{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "e7b375ee-549b-4340-866c-dd85f545f3c4", "code": "142363-53-9", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=142363-53-9", "code_system": "CAS", "references": [ "89aa9463-a677-42a8-a310-e24261c9c56a", "aeb0ca9a-6b1d-405a-aad3-55aa38af4f12" ] }, { "uuid": "e6ac79dc-2f46-4775-b1ac-ada8ece7cc09", "code": "115236", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/115236", "code_system": "PUBCHEM", "references": [ "89aa9463-a677-42a8-a310-e24261c9c56a" ] }, { "uuid": "172cf189-db9a-b6c7-15de-008aa1fb7e56", "code": "DTXSID6037485", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID6037485", "code_system": "EPA CompTox", "references": [ "a0e66202-04fd-a7eb-97b3-6403fe8227c4" ] }, { "uuid": "189e3b35-aba3-4c58-b19f-1ab0f75aed80", "code": "31LO95HB3M", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "36c333d4-4bd5-43a2-8116-cecf2ab62770", "name": "2-((2,6-DIETHYLPHENYL)(METHOXYMETHYL)AMINO)-2-OXO-ETHANESULFONIC ACID", "stdName": "2-((2,6-DIETHYLPHENYL)(METHOXYMETHYL)AMINO)-2-OXO-ETHANESULFONIC ACID", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "4d455ce1-40d5-4dd8-9e48-737666f8e8c4", "1c7c46c4-2ad1-4a62-8acb-8271c06ebb3a" ], "display_name": true }, { "uuid": "a24054d6-40be-44e2-bd2c-520185f20e0f", "name": "ALACHLOR ESA", "stdName": "ALACHLOR ESA", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "4d455ce1-40d5-4dd8-9e48-737666f8e8c4", "e3130943-dc8a-442b-b4a1-08d052ed1b76" ], "display_name": false }, { "uuid": "e4c9adbf-cc97-44fe-a67b-b99b080589a5", "name": "ETHANESULFONIC ACID, 2-((2,6-DIETHYLPHENYL)(METHOXYMETHYL)AMINO)-2-OXO-", "stdName": "ETHANESULFONIC ACID, 2-((2,6-DIETHYLPHENYL)(METHOXYMETHYL)AMINO)-2-OXO-", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "4d455ce1-40d5-4dd8-9e48-737666f8e8c4", "1a5e3c91-7d7b-4dab-8a60-1dada2752816" ], "display_name": false } ], "references": [ { "uuid": "1c7c46c4-2ad1-4a62-8acb-8271c06ebb3a", "citation": "EPA", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "4d455ce1-40d5-4dd8-9e48-737666f8e8c4", "citation": "EPA", "doc_type": "EPA", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "e3130943-dc8a-442b-b4a1-08d052ed1b76", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "1a5e3c91-7d7b-4dab-8a60-1dada2752816", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "89aa9463-a677-42a8-a310-e24261c9c56a", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493392220000, "tags": [ "NOMEN" ] }, { "uuid": "f9b8c8c4-346e-4730-aa68-6bef5aa06bd6", "citation": "SRS import [31LO95HB3M]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=31LO95HB3M", "doc_type": "SRS", "public_domain": true, "document_date": 1493392220000, "tags": [ "NOMEN" ] }, { "uuid": "a0e66202-04fd-a7eb-97b3-6403fe8227c4", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=142363-53-9", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "aeb0ca9a-6b1d-405a-aad3-55aa38af4f12", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6d8f5586-554b-4d64-940b-1767401d427e", "id": "6d8f5586-554b-4d64-940b-1767401d427e", "molfile": "\n Marvin 01132105412D \n\n 21 21 0 0 0 0 999 V2000\n 0.0000 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -2.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -3.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1456 -4.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8591 -3.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8591 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5727 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2862 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1406 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1406 -1.6416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -1.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -0.4092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8541 -1.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8541 -0.3992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5677 -1.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2812 -1.2225 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9897 -0.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7024 -0.6387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8650 -1.8013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 3 4 1 0 0 0 0\n 3 10 2 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 7 8 1 0 0 0 0\n 7 10 1 0 0 0 0\n 8 9 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 15 17 1 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 1 0 0 0 0\n 18 20 2 0 0 0 0\n 18 21 2 0 0 0 0\nM END", "smiles": "CCc1cccc(CC)c1N(COC)C(=O)CS(=O)(=O)O", "formula": "C14H21NO5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "d6c7baae-aacc-42ec-8e54-aaa15367e2c8" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.3869", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "61310631-1ce4-4c9a-a933-a323f956c750", "version": "3", "structure": { "id": "bc1c46c0-1903-4290-93c0-f24ef0bfc9af", "molfile": "\n Marvin 01132109442D \n\n 21 21 0 0 0 0 999 V2000\n 1.4271 -2.8791 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -3.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1456 -4.1215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8591 -3.7073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8591 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1406 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.0000 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5727 -2.4649 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2862 -2.8741 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.1406 -1.6416 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8541 -1.2275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.5677 -1.6367 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.2812 -1.2225 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0\n 2.8541 -0.3992 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.9897 -0.8083 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.7024 -0.6387 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.8650 -1.8013 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -1.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.4271 -0.4092 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.7135 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 6 1 0 0 0 0\n 1 2 2 0 0 0 0\n 1 7 1 0 0 0 0\n 2 3 1 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 5 9 1 0 0 0 0\n 6 11 1 0 0 0 0\n 7 8 1 0 0 0 0\n 9 10 1 0 0 0 0\n 11 12 1 0 0 0 0\n 11 19 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 15 2 0 0 0 0\n 13 14 1 0 0 0 0\n 14 16 1 0 0 0 0\n 14 17 2 0 0 0 0\n 14 18 2 0 0 0 0\n 19 20 1 0 0 0 0\n 20 21 1 0 0 0 0\nM END", "smiles": "CCc1cccc(CC)c1N(COC)C(=O)CS(=O)(=O)O", "formula": "C14H21NO5S", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "315.3869", "optical_activity": "NONE", "references": [ "f9b8c8c4-346e-4730-aa68-6bef5aa06bd6", "1a5e3c91-7d7b-4dab-8a60-1dada2752816" ], "stereo_centers": 0 }, "unii": "31LO95HB3M" } ] }