{
  "meta": {
    "disclaimer": "Do not rely on openFDA to make decisions regarding medical care. While we make every effort to ensure that data is accurate, you should assume all results are unvalidated. We may limit or otherwise restrict your access to the API in line with our Terms of Service.",
    "terms": "https://open.fda.gov/terms/",
    "license": "https://open.fda.gov/license/",
    "last_updated": "2025-09-19",
    "results": {
      "skip": 0,
      "limit": 1,
      "total": 1
    }
  },
  "results": [
    {
      "codes": [
        {
          "uuid": "53228b80-4c33-4aac-9b60-f486d1b53605",
          "code": "945526-43-2",
          "type": "PRIMARY",
          "url": "https://commonchemistry.cas.org/detail?cas_rn=945526-43-2",
          "code_system": "CAS",
          "references": [
            "f5d3b09a-b32b-4d44-b5a4-2aa2e3048337",
            "d221c2d1-13b7-4b3f-a92c-f12163987e8f"
          ]
        },
        {
          "uuid": "d8e70447-4302-4fff-9fad-88b38b269e06",
          "code": "3792751",
          "type": "PRIMARY",
          "url": "https://pubchem.ncbi.nlm.nih.gov/compound/3792751",
          "code_system": "PUBCHEM",
          "references": [
            "f5d3b09a-b32b-4d44-b5a4-2aa2e3048337"
          ]
        },
        {
          "uuid": "45073762-14ce-a4a0-6249-258840fe1c89",
          "code": "DTXSID70241524",
          "type": "PRIMARY",
          "url": "https://comptox.epa.gov/dashboard/chemical/details/DTXSID70241524",
          "code_system": "EPA CompTox",
          "references": [
            "856f21aa-454a-de78-76ae-514d799cbe11"
          ]
        },
        {
          "uuid": "c18c3faa-88f1-4304-acc0-f373887536a5",
          "code": "3028H7W568",
          "type": "PRIMARY",
          "code_system": "FDA UNII"
        }
      ],
      "relationships": [
        {
          "uuid": "38646826-b694-461a-a698-394519a4f3ef",
          "type": "ACTIVE MOIETY",
          "related_substance": {
            "uuid": "98683074-580f-4680-8ef2-341fa02b5f86",
            "refuuid": "113fe86c-817c-4b26-a196-094b8c26d317",
            "name": "ISCK-03",
            "unii": "3028H7W568",
            "linking_id": "3028H7W568",
            "ref_pname": "ISCK-03",
            "substance_class": "reference"
          }
        }
      ],
      "substance_class": "chemical",
      "names": [
        {
          "uuid": "144cd825-641d-4405-9814-30d0b5421be6",
          "name": "BENZENESULFONAMIDE, 4-(1,1-DIMETHYLETHYL)-N-(4-(1H-IMIDAZOL-1-YL)PHENYL)-",
          "stdName": "BENZENESULFONAMIDE, 4-(1,1-DIMETHYLETHYL)-N-(4-(1H-IMIDAZOL-1-YL)PHENYL)-",
          "type": "sys",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97fcc883-ac08-48ed-bd95-403850f4b1ee",
            "0d777bb9-854d-49a6-9ed8-691731feba20"
          ],
          "display_name": false
        },
        {
          "uuid": "9999e39f-670c-4251-a9cd-a42a13a0ede8",
          "name": "ISCK-03",
          "stdName": "ISCK-03",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "97fcc883-ac08-48ed-bd95-403850f4b1ee",
            "0d777bb9-854d-49a6-9ed8-691731feba20"
          ],
          "display_name": true
        },
        {
          "uuid": "b9cc2b2a-7854-4f5c-89a1-d6e45a489bf6",
          "name": "T-BUTYLPHENYL IMIDAZOLYLPHENYL SULFONAMIDE",
          "stdName": "T-BUTYLPHENYL IMIDAZOLYLPHENYL SULFONAMIDE",
          "type": "of",
          "languages": [
            "en"
          ],
          "preferred": true,
          "references": [
            "86b54881-f3b9-4e52-9b81-1a3ba171e4e0",
            "1332df98-10c0-4cb8-a4f9-a0d9a6852c9c",
            "0d777bb9-854d-49a6-9ed8-691731feba20",
            "4f2d21d0-d74c-47fc-9653-ca642037117d"
          ],
          "display_name": false,
          "domains": [
            "cosmetic"
          ],
          "name_orgs": [
            {
              "uuid": "c6c06f22-cc8d-4088-930d-47ae094c9c6f",
              "name_org": "INCI"
            }
          ]
        },
        {
          "uuid": "dcb139fe-94f4-46c7-b95b-4c7999b49700",
          "name": "TERT-BUTYLPHENYL IMIDAZOLYLPHENYL SULFONAMIDE",
          "stdName": "TERT-BUTYLPHENYL IMIDAZOLYLPHENYL SULFONAMIDE",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "0d777bb9-854d-49a6-9ed8-691731feba20",
            "3ae91dec-1dcc-427d-abbd-99b1158e783a"
          ],
          "display_name": false
        },
        {
          "uuid": "dee7f7bd-ec11-4d45-985b-ba5e1c243169",
          "name": "WHITEPLEX-IN",
          "stdName": "WHITEPLEX-IN",
          "type": "cn",
          "languages": [
            "en"
          ],
          "preferred": false,
          "references": [
            "1332df98-10c0-4cb8-a4f9-a0d9a6852c9c",
            "0d777bb9-854d-49a6-9ed8-691731feba20"
          ],
          "display_name": false
        }
      ],
      "references": [
        {
          "uuid": "1332df98-10c0-4cb8-a4f9-a0d9a6852c9c",
          "citation": "PCPC-DB",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE",
            "AUTO_SELECTED"
          ]
        },
        {
          "uuid": "0d777bb9-854d-49a6-9ed8-691731feba20",
          "citation": "PERSONAL CARE PRODUCTS COUNCIL",
          "doc_type": "PERSONAL CARE PRODUCTS COUNCIL",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "97fcc883-ac08-48ed-bd95-403850f4b1ee",
          "citation": "STN",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "3ae91dec-1dcc-427d-abbd-99b1158e783a",
          "citation": "FDA_SRS",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "4f2d21d0-d74c-47fc-9653-ca642037117d",
          "citation": "PCPC",
          "doc_type": "SRS",
          "public_domain": true,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "f5d3b09a-b32b-4d44-b5a4-2aa2e3048337",
          "citation": "SRS CODE IMPORT",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "bb8a5920-8a5b-4de1-9611-2cadee47a0eb",
          "citation": "SRS import [3028H7W568]",
          "url": "http://fdasis.nlm.nih.gov/srs/srsdirect.jsp?regno=3028H7W568",
          "doc_type": "SRS",
          "public_domain": true,
          "document_date": 1493391622000,
          "tags": [
            "NOMEN"
          ]
        },
        {
          "uuid": "86b54881-f3b9-4e52-9b81-1a3ba171e4e0",
          "citation": "T-BUTYLPHENYL IMIDAZOLYLPHENYL SULFONAMIDE [INCI]",
          "doc_type": "SRS_LOCATOR",
          "public_domain": true
        },
        {
          "uuid": "856f21aa-454a-de78-76ae-514d799cbe11",
          "citation": "WEBSITE",
          "url": "https://comptox.epa.gov/dashboard/dsstoxdb/results?utf8=%E2%9C%93&search=945526-43-2",
          "doc_type": "WEBSITE",
          "public_domain": true,
          "tags": [
            "NOMEN",
            "PUBLIC_DOMAIN_RELEASE"
          ]
        },
        {
          "uuid": "d221c2d1-13b7-4b3f-a92c-f12163987e8f",
          "citation": "STN",
          "doc_type": "STN (SCIFINDER)",
          "public_domain": true
        }
      ],
      "definition_type": "PRIMARY",
      "moieties": [
        {
          "uuid": "afc257f7-6055-46fc-ae15-024cf6df90ae",
          "id": "afc257f7-6055-46fc-ae15-024cf6df90ae",
          "molfile": "\n  Marvin  01132109072D          \n\n 25 27  0  0  0  0            999 V2000\n    9.5292   -1.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -1.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -1.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -2.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -4.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -5.3493    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0687   -5.3493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -5.3493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -6.1743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -6.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8147   -6.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1003   -6.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1003   -7.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8148   -7.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -7.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3858   -7.8243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -7.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0801   -8.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4926   -8.8163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2996   -8.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  2  1  1  0  0  0  0\n  2  3  1  0  0  0  0\n  2  4  1  0  0  0  0\n  2  5  1  0  0  0  0\n  6  5  1  0  0  0  0\n  5 10  2  0  0  0  0\n  7  6  2  0  0  0  0\n  8  7  1  0  0  0  0\n  8  9  2  0  0  0  0\n  8 11  1  0  0  0  0\n 10  9  1  0  0  0  0\n 11 12  2  0  0  0  0\n 11 13  2  0  0  0  0\n 11 14  1  0  0  0  0\n 14 15  1  0  0  0  0\n 15 16  1  0  0  0  0\n 15 20  2  0  0  0  0\n 16 17  2  0  0  0  0\n 17 18  1  0  0  0  0\n 18 19  2  0  0  0  0\n 21 18  1  0  0  0  0\n 19 20  1  0  0  0  0\n 22 21  1  0  0  0  0\n 25 21  1  0  0  0  0\n 23 22  2  0  0  0  0\n 24 23  1  0  0  0  0\n 25 24  2  0  0  0  0\nM  END",
          "smiles": "CC(C)(C)c1ccc(cc1)S(=O)(=O)Nc2ccc(cc2)-n3ccnc3",
          "formula": "C19H21N3O2S",
          "atropisomerism": "No",
          "charge": 0,
          "count": 1,
          "stereochemistry": "ACHIRAL",
          "count_amount": {
            "type": "MOL RATIO",
            "average": 1,
            "units": "MOL RATIO",
            "uuid": "3f9c7967-2adb-4650-b8de-31ef6f7aba71"
          },
          "defined_stereo": 0,
          "ez_centers": 0,
          "molecular_weight": "355.4557",
          "optical_activity": "NONE",
          "stereo_centers": 0
        }
      ],
      "definition_level": "COMPLETE",
      "uuid": "113fe86c-817c-4b26-a196-094b8c26d317",
      "version": "5",
      "structure": {
        "id": "3834e223-d23f-4ec2-8ece-056c6f0345c0",
        "molfile": "\n  Marvin  01132102592D          \n\n 25 27  0  0  0  0            999 V2000\n   10.2437   -4.5243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -2.8743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -3.2867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -4.1117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -5.3493    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0\n   11.0687   -5.3493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n    9.4187   -5.3493    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -6.1743    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -6.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8147   -6.1743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1003   -6.5867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.1003   -7.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    8.8148   -7.8243    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -7.4117    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    9.5292   -1.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.9582   -1.6367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -1.2242    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n   10.2437   -2.0493    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.4926   -8.8163    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    6.0801   -8.1018    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    6.6321   -7.4887    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n    7.3858   -7.8243    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0\n    7.2996   -8.6447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0\n  1  2  1  0  0  0  0\n  2  3  2  0  0  0  0\n  3  4  1  0  0  0  0\n  4  5  2  0  0  0  0\n  5  6  1  0  0  0  0\n  1  6  2  0  0  0  0\n  1  7  1  0  0  0  0\n  7  8  2  0  0  0  0\n  7  9  2  0  0  0  0\n  7 10  1  0  0  0  0\n 10 11  1  0  0  0  0\n 11 12  1  0  0  0  0\n 12 13  2  0  0  0  0\n 13 14  1  0  0  0  0\n 14 15  2  0  0  0  0\n 15 16  1  0  0  0  0\n 11 16  2  0  0  0  0\n 20 17  1  0  0  0  0\n 20 18  1  0  0  0  0\n 20 19  1  0  0  0  0\n 20  4  1  0  0  0  0\n 25 21  2  0  0  0  0\n 21 22  1  0  0  0  0\n 22 23  2  0  0  0  0\n 23 24  1  0  0  0  0\n 25 24  1  0  0  0  0\n 24 14  1  0  0  0  0\nM  END",
        "smiles": "CC(C)(C)c1ccc(cc1)S(=O)(=O)Nc2ccc(cc2)-n3ccnc3",
        "formula": "C19H21N3O2S",
        "atropisomerism": "No",
        "charge": 0,
        "count": 1,
        "stereochemistry": "ACHIRAL",
        "defined_stereo": 0,
        "ez_centers": 0,
        "molecular_weight": "355.4557",
        "optical_activity": "NONE",
        "references": [
          "97fcc883-ac08-48ed-bd95-403850f4b1ee",
          "bb8a5920-8a5b-4de1-9611-2cadee47a0eb"
        ],
        "stereo_centers": 0
      },
      "unii": "3028H7W568"
    }
  ]
}