{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "ae4feb5e-6bd1-4e4a-81b8-916af529feff", "code": "14726-36-4", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=14726-36-4", "code_system": "CAS", "references": [ "290201d2-174c-438f-963c-9319fbd3b0a3", "12e599bc-50fb-4a24-af17-6008a03cbbde" ] }, { "uuid": "de159291-77f8-4189-8508-27bc1576afdb", "code": "C005895", "type": "PRIMARY", "url": "http://www.ncbi.nlm.nih.gov/mesh/67005895", "code_system": "MESH", "references": [ "290201d2-174c-438f-963c-9319fbd3b0a3" ] }, { "uuid": "95b07a4f-6441-4525-9d93-2ac1251e6208", "code": "SUB169861", "type": "PRIMARY", "code_system": "EVMPD", "references": [ "290201d2-174c-438f-963c-9319fbd3b0a3" ] }, { "uuid": "be81b1c7-5a15-4040-b12b-228d5a5ba7ad", "code": "238-778-0", "type": "PRIMARY", "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.035.238", "code_system": "ECHA (EC/EINECS)", "references": [ "290201d2-174c-438f-963c-9319fbd3b0a3" ] }, { "uuid": "6be40fe0-a8e3-3a6a-a279-8c2c55898485", "code": "84610", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/84610", "code_system": "PUBCHEM", "references": [ "0644c8e3-57b6-a2f4-2080-0700e9708589" ] }, { "uuid": "f0e4a15c-34a2-4e1d-84bf-53188b90e5ff", "code": "33RO266515", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "b630958d-6594-869f-57ca-b5b74c35db71", "code": "DTXSID20893254", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20893254", "code_system": "EPA CompTox" }, { "uuid": "59e74bd3-3e1f-b19d-6f70-76e2425c9a5c", "code": "100000159554", "type": "PRIMARY", "code_system": "SMS_ID", "references": [ "13552a27-ecf3-b86f-7062-b4382bdd77cb" ] } ], "relationships": [ { "uuid": "443e78be-4acc-4adb-acda-498119437552", "type": "PARENT->SALT/SOLVATE", "related_substance": { "uuid": "9ed5cfe8-3659-428b-8403-8c530aa08c56", "refuuid": "a0cf59d1-0ce6-46d2-a53c-21c4b202ec9c", "name": "ZINC CATION", "unii": "13S1S8SF37", "linking_id": "13S1S8SF37", "ref_pname": "ZINC CATION", "substance_class": "reference" } } ], "substance_class": "chemical", "names": [ { "uuid": "bf3117c4-c74a-4e9c-8bf9-8998ac489223", "name": "ZINC DIBENZYLDITHIOCARBAMATE", "stdName": "ZINC DIBENZYLDITHIOCARBAMATE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "19c663e4-dec0-48b3-bcc7-f6ce591c2650" ], "display_name": true } ], "references": [ { "uuid": "19c663e4-dec0-48b3-bcc7-f6ce591c2650", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "290201d2-174c-438f-963c-9319fbd3b0a3", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391116000, "tags": [ "NOMEN" ] }, { "uuid": "94077ef5-7ea0-41e9-b046-1bd62ae160a0", "citation": "SRS import [33RO266515]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=33RO266515", "doc_type": "SRS", "public_domain": true, "document_date": 1493391116000, "tags": [ "NOMEN" ] }, { "uuid": "affc4ca7-47a9-43ab-b12e-08a472826a14", "citation": "CHEMID 2011", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "13552a27-ecf3-b86f-7062-b4382bdd77cb", "citation": "EU-SRS", "doc_type": "EMA LIST", "public_domain": true }, { "uuid": "0644c8e3-57b6-a2f4-2080-0700e9708589", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "12e599bc-50fb-4a24-af17-6008a03cbbde", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "5bb90de5-ea6c-405d-9645-e66f68f02c75", "id": "5bb90de5-ea6c-405d-9645-e66f68f02c75", "molfile": "\n Marvin 01132104452D \n\n 1 0 0 0 0 0 999 V2000\n 11.6068 -7.4336 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\nM CHG 1 1 2\nM END", "smiles": "[Zn+2]", "formula": "Zn", "atropisomerism": "No", "charge": 2, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "9e0f0027-4e64-4ecd-9584-56bac062dfb5" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "65.3956", "optical_activity": "NONE", "stereo_centers": 0 }, { "uuid": "90ef9b67-9201-4c86-882a-b37d75c49d2f", "id": "90ef9b67-9201-4c86-882a-b37d75c49d2f", "molfile": "\n Marvin 01132107312D \n\n 18 19 0 0 0 0 999 V2000\n 6.7854 -4.6662 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2638 -5.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7402 -6.3887 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2813 -5.5177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7325 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7734 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3659 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5409 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1240 -6.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5311 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3574 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6457 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6799 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2653 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4495 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0379 -4.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4405 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2632 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 2 4 1 0 0 0 0\n 5 4 1 0 0 0 0\n 12 4 1 0 0 0 0\n 5 6 1 0 0 0 0\n 7 6 1 0 0 0 0\n 6 11 2 0 0 0 0\n 8 7 2 0 0 0 0\n 9 8 1 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 18 13 2 0 0 0 0\n 14 15 2 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\nM END", "smiles": "c1ccc(cc1)CN(Cc2ccccc2)C(=S)S", "formula": "C15H15NS2", "atropisomerism": "No", "charge": 0, "count": 2, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 2, "units": "MOL RATIO", "uuid": "add04b65-4fb2-4808-b3bf-9da37768fdce" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "273.419", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "e4fb8cdf-27e0-4bd1-b36d-95e9512b344f", "version": "5", "structure": { "id": "0ba47ae9-aa59-4f9b-9742-71c29e2fd64b", "molfile": "\n Marvin 01132100512D \n\n 37 38 0 0 0 0 999 V2000\n 11.6068 -7.4336 0.0000 Zn 0 2 0 0 0 0 0 0 0 0 0 0\n 3.3574 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5311 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1240 -6.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5409 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3659 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7734 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7325 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2813 -5.5177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2638 -5.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7854 -4.6662 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7402 -6.3887 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 4.6457 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6799 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2632 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4405 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0379 -4.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4495 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2653 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3574 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5311 -5.7031 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1240 -6.4173 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5409 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.3659 -7.1301 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7734 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.7325 -6.4093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.2813 -5.5177 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 6.2638 -5.5177 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7854 -4.6662 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 6.7402 -6.3887 0.0000 S 0 5 0 0 0 0 0 0 0 0 0 0\n 4.6457 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.6799 -4.7029 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2632 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4405 -5.4083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.0379 -4.6928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4495 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2653 -3.9861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 14 19 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 2 1 0 0 0 0\n 8 7 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 9 1 0 0 0 0\n 11 10 2 0 0 0 0\n 10 12 1 0 0 0 0\n 13 9 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 14 2 0 0 0 0\n 16 15 1 0 0 0 0\n 17 16 2 0 0 0 0\n 18 17 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 21 2 0 0 0 0\n 25 20 1 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 26 25 1 0 0 0 0\n 26 27 1 0 0 0 0\n 28 27 1 0 0 0 0\n 31 27 1 0 0 0 0\n 29 28 2 0 0 0 0\n 28 30 1 0 0 0 0\n 31 32 1 0 0 0 0\n 32 37 1 0 0 0 0\n 33 32 2 0 0 0 0\n 34 33 1 0 0 0 0\n 35 34 2 0 0 0 0\n 36 35 1 0 0 0 0\n 37 36 2 0 0 0 0\nM CHG 3 1 2 12 -1 30 -1\nM STY 1 1 MUL\nM SCN 1 1 HT \nM SAL 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SAL 1 15 17 18 19 20 21 22 23 24 25 26 27 28 29 30 31\nM SAL 1 6 32 33 34 35 36 37\nM SPA 1 15 2 3 4 5 6 7 8 9 10 11 12 13 14 15 16\nM SPA 1 3 17 18 19\nM SDI 1 4 1.6179 -7.5501 1.6179 -3.5661\nM SDI 1 4 7.2054 -3.5661 7.2054 -7.5501\nM SMT 1 2\nM END", "smiles": "c1ccc(cc1)CN(Cc2ccccc2)C(=S)[S-].c1ccc(cc1)CN(Cc2ccccc2)C(=S)[S-].[Zn+2]", "formula": "2C15H14NS2.Zn", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "610.2177", "optical_activity": "NONE", "references": [ "affc4ca7-47a9-43ab-b12e-08a472826a14", "94077ef5-7ea0-41e9-b046-1bd62ae160a0" ], "stereo_centers": 0 }, "unii": "33RO266515" } ] }