0  0  0\n 34 35  1  0  0  0  0\n  5 34  1  0  0  0  0\nM  END",
        "smiles": "COc1cc(ccc1O)[C@@H]2[C@@H](CO)Oc3ccc(cc3O2)[C@@H]4[C@H](C(=O)c5c(cc(cc5O4)O)O)O",
        "formula": "C25H22O10",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ABSOLUTE",
        "defined_stereo": 4,
        "ez_centers": 0,
        "molecular_weight": "482.4371",
        "optical_activity": "UNSPECIFIED",
        "references": [
          "12bd3f10-68de-483a-8add-5f31c9a8267f",
          "28ac1927-8d3d-4fac-8600-4088995568ca"
        ],
        "stereo_centers": 4
      },
      "unii": "33X338MNE4"
    }
  ]
}