{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "b6fa24ab-7796-419e-805e-5cd8a6060229",
          "code": "642-05-7",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=642-05-7",
          "code_system": "CAS",
          "references": [
            "d178795a-c264-4842-9b0d-c15ead25fd3e",
            "1444bf4e-4d86-4bdb-9f2c-9ef5974088ce"
          ]
        },
        {
          "uuid": "c13546cb-883f-4053-8ecc-68d9c9ba072b",
          "code": "69502",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/69502",
          "code_system": "PUBCHEM",
          "references": [
            "d178795a-c264-4842-9b0d-c15ead25fd3e"
          ]
        },
        {
          "uuid": "24453269-de67-3b95-73e3-d6757ea585eb",
          "code": "DTXSID20214400",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID20214400",
          "code_system": "EPA CompTox",
          "references": [
            "357e9b78-db0a-cef5-da4f-421715098207"
          ]
        },
        {
          "uuid": "e53751f3-fb2f-4899-98d4-84d126e6c584",
          "code": "3043NX3603",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        },
        {
          "uuid": "c8288714-883e-4aa3-5292-3fef1e23c4ec",
          "code": "301051",
          "type": "PRIMARY",
          "url": "https://dtp.cancer.gov/dtpstandard/servlet/dwindex?searchtype=NSC&outputformat=html&searchlist=301051",
          "code_system": "NSC",
          "references": [
            "ae87a45a-31df-d5cd-ed69-8af16806e1ea"
          ]
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "5b30d68b-3d93-4a4b-9cbf-18174ff69aa6",
          "name": "5-BENZOFURANACRYLIC ACID, 6,7-DIHYDROXY-4-(3-METHYL-2-BUTENYL)-, .DELTA.-LACTONE",
          "stdName": "5-BENZOFURANACRYLIC ACID, 6,7-DIHYDROXY-4-(3-METHYL-2-BUTENYL)-, .DELTA.-LACTONE",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "454fa01a-1c37-4cac-af30-d94c62faebfd",
            "f9eff1a6-af45-4417-8c63-b1135b9295f0"
          ],
          "display_name": false
        },
        {
          "uuid": "506fb4eb-371d-4560-a3a5-a2da4b3fd3be",
          "name": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 9-HYDROXY-4-(3-METHYL-2-BUTEN-1-YL)-",
          "stdName": "7H-FURO(3,2-G)(1)BENZOPYRAN-7-ONE, 9-HYDROXY-4-(3-METHYL-2-BUTEN-1-YL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "454fa01a-1c37-4cac-af30-d94c62faebfd",
            "f9eff1a6-af45-4417-8c63-b1135b9295f0"
          ],
          "display_name": false
        },
        {
          "uuid": "206a1888-a8a4-43f2-b81c-d277abd9b753",
          "name": "ALLOIMPERATORIN",
          "stdName": "ALLOIMPERATORIN",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "9812438d-cbb5-468d-b66e-a7ed1742126d",
            "f9eff1a6-af45-4417-8c63-b1135b9295f0",
            "71b26f1d-4215-4884-80a4-e10e82d37a6f",
            "e13e65a4-ed15-4183-bdc4-5401c88fdb7a"
          ],
          "display_name": true,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "f25079b8-a1e7-416e-a5e4-d381d073460f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "4e3989a9-8a00-40a8-a8dd-4ed939ca72e8",
          "name": "NSC-301051",
          "stdName": "NSC-301051",
          "type": "cd",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "454fa01a-1c37-4cac-af30-d94c62faebfd",
            "f9eff1a6-af45-4417-8c63-b1135b9295f0"
          ],
          "display_name": false
        },
        {
          "uuid": "110063b4-23ab-4daa-acf1-269d18c075a2",
          "name": "PRANGENIDIN",
          "stdName": "PRANGENIDIN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "454fa01a-1c37-4cac-af30-d94c62faebfd",
            "f9eff1a6-af45-4417-8c63-b1135b9295f0"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "9812438d-cbb5-468d-b66e-a7ed1742126d",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "e13e65a4-ed15-4183-bdc4-5401c88fdb7a",
          "citation": "CFSAN THESAURUS 2011",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "454fa01a-1c37-4cac-af30-d94c62faebfd",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f9eff1a6-af45-4417-8c63-b1135b9295f0",
          "citation": "STN (SCIFINDER)",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "d178795a-c264-4842-9b0d-c15ead25fd3e",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "1f480421-2b0b-43d1-9129-0137f5f44fd1",
          "citation": "SRS import [3043NX3603]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3043NX3603",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391001000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "8506e4d5-2ff0-488b-af3a-9ee035e619dc",
          "citation": "CHEMID  2011",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "71b26f1d-4215-4884-80a4-e10e82d37a6f",
          "citation": "ALLOIMPERATORIN [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "357e9b78-db0a-cef5-da4f-421715098207",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=642-05-7",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "ae87a45a-31df-d5cd-ed69-8af16806e1ea",
          "citation": "NCI",
          "doc_type": "NCI DRUG DICTIONARY",
          "public_domain": true
        },
        {
          "uuid": "1444bf4e-4d86-4bdb-9f2c-9ef5974088ce",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "4bb8df68-12ea-4fe3-8219-a90a20800d3e",
          "id": "4bb8df68-12ea-4fe3-8219-a90a20800d3e",
          "molfile": "\n  Marvin  01132103572D          \n\n 20 22  0  0  0  0            999 V2000\n    9.6105   -5.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8911   -5.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8911   -6.7663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1815   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4619   -5.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7467   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7467   -4.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3566   -4.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0275   -3.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.2002   -3.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -4.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -4.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6011   -4.2893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5975   -5.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5975   -6.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8824   -7.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -7.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -6.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -5.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  4  2  2  0  0  0  0\n  5  4  1  0  0  0  0\n  6  5  1  0  0  0  0\n  6  7  1  0  0  0  0\n 20  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  7 11  2  0  0  0  0\n  9  8  2  0  0  0  0\n 10  9  1  0  0  0  0\n 11 10  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  1  0  0  0  0\n 12 14  2  0  0  0  0\n 14 15  1  0  0  0  0\n 20 14  1  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  2  0  0  0  0\n 16 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 19 20  1  0  0  0  0\nM  END",
          "smiles": "CC(=CCc1c2ccc(=O)oc2c(c3c1cco3)O)C",
          "formula": "C16H14O4",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "b2571b29-6fe1-4895-a48b-abc3dc04fd0f"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "270.2806",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "c7a18a2c-4342-4ee4-8cf3-bb02b674f7e1",
      "version": "5",
      "structure": {
        "id": "621f6f22-679e-4e96-a318-158a5e43fa8e",
        "molfile": "\n  Marvin  01132105052D          \n\n 20 22  0  0  0  0            999 V2000\n    6.2002   -3.4826    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    7.0275   -3.3946    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3566   -4.1485    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7467   -4.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -4.2924    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -4.7017    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.6011   -4.2893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5975   -5.9438    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    4.5975   -6.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    3.8824   -7.1822    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    5.3177   -7.1812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -6.7672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0313   -5.9438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.7467   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.4619   -5.9448    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1815   -5.5298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8911   -5.9429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.6105   -5.5279    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8911   -6.7663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  1  0  0  0  0\n  5  1  1  0  0  0  0\n  5  6  2  0  0  0  0\n  6  7  1  0  0  0  0\n  6  8  1  0  0  0  0\n  8  9  1  0  0  0  0\n  9 10  1  0  0  0  0\n 10 11  2  0  0  0  0\n 10 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14  8  2  0  0  0  0\n 14 15  1  0  0  0  0\n 15  4  2  0  0  0  0\n 15 16  1  0  0  0  0\n 16 17  1  0  0  0  0\n 17 18  2  0  0  0  0\n 18 19  1  0  0  0  0\n 18 20  1  0  0  0  0\nM  END",
        "smiles": "CC(=CCc1c2ccc(=O)oc2c(c3c1cco3)O)C",
        "formula": "C16H14O4",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "270.2806",
        "optical_activity": "NONE",
        "references": [
          "1f480421-2b0b-43d1-9129-0137f5f44fd1",
          "8506e4d5-2ff0-488b-af3a-9ee035e619dc"
        ],
        "stereo_centers": 0
      },
      "unii": "3043NX3603"
    }
  ]
}