{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "a08dba97-a128-4a29-bee2-ad620d78cf72",
          "code": "2430-46-8",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=2430-46-8",
          "code_system": "CAS",
          "references": [
            "6fd032b0-5661-4012-a7c4-2a2be90f134f",
            "c1c085fc-2f6b-4689-b89a-f8b021f18b64"
          ]
        },
        {
          "uuid": "a4b51de6-db48-4928-af3a-efa4a03d362d",
          "code": "SUB11149MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "6fd032b0-5661-4012-a7c4-2a2be90f134f"
          ]
        },
        {
          "uuid": "50971736-168f-4aa3-80f7-e35f76deb259",
          "code": "1273",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=1273",
          "code_system": "INN",
          "references": [
            "6fd032b0-5661-4012-a7c4-2a2be90f134f"
          ]
        },
        {
          "uuid": "3b44e1aa-6c18-44c4-a0bf-57c10c45d814",
          "code": "C75058",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C75058",
          "code_system": "NCI_THESAURUS",
          "references": [
            "6fd032b0-5661-4012-a7c4-2a2be90f134f"
          ]
        },
        {
          "uuid": "bf240b8d-476f-4205-900a-420088cf4e1a",
          "code": "72134",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/72134",
          "code_system": "PUBCHEM",
          "references": [
            "6fd032b0-5661-4012-a7c4-2a2be90f134f"
          ]
        },
        {
          "uuid": "faea41d3-2bcd-c43c-22b0-3c74b8c8fde7",
          "code": "DTXSID70179035",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70179035",
          "code_system": "EPA CompTox",
          "references": [
            "d31f2696-0a7f-e344-0ceb-4ff710409d3b"
          ]
        },
        {
          "uuid": "6ea18ff4-dab1-3e8c-8066-18ea5716acdd",
          "code": "C29713",
          "comments": "Pharmacologic Substance[C1909]|Agent Affecting Nervous System[C78272]|Adrenergic Agent[C29747]|Adrenergic Antagonist[C72900]|Alpha-Adrenergic Antagonist",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C29713",
          "code_system": "NCI_THESAURUS",
          "references": [
            "1e51c0d1-e13b-46df-741d-1812e0a936af"
          ]
        },
        {
          "uuid": "96eeb1d4-9065-4dee-b863-22ca85c2785c",
          "code": "33P8JV23L7",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "d1b071b3-ab5a-ad84-fb7d-55ad5da29b86",
          "code": "100000077732",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "ded3ee7a-1d4c-d791-0d85-4f54003cbb76"
          ]
        },
        {
          "uuid": "39a9752a-cd56-bd59-7617-0de3f1e217c2",
          "code": "169422",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=169422",
          "code_system": "NSC",
          "references": [
            "13f0af3b-7c49-64d3-f79e-36d0c367c939"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "a34f313a-2f9a-4079-8beb-e1dbd8286776",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "c6cc10f7-a21c-48c6-8275-f057c8f7b8a0",
            "refuuid": "84c50fbf-d9d3-4941-87b5-dd731076afac",
            "name": "TOLBOXANE",
            "unii": "33P8JV23L7",
            "linking_id": "33P8JV23L7",
            "ref_pname": "TOLBOXANE",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "1dbe6289-6b80-419b-93c4-6c2a71f6b1c6",
          "name": "NSC-169422",
          "stdName": "NSC-169422",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "833f06ab-cfe4-49ca-9099-5134321cc8a8",
            "c7376b45-0372-499d-89e7-478a2d6d0b7c"
          ],
          "display_name": false
        },
        {
          "uuid": "e5559d62-bcfe-4445-90a9-a3528b3f7a3a",
          "name": "TOLBOXANE",
          "stdName": "TOLBOXANE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e69a45-34cb-4769-bd83-45fca2557f60",
            "1011b95c-1e6a-47df-8cb0-2832662c99fb",
            "9763d213-706e-470a-baed-9e937d2de54f"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "1abfcf6f-20f1-4506-9005-9407892fe4f9",
              "name_org": "INN"
            }
          ]
        },
        {
          "uuid": "a7943c18-8147-4bdf-a074-0768534690ec",
          "name": "tolboxane [INN]",
          "stdName": "TOLBOXANE [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4e69a45-34cb-4769-bd83-45fca2557f60"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1011b95c-1e6a-47df-8cb0-2832662c99fb",
          "citation": "USP Dictionary 2007",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "a4e69a45-34cb-4769-bd83-45fca2557f60",
          "citation": "INN Proposed List 12",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL12.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "833f06ab-cfe4-49ca-9099-5134321cc8a8",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c7376b45-0372-499d-89e7-478a2d6d0b7c",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fd032b0-5661-4012-a7c4-2a2be90f134f",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b4d481f9-ebb5-47b3-a387-939c8d3314b4",
          "citation": "SRS import [33P8JV23L7]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=33P8JV23L7",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389916000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "23729cd2-14d1-401f-949c-652cfbd8a638",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9763d213-706e-470a-baed-9e937d2de54f",
          "citation": "TOLBOXANE [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d31f2696-0a7f-e344-0ceb-4ff710409d3b",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=2430-46-8",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ded3ee7a-1d4c-d791-0d85-4f54003cbb76",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "1e51c0d1-e13b-46df-741d-1812e0a936af",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "c1c085fc-2f6b-4689-b89a-f8b021f18b64",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "13f0af3b-7c49-64d3-f79e-36d0c367c939",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4ccc0454-8410-40e1-93be-87722fbec919",
          "id": "4ccc0454-8410-40e1-93be-87722fbec919",
          "molfile": "\n  Marvin  01132104002D          \n\n 17 18  0  0  0  0            999 V2000\n   -3.8992    1.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1109    1.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5296    1.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7295    1.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1365    1.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3137    1.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4885    1.9791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0769    1.2639    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4927    0.5479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3179    0.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7469    1.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1558    0.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9808    0.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3959    1.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2311    1.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850    1.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1633    1.9734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  4  5  1  0  0  0  0\n  6  4  1  0  0  0  0\n  4 10  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  1  0  0  0  0\n 17 11  2  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 14 16  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
          "smiles": "CCCC1(C)COB(c2ccc(C)cc2)OC1",
          "formula": "C14H21BO2",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "d5465aad-1348-44e2-a540-45831ed5eb11"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "232.1269",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "84c50fbf-d9d3-4941-87b5-dd731076afac",
      "version": "7",
      "structure": {
        "id": "8036d1ea-f55e-457e-b84b-21491935c0dc",
        "molfile": "\n  Marvin  01132106392D          \n\n 17 18  0  0  0  0            999 V2000\n   -1.3137    1.9821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.7295    1.2661    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.3179    0.5507    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4927    0.5479    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0769    1.2639    0.0000 B   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.4885    1.9791    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    0.7469    1.2594    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1558    0.5436    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9808    0.5424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.3959    1.2599    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.9850    1.9721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.1633    1.9734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2311    1.2595    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.1365    1.9738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.5296    1.0435    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.1109    1.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.8992    1.4003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n  2  3  1  0  0  0  0\n  9 10  2  0  0  0  0\n  3  4  1  0  0  0  0\n 10 11  1  0  0  0  0\n  4  5  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12  7  1  0  0  0  0\n  5  6  1  0  0  0  0\n 10 13  1  0  0  0  0\n  2 14  1  0  0  0  0\n  5  7  1  0  0  0  0\n  2 15  1  0  0  0  0\n  1  2  1  0  0  0  0\n 15 16  1  0  0  0  0\n  7  8  2  0  0  0  0\n 16 17  1  0  0  0  0\nM  END",
        "smiles": "CCCC1(C)COB(c2ccc(C)cc2)OC1",
        "formula": "C14H21BO2",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "232.1269",
        "optical_activity": "NONE",
        "references": [
          "b4d481f9-ebb5-47b3-a387-939c8d3314b4",
          "23729cd2-14d1-401f-949c-652cfbd8a638",
          "a4e69a45-34cb-4769-bd83-45fca2557f60"
        ],
        "stereo_centers": 0
      },
      "unii": "33P8JV23L7"
    }
  ]
}