{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "82fd5246-31fc-4bd4-bb99-19cdb9bf307e",
          "code": "818-04-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=818-04-2",
          "code_system": "CAS",
          "references": [
            "8013b5e1-b1f7-4141-8230-2a5c8ef02940",
            "b2257a15-28f8-4485-8cde-1ba5e25914cd"
          ]
        },
        {
          "uuid": "bf1a9f53-e142-42ee-80de-6268ca7a13b9",
          "code": "212-448-6",
          "type": "PRIMARY",
          "url": "https://echa.europa.eu/substance-information/-/substanceinfo/100.011.316",
          "code_system": "ECHA (EC/EINECS)",
          "references": [
            "8013b5e1-b1f7-4141-8230-2a5c8ef02940"
          ]
        },
        {
          "uuid": "28fb64d8-a99f-45f7-a4e9-beaa17e8df53",
          "code": "69956",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69956",
          "code_system": "PUBCHEM",
          "references": [
            "8013b5e1-b1f7-4141-8230-2a5c8ef02940"
          ]
        },
        {
          "uuid": "81c6eaa2-54e6-1998-769a-3c6cc31bdbad",
          "code": "DTXSID80231370",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID80231370",
          "code_system": "EPA CompTox",
          "references": [
            "9569252c-ed89-6654-e08b-e0a76b62c80a"
          ]
        },
        {
          "uuid": "cdc79253-3772-44c1-bd03-3266b02b9b9d",
          "code": "32GYA74XJK",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "404254b8-4c03-49fb-9605-382c0a1e3760",
          "name": "Butanedioic acid, 1,4-bis(3-methylbutyl) ester",
          "stdName": "BUTANEDIOIC ACID, 1,4-BIS(3-METHYLBUTYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4187e51-27a6-4252-8773-ca24b9264d69",
            "8c55040d-108c-4a92-89a9-ff8b85d6896d"
          ],
          "display_name": false
        },
        {
          "uuid": "f7abc63e-87a2-42f8-93a5-5f3c6a021c9f",
          "name": "Butanedioic acid, bis(3-methylbutyl) ester",
          "stdName": "BUTANEDIOIC ACID, BIS(3-METHYLBUTYL) ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4187e51-27a6-4252-8773-ca24b9264d69",
            "8c55040d-108c-4a92-89a9-ff8b85d6896d"
          ],
          "display_name": false
        },
        {
          "uuid": "f33e895d-8b77-46ed-a751-710df5a312a2",
          "name": "Di(2-methylbutyl) succinate",
          "stdName": "DI(2-METHYLBUTYL) SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4187e51-27a6-4252-8773-ca24b9264d69",
            "6fd4fa8e-1436-455e-8a34-0a04cc912faf"
          ],
          "display_name": false
        },
        {
          "uuid": "4e39a082-83b4-49c3-8558-8d6fb3f2e5ab",
          "name": "Diisoamyl succinate",
          "stdName": "DIISOAMYL SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "d8684edb-0b38-4e0a-b773-a6ed9cff47f1"
          ],
          "display_name": false
        },
        {
          "uuid": "ea5e7aaa-b59e-45cb-8688-d45950a7a97d",
          "name": "Diisopentyl succinate",
          "stdName": "DIISOPENTYL SUCCINATE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4187e51-27a6-4252-8773-ca24b9264d69",
            "8c55040d-108c-4a92-89a9-ff8b85d6896d"
          ],
          "display_name": true
        },
        {
          "uuid": "81523e96-be59-42e8-bb07-2f1b1e85ba1e",
          "name": "Succinic acid, diisopentyl ester",
          "stdName": "SUCCINIC ACID, DIISOPENTYL ESTER",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "c4187e51-27a6-4252-8773-ca24b9264d69",
            "8c55040d-108c-4a92-89a9-ff8b85d6896d"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "d8684edb-0b38-4e0a-b773-a6ed9cff47f1",
          "citation": "CHEMID 2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8c55040d-108c-4a92-89a9-ff8b85d6896d",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "c4187e51-27a6-4252-8773-ca24b9264d69",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "6fd4fa8e-1436-455e-8a34-0a04cc912faf",
          "citation": "CHEMID",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8013b5e1-b1f7-4141-8230-2a5c8ef02940",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391097000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9349dcca-31d0-4776-bdd3-4334c74df945",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "9569252c-ed89-6654-e08b-e0a76b62c80a",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=818-04-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "b2257a15-28f8-4485-8cde-1ba5e25914cd",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "45cdeb1c-72ef-4ff8-a418-14da7e278e58",
          "id": "45cdeb1c-72ef-4ff8-a418-14da7e278e58",
          "molfile": "\n  Marvin  01132103402D          \n\n 18 17  0  0  0  0            999 V2000\n   11.1782   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7638   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1860   -6.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9274   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5053   -4.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6688   -4.7513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2466   -4.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6656   -3.3387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4101   -4.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0006   -4.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.1640   -4.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7420   -4.0612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7499   -5.4877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9133   -5.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4991   -6.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6626   -6.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2452   -5.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2530   -6.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  3  2  1  0  0  0  0\n  2  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  6  7  1  0  0  0  0\n  8  7  2  0  0  0  0\n  7  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 12 11  2  0  0  0  0\n 13 11  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
          "smiles": "CC(C)CCOC(=O)CCC(=O)OCCC(C)C",
          "formula": "C14H26O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b7e59f63-d4bc-4904-9be6-2b2afa9fa944"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "258.3544",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "6cd8e418-8d44-4465-93a1-edce4d0b7acc",
      "version": "5",
      "structure": {
        "id": "e7a5646b-470f-4ed9-a005-d27c8f446cff",
        "molfile": "\n  Marvin  01132111592D          \n\n 18 17  0  0  0  0            999 V2000\n    6.1640   -4.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7420   -4.0612    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0006   -4.7699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4101   -4.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.2466   -4.0474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6656   -3.3387    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    8.6688   -4.7513    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5053   -4.7513    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.9274   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.7638   -5.4554    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1782   -4.7420    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1860   -6.1640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.7499   -5.4877    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.9133   -5.4877    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.4991   -6.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.6626   -6.2011    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2452   -5.4924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.2530   -6.9145    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  2  0  0  0  0\n  3  1  1  0  0  0  0\n  4  3  1  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  2  0  0  0  0\n  7  5  1  0  0  0  0\n  8  7  1  0  0  0  0\n  9  8  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 12 10  1  0  0  0  0\n 13  1  1  0  0  0  0\n 14 13  1  0  0  0  0\n 15 14  1  0  0  0  0\n 16 15  1  0  0  0  0\n 17 16  1  0  0  0  0\n 18 16  1  0  0  0  0\nM  END",
        "smiles": "CC(C)CCOC(=O)CCC(=O)OCCC(C)C",
        "formula": "C14H26O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "258.3544",
        "optical_activity": "NONE",
        "references": [
          "9349dcca-31d0-4776-bdd3-4334c74df945"
        ],
        "stereo_centers": 0
      },
      "unii": "32GYA74XJK"
    }
  ]
}