{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "9482fd27-cdff-43ce-9ebd-868399ed8692", "code": "1186004-10-3", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=1186004-10-3", "code_system": "CAS", "references": [ "1bad59dd-fd67-46e2-98e0-468ae06a5b1e", "2cee5e71-c0c3-472b-8b39-65b0c36b02bc" ] }, { "uuid": "c893f7bd-a7d1-414a-a974-df2735371302", "code": "44204990", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/44204990", "code_system": "PUBCHEM", "references": [ "b1add9a7-c106-de9b-e467-0a1528df93a9" ] }, { "uuid": "8e507ec1-036d-45c0-9195-d3a194551778", "code": "3086SB35E6", "type": "PRIMARY", "code_system": "FDA UNII" }, { "uuid": "06574e33-812f-5c6b-c88f-5c3f8a937cca", "code": "DTXSID501019574", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID501019574", "code_system": "EPA CompTox" }, { "uuid": "5abc6972-2362-f0a4-8719-4b56dcdbdf20", "code": "2134", "type": "PRIMARY", "url": "https://www.fao.org/food/food-safety-quality/scientific-advice/jecfa/jecfa-flav/details/en/c/2134/", "code_system": "JECFA MONOGRAPH", "references": [ "ce758c21-6313-9f98-89f8-dc7dbe1b0ff2" ] } ], "substance_class": "chemical", "names": [ { "uuid": "fb52c958-d611-f65e-ec24-af098f687e6a", "name": "1-(2-HYDROXYPHENYL)-3-(4-PYRIDINYL)-1-PROPANONE", "stdName": "1-(2-HYDROXYPHENYL)-3-(4-PYRIDINYL)-1-PROPANONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2cee5e71-c0c3-472b-8b39-65b0c36b02bc" ], "display_name": true }, { "uuid": "1be0ad00-65b8-4e3d-b715-a61e1f95be16", "name": "1-(2-HYDROXYPHENYL)-3-(PYRIDIN-4-YL)PROPAN-1-ONE", "stdName": "1-(2-HYDROXYPHENYL)-3-(PYRIDIN-4-YL)PROPAN-1-ONE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "37683879-5ef5-4863-b75b-0491622ca67d" ], "display_name": false }, { "uuid": "0cb89080-e436-e1c3-f62b-bce0b08a584d", "name": "1-PROPANONE, 1-(2-HYDROXYPHENYL)-3-(4-PYRIDINYL)-", "stdName": "1-PROPANONE, 1-(2-HYDROXYPHENYL)-3-(4-PYRIDINYL)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "2cee5e71-c0c3-472b-8b39-65b0c36b02bc" ], "display_name": false }, { "uuid": "be1965d8-9851-c87b-4fb0-a652e72aee03", "name": "FEMA NO. 4721", "stdName": "FEMA NO. 4721", "type": "cd", "languages": [ "en" ], "preferred": false, "references": [ "246a8fc0-c76a-ba59-96fb-49a622b2e297" ], "display_name": false } ], "references": [ { "uuid": "37683879-5ef5-4863-b75b-0491622ca67d", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "1bad59dd-fd67-46e2-98e0-468ae06a5b1e", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493394363000, "tags": [ "NOMEN" ] }, { "uuid": "246a8fc0-c76a-ba59-96fb-49a622b2e297", "citation": "FHFI", "doc_type": "HANDBOOK OF FLAVOR INGREDIENTS", "public_domain": true, "tags": [ "PUBLIC_DOMAIN_RELEASE", "NOMEN" ] }, { "uuid": "2cee5e71-c0c3-472b-8b39-65b0c36b02bc", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "b1add9a7-c106-de9b-e467-0a1528df93a9", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "ce758c21-6313-9f98-89f8-dc7dbe1b0ff2", "citation": "JECFA", "doc_type": "JECFA", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "6b4fc505-820b-475c-858d-211fe379517b", "id": "6b4fc505-820b-475c-858d-211fe379517b", "molfile": "\n Marvin 01132105352D \n\n 17 18 0 0 0 0 999 V2000\n 4.6172 -4.3808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6185 -5.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3330 -5.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3378 -6.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6209 -6.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8991 -6.4517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9016 -5.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -5.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -5.6225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -4.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -3.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -3.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -1.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -1.4892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1883 -1.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1883 -2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 1 0 0 0 0\n 7 2 2 0 0 0 0\n 3 4 2 0 0 0 0\n 4 5 1 0 0 0 0\n 5 6 2 0 0 0 0\n 7 6 1 0 0 0 0\n 7 8 1 0 0 0 0\n 8 9 2 0 0 0 0\n 8 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 12 11 1 0 0 0 0\n 13 12 1 0 0 0 0\n 12 17 2 0 0 0 0\n 14 13 2 0 0 0 0\n 15 14 1 0 0 0 0\n 15 16 2 0 0 0 0\n 17 16 1 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)CCc2ccncc2)O", "formula": "C14H13NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "8f7ae521-7f37-40ef-b331-927f1b55c579" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "227.259", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "a1362bef-1dc8-405e-945e-97bd2ee8eaa1", "version": "9", "structure": { "id": "e5b5461b-a84c-4e4d-acba-0c0b911d14e5", "molfile": "\n Marvin 01132111532D \n\n 17 18 0 0 0 0 999 V2000\n 4.6172 -4.3808 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9016 -5.6225 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6185 -5.2057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3330 -5.6182 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3378 -6.4432 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6209 -6.8599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.8991 -6.4517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -1.4892 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -1.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7571 -2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -3.1477 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1883 -2.7373 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1883 -1.9080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -5.2100 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.1872 -4.3851 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -3.9726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.4727 -5.6225 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 6 7 2 0 0 0 0\n 2 7 1 0 0 0 0\n 1 3 1 0 0 0 0\n 8 9 2 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 2 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 2 0 0 0 0\n 8 13 1 0 0 0 0\n 14 15 1 0 0 0 0\n 15 16 1 0 0 0 0\n 14 17 2 0 0 0 0\n 11 16 1 0 0 0 0\n 2 14 1 0 0 0 0\nM END", "smiles": "c1ccc(c(c1)C(=O)CCc2ccncc2)O", "formula": "C14H13NO2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "227.259", "optical_activity": "NONE", "references": [ "37683879-5ef5-4863-b75b-0491622ca67d" ], "stereo_centers": 0 }, "unii": "3086SB35E6" } ] }