{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3f64c2d1-d660-4dad-91fb-fb8e3f3183a0",
          "code": "23383-11-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=23383-11-1",
          "code_system": "CAS",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5",
            "5562d006-92e8-4e4d-843d-9e4c67a09deb"
          ]
        },
        {
          "uuid": "872e816b-b1dd-4d40-90b6-259b3affc7c8",
          "code": "C016600",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67016600",
          "code_system": "MESH",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "f5f0f782-1bcf-474e-8642-c49d70b9b00b",
          "code": "IRON(II) CITRATE",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Iron(II)_citrate",
          "code_system": "WIKIPEDIA",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "80812214-5ddb-4931-ba47-1a50fc7dadb4",
          "code": "21 CFR 184.1307C",
          "comments": "PART 184 -- DIRECT FOOD SUBSTANCES AFFIRMED AS GENERALLY RECOGNIZED AS SAFE|Subpart B--Listing of Specific Substances Affirmed as GRAS|Sec. 184.1307c Ferrous citrate",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=184.1307c",
          "code_system": "CFR",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "b396681a-c3dc-4c1b-951a-57d63c77205b",
          "code": "245-625-1",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.041.463",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "b2d7fb3c-7340-4756-bd37-309deda208d9",
          "code": "m5341",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m5341?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "23e8c6c2-8e5d-4ab8-b5bc-fa962821dfb6",
          "code": "SUB13864MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "a94773f7-c4a3-4af5-bd17-bb80cd4354d5"
          ]
        },
        {
          "uuid": "7241936b-d813-cbd4-b4c2-6436f69c5a49",
          "code": "460",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/460",
          "code_system": "HSDB",
          "references": [
            "6d5f1df0-35ce-2844-0a62-4f0908b72126"
          ]
        },
        {
          "uuid": "62c04cc2-2ba6-abbf-c3dc-1d74f149129a",
          "code": "11064683",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/11064683",
          "code_system": "PUBCHEM",
          "references": [
            "a274c103-9afd-6eaa-03d1-bd3112ce4538"
          ]
        },
        {
          "uuid": "be06dd5f-3369-457a-a44c-552d9dd776ac",
          "code": "33KM3X4QQW",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "3b96ddb9-220e-e373-6199-af67deb8d766",
          "code": "DTXSID701018441",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID701018441",
          "code_system": "EPA CompTox"
        },
        {
          "uuid": "dc7bf77f-a919-e4be-7c14-eb7a2524075f",
          "code": "100000078449",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "10fda5f7-9a06-2f4b-bcca-936f9fc872af"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "5535ec74-58c8-4c63-a950-8dc8b8702556",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "ab047384-bd30-4840-885d-67f07b5fbab4",
            "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d",
            "name": "FERROUS CATION",
            "unii": "GW89581OWR",
            "linking_id": "GW89581OWR",
            "ref_pname": "FERROUS CATION",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8eeb149b-1299-44a8-a041-ff464455fcad",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "9dfa1a2b-e05d-4a3a-b7f8-a44d6633095e",
            "refuuid": "7495c063-0afe-4404-b6dc-1327ce06fa4e",
            "name": "Anhydrous citric acid",
            "unii": "XF417D3PSL",
            "linking_id": "XF417D3PSL",
            "ref_pname": "Anhydrous citric acid",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "9fd36ac2-8b8d-44e2-978a-b0e3bcc1f722",
          "type": "PARENT->SALT/SOLVATE",
          "related_substance": {
            "uuid": "3315dc96-ff1d-4ff9-ad75-4491c5d9615a",
            "refuuid": "3963b0fc-3b47-4ee5-8f3a-4a92b7438c3d",
            "name": "FERROUS CATION",
            "unii": "GW89581OWR",
            "linking_id": "GW89581OWR",
            "ref_pname": "FERROUS CATION",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "a99aaeb7-bccf-4861-85cd-2f62f55af8d0",
          "name": "CITRIC ACID, IRON(2+) SALT",
          "stdName": "CITRIC ACID, IRON(2+) SALT",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a385790-42d0-44b1-b870-0cc957fdd55d",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": false
        },
        {
          "uuid": "c58f9a18-4238-443c-9f95-df40af28bddf",
          "name": "FERROUS CITRATE",
          "stdName": "FERROUS CITRATE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d1a0841b-d8f5-40de-8986-32130a7e26f2",
            "b59730db-1284-4250-ab56-bc86923b33b3",
            "c7b13963-b4ff-4467-8d32-81008b879521",
            "043f92c7-e01a-4249-82f7-c7e954e5975f",
            "b46485f1-9b8e-4f87-9365-a35a9bed8f4e",
            "77439993-b6e0-4583-bb59-d37b83b7e718",
            "d0dd8448-dbde-4305-9116-d9f9fdfccb09",
            "8494eba2-83e4-4dec-8aba-95581ed137b4",
            "08265d05-80bb-4a12-9551-c9b8baa1faa8",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": true
        },
        {
          "uuid": "f522554e-50c1-45ff-80aa-7ccd3e1e9927",
          "name": "FERROUS CITRATE [FCC]",
          "stdName": "FERROUS CITRATE [FCC]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "08265d05-80bb-4a12-9551-c9b8baa1faa8",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": false
        },
        {
          "uuid": "9642a2c2-5f3d-46d4-a38f-741718cbe09a",
          "name": "FERROUS CITRATE [HSDB]",
          "stdName": "FERROUS CITRATE [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "043f92c7-e01a-4249-82f7-c7e954e5975f",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": false
        },
        {
          "uuid": "20fa2fd3-065f-4b91-8ed9-f80e0669ba1e",
          "name": "FERROUS CITRATE [MI]",
          "stdName": "FERROUS CITRATE [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8494eba2-83e4-4dec-8aba-95581ed137b4",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": false
        },
        {
          "uuid": "dd1ae350-5508-91ad-5210-1bbda2d1c6ff",
          "name": "Ferrous citrate [WHO-DD]",
          "stdName": "FERROUS CITRATE [WHO-DD]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5bef2cb5-b14a-7d31-7863-f9b7a3af72fb"
          ],
          "display_name": false
        },
        {
          "uuid": "203cb264-d71f-4f48-b670-c01dac8910ed",
          "name": "IRON(II) CITRATE",
          "stdName": "IRON(II) CITRATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4a385790-42d0-44b1-b870-0cc957fdd55d",
            "2be4e510-5fc8-4385-986e-df2760830b46"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a42cfd95-38cc-4dd1-881b-a4fcd2e29654",
          "citation": "SRS import [33KM3X4QQW]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=33KM3X4QQW",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "77439993-b6e0-4583-bb59-d37b83b7e718",
          "citation": "FERROUS CITRATE [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d1a0841b-d8f5-40de-8986-32130a7e26f2",
          "citation": "FERROUS CITRATE [FCC]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c7b13963-b4ff-4467-8d32-81008b879521",
          "citation": "FERROUS CITRATE [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "b46485f1-9b8e-4f87-9365-a35a9bed8f4e",
          "citation": "FERROUS CITRATE [WHO-DD]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "08265d05-80bb-4a12-9551-c9b8baa1faa8",
          "citation": "FCC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b59730db-1284-4250-ab56-bc86923b33b3",
          "citation": "OTC",
          "doc_type": "USP FOOD CHEMICALS CODEX",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4a385790-42d0-44b1-b870-0cc957fdd55d",
          "citation": "ChemID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "2be4e510-5fc8-4385-986e-df2760830b46",
          "citation": "CHEMID",
          "doc_type": "CHEMID",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8494eba2-83e4-4dec-8aba-95581ed137b4",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "043f92c7-e01a-4249-82f7-c7e954e5975f",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d0dd8448-dbde-4305-9116-d9f9fdfccb09",
          "citation": "WHO-DD",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a94773f7-c4a3-4af5-bd17-bb80cd4354d5",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493389687000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6d5f1df0-35ce-2844-0a62-4f0908b72126",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+23383-11-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "10fda5f7-9a06-2f4b-bcca-936f9fc872af",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "a274c103-9afd-6eaa-03d1-bd3112ce4538",
          "citation": "PUBCHEM",
          "doc_type": "PUBCHEM",
          "public_domain": true
        },
        {
          "uuid": "5562d006-92e8-4e4d-843d-9e4c67a09deb",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "5bef2cb5-b14a-7d31-7863-f9b7a3af72fb",
          "citation": "WHO-DD",
          "doc_type": "WHO DRUG DICTIONARY",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "adefd6e9-a628-4581-80a7-4ce3eddddff2",
          "id": "adefd6e9-a628-4581-80a7-4ce3eddddff2",
          "molfile": "\n  Marvin  01132109022D          \n\n  1  0  0  0  0  0            999 V2000\n   10.1916   -3.6742    0.0000 Fe  0  2  0  0  0  0  0  0  0  0  0  0\nM  CHG  1   1   2\nM  END",
          "smiles": "[Fe+2]",
          "formula": "Fe",
          "atropisomerism": "No",
          "charge": 2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0ccc3004-807a-4f26-8e49-2e9c4ec94151"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "55.8451",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "7be8fd79-2f31-40b0-b660-ed9a75187c65",
          "id": "7be8fd79-2f31-40b0-b660-ed9a75187c65",
          "molfile": "\n  Marvin  01132106262D          \n\n 13 12  0  0  0  0            999 V2000\n    7.8174   -4.4946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1070   -4.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3875   -4.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1070   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1070   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3920   -3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6816   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9620   -3.6742    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6816   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8220   -3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5325   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2475   -3.6742    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.5325   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  2  0  0  0  0\n  2  4  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  4  1  0  0  0  0\n 10  4  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 11 10  1  0  0  0  0\n 12 11  1  0  0  0  0\n 13 11  2  0  0  0  0\nM  CHG  2   8  -1  12  -1\nM  END",
          "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O",
          "formula": "C6H6O7",
          "atropisomerism": "No",
          "charge": -2,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6ec0850b-90d2-4e37-b261-0d0be28617f8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "190.1079",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "65afa25b-a53e-4479-a72d-00c0754c44f2",
      "version": "8",
      "structure": {
        "id": "27783fe0-9a9b-4627-9a00-f491c7c8f5c6",
        "molfile": "\n  Marvin  01132102102D          \n\n 14 12  0  0  0  0            999 V2000\n    7.1070   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3920   -3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6816   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9620   -3.6742    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    5.6816   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8220   -3.6742    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.5325   -3.2571    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.2475   -3.6742    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0\n    8.5325   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1070   -4.0821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.8174   -4.4946    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3875   -4.4855    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.1070   -2.4321    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.1916   -3.6742    0.0000 Fe  0  2  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  3  2  0  0  0  0\n  6  1  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  7  2  0  0  0  0\n 10  1  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  2  0  0  0  0\n 13  1  1  0  0  0  0\nM  CHG  3   4  -1   8  -1  14   2\nM  END",
        "smiles": "C(C(=O)[O-])C(CC(=O)[O-])(C(=O)O)O.[Fe+2]",
        "formula": "C6H6O7.Fe",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "245.953",
        "optical_activity": "NONE",
        "references": [
          "08265d05-80bb-4a12-9551-c9b8baa1faa8",
          "a42cfd95-38cc-4dd1-881b-a4fcd2e29654"
        ],
        "stereo_centers": 0
      },
      "unii": "33KM3X4QQW"
    }
  ]
}