{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "783dd5f7-b975-40c7-ac28-2b92a40baec4",
          "code": "21 CFR 524.86",
          "comments": "SUBCHAPTER E--ANIMAL DRUGS, FEEDS, AND RELATED PRODUCTS|PART 524 OPHTHALMIC AND TOPICAL DOSAGE FORM NEW ANIMAL DRUGS|SEC. 524.86 Amitraz.",
          "type": "PRIMARY",
          "url": "http://www.accessdata.fda.gov/scripts/cdrh/cfdocs/cfcfr/CFRSearch.cfm?fr=524.86",
          "code_system": "CFR",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "3bb59384-a489-440e-8f9a-720ef3f7bb81",
          "code": "CHEMBL1365675",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chembl/compound/inspect/CHEMBL1365675",
          "code_system": "ChEMBL",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "cd22cc7a-0589-4998-8d05-1ab9541055c9",
          "code": "251-375-4",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.046.691",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "88f4fd37-5126-4db1-9920-72fccc90839b",
          "code": "36324",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/36324",
          "code_system": "PUBCHEM",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "7063e619-1446-4489-b17a-5367dce8397b",
          "code": "QP53AD51",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Amidines|amitraz, combinations",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AD51&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "9bf88360-5856-4875-976f-e9223acbaa4f",
          "code": "QP53AD01",
          "comments": "VATC|ECTOPARACITICIDES,  INSECTICIDES AND REPELLENTS|ECTOPARASITICIDES FOR TOPICAL USE, INCL. INSECTICIDES|Amidines|amitraz",
          "type": "PRIMARY",
          "url": "http://www.whocc.no/atcvet/atcvet_index/?code=QP53AD01&showdescription=yes",
          "code_system": "WHO-VATC",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "9cf349bd-655e-4c93-9747-117b73fe083b",
          "code": "33089-61-1",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=33089-61-1",
          "code_system": "CAS",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287",
            "8aaddffb-efb2-42c1-8e61-6add807daaaf"
          ]
        },
        {
          "uuid": "149c3745-9e36-4e81-97c8-1352b11216d1",
          "code": "C74339",
          "type": "PRIMARY",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C74339",
          "code_system": "NCI_THESAURUS",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "5b01091b-4656-4ec0-9f32-1e5639c2a59f",
          "code": "C014983",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67014983",
          "code_system": "MESH",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "f5505834-3131-401e-88bc-a496dbe5af42",
          "code": "AMITRAZ",
          "type": "PRIMARY",
          "url": "https://en.wikipedia.org/wiki/Amitraz",
          "code_system": "WIKIPEDIA",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "6affeb69-1d19-4ae1-937f-2eb81f15e265",
          "code": "SUB05461MIG",
          "type": "PRIMARY",
          "code_system": "EVMPD",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "9126920e-e832-4c55-8c1a-22d00d92e37b",
          "code": "106201",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:1197",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "e1c589ad-a845-4192-a2c6-572d13e54b36",
          "code": "5183",
          "type": "PRIMARY",
          "url": "https://extranet.who.int/soinn/mod/page/view.php?id=137&inn_n=5183",
          "code_system": "INN",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "d5a6ec16-3df9-4057-b550-c27b840fd646",
          "code": "17763",
          "comments": "RxNorm",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/17763/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "7a47e361-f5ac-4118-95dc-0e781e60a6ce",
          "code": "m1752",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m1752?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "5d2c79c9-d513-4841-b7ac-215e3181f287"
          ]
        },
        {
          "uuid": "eef36d72-ddd7-4b1f-9d8e-45c403e7377b",
          "code": "PROMERIS DUO",
          "comments": "EMA VET. EPAR|DOGS|TREATMENT AND PREVENTION OF FLEAS, TICKS, LICE AND DEMODICOSIS INFESTATION",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/000108/vet_med_000169.jsp&mid=WC0b01ac058001fa1c",
          "code_system": "EMA VETERINARY ASSESSMENT REPORTS",
          "references": [
            "a4b362ce-6fee-4191-6a05-a2b48ed08b57"
          ]
        },
        {
          "uuid": "12ffe617-5e8e-4908-a0af-e01bce8fa82c",
          "code": "CERTIFECT (AUTHORISED)",
          "comments": "DOGS",
          "type": "PRIMARY",
          "url": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/002002/vet_med_000241.jsp&mid=WC0b01ac058001fa1c",
          "code_system": "EMA VETERINARY ASSESSMENT REPORTS",
          "references": [
            "86a9b232-521d-424a-91ec-bef00b06f8da"
          ]
        },
        {
          "uuid": "9ea06a98-d225-07e9-9e42-caa71927efae",
          "code": "6939",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/6939",
          "code_system": "HSDB",
          "references": [
            "d7e19775-bec5-f740-a12a-982f2522ee00"
          ]
        },
        {
          "uuid": "f2d0ae6f-4c99-5bbe-d8dd-9a40933d2967",
          "code": "DTXSID5023871",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID5023871",
          "code_system": "EPA CompTox",
          "references": [
            "923cdc2c-14ba-4a5e-d6d1-05aa35f3b034"
          ]
        },
        {
          "uuid": "56d0c0dc-5b1e-9503-db8c-d94595b4d1a2",
          "code": "C737",
          "comments": "Industrial Aid[C45678]|Pesticide",
          "type": "CONCEPT",
          "url": "https://ncit.nci.nih.gov/ncitbrowser/ConceptReport.jsp?dictionary=NCI%20Thesaurus&code=C737",
          "code_system": "NCI_THESAURUS",
          "references": [
            "ec6fe74d-bc05-8154-9736-e87a141bf85c"
          ]
        },
        {
          "uuid": "2aa83d67-1060-4192-9be7-85555c62be02",
          "code": "33IAH5017S",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "8d1c34ce-8611-5007-0617-84b308c949cd",
          "code": "DB11373",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB11373",
          "code_system": "DRUG BANK",
          "references": [
            "ec6fe74d-bc05-8154-9736-e87a141bf85c"
          ]
        },
        {
          "uuid": "5e01a0e3-61a1-d536-6eae-4d6c0b073a3e",
          "code": "2665",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:2665",
          "code_system": "CHEBI",
          "references": [
            "ec6fe74d-bc05-8154-9736-e87a141bf85c"
          ]
        },
        {
          "uuid": "6fec0f23-a383-3ed5-c95d-22e7ef94c0f9",
          "code": "1028000",
          "type": "PRIMARY",
          "url": "https://store.usp.org/product/1028000",
          "code_system": "RS_ITEM_NUM",
          "references": [
            "ec6fe74d-bc05-8154-9736-e87a141bf85c"
          ]
        },
        {
          "uuid": "16e1c9d4-de54-0e48-947a-2c312700e8d3",
          "code": "100000087403",
          "type": "PRIMARY",
          "code_system": "SMS_ID",
          "references": [
            "dad5d243-cb7c-828c-47ce-9297792c01d8"
          ]
        },
        {
          "uuid": "0215609a-71d8-b83b-1bb3-1e8c6ead8b2d",
          "code": "amitraz",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/amitraz.html",
          "code_system": "ALANWOOD",
          "references": [
            "3d9da06f-de83-88c6-da3a-6d67fe9cf9b4"
          ]
        },
        {
          "uuid": "f9069555-bff9-03d2-57a3-40b15ff4b72f",
          "code": "324552",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=324552",
          "code_system": "NSC",
          "references": [
            "68bc91ab-6f37-37b3-bcde-663079bf5eaf"
          ]
        }
      ],
      "relationships": [
        {
          "uuid": "4b2003ed-8f61-43af-afca-c2866bd821e9",
          "amount": {
            "uuid": "1c1858de-c55d-43cc-99c6-1629c46d9fbf"
          },
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "4d5ab57d-6eb1-482d-9415-c5ab4d9c989c",
            "refuuid": "63c7ae6a-1355-4625-8053-4c4af33b485d",
            "name": "AMITRAZ",
            "unii": "33IAH5017S",
            "linking_id": "33IAH5017S",
            "ref_pname": "AMITRAZ",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "04a4a5e9-c674-4f5f-a542-5c2cf0985c59",
          "amount": {
            "uuid": "793501a4-b8bc-451e-b351-da56a733a7d3",
            "type": "RELATIONSHIP_AMOUNT",
            "units": "WEIGHT PERCENT",
            "high_limit": 101.5,
            "low_limit": 95
          },
          "qualification": "USP",
          "type": "BASIS OF STRENGTH->SUBSTANCE",
          "interaction_type": "CHROMATOGRAPHIC PURITY (HPLC/UV)",
          "references": [
            "a03ee246-43ce-4f06-a340-29418ef7db90"
          ],
          "related_substance": {
            "uuid": "dc3569b2-a9e3-48c6-a138-c45e95fcf883",
            "refuuid": "63c7ae6a-1355-4625-8053-4c4af33b485d",
            "name": "AMITRAZ",
            "unii": "33IAH5017S",
            "linking_id": "33IAH5017S",
            "ref_pname": "AMITRAZ",
            "substance_class": "reference"
          }
        },
        {
          "uuid": "8b652327-2e4b-47c3-a2fa-5c0618e5976d",
          "amount": {
            "uuid": "7778f8d7-b9fe-4ea3-bdab-ec395d2231fa",
            "units": "PERCENT PEAK AREA",
            "high_limit": 1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "9c3afb59-e640-47d1-b0a7-02f64a421bcf"
          ],
          "related_substance": {
            "uuid": "01c8017a-2e8c-4c5e-99e2-e5ee002f69f5",
            "refuuid": "124d3b93-38ad-4984-9eca-c760c2b9a7fd",
            "name": "SEMIAMITRAZ",
            "unii": "CTZ715OQFA",
            "linking_id": "CTZ715OQFA",
            "ref_pname": "SEMIAMITRAZ"
          }
        },
        {
          "uuid": "56af8897-c8a4-463a-bdbd-ee7bc944d94c",
          "amount": {
            "uuid": "ad2118fd-16c3-40f2-84c5-1a40ede10b63",
            "units": "PERCENT PEAK AREA",
            "high_limit": 0.1
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "0a4f6702-c9fb-405d-88f9-fee5473e71c1"
          ],
          "related_substance": {
            "uuid": "9150affd-8062-40f5-8468-f646dfc1d2f9",
            "refuuid": "fc586b61-9667-4997-a8b2-1b2299cecf9a",
            "name": "2,4-Xylidine",
            "unii": "367R1L22C9",
            "linking_id": "367R1L22C9",
            "ref_pname": "2,4-Xylidine"
          }
        },
        {
          "uuid": "4114c728-c197-40bf-ade5-5d6d417753b6",
          "amount": {
            "uuid": "08e050b8-d5ea-4e0f-a8a7-dfc17d31bee7",
            "units": "PERCENT PEAK AREA",
            "high_limit": 2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "918ad1da-daa2-4eda-8059-2651a5918799"
          ],
          "related_substance": {
            "uuid": "65d05768-f3bd-4333-a89a-68bac091d08e",
            "refuuid": "4baf34b9-d57c-4832-851d-a02857243fd7",
            "name": "N-(2,4-DIMETHYLPHENYL)FORMAMIDE",
            "unii": "X81G373YUR",
            "linking_id": "X81G373YUR",
            "ref_pname": "N-(2,4-DIMETHYLPHENYL)FORMAMIDE"
          }
        },
        {
          "uuid": "de7ac944-0201-4d64-879a-f386be67165b",
          "amount": {
            "uuid": "7fed14fa-1e5a-4ba7-acad-916e0112cb8b",
            "units": "PERCENT PEAK AREA",
            "high_limit": 2
          },
          "qualification": "USP",
          "type": "IMPURITY->PARENT",
          "interaction_type": "CHROMATOGRAPHIC PURITY (GC)",
          "references": [
            "c0c595c6-f6d0-4d6d-9e75-7b2044ce5e8a"
          ],
          "related_substance": {
            "uuid": "9a2f4724-276b-4c97-ae2a-615c697126bc",
            "refuuid": "add9dc06-b389-4130-9e64-bde0dad50c58",
            "name": "METHANIMIDAMIDE, N,N'-BIS(2,4-DIMETHYLPHENYL)-",
            "unii": "SFW2J15YOG",
            "linking_id": "SFW2J15YOG",
            "ref_pname": "METHANIMIDAMIDE, N,N'-BIS(2,4-DIMETHYLPHENYL)-"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "3458f439-126c-458f-b1cc-c3e91971f87c",
          "name": "AMITRAZ",
          "stdName": "AMITRAZ",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "821c52e9-6645-40ca-8ade-04e074e9c715",
            "dc5e49a8-0203-4bdc-a39c-c45132daceb2",
            "994d1b0b-3523-4fa8-96bd-3ceb912fc7fc",
            "0067a943-37b1-4579-be40-6546a90ef174",
            "5d9068e5-0191-4a59-b5a4-2446240d2207",
            "838bd049-bf42-47ce-aca1-3df742a7068a",
            "63d00834-194f-43c0-b1c3-7b66041db88c",
            "7b728e56-0d88-4b53-b0e2-eaeb32777b4c",
            "8f726ee5-d843-4535-b9e5-a86c9db848ec",
            "c307160e-1097-4b73-adf9-5447a5e9c0a1",
            "d7a4ef8b-639e-4ba6-8b62-7f1489a3069f",
            "c4569b9f-61ae-4340-9323-18d63d214f7f",
            "812d4378-63b0-446b-bf24-0aed16ee2628",
            "bb9889f4-5a37-443b-906a-4326d607d728",
            "8bd9afe7-a3c1-4554-97e8-467e4e1934ac",
            "cc1835c5-0f33-43fa-ae1c-5acd03d45a38",
            "4c7f5398-a726-492b-ac0f-074305824cbe"
          ],
          "display_name": true,
          "domains": [
            "drug"
          ],
          "name_orgs": [
            {
              "uuid": "049ace6c-105e-4769-9f80-1c702f01911f",
              "name_org": "INN"
            },
            {
              "uuid": "f21164c8-01de-4a11-bd48-1b992b53c7aa",
              "name_org": "USAN"
            }
          ]
        },
        {
          "uuid": "2a4c4421-7d74-45e6-b953-2d363099945a",
          "name": "AMITRAZ [EMA EPAR VETERINARY]",
          "stdName": "AMITRAZ [EMA EPAR VETERINARY]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86a9b232-521d-424a-91ec-bef00b06f8da"
          ],
          "display_name": false
        },
        {
          "uuid": "6890b275-f6b3-4340-b727-32e359b05da7",
          "name": "AMITRAZ [GREEN BOOK]",
          "stdName": "AMITRAZ [GREEN BOOK]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0067a943-37b1-4579-be40-6546a90ef174"
          ],
          "display_name": false
        },
        {
          "uuid": "cbc34104-8128-47fd-a749-5780746019d6",
          "name": "AMITRAZ [HSDB]",
          "stdName": "AMITRAZ [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "7b728e56-0d88-4b53-b0e2-eaeb32777b4c"
          ],
          "display_name": false
        },
        {
          "uuid": "8baa7a09-5f33-4cd7-85a7-dca5ff54153e",
          "name": "AMITRAZ [MART.]",
          "stdName": "AMITRAZ [MART.]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "821c52e9-6645-40ca-8ade-04e074e9c715"
          ],
          "display_name": false
        },
        {
          "uuid": "a7bbc1e1-d86b-45ab-9964-02669942a00c",
          "name": "AMITRAZ [MI]",
          "stdName": "AMITRAZ [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c307160e-1097-4b73-adf9-5447a5e9c0a1"
          ],
          "display_name": false
        },
        {
          "uuid": "fc43da1e-631d-4278-ae49-faa08ac8deed",
          "name": "AMITRAZ [USAN]",
          "stdName": "AMITRAZ [USAN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "8f726ee5-d843-4535-b9e5-a86c9db848ec"
          ],
          "display_name": false
        },
        {
          "uuid": "b099e214-7f9d-eba5-1538-3c98156d3207",
          "name": "AMITRAZ [USP MONOGRAPH]",
          "stdName": "AMITRAZ [USP MONOGRAPH]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c233dc63-0855-ec05-82be-65f49d7fed74"
          ],
          "display_name": false
        },
        {
          "uuid": "196283e4-5109-48f2-9c2e-ae4c1ed4f443",
          "name": "AMITRAZ [USP-RS]",
          "stdName": "AMITRAZ [USP-RS]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "5d9068e5-0191-4a59-b5a4-2446240d2207"
          ],
          "display_name": false
        },
        {
          "uuid": "663f0fe4-fb7a-4380-897d-714846c65dec",
          "name": "CERTIFECT",
          "stdName": "CERTIFECT",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "86a9b232-521d-424a-91ec-bef00b06f8da"
          ],
          "display_name": false
        },
        {
          "uuid": "a8e7c11e-a44c-49aa-befa-60621ab8ee60",
          "name": "METHANIMIDAMIDE, N'-(2,4-DIMETHYLPHENYL)-N-(((2,4-DIMETHYLPHENYL)IMINO)METHYL)-N-METHYL-",
          "stdName": "METHANIMIDAMIDE, N'-(2,4-DIMETHYLPHENYL)-N-(((2,4-DIMETHYLPHENYL)IMINO)METHYL)-N-METHYL-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfa2ed8c-dce5-4637-8385-e551b179df14"
          ],
          "display_name": false
        },
        {
          "uuid": "dbba8296-0a27-4b4f-b185-2b609271cb02",
          "name": "N-METHYL-N'-2,4-XYLYL-N-(N-2,4-XYLYLFORMIMIDOYL)FORMAMIDINE",
          "stdName": "N-METHYL-N'-2,4-XYLYL-N-(N-2,4-XYLYLFORMIMIDOYL)FORMAMIDINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfa2ed8c-dce5-4637-8385-e551b179df14"
          ],
          "display_name": false
        },
        {
          "uuid": "c51d2473-caab-40dd-abaf-309e97e59c26",
          "name": "N-METHYLBIS(2,4-XYLYLIMINOMETHYL)AMINE",
          "stdName": "N-METHYLBIS(2,4-XYLYLIMINOMETHYL)AMINE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "dfa2ed8c-dce5-4637-8385-e551b179df14"
          ],
          "display_name": false
        },
        {
          "uuid": "e32873f3-3eb4-442c-8edf-b4256f4b6644",
          "name": "NSC-324552",
          "stdName": "NSC-324552",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "ae3576ee-b589-4a00-82f7-d466b32ff3d2"
          ],
          "display_name": false
        },
        {
          "uuid": "270f5dc4-a6b3-4bb9-91b0-597a91552637",
          "name": "PROMERIS DUO COMPONENT AMITRAZ",
          "stdName": "PROMERIS DUO COMPONENT AMITRAZ",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "a4b362ce-6fee-4191-6a05-a2b48ed08b57"
          ],
          "display_name": false
        },
        {
          "uuid": "06c8dccb-0876-4598-8778-6052cbbb4eb9",
          "name": "U-36,059",
          "stdName": "U-36,059",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "6e542550-54d7-404e-920c-d38f62315d49"
          ],
          "display_name": false
        },
        {
          "uuid": "594a4669-dbdc-4424-85ec-7eec076de659",
          "name": "U-36-059",
          "stdName": "U-36-059",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "19962bc9-c365-407f-a011-fa73f3382c57"
          ],
          "display_name": false
        },
        {
          "uuid": "626aa7c1-fd35-4b83-b7d8-8fcd08001975",
          "name": "U-36059",
          "stdName": "U-36059",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "bb4038d7-095c-456b-98e4-320dc0d47b5e"
          ],
          "display_name": false
        },
        {
          "uuid": "5c62515b-c0a9-4293-ba79-210bce85e3f2",
          "name": "amitraz [INN]",
          "stdName": "AMITRAZ [INN]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "4c7f5398-a726-492b-ac0f-074305824cbe"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "8bd9afe7-a3c1-4554-97e8-467e4e1934ac",
          "citation": "USP Dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "dfa2ed8c-dce5-4637-8385-e551b179df14",
          "citation": "usp dictionary 2008",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "19962bc9-c365-407f-a011-fa73f3382c57",
          "citation": "USP Dictionary 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6e542550-54d7-404e-920c-d38f62315d49",
          "citation": "USP DICTIONARY",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4c7f5398-a726-492b-ac0f-074305824cbe",
          "citation": "INN Proposed List 47",
          "url": "https://www.who.int/medicines/publications/druginformation/innlists/PL47.pdf",
          "doc_type": "INN_LIST",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8f726ee5-d843-4535-b9e5-a86c9db848ec",
          "citation": "USP DICTIONARY 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4569b9f-61ae-4340-9323-18d63d214f7f",
          "citation": "USP 33",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "821c52e9-6645-40ca-8ade-04e074e9c715",
          "citation": "MARTINDALE 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c307160e-1097-4b73-adf9-5447a5e9c0a1",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "0067a943-37b1-4579-be40-6546a90ef174",
          "citation": "FDA SRS 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7b728e56-0d88-4b53-b0e2-eaeb32777b4c",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d9068e5-0191-4a59-b5a4-2446240d2207",
          "citation": "USP/NF",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "ae3576ee-b589-4a00-82f7-d466b32ff3d2",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb4038d7-095c-456b-98e4-320dc0d47b5e",
          "citation": "CHEMBL",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5d2c79c9-d513-4841-b7ac-215e3181f287",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390588000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "a03ee246-43ce-4f06-a340-29418ef7db90",
          "citation": "USP 35 AMITRAZ MONOGRAPH",
          "doc_type": "USP",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "02d955f7-4205-4f3b-ace7-eaf5500f6c34",
          "citation": "SRS import [33IAH5017S]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=33IAH5017S",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390588000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc1835c5-0f33-43fa-ae1c-5acd03d45a38",
          "citation": "AMITRAZ [INN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "812d4378-63b0-446b-bf24-0aed16ee2628",
          "citation": "AMITRAZ [USAN]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bb9889f4-5a37-443b-906a-4326d607d728",
          "citation": "AMITRAZ [USP]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "dc5e49a8-0203-4bdc-a39c-c45132daceb2",
          "citation": "AMITRAZ [MART.]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "994d1b0b-3523-4fa8-96bd-3ceb912fc7fc",
          "citation": "AMITRAZ [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "d7a4ef8b-639e-4ba6-8b62-7f1489a3069f",
          "citation": "AMITRAZ [GREEN BOOK]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "838bd049-bf42-47ce-aca1-3df742a7068a",
          "citation": "AMITRAZ [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "63d00834-194f-43c0-b1c3-7b66041db88c",
          "citation": "AMITRAZ [USP-RS]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "86a9b232-521d-424a-91ec-bef00b06f8da",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages%2Fmedicines%2Flanding%2Fvet_epar_search.jsp&mid=WC0b01ac058001fa1c&searchTab=&alreadyLoaded=true&isNewQuery=true&status=Authorised&status=Withdrawn&status=Suspended&status=Refused&startLetter=View+all&keyword=Enter+keywords&searchType=name&taxonomyPath=&treeNumber=",
          "doc_type": "EMA REVIEW",
          "public_domain": true
        },
        {
          "uuid": "a4b362ce-6fee-4191-6a05-a2b48ed08b57",
          "citation": "http://www.ema.europa.eu/ema/index.jsp?curl=pages/medicines/veterinary/medicines/000108/vet_med_000169.jsp&mid=WC0b01ac058001fa1c",
          "doc_type": "EMA REVIEW",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE",
            "NOMEN"
          ]
        },
        {
          "uuid": "d7e19775-bec5-f740-a12a-982f2522ee00",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+33089-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "923cdc2c-14ba-4a5e-d6d1-05aa35f3b034",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=33089-61-1",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "dad5d243-cb7c-828c-47ce-9297792c01d8",
          "citation": "EU-SRS",
          "doc_type": "EMA LIST",
          "public_domain": true
        },
        {
          "uuid": "ec6fe74d-bc05-8154-9736-e87a141bf85c",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "9c3afb59-e640-47d1-b0a7-02f64a421bcf",
          "citation": "USP42-NF37 - 257, Amitraz Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "0a4f6702-c9fb-405d-88f9-fee5473e71c1",
          "citation": "USP42-NF37 - 257, Amitraz Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "918ad1da-daa2-4eda-8059-2651a5918799",
          "citation": "USP42-NF37 - 257, Amitraz Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "c0c595c6-f6d0-4d6d-9e75-7b2044ce5e8a",
          "citation": "USP42-NF37 - 257, Amitraz Monograph",
          "doc_type": "USPNF",
          "public_domain": true,
          "tags": [
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "8aaddffb-efb2-42c1-8e61-6add807daaaf",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "3d9da06f-de83-88c6-da3a-6d67fe9cf9b4",
          "citation": "AW",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "8d129815-849e-5e70-878a-7cc67fe6ab1f",
          "citation": "USP-RS",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "c233dc63-0855-ec05-82be-65f49d7fed74",
          "citation": "USP 10/2020",
          "doc_type": "USPNF",
          "public_domain": true
        },
        {
          "uuid": "68bc91ab-6f37-37b3-bcde-663079bf5eaf",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "17728e59-c7ec-5168-5c31-15f0427e11c9",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "c8202978-0736-4508-a93c-c6959f7da704",
          "id": "c8202978-0736-4508-a93c-c6959f7da704",
          "molfile": "\n  Marvin  01132110202D          \n\n 22 23  0  0  0  0            999 V2000\n   -0.0748    1.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0748    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7816    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4956    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2073    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9213    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6354    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6354   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3663   -1.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9213   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2073   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4956   -1.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6513    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3678    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0842    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0842   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5075   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2215   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5075    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983    1.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2 13  1  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  5  6  1  0  0  0  0\n  5 11  2  0  0  0  0\n  6  7  2  0  0  0  0\n  7  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  2  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 13 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 21  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  1  0  0  0  0\n 20 18  2  0  0  0  0\n 21 20  1  0  0  0  0\n 21 22  1  0  0  0  0\nM  END",
          "smiles": "Cc1ccc(c(C)c1)/N=C/N(C)/C=N/c2ccc(C)cc2C",
          "formula": "C19H23N3",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "0896b244-c71f-466e-b02d-d5f389668c6c"
          },
          "defined_stereo": 0,
          "ez_centers": 2,
          "molecular_weight": "293.4067",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "63c7ae6a-1355-4625-8053-4c4af33b485d",
      "version": "30",
      "structure": {
        "id": "ed73b4f4-905d-4963-baa6-51bbb318b689",
        "molfile": "\n  Marvin  01132112172D          \n\n 22 23  0  0  0  0            999 V2000\n   -2.2073    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.2073   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9213    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4956    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -2.9213   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -1.4956   -1.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6354    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.7816    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -3.6354   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0748    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   -4.3663   -1.0349    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    0.6513    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   -0.0748    1.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    1.3678    0.6320    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0842    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983    0.6320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.0842   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5075    0.2292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983    1.4860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    2.7983   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.5075   -0.5958    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.2215   -1.0180    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  2  0  0  0  0\n  1  3  1  0  0  0  0\n  1  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  2  6  1  0  0  0  0\n  3  7  2  0  0  0  0\n  4  8  2  0  0  0  0\n  5  9  2  0  0  0  0\n  8 10  1  0  0  0  0\n  9 11  1  0  0  0  0\n 10 12  1  0  0  0  0\n 10 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 17  2  0  0  0  0\n 16 18  2  0  0  0  0\n 16 19  1  0  0  0  0\n 17 20  1  0  0  0  0\n 18 21  1  0  0  0  0\n 21 22  1  0  0  0  0\n  7  9  1  0  0  0  0\n 20 21  2  0  0  0  0\nM  END",
        "smiles": "Cc1ccc(c(C)c1)/N=C/N(C)/C=N/c2ccc(C)cc2C",
        "formula": "C19H23N3",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 2,
        "molecular_weight": "293.4067",
        "optical_activity": "NONE",
        "references": [
          "19962bc9-c365-407f-a011-fa73f3382c57",
          "02d955f7-4205-4f3b-ace7-eaf5500f6c34",
          "4c7f5398-a726-492b-ac0f-074305824cbe"
        ],
        "stereo_centers": 0
      },
      "unii": "33IAH5017S"
    }
  ]
}