{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "c66b604c-a120-4064-a82d-7e66227482c4",
          "code": "76902-90-4",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=76902-90-4",
          "code_system": "CAS",
          "references": [
            "e11a33cb-e496-41c1-bb78-97f7eae9a6f8",
            "89d35f1b-5515-4065-a3d9-928ac3b22d70"
          ]
        },
        {
          "uuid": "3e9394f3-d889-4477-86e0-d0ed0c441e26",
          "code": "128889",
          "comments": "EPA PESTICIDE|CONVENTIONAL CHEMICAL",
          "type": "PRIMARY",
          "url": "http://iaspub.epa.gov/apex/pesticides/f?p=CHEMICALSEARCH:3:0::NO:21,3,31,7,12,25:P3_XCHEMICAL_ID:673",
          "code_system": "EPA PESTICIDE CODE",
          "references": [
            "e11a33cb-e496-41c1-bb78-97f7eae9a6f8"
          ]
        },
        {
          "uuid": "44003eb9-e542-426d-ab7d-57eb35232a9e",
          "code": "150860",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/150860",
          "code_system": "PUBCHEM",
          "references": [
            "e11a33cb-e496-41c1-bb78-97f7eae9a6f8"
          ]
        },
        {
          "uuid": "f34e6ff1-b263-e265-74bb-a5b98e0473e1",
          "code": "DTXSID7035806",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID7035806",
          "code_system": "EPA CompTox",
          "references": [
            "bcf1e56a-7977-1760-27bc-f59415982370"
          ]
        },
        {
          "uuid": "5030c49e-1cf8-47ae-af9a-e48a1a6db74b",
          "code": "31ION412DH",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5eca23b4-84b4-492e-b0da-f06f97b7d79b",
          "name": "3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.13,7)DECANE, 1-METHYL-, CHLORIDE (1:1)",
          "stdName": "3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.13,7)DECANE, 1-METHYL-, CHLORIDE (1:1)",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "aa7b843e-2927-4cf0-b4c0-a112b51585e2",
            "bbac6d97-3332-4cf2-a1c4-16ae924ea6d4"
          ],
          "display_name": false
        },
        {
          "uuid": "be93b774-c9ac-4471-8371-7203743b90dd",
          "name": "BUSAN 1500",
          "stdName": "BUSAN 1500",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "b95cd17c-5902-471a-aa89-096274c2a836",
            "bbac6d97-3332-4cf2-a1c4-16ae924ea6d4"
          ],
          "display_name": false
        },
        {
          "uuid": "9c011da6-4107-49f3-8af0-0229277d8961",
          "name": "METHENAMMONIUM CHLORIDE",
          "stdName": "METHENAMMONIUM CHLORIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "deacc314-4933-4c11-b91e-2b1a663e8858",
            "b95cd17c-5902-471a-aa89-096274c2a836",
            "bbac6d97-3332-4cf2-a1c4-16ae924ea6d4"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "48d918a5-2b81-4e7d-9b7a-90df6e2eb932",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "7d16e180-82b6-45ba-a01b-c2dc023faf53",
          "name": "METHYL-3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.1(3,7))DECANE CHLORIDE, 1-",
          "stdName": "METHYL-3,5,7-TRIAZA-1-AZONIATRICYCLO(3.3.1.1(3,7))DECANE CHLORIDE, 1-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "65dce31c-090c-49a3-81f3-c66d197d0ddd"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "65dce31c-090c-49a3-81f3-c66d197d0ddd",
          "citation": "ICSAS BATCH 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "b95cd17c-5902-471a-aa89-096274c2a836",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bbac6d97-3332-4cf2-a1c4-16ae924ea6d4",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "aa7b843e-2927-4cf0-b4c0-a112b51585e2",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "e11a33cb-e496-41c1-bb78-97f7eae9a6f8",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "cc4a220f-125a-409f-b165-6c06627c39f9",
          "citation": "SRS import [31ION412DH]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=31ION412DH",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493390918000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86c18926-45b5-4432-a004-c3e9b0d74df2",
          "citation": "CHEMID 2010",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "deacc314-4933-4c11-b91e-2b1a663e8858",
          "citation": "METHENAMMONIUM CHLORIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "bcf1e56a-7977-1760-27bc-f59415982370",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=76902-90-4",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "89d35f1b-5515-4065-a3d9-928ac3b22d70",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "d3799c55-74de-44e2-b507-d17ff7734b2c",
          "id": "d3799c55-74de-44e2-b507-d17ff7734b2c",
          "molfile": "\n  Marvin  01132110562D          \n\n  1  0  0  0  0  0            999 V2000\n   14.3024   -5.1436    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0\nM  END",
          "smiles": "Cl",
          "formula": "ClH",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "f1f12095-d832-4df8-be85-e5b9724f5a42"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "36.4609",
          "optical_activity": "NONE",
          "stereo_centers": 0
        },
        {
          "uuid": "d904c3da-8cf6-4a17-94ae-9d3e2c6f8c49",
          "id": "d904c3da-8cf6-4a17-94ae-9d3e2c6f8c49",
          "molfile": "\n  Marvin  01132111152D          \n\n 11 13  0  0  0  0            999 V2000\n   12.5914   -3.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1857   -3.9937    0.0000 N   0  3  0  0  0  0  0  0  0  3  0  0\n   11.1401   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6240   -4.9147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1508   -5.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6707   -4.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1964   -5.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2036   -5.8045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1568   -5.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7173   -4.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6646   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2 10  1  0  0  0  0\n  2 11  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  4  9  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 11  6  1  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  1  0  0  0  0\n 10  8  1  0  0  0  0\nM  CHG  1   2   1\nM  END",
          "smiles": "C[N+]12CN3CN(CN(C3)C1)C2",
          "formula": "C7H15N4",
          "atropisomerism": "No",
          "charge": 1,
          "count": 1,
          "stereochemistry": "RACEMIC",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "6d13323d-5dab-483f-8dee-e1dd108646d8"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "155.2211",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c8da6a56-b667-4cc5-82b6-ce5132e95b15",
      "version": "4",
      "structure": {
        "id": "29f7efab-b57c-4be8-9733-a4fee51233db",
        "molfile": "\n  Marvin  01132102172D          \n\n 12 13  0  0  0  0            999 V2000\n   14.3024   -5.1436    0.0000 Cl  0  5  0  0  0  0  0  0  0  0  0  0\n   12.5914   -3.2754    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1857   -3.9937    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0\n   11.1401   -4.0034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.6240   -4.9147    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1508   -5.2104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6707   -4.9039    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   12.1964   -5.1997    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.2036   -5.8045    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n   11.1568   -5.8140    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   12.7173   -4.8944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   11.6646   -4.3003    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  3  1  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  6  1  0  0  0  0\n  7  6  1  0  0  0  0\n  7  8  1  0  0  0  0\n  9  8  1  0  0  0  0\n  5 10  1  0  0  0  0\n  9 10  1  0  0  0  0\n  3 11  1  0  0  0  0\n 11  9  1  0  0  0  0\n 12  7  1  0  0  0  0\n  3 12  1  0  0  0  0\nM  CHG  2   1  -1   3   1\nM  END",
        "smiles": "C[N+]12CN3CN(CN(C3)C1)C2.[Cl-]",
        "formula": "C7H15N4.Cl",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "190.674",
        "optical_activity": "NONE",
        "references": [
          "cc4a220f-125a-409f-b165-6c06627c39f9",
          "86c18926-45b5-4432-a004-c3e9b0d74df2"
        ],
        "stereo_centers": 0
      },
      "unii": "31ION412DH"
    }
  ]
}