{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "3a4cd61b-782b-40a2-b1c4-b4cff84fe4c3",
          "code": "188425-85-6",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=188425-85-6",
          "code_system": "CAS",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40",
            "88f54669-b6b1-429b-a16c-c5890c39d6d7"
          ]
        },
        {
          "uuid": "cfb40240-3549-4fed-bbcc-91411650dff7",
          "code": "C550088",
          "type": "PRIMARY",
          "url": "http://www.ncbi.nlm.nih.gov/mesh/67550088",
          "code_system": "MESH",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40"
          ]
        },
        {
          "uuid": "d5fe9a87-6720-4113-ab7b-00747c411282",
          "code": "128008",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:4488",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40"
          ]
        },
        {
          "uuid": "fad15fb3-c08a-4e8c-b96c-c1ea59497812",
          "code": "m2624",
          "comments": "Merck Index",
          "type": "PRIMARY",
          "url": "https://merckindex.rsc.org/monographs/m2624?q=authorize",
          "code_system": "MERCK INDEX",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40"
          ]
        },
        {
          "uuid": "03c4950c-4490-46d8-a3b9-41183b8532b7",
          "code": "1735163",
          "type": "PRIMARY",
          "url": "https://rxnav.nlm.nih.gov/REST/rxcui/1735163/allProperties.xml?prop=all",
          "code_system": "RXCUI",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40"
          ]
        },
        {
          "uuid": "733e81d0-b605-476f-9b89-41f5f0254a46",
          "code": "213013",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/213013",
          "code_system": "PUBCHEM",
          "references": [
            "b46b014e-8082-4e02-a626-c14db8855b40"
          ]
        },
        {
          "uuid": "b6516db4-06c6-d642-f577-249b8ee4eb2b",
          "code": "7499",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/source/hsdb/7499",
          "code_system": "HSDB",
          "references": [
            "c1cc831e-de57-327f-833f-b14140a49d30"
          ]
        },
        {
          "uuid": "6ed265e7-cd5f-a475-3734-a7375c3f0cdb",
          "code": "DTXSID6034392",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6034392",
          "code_system": "EPA CompTox",
          "references": [
            "b5c46f70-0786-888c-44e1-dbc66d990d7f"
          ]
        },
        {
          "uuid": "fa06814f-b0b4-18c6-d588-4a55481d2d43",
          "code": "DB12792",
          "type": "PRIMARY",
          "url": "http://www.drugbank.ca/drugs/DB12792",
          "code_system": "DRUG BANK",
          "references": [
            "b18b6826-a526-0f16-9aff-9e3af8d7f71e"
          ]
        },
        {
          "uuid": "ce159ec1-6d7c-4dec-bbf9-7ae12ef92d5c",
          "code": "32MS8ZRD1V",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "32e76c09-bb1f-0624-46b1-d5ceeab75c2a",
          "code": "81822",
          "type": "PRIMARY",
          "url": "https://www.ebi.ac.uk/chebi/chebiOntology.do?chebiId=CHEBI:81822",
          "code_system": "CHEBI",
          "references": [
            "b18b6826-a526-0f16-9aff-9e3af8d7f71e"
          ]
        },
        {
          "uuid": "f3772b5b-f5c7-0e87-977b-cb78953663df",
          "code": "32MS8ZRD1V",
          "type": "PRIMARY",
          "url": "https://dailymed.nlm.nih.gov/dailymed/search.cfm?adv=1&query=32MS8ZRD1V",
          "code_system": "DAILYMED",
          "references": [
            "d69beaab-e48f-bd8d-f286-d519724c97ea"
          ]
        },
        {
          "uuid": "d5aef3e9-e161-9af0-6114-bc24ab60b709",
          "code": "boscalid",
          "type": "PRIMARY",
          "url": "https://pesticidecompendium.bcpc.org/boscalid.html",
          "code_system": "ALANWOOD",
          "references": [
            "273c1d8c-861e-dd7a-13c1-a7adad87c76d"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "d3eef073-bc45-4de6-9894-264e3d8e0798",
          "name": "2-CHLORO-N-(4'-CHLORO(1,1'-BIPHENYL)-2-YL)-3-PYRIDINECARBOXAMIDE",
          "stdName": "2-CHLORO-N-(4'-CHLORO(1,1'-BIPHENYL)-2-YL)-3-PYRIDINECARBOXAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdf3a2ae-6d8e-4322-bdeb-5b5912b7fb9e",
            "1c16b54b-a3bc-44b1-ab41-ec825ca7c51b"
          ],
          "display_name": false
        },
        {
          "uuid": "b67edcb5-d377-417d-a983-78d6d87362f4",
          "name": "2-CHLORO-N-(4'-CHLOROBIPHENYL-2-YL)NICOTINAMIDE",
          "stdName": "2-CHLORO-N-(4'-CHLOROBIPHENYL-2-YL)NICOTINAMIDE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "fdf3a2ae-6d8e-4322-bdeb-5b5912b7fb9e",
            "d22cdb03-b3d9-4307-91e4-6158713d5c9f"
          ],
          "display_name": false
        },
        {
          "uuid": "efe2c8b5-59f9-4301-be56-3b3a4c349555",
          "name": "BAS 510",
          "stdName": "BAS 510",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "525b9387-9953-4a4a-85ad-edf8e9c940b2"
          ],
          "display_name": false
        },
        {
          "uuid": "007bf9d3-de71-4917-b77c-5eff42a605e3",
          "name": "BAS 510 F",
          "stdName": "BAS 510 F",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "7ed4ff71-6a70-4d53-aabb-2c4b70236666"
          ],
          "display_name": false
        },
        {
          "uuid": "787d4b08-c415-4a0d-90f3-92b809a41d06",
          "name": "BAS-510",
          "stdName": "BAS-510",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "525b9387-9953-4a4a-85ad-edf8e9c940b2"
          ],
          "display_name": false
        },
        {
          "uuid": "5d945331-c0b6-481a-be57-ebb8281baf26",
          "name": "BOSCALID",
          "stdName": "BOSCALID",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "09c88dc2-66e9-40ad-a04e-1d1f6ea714db",
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "89c92519-f091-4704-96f9-106a3aad4932",
            "5affd0d4-0db9-49f5-b272-eabc3902464f",
            "e557eb17-626e-4e54-a096-481400f70c34",
            "fdaaa7a5-86e6-449c-9b2d-c8756f1d1dc4",
            "49c32d83-7de9-4fe9-a3ea-4a69e91350c3",
            "7f2da638-2a01-4513-a600-0acbf5f49a3e"
          ],
          "display_name": true
        },
        {
          "uuid": "898aed31-4c67-454c-8330-b07d4d2aeccb",
          "name": "BOSCALID [HSDB]",
          "stdName": "BOSCALID [HSDB]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "7f2da638-2a01-4513-a600-0acbf5f49a3e"
          ],
          "display_name": false
        },
        {
          "uuid": "42a96c13-3255-4c68-a344-cfaa91f4c210",
          "name": "BOSCALID [ISO]",
          "stdName": "BOSCALID [ISO]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "5affd0d4-0db9-49f5-b272-eabc3902464f"
          ],
          "display_name": false
        },
        {
          "uuid": "3765b051-ccc6-4e29-ac7b-b499352cec99",
          "name": "BOSCALID [MI]",
          "stdName": "BOSCALID [MI]",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "89c92519-f091-4704-96f9-106a3aad4932"
          ],
          "display_name": false
        },
        {
          "uuid": "439374a8-b469-4f65-beb7-8838061aff18",
          "name": "EMERALD",
          "stdName": "EMERALD",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "a2122111-0804-4973-85bc-ff4f327f2999",
            "525b9387-9953-4a4a-85ad-edf8e9c940b2",
            "cf806e18-bc96-4d9b-a5a2-4f4a171e9534"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "de4c052f-5887-403b-8ebd-e4549011a80b",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "43d443b0-817a-4501-9f22-1b7e52bec984",
          "name": "ENDURA",
          "stdName": "ENDURA",
          "type": "bn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "525b9387-9953-4a4a-85ad-edf8e9c940b2"
          ],
          "display_name": false
        },
        {
          "uuid": "80dd2540-523d-4c17-869c-10a56a0e0169",
          "name": "NICOBIFEN",
          "stdName": "NICOBIFEN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
            "7ed4ff71-6a70-4d53-aabb-2c4b70236666"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "a2122111-0804-4973-85bc-ff4f327f2999",
          "citation": "EMERALD [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "e557eb17-626e-4e54-a096-481400f70c34",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "fdf3a2ae-6d8e-4322-bdeb-5b5912b7fb9e",
          "citation": "ALANWOOD.NET",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1c16b54b-a3bc-44b1-ab41-ec825ca7c51b",
          "citation": "ALANWOOD CAS",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d22cdb03-b3d9-4307-91e4-6158713d5c9f",
          "citation": "ALANWOOD IUPAC",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "5affd0d4-0db9-49f5-b272-eabc3902464f",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9c456eb3-6309-4511-b3d1-3d6f6e2aa102",
          "citation": "WEB PAGE",
          "doc_type": "WEB PAGE",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "525b9387-9953-4a4a-85ad-edf8e9c940b2",
          "citation": "http://www.epa.gov/opprd001/factsheets/boscalid.pdf",
          "url": "http://www.epa.gov/opprd001/factsheets/boscalid.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7ed4ff71-6a70-4d53-aabb-2c4b70236666",
          "citation": "http://www.fao.org/ag/AGP/AGPP/Pesticid/JMPR/Download/2006_eva/Boscalid%202006%20Evaluation.pdf",
          "url": "http://www.fao.org/ag/AGP/AGPP/Pesticid/JMPR/Download/2006_eva/Boscalid%202006%20Evaluation.pdf",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "89c92519-f091-4704-96f9-106a3aad4932",
          "citation": "MERCK INDEX",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "7f2da638-2a01-4513-a600-0acbf5f49a3e",
          "citation": "HSDB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cf806e18-bc96-4d9b-a5a2-4f4a171e9534",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "b46b014e-8082-4e02-a626-c14db8855b40",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "82a8a9c6-d32f-4d7e-a7c3-170fd49e1477",
          "citation": "SRS import [32MS8ZRD1V]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=32MS8ZRD1V",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390954000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1835fa40-5996-49d8-a051-ffba40262f61",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "49c32d83-7de9-4fe9-a3ea-4a69e91350c3",
          "citation": "BOSCALID [ISO]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "09c88dc2-66e9-40ad-a04e-1d1f6ea714db",
          "citation": "BOSCALID [MI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "fdaaa7a5-86e6-449c-9b2d-c8756f1d1dc4",
          "citation": "BOSCALID [HSDB]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "c1cc831e-de57-327f-833f-b14140a49d30",
          "citation": "WEBSITE",
          "url": "https://toxnet.nlm.nih.gov/cgi-bin/sis/search2/r?dbs+hsdb:@term+@rn+@rel+188425-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b5c46f70-0786-888c-44e1-dbc66d990d7f",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=188425-85-6",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "273c1d8c-861e-dd7a-13c1-a7adad87c76d",
          "citation": "BCPC",
          "doc_type": "ALANWOOD",
          "public_domain": true
        },
        {
          "uuid": "b18b6826-a526-0f16-9aff-9e3af8d7f71e",
          "doc_type": "SYSTEM",
          "public_domain": true
        },
        {
          "uuid": "88f54669-b6b1-429b-a16c-c5890c39d6d7",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        },
        {
          "uuid": "d69beaab-e48f-bd8d-f286-d519724c97ea",
          "citation": "DailyMed",
          "doc_type": "DAILYMED",
          "public_domain": true
        },
        {
          "uuid": "8c4494fd-f1b0-7fde-8d46-f390924e3777",
          "citation": "STARI",
          "doc_type": "CFSAN",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4d345b69-4e31-471d-a807-c661c3489e3b",
          "id": "4d345b69-4e31-471d-a807-c661c3489e3b",
          "molfile": "\n  Marvin  01132104022D          \n\n 23 25  0  0  0  0            999 V2000\n    4.8893   -7.6095    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    5.6006   -7.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6006   -6.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3229   -5.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312   -6.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312   -7.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3169   -7.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7561   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4590   -6.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1752   -5.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1752   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4634   -4.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7561   -5.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0470   -4.7516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0470   -3.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7586   -3.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3303   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6146   -3.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9018   -3.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9018   -2.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6126   -2.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3303   -2.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0483   -2.2527    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  7  2  0  0  0  0\n  4  3  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  8  5  1  0  0  0  0\n  7  6  1  0  0  0  0\n  8  9  1  0  0  0  0\n 13  8  2  0  0  0  0\n  9 10  2  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  2  0  0  0  0\n 12 13  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 15 16  2  0  0  0  0\n 17 15  1  0  0  0  0\n 18 17  1  0  0  0  0\n 17 22  2  0  0  0  0\n 19 18  2  0  0  0  0\n 20 19  1  0  0  0  0\n 21 20  2  0  0  0  0\n 22 21  1  0  0  0  0\n 22 23  1  0  0  0  0\nM  END",
          "smiles": "c1ccc(c(c1)-c2ccc(cc2)Cl)NC(=O)c3cccnc3Cl",
          "formula": "C18H12Cl2N2O",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "9d8733fe-874a-45ca-9f49-52c85c4e4b14"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "343.2072",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "ced2b239-07ab-4a56-9c28-4e841007745e",
      "version": "10",
      "structure": {
        "id": "20408080-8933-4229-a02e-749b99ec42c4",
        "molfile": "\n  Marvin  01132101502D          \n\n 23 25  0  0  0  0            999 V2000\n    4.9018   -2.6755    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6126   -2.2642    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3303   -2.6716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0483   -2.2527    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    6.3303   -3.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6146   -3.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9018   -3.5005    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0470   -3.9184    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0470   -4.7516    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7561   -5.1653    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.7561   -5.9845    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4590   -6.3982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1752   -5.9896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.1752   -5.1625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.4634   -4.7530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312   -6.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3229   -5.9691    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6006   -6.3743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.6006   -7.2023    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.3169   -7.6185    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0312   -7.2058    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.8893   -7.6095    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\n    7.7586   -3.5077    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  3  2  2  0  0  0  0\n  3  4  1  0  0  0  0\n  5  3  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  6  1  0  0  0  0\n  1  7  2  0  0  0  0\n  5  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 10  1  0  0  0  0\n 11 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\n 20 21  2  0  0  0  0\n 21 16  1  0  0  0  0\n 19 22  1  0  0  0  0\n  8 23  2  0  0  0  0\nM  END",
        "smiles": "c1ccc(c(c1)-c2ccc(cc2)Cl)NC(=O)c3cccnc3Cl",
        "formula": "C18H12Cl2N2O",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "343.2072",
        "optical_activity": "NONE",
        "references": [
          "82a8a9c6-d32f-4d7e-a7c3-170fd49e1477",
          "1835fa40-5996-49d8-a051-ffba40262f61"
        ],
        "stereo_centers": 0
      },
      "unii": "32MS8ZRD1V"
    }
  ]
}