{ "meta": { "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.", "terms": "https://open.fda.gov/terms/", "license": "https://open.fda.gov/license/", "last_updated": "2025-09-19", "results": { "skip": 0, "limit": 1, "total": 1 } }, "results": [ { "codes": [ { "uuid": "4244d17b-ad80-48d9-b370-d20e3a890b2d", "code": "147315-50-2", "type": "PRIMARY", "url": "https://commonchemistry.cas.org/detail?cas_rn=147315-50-2", "code_system": "CAS", "references": [ "7e9bd9be-c0ce-4853-ba34-98ae39ece735", "388123f5-e416-4436-ab6b-9dee3d60bb1b" ] }, { "uuid": "b055d9b1-5866-0ebe-eea5-6b73ed164c5e", "code": "DTXSID4051299", "type": "PRIMARY", "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID4051299", "code_system": "EPA CompTox", "references": [ "b0e16100-98a1-1dec-8f9c-d7cb4035663c" ] }, { "uuid": "9f3c1395-70d4-7909-70ca-b59e58e4f4bc", "code": "4992761", "type": "PRIMARY", "url": "https://pubchem.ncbi.nlm.nih.gov/compound/4992761", "code_system": "PUBCHEM", "references": [ "79281a3e-48e0-4303-7809-75918a3ee717" ] }, { "uuid": "f0baadc7-2364-4fac-8e6b-1f4348a9d3de", "code": "302PHN0JBS", "type": "PRIMARY", "code_system": "FDA UNII" } ], "substance_class": "chemical", "names": [ { "uuid": "cb9557f3-a3fc-483f-b039-3927521abf38", "name": "2,4-DIPHENYL-6-(2-HYDROXY-4-HEXYLOXYPHENYL)-S-TRIAZINE", "stdName": "2,4-DIPHENYL-6-(2-HYDROXY-4-HEXYLOXYPHENYL)-S-TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c" ], "display_name": false }, { "uuid": "00481867-8b5c-425d-a9ee-8436474792da", "name": "2-(2-HYDROXY-4-HEXYLOXYPHENYL)-4,6-DIPHENYL-1,3,5-TRIAZINE", "stdName": "2-(2-HYDROXY-4-HEXYLOXYPHENYL)-4,6-DIPHENYL-1,3,5-TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c" ], "display_name": true }, { "uuid": "cf0fc308-7e42-41a6-9c4e-963085de3291", "name": "2-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-5- HEXYLOXY)PHENOL", "stdName": "2-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-5- HEXYLOXY)PHENOL", "type": "cn", "languages": [ "en" ], "preferred": false, "references": [ "b2c50852-7e3f-431d-a32b-9089711ccb8f" ], "display_name": false }, { "uuid": "9cb04d56-ce4c-4a2c-b676-a283167f7846", "name": "2-(4,6-DIPHENYL-S-TRIAZIN-2-YL)-5-HEXYLOXYPHENOL", "stdName": "2-(4,6-DIPHENYL-S-TRIAZIN-2-YL)-5-HEXYLOXYPHENOL", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "826da8ed-7181-44f3-891b-3b68a142a353" ], "display_name": false }, { "uuid": "b7cf4c1a-60f1-4902-b2ca-b8865671d776", "name": "4,6-DIPHENYL-2-(4-HEXYLOXY-2-HYDROXYPHENYL)-S-TRIAZINE", "stdName": "4,6-DIPHENYL-2-(4-HEXYLOXY-2-HYDROXYPHENYL)-S-TRIAZINE", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c" ], "display_name": false }, { "uuid": "86226a11-7818-4d4e-8792-1dd8c4f72681", "name": "PHENOL, 2-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-5-(HEXYLOXY)-", "stdName": "PHENOL, 2-(4,6-DIPHENYL-1,3,5-TRIAZIN-2-YL)-5-(HEXYLOXY)-", "type": "sys", "languages": [ "en" ], "preferred": false, "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c" ], "display_name": false }, { "uuid": "98a0a924-1ac2-412e-a6c4-7dc3f5a0b212", "name": "TINUVIN 1577", "stdName": "TINUVIN 1577", "type": "bn", "languages": [ "en" ], "preferred": false, "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c" ], "display_name": false } ], "references": [ { "uuid": "826da8ed-7181-44f3-891b-3b68a142a353", "citation": "CFSAN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE", "AUTO_SELECTED" ] }, { "uuid": "b2c50852-7e3f-431d-a32b-9089711ccb8f", "citation": "CEDI", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "faaf42d9-b9a0-439c-9e4b-60f76978ba9c", "citation": "STN", "doc_type": "SRS", "public_domain": true, "tags": [ "NOMEN" ] }, { "uuid": "7e9bd9be-c0ce-4853-ba34-98ae39ece735", "citation": "SRS CODE IMPORT", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "86b3179e-9d64-4df3-a75e-84d4a19a04f8", "citation": "SRS import [302PHN0JBS]", "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=302PHN0JBS", "doc_type": "SRS", "public_domain": true, "document_date": 1493391756000, "tags": [ "NOMEN" ] }, { "uuid": "b0e16100-98a1-1dec-8f9c-d7cb4035663c", "citation": "WEBSITE", "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=147315-50-2", "doc_type": "WEBSITE", "public_domain": true, "tags": [ "NOMEN", "PUBLIC_DOMAIN_RELEASE" ] }, { "uuid": "79281a3e-48e0-4303-7809-75918a3ee717", "citation": "PUBCHEM", "doc_type": "PUBCHEM", "public_domain": true }, { "uuid": "388123f5-e416-4436-ab6b-9dee3d60bb1b", "citation": "STN", "doc_type": "STN (SCIFINDER)", "public_domain": true } ], "definition_type": "PRIMARY", "moieties": [ { "uuid": "0fd8b234-8f32-42fe-a9da-3a56ac63e6c2", "id": "0fd8b234-8f32-42fe-a9da-3a56ac63e6c2", "molfile": "\n Marvin 01132101032D \n\n 32 35 0 0 0 0 999 V2000\n -5.3589 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6444 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9299 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2153 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5008 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7863 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0718 -2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0718 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0718 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 -1.4439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9299 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6444 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3589 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3589 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6444 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9299 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2 1 1 0 0 0 0\n 3 2 1 0 0 0 0\n 4 3 1 0 0 0 0\n 5 4 1 0 0 0 0\n 6 5 1 0 0 0 0\n 7 6 1 0 0 0 0\n 8 7 1 0 0 0 0\n 9 8 1 0 0 0 0\n 8 14 2 0 0 0 0\n 10 9 2 0 0 0 0\n 11 10 1 0 0 0 0\n 12 11 2 0 0 0 0\n 11 15 1 0 0 0 0\n 12 13 1 0 0 0 0\n 12 14 1 0 0 0 0\n 16 15 1 0 0 0 0\n 15 20 2 0 0 0 0\n 16 17 2 0 0 0 0\n 18 17 1 0 0 0 0\n 17 27 1 0 0 0 0\n 19 18 2 0 0 0 0\n 20 19 1 0 0 0 0\n 19 21 1 0 0 0 0\n 21 22 1 0 0 0 0\n 21 26 2 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 27 28 1 0 0 0 0\n 27 32 2 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\nM END", "smiles": "CCCCCCOc1ccc(c(c1)O)-c2nc(-c3ccccc3)nc(-c4ccccc4)n2", "formula": "C27H27N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "count_amount": { "type": "MOL RATIO", "average": 1, "units": "MOL RATIO", "uuid": "23e0af75-0863-437b-a21b-8f54632b7131" }, "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.5232", "optical_activity": "NONE", "stereo_centers": 0 } ], "definition_level": "COMPLETE", "uuid": "2ab3c970-36e8-4f99-a9e2-5e6d7a15af77", "version": "5", "structure": { "id": "a08a2e52-9ed7-4e8d-8bd4-bcee9fb85100", "molfile": "\n Marvin 01132108202D \n\n 32 35 0 0 0 0 999 V2000\n 1.0718 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.0718 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -0.3572 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 0.3572 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.0718 -2.6814 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0\n -1.7863 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -2.5008 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.2153 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -3.9299 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -4.6444 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n -5.3589 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 -1.4439 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 -0.2062 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 0.2062 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1.7863 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 2.5008 2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.2153 1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9299 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6444 -1.0314 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3589 -1.4439 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 5.3589 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 4.6444 -2.6814 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 3.9299 -2.2689 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0\n 1 2 1 0 0 0 0\n 2 3 2 0 0 0 0\n 3 4 1 0 0 0 0\n 4 5 2 0 0 0 0\n 5 6 1 0 0 0 0\n 1 6 2 0 0 0 0\n 1 7 1 0 0 0 0\n 9 10 1 0 0 0 0\n 10 11 1 0 0 0 0\n 11 12 1 0 0 0 0\n 12 13 1 0 0 0 0\n 13 14 1 0 0 0 0\n 8 9 1 0 0 0 0\n 5 8 1 0 0 0 0\n 15 16 1 0 0 0 0\n 16 17 2 0 0 0 0\n 17 18 1 0 0 0 0\n 18 19 2 0 0 0 0\n 19 20 1 0 0 0 0\n 15 20 2 0 0 0 0\n 21 22 1 0 0 0 0\n 22 23 2 0 0 0 0\n 23 24 1 0 0 0 0\n 24 25 2 0 0 0 0\n 25 26 1 0 0 0 0\n 21 26 2 0 0 0 0\n 20 21 1 0 0 0 0\n 27 28 1 0 0 0 0\n 28 29 2 0 0 0 0\n 29 30 1 0 0 0 0\n 30 31 2 0 0 0 0\n 31 32 1 0 0 0 0\n 27 32 2 0 0 0 0\n 18 27 1 0 0 0 0\n 2 16 1 0 0 0 0\nM END", "smiles": "CCCCCCOc1ccc(c(c1)O)-c2nc(-c3ccccc3)nc(-c4ccccc4)n2", "formula": "C27H27N3O2", "atropisomerism": "No", "charge": 0, "count": 1, "stereochemistry": "ACHIRAL", "defined_stereo": 0, "ez_centers": 0, "molecular_weight": "425.5232", "optical_activity": "NONE", "references": [ "faaf42d9-b9a0-439c-9e4b-60f76978ba9c", "86b3179e-9d64-4df3-a75e-84d4a19a04f8" ], "stereo_centers": 0 }, "unii": "302PHN0JBS" } ] }